Natural Product: NPC207554| Natural Product ID | NPC207554 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| Tryptanthrin |
| IUPAC Name | indolo[2,1-b]quinazoline-6,12-dione |
| Synonyms | GNF-Pf-2691; TCMDC-125859 |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL306946 |
| PubChem CID |
73549 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | VQQVWGVXDIPORV-UHFFFAOYSA-N |
| Standard InCHI | InChI=1S/C15H8N2O2/c18-13-10-6-2-4-8-12(10)17-14(13)16-11-7-3-1-5-9(11)15(17)19/h1-8H |
| SMILES | c1ccc2c(c1)c(=O)n1-c3ccccc3C(=O)c1n2 |
  Calculated Properties| Molecular Weight:   | 248.06 | Volume:   | 249.616 Van der Waals volume.
|
| Dense:   | 0.994 | LogP:   | 2.125 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 2.338 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -3.908 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 0.0 | Rigid Bonds:   | 22.0 |
| TPSA:   | 51.96 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 4.0 |
| H-Bond Donor:   | 0.0 | Rings:   | 4.0 |
| Heavy Atoms:   | 4.0 |
| QED Drug-Likeness Score:   | 0.478 | GASA:   | 1.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 1.939 | Fsp3:   | 0.0 |
| MCE-18:   | 40.0 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Rejected | GSK Rule:   | Rejected |
| Golden Triangle Rule:   | Rejected | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.284 | Fluc inhibitor:   | 0.062 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.716 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.442 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.481 | Promiscuous compounds:   | 0.61 |
| Caco-2 Permeability:   | -4.171 | MDCK Permeability:   | -4.492 |
| Pgp-inhibitor:   | 0.989 | Pgp-substrate:   | 0.003 |
| PAMPA:   |
0.128 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.007 |
| 20% Bioavailability (F20%):   | 0.002 | 30% Bioavailability (F30%):   | 0.094 |
| 50% Bioavailability (F50%):   | 0.198 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.143 | MRP1:   | 0.165 |
| Plasma Protein Binding (PPB):   | 94.99% | Volume Distribution (VD):   | -0.449 |
| Fu: |
5.394% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.861 |
| OATP1B3 inhibitor:   | 0.985 | BCRP inhibitor:   | 0.319 |
| BSEP inhibitor:   | 0.994 |
| CYP1A2-inhibitor:   | 0.949 | CYP1A2-substrate:   | 0.704 |
| CYP2C19-inhibitor:   | 0.047 | CYP2C19-substrate:   | 0.973 |
| CYP2C9-inhibitor:   | 0.193 | CYP2C9-substrate:   | 0.0 |
| CYP2D6-inhibitor:   | 0.162 | CYP2D6-substrate:   | 0.459 |
| CYP3A4-inhibitor:   | 0.035 | CYP3A4-substrate:   | 0.007 |
| CYP2B6-substrate:   | 0.0 | CYP2C8-inhibitor:   | 1.0 |
| HLM stability:   |
0.722 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 2.887 | Half-life (T1/2):   | 1.151 |
| hERG Blockers:   | 0.204 | hERG Blockers (10um):   | 0.585 |
| Human Hepatotoxicity (H-HT):   | 0.722 | Drug-induced Liver Injury (DILI):   | 0.684 |
| AMES Toxicity:   | 0.834 | Rat Oral Acute Toxicity:   | 0.426 |
| Maximum Recommended Daily Dose:   | 0.482 | Skin Sensitization:   | 0.555 |
| Carcinogencity:   | 0.786 | Eye Corrosion:   | 0.006 |
| Eye Irritation:   | 0.863 | Respiratory Toxicity:   | 0.599 |
| Drug-induced Neurotoxicity:   | 0.898 | Ototoxicity:   | 0.365 |
| Hematotoxicity:   | 0.674 | Drug-induced Nephrotoxicity:   | 0.532 |
| Genotoxicity:   | 0.912 | RPMI-8226 Immunitoxicity:   | 0.082 |
| A549 Cytotoxicity:   | 0.209 | Hek293 Cytotoxicity:   | 0.416 |
| BCF:   |
1.264 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
4.313 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
5.041 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
4.971 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1007/BF00714468] |
| NPO21080 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | fruit | n.a. | DOI[10.1007/s11306-014-0728-9] |
| NPO31573 | Polygonum tinctorium | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/j.jarmap.2018.11.004] |
| NPO17694 | Nicotiana tabacum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/j.jarmap.2018.11.004] |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/j.jfca.2004.07.004] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/j.jfca.2005.08.001] |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/j.jfca.2005.08.001] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | retail stores, supermarkets and market stalls in Forssa and in the Helsinki area | 2003–2005 | DOI[10.1016/j.jfca.2006.05.007] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/j.jplph.2011.12.019] |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/S0031-9422(00)89267-5] |
| NPO17694 | Nicotiana tabacum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/S0031-9422(00)98060-9] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | n.a. | DOI[10.1021/jf00055a023] | |
| NPO21080 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1038/sdata.2014.29] |
| NPO17694 | Nicotiana tabacum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1042/bst0160071] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1093/jxb/erx356] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1111/j.1365-3040.1996.tb00393.x] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | 1996-Sep |
PMID[10352947] |
| NPO21080 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | fruit | n.a. |
PMID[11171227] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | seed | n.a. |
PMID[11539687] |
| NPO17694 | Nicotiana tabacum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[11559179] |
| NPO31050 | Isatis indigotica | Species | Brassicaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[11678654] |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[12379786] |
| NPO21080 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | fruit | n.a. |
PMID[12576668] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[12713418] |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[12882150] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | Himeji City, Japan | n.a. |
PMID[15053555] |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[15666542] |
| NPO31050 | Isatis indigotica | Species | Brassicaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[15787451] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[15877880] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[17764147] |
| NPO17694 | Nicotiana tabacum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18001808] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18270436] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18460139] |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18460139] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | Northeastern Regional Plant Introduction Station at Geneva | 1966, 1967, and 1968 crop seasons |
PMID[18460139] |
| NPO4147 | Phaius mishmensis | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18507473] |
| NPO17694 | Nicotiana tabacum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[20954721] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[21080643] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | husk | n.a. |
PMID[21574561] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | leaf | n.a. |
PMID[21574561] |
| NPO31050 | Isatis indigotica | Species | Brassicaceae | Eukaryota | Roots | Anhui, China | n.a. |
PMID[22694318] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | seed | n.a. |
PMID[23292602] |
| NPO17694 | Nicotiana tabacum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[23479199] |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[23507362] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[23793896] |
| NPO11981 | Bufo gargarizans | Species | Bufonidae | Eukaryota | venom | n.a. | n.a. |
PMID[24050254] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | n.a. | seed | n.a. |
PMID[24967651] |
| NPO21080 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | seed | n.a. |
PMID[25891114] |
| NPO11981 | Bufo gargarizans | Species | Bufonidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28256122] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[2831703] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29762032] |
| NPO40957 | Wrightia hanleyi | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[30295480] |
| NPO4554 | Isatis tinctoria | Species | Brassicaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[32004936] |
| NPO10585 | Yarrowia lipolytica | Species | Dipodascaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[34751575] |
| NPO17694 | Nicotiana tabacum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[36500609] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[37980871] |
| NPO4554 | Isatis tinctoria | Species | Brassicaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[39053741] |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | n.a. | trunk bark | n.a. |
PMID[556731] |
| NPO21080 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[8987503] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | pollen | n.a. |
PMID[8987503] |
| NPO4582 | Baphicacanthus cusia | Species | Acanthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO4554 | Isatis tinctoria | Species | Brassicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO17694 | Nicotiana tabacum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO31050 | Isatis indigotica | Species | Brassicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO9069 | Persicaria tinctoria | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO31404 | Bufo melanostictus | Species | Bufonidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO8733 | Duttaphrynus melanostictus | Species | Bufonidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO4147 | Phaius mishmensis | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO31573 | Polygonum tinctorium | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO17272 | Cotoneaster simonsii | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | Cob | n.a. | n.a. | Database[FooDB] |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | Cotyledon | n.a. | n.a. | Database[FooDB] |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | Husk Essent. Oil | n.a. | n.a. | Database[FooDB] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | Oil | n.a. | n.a. | Database[FooDB] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | Plant | n.a. | n.a. | Database[FooDB] |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | Plant | n.a. | n.a. | Database[FooDB] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | Plant | n.a. | n.a. | Database[FooDB] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | Pollen Or Spore | n.a. | n.a. | Database[FooDB] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | Root | n.a. | n.a. | Database[FooDB] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | Root | n.a. | n.a. | Database[FooDB] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | Root | n.a. | n.a. | Database[FooDB] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | Seed Essent. Oil | n.a. | n.a. | Database[FooDB] |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | Seed Oil | n.a. | n.a. | Database[FooDB] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | Shoot | n.a. | n.a. | Database[FooDB] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | Shoot | n.a. | n.a. | Database[FooDB] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | Shoot | n.a. | n.a. | Database[FooDB] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | Silk Essent. Oil | n.a. | n.a. | Database[FooDB] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | Silk Stigma Style | n.a. | n.a. | Database[FooDB] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | Sprout Seedling | n.a. | n.a. | Database[FooDB] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | Stem | n.a. | n.a. | Database[FooDB] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | Stem | n.a. | n.a. | Database[FooDB] |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | Tuber | n.a. | n.a. | Database[FooDB] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | Tubers | n.a. | Database[FooDB] | |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO31050 | Isatis indigotica | Species | Brassicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO17694 | Nicotiana tabacum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO31573 | Polygonum tinctorium | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO4582 | Baphicacanthus cusia | Species | Acanthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO31404 | Bufo melanostictus | Species | Bufonidae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO4554 | Isatis tinctoria | Species | Brassicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO30651 | Folium polygoni | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO5812 | Indigo naturalis | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO10585 | Yarrowia lipolytica | Species | Dipodascaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[https://doi.org/10.1186/s13068-019-1636-z] |
| NPO21080 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[MetaboLights] |
| NPO21080 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | fruit | n.a. | Database[MetaboLights] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | Database[Phenol-Explorer] | |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | n.a. | n.a. | Database[Phenol-Explorer] | |
| NPO4554 | Isatis tinctoria | Species | Brassicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO4582 | Baphicacanthus cusia | Species | Acanthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO5812 | Indigo naturalis | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO17694 | Nicotiana tabacum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO21080 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO9069 | Persicaria tinctoria | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO8733 | Duttaphrynus melanostictus | Species | Bufonidae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO8277 | Folium polygoni tinctorii | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO11981 | Bufo gargarizans | Species | Bufonidae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO31050 | Isatis indigotica | Species | Brassicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO17694 | Nicotiana tabacum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO31404 | Bufo melanostictus | Species | Bufonidae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO31303 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO31573 | Polygonum tinctorium | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO4554 | Isatis tinctoria | Species | Brassicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO9069 | Persicaria tinctoria | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO4582 | Baphicacanthus cusia | Species | Acanthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO11981 | Bufo gargarizans | Species | Bufonidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17694 | Nicotiana tabacum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO21080 | Solanum lycopersicum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4582 | Baphicacanthus cusia | Species | Acanthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17272 | Cotoneaster simonsii | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO15810 | Zea mays | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4359 | Solanum tuberosum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10585 | Yarrowia lipolytica | Species | Dipodascaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO12310 | Viburnum orientale | Species | Adoxaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9069 | Persicaria tinctoria | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO15089 | Stylocheilus longicaudus | Species | Aplysiidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO15346 | Remijia bicolorata | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO22132 | Hordeum vulgare | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO8733 | Duttaphrynus melanostictus | Species | Bufonidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9507 | Agathosma mundtii | Species | Rutaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4554 | Isatis tinctoria | Species | Brassicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7530 | Cucumis sativus | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4147 | Phaius mishmensis | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 64.0 | nM | PMID[23146282] |
| NPT1197 | Individual protein | Huntingtin | Homo sapiens | Potency | = | 11220.2 | nM | PubChem BioAssay data set |
| NPT1038 | Individual protein | Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 5173.5 | nM | PubChem BioAssay data set |
| NPT2866 | Individual protein | Replicative DNA helicase | Mycobacterium tuberculosis | AC50 | = | 1078.0 | nM | PubChem BioAssay data set |
| NPT2867 | Individual protein | Protein RecA | Mycobacterium tuberculosis | EC50 | = | 643.0 | nM | PubChem BioAssay data set |
| NPT2866 | Individual protein | Replicative DNA helicase | Mycobacterium tuberculosis | AC50 | > | 380000.0 | nM | PubChem BioAssay data set |
| NPT154 | Individual protein | Mothers against decapentaplegic homolog 3 | Homo sapiens | Potency | n.a. | 3162.3 | nM | PubChem BioAssay data set |
| NPT1044 | Individual protein | DNA topoisomerase II alpha | Homo sapiens | Inhibition | = | 4.54 | % | PMID[22819942] |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | n.a. | 1158.2 | nM | PubChem BioAssay data set |
| NPT159 | Individual protein | Aberrant vpr protein | Human immunodeficiency virus 1 | Potency | n.a. | 3548.1 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Inhibition | = | 12.0 | % | PMID[23360475] |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | Inhibition | = | 9.0 | % | PMID[23360475] |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | Inhibition | = | 25.0 | % | PMID[23360475] |
| NPT1078 | Individual protein | Indoleamine 2,3-dioxygenase | Homo sapiens | IC50 | = | 53.7 | nM | PMID[24099220] |
| NPT1078 | Individual protein | Indoleamine 2,3-dioxygenase | Homo sapiens | IC50 | = | 7150.0 | nM | PMID[24099220] |
| NPT1078 | Individual protein | Indoleamine 2,3-dioxygenase | Homo sapiens | Ki | = | 4810.0 | nM | PMID[24099220] |
| NPT105 | Individual protein | Muscleblind-like protein 1 | Homo sapiens | Potency | n.a. | 1412.5 | nM | PubChem BioAssay data set |
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 6513.1 | nM | PubChem BioAssay data set |
| NPT1078 | Individual protein | Indoleamine 2,3-dioxygenase | Homo sapiens | IC50 | = | 498700.0 | nM | PMID[28720329] |
| NPT1426 | Individual protein | c-Jun N-terminal kinase 1 | Homo sapiens | Kd | = | 23000.0 | nM | PMID[30347329] |
| NPT3239 | Individual protein | Nerve growth factor receptor Trk-A | Homo sapiens | Kd | = | 9200.0 | nM | PMID[30347329] |
| NPT3270 | Individual protein | Neurotrophic tyrosine kinase receptor type 2 | Homo sapiens | Kd | = | 7200.0 | nM | PMID[30347329] |
| NPT2961 | Individual protein | Tryptophan 2,3-dioxygenase | Homo sapiens | IC50 | = | 900.0 | nM | PMID[30773421] |
| NPT2961 | Individual protein | Tryptophan 2,3-dioxygenase | Homo sapiens | IC50 | = | 3940.0 | nM | PMID[30321802] |
| NPT2961 | Individual protein | Tryptophan 2,3-dioxygenase | Homo sapiens | Ki | = | 581.0 | nM | PMID[30321802] |
| NPT2961 | Individual protein | Tryptophan 2,3-dioxygenase | Homo sapiens | IC50 | = | 194.0 | nM | PMID[30321802] |
| NPT2961 | Individual protein | Tryptophan 2,3-dioxygenase | Homo sapiens | IC50 | = | 140.0 | nM | PMID[30321802] |
| NPT483 | Individual protein | Prelamin-A/C | Homo sapiens | Potency | = | 354.8 | nM | PubChem BioAssay data set |
| NPT537 | Individual protein | Ras-related protein Rab-9A | Homo sapiens | Potency | = | 3162.3 | nM | PubChem BioAssay data set |
| NPT55 | Individual protein | Putative fructose-1,6-bisphosphate aldolase | Giardia intestinalis | Potency | = | 7924.5 | nM | PubChem BioAssay data set |
| NPT55 | Individual protein | Putative fructose-1,6-bisphosphate aldolase | Giardia intestinalis | Potency | = | 7062.7 | nM | PubChem BioAssay data set |
| NPT55 | Individual protein | Putative fructose-1,6-bisphosphate aldolase | Giardia intestinalis | Potency | = | 6294.6 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 11220.2 | nM | PubChem BioAssay data set |
| NPT944 | Individual protein | Glucose transporter | Leishmania mexicana | Inhibition | = | -3.28 | % | DOI[10.6019/CHEMBL3433997] |
| NPT54 | Individual protein | Nonstructural protein 1 | Influenza A virus | Potency | = | 1122.0 | nM | PubChem BioAssay data set |
| NPT538 | Individual protein | Niemann-Pick C1 protein | Homo sapiens | Potency | = | 2818.4 | nM | PubChem BioAssay data set |
| NPT484 | Individual protein | Luciferin 4-monooxygenase | Photinus pyralis | Potency | n.a. | 21331.3 | nM | PubChem BioAssay data set |
| NPT67 | Individual protein | Cholinesterase | Equus caballus | Inhibition | = | -2.13 | % | PMID[23062825] |
| NPT26497 | Single protein | Indoleamine 2,3-dioxygenase 2 | Homo sapiens | IC50 | = | 5000.0 | nM | PMID[27475108] |
| NPT26497 | Single protein | Indoleamine 2,3-dioxygenase 2 | Homo sapiens | IC50 | = | 17300.0 | nM | PMID[27475108] |
| NPT26497 | Single protein | Indoleamine 2,3-dioxygenase 2 | Homo sapiens | Ki | = | 15200.0 | nM | PMID[27475108] |
| NPT26497 | Single protein | Indoleamine 2,3-dioxygenase 2 | Homo sapiens | Ratio IC50 | = | 29.7 | n.a. | PMID[27475108] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | Inhibition | > | 30.0 | % | PMID[28675836] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 21.13 | % | DOI[10.6019/CHEMBL4495564] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 10.32 | % | DOI[10.6019/CHEMBL4495564] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | 103.79 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | 82.69 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | IC50 | = | 3286.0 | nM | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | 68.59 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 17782.8 | nM | PubChem BioAssay data set |
| NPT8 | Individual protein | DNA polymerase iota | Homo sapiens | Potency | n.a. | 89125.1 | nM | PubChem BioAssay data set |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | 35.31 | % | PMID[23062825] |
| NPT535 | Individual protein | Parathyroid hormone receptor | Homo sapiens | Potency | n.a. | 3162.3 | nM | PubChem BioAssay data set |
| NPT943 | Individual protein | Hexose transporter 1 | Plasmodium falciparum | Inhibition | = | -2.55 | % | DOI[10.6019/CHEMBL3433997] |
| NPT56 | Individual protein | Beta-lactamase AmpC | Escherichia coli K-12 | Potency | = | 891.3 | nM | PubChem BioAssay data set |
| NPT443 | Individual protein | Histone acetyltransferase GCN5 | Homo sapiens | Potency | n.a. | 10000.0 | nM | PubChem BioAssay data set |
| NPT64 | Individual protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 1635.3 | nM | PubChem BioAssay data set |
| NPT570 | Individual protein | Arachidonate 5-lipoxygenase | Homo sapiens | IC50 | = | 150.0 | nM | PMID[22819942] |
| NPT942 | Individual protein | Glucose transporter | Homo sapiens | Inhibition | = | -2.52 | % | DOI[10.6019/CHEMBL3433997] |
| NPT570 | Individual protein | Arachidonate 5-lipoxygenase | Homo sapiens | IC50 | = | 200000.0 | nM | PMID[28720329] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT378 | Cell line | NCI/ADR-RES | Homo sapiens | GI50 | = | 30000.0 | nM | PMID[12161121] |
| NPT380 | Cell line | U-251 | Homo sapiens | GI50 | = | 100000.0 | nM | PMID[12161121] |
| NPT323 | Cell line | SW-620 | Homo sapiens | GI50 | = | 5000.0 | nM | PMID[12161121] |
| NPT455 | Cell line | NCI-H522 | Homo sapiens | GI50 | = | 15000.0 | nM | PMID[12161121] |
| NPT387 | Cell line | M14 | Homo sapiens | GI50 | = | 15000.0 | nM | PMID[12161121] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | GI50 | = | 2500.0 | nM | PMID[12161121] |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | = | 400.0 | nM | PMID[12161121] |
| NPT376 | Cell line | A498 | Homo sapiens | GI50 | = | 950.0 | nM | PMID[12161121] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 11100.0 | nM | PMID[18507473] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 9000.0 | nM | PMID[18507473] |
| NPT395 | Cell line | SF-268 | Homo sapiens | IC50 | = | 24400.0 | nM | PMID[18507473] |
| NPT65 | Cell line | HepG2 | Homo sapiens | Inhibition | = | 9.0 | % | PMID[20485427] |
| NPT65 | Cell line | HepG2 | Homo sapiens | Potency | n.a. | 3981.1 | nM | PubChem BioAssay data set |
| NPT368 | Cell line | SN12C | Homo sapiens | GI50 | n.a. | 12618.28 | nM | PubChem BioAssay data set |
| NPT367 | Cell line | MDA-N | Homo sapiens | GI50 | n.a. | 18197.01 | nM | PubChem BioAssay data set |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | GI50 | n.a. | 9727.47 | nM | PubChem BioAssay data set |
| NPT369 | Cell line | ACHN | Homo sapiens | GI50 | n.a. | 1995.26 | nM | PubChem BioAssay data set |
| NPT371 | Cell line | UO-31 | Homo sapiens | GI50 | n.a. | 5058.25 | nM | PubChem BioAssay data set |
| NPT372 | Cell line | HOP-92 | Homo sapiens | GI50 | n.a. | 44463.13 | nM | PubChem BioAssay data set |
| NPT116 | Cell line | HL-60 | Homo sapiens | GI50 | n.a. | 3706.81 | nM | PubChem BioAssay data set |
| NPT374 | Cell line | SF-539 | Homo sapiens | GI50 | n.a. | 20749.14 | nM | PubChem BioAssay data set |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | n.a. | 10690.55 | nM | PubChem BioAssay data set |
| NPT373 | Cell line | SK-MEL-5 | Homo sapiens | GI50 | n.a. | 13122.0 | nM | PubChem BioAssay data set |
| NPT375 | Cell line | Malme-3M | Homo sapiens | GI50 | n.a. | 13396.77 | nM | PubChem BioAssay data set |
| NPT376 | Cell line | A498 | Homo sapiens | GI50 | n.a. | 18155.16 | nM | PubChem BioAssay data set |
| NPT111 | Cell line | K562 | Homo sapiens | GI50 | n.a. | 3184.2 | nM | PubChem BioAssay data set |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | GI50 | n.a. | 4539.42 | nM | PubChem BioAssay data set |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | GI50 | n.a. | 7943.28 | nM | PubChem BioAssay data set |
| NPT379 | Cell line | HOP-62 | Homo sapiens | GI50 | n.a. | 12133.89 | nM | PubChem BioAssay data set |
| NPT378 | Cell line | NCI/ADR-RES | Homo sapiens | GI50 | n.a. | 22335.72 | nM | PubChem BioAssay data set |
| NPT380 | Cell line | U-251 | Homo sapiens | GI50 | n.a. | 3341.95 | nM | PubChem BioAssay data set |
| NPT381 | Cell line | OVCAR-8 | Homo sapiens | GI50 | n.a. | 5794.29 | nM | PubChem BioAssay data set |
| NPT382 | Cell line | OVCAR-5 | Homo sapiens | GI50 | n.a. | 15995.58 | nM | PubChem BioAssay data set |
| NPT383 | Cell line | SNB-19 | Homo sapiens | GI50 | n.a. | 25003.45 | nM | PubChem BioAssay data set |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | GI50 | n.a. | 16672.47 | nM | PubChem BioAssay data set |
| NPT385 | Cell line | SR | Homo sapiens | GI50 | n.a. | 8472.27 | nM | PubChem BioAssay data set |
| NPT384 | Cell line | TK-10 | Homo sapiens | GI50 | n.a. | 43251.38 | nM | PubChem BioAssay data set |
| NPT323 | Cell line | SW-620 | Homo sapiens | GI50 | n.a. | 20796.97 | nM | PubChem BioAssay data set |
| NPT455 | Cell line | NCI-H522 | Homo sapiens | GI50 | n.a. | 15346.17 | nM | PubChem BioAssay data set |
| NPT386 | Cell line | KM12 | Homo sapiens | GI50 | n.a. | 6622.17 | nM | PubChem BioAssay data set |
| NPT387 | Cell line | M14 | Homo sapiens | GI50 | n.a. | 5649.37 | nM | PubChem BioAssay data set |
| NPT389 | Cell line | RPMI-8226 | Homo sapiens | GI50 | n.a. | 1039.92 | nM | PubChem BioAssay data set |
| NPT388 | Cell line | NCI-H322M | Homo sapiens | GI50 | n.a. | 11324.0 | nM | PubChem BioAssay data set |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | GI50 | n.a. | 4436.09 | nM | PubChem BioAssay data set |
| NPT456 | Cell line | OVCAR-4 | Homo sapiens | GI50 | n.a. | 19054.61 | nM | PubChem BioAssay data set |
| NPT457 | Cell line | BT-549 | Homo sapiens | GI50 | n.a. | 14554.59 | nM | PubChem BioAssay data set |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | GI50 | n.a. | 10092.53 | nM | PubChem BioAssay data set |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | n.a. | 2588.21 | nM | PubChem BioAssay data set |
| NPT392 | Cell line | SNB-75 | Homo sapiens | GI50 | n.a. | 30831.88 | nM | PubChem BioAssay data set |
| NPT391 | Cell line | HCC 2998 | Homo sapiens | GI50 | n.a. | 29376.5 | nM | PubChem BioAssay data set |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | n.a. | 5861.38 | nM | PubChem BioAssay data set |
| NPT148 | Cell line | HCT-15 | Homo sapiens | GI50 | n.a. | 3597.49 | nM | PubChem BioAssay data set |
| NPT395 | Cell line | SF-268 | Homo sapiens | GI50 | n.a. | 19906.73 | nM | PubChem BioAssay data set |
| NPT394 | Cell line | EKVX | Homo sapiens | GI50 | n.a. | 13427.65 | nM | PubChem BioAssay data set |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | n.a. | 7194.49 | nM | PubChem BioAssay data set |
| NPT306 | Cell line | PC-3 | Homo sapiens | GI50 | n.a. | 648.63 | nM | PubChem BioAssay data set |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | GI50 | n.a. | 100000.0 | nM | PubChem BioAssay data set |
| NPT396 | Cell line | T47D | Homo sapiens | GI50 | n.a. | 8871.56 | nM | PubChem BioAssay data set |
| NPT398 | Cell line | UACC-62 | Homo sapiens | GI50 | n.a. | 3689.78 | nM | PubChem BioAssay data set |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | GI50 | n.a. | 1435.49 | nM | PubChem BioAssay data set |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | GI50 | n.a. | 12331.05 | nM | PubChem BioAssay data set |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | GI50 | n.a. | 1853.53 | nM | PubChem BioAssay data set |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | GI50 | n.a. | 23014.42 | nM | PubChem BioAssay data set |
| NPT399 | Cell line | SF-295 | Homo sapiens | GI50 | n.a. | 4285.49 | nM | PubChem BioAssay data set |
| NPT402 | Cell line | Hs-578T | Homo sapiens | GI50 | n.a. | 17139.57 | nM | PubChem BioAssay data set |
| NPT401 | Cell line | 786-0 | Homo sapiens | GI50 | n.a. | 28248.8 | nM | PubChem BioAssay data set |
| NPT403 | Cell line | UACC-257 | Homo sapiens | GI50 | n.a. | 3019.95 | nM | PubChem BioAssay data set |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | GI50 | n.a. | 9078.21 | nM | PubChem BioAssay data set |
| NPT405 | Cell line | NCI-H226 | Homo sapiens | GI50 | n.a. | 30902.95 | nM | PubChem BioAssay data set |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | n.a. | 14757.07 | nM | PubChem BioAssay data set |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | GI50 | n.a. | 15812.48 | nM | PubChem BioAssay data set |
| NPT407 | Cell line | COLO 205 | Homo sapiens | GI50 | n.a. | 12764.39 | nM | PubChem BioAssay data set |
| NPT406 | Cell line | RXF 393 | Homo sapiens | GI50 | n.a. | 28054.34 | nM | PubChem BioAssay data set |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 14290.0 | nM | PMID[22819942] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 8490.0 | nM | PMID[22819942] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 6220.0 | nM | PMID[22819942] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 4110.0 | nM | PMID[22819942] |
| NPT2419 | Cell line | HT-1376 | Homo sapiens | Activity | = | 10.0 | uM | PMID[22819942] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | Ratio | > | 1.0 | n.a. | PMID[23360475] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | > | 8.0 | ug.mL-1 | PMID[23360475] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 0.3054 | ug.mL-1 | PMID[25654185] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 5000.0 | nM | PMID[28720329] |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | IC50 | = | 8000.0 | nM | PMID[28720329] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 580.0 | nM | PMID[28720329] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 2000.0 | nM | PMID[28720329] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 15000.0 | nM | PMID[28720329] |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | IC50 | = | 10000.0 | nM | PMID[28720329] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 5000.0 | nM | PMID[28720329] |
| NPT111 | Cell line | K562 | Homo sapiens | Activity | = | 52.2 | % | PMID[28720329] |
| NPT111 | Cell line | K562 | Homo sapiens | Activity | = | 33.4 | % | PMID[28720329] |
| NPT111 | Cell line | K562 | Homo sapiens | Activity | = | 21.9 | % | PMID[28720329] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 8.8 | ug.mL-1 | PMID[28720329] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | > | 100.0 | ug.mL-1 | PMID[30295480] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | GI50 | = | 14470.0 | nM | PMID[32712536] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 44360.0 | nM | PMID[32712536] |
| NPT380 | Cell line | U-251 | Homo sapiens | GI50 | = | 100000.0 | nM | PMID[36375335] |
| NPT387 | Cell line | M14 | Homo sapiens | GI50 | = | 15000.0 | nM | PMID[36375335] |
| NPT378 | Cell line | NCI/ADR-RES | Homo sapiens | GI50 | = | 30000.0 | nM | PMID[36375335] |
| NPT323 | Cell line | SW-620 | Homo sapiens | GI50 | = | 5000.0 | nM | PMID[36375335] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 6.3 | ug.mL-1 | PMID[36375335] |
| NPT762 | Cell line | A-431 | Homo sapiens | IC50 | = | 9000.0 | nM | PMID[36375335] |
| NPT376 | Cell line | A498 | Homo sapiens | GI50 | = | 950.0 | nM | PMID[36375335] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | GI50 | = | 2500.0 | nM | PMID[36375335] |
| NPT455 | Cell line | NCI-H522 | Homo sapiens | GI50 | = | 15000.0 | nM | PMID[36375335] |
| NPT2027 | Cell line | SK-N-DZ | Homo sapiens | IC50 | = | 14000.0 | nM | PMID[36375335] |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | = | 400.0 | nM | PMID[36375335] |
| NPT519 | Cell line | SH-SY5Y | Homo sapiens | IC50 | = | 22000.0 | nM | PMID[36375335] |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | = | 3.1 | ug.mL-1 | PMID[36375335] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 relative | = | 4300.0 | nM | ECBD screening data for assay EOS300108 |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 31.3 | % | PMID[36450214] |
| NPT1229 | Cell line | Huh-7 | Homo sapiens | CC50 | > | 10000.0 | nM | PMID[18579783] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 80.0 | % | PMID[20485427] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 93.0 | % | PMID[20485427] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | XC50 | = | 856.44 | nM | PMID[20485427] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 4.0 | % | PMID[20485427] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 211.7 | nM | PMID[18579783] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 275.6 | nM | PMID[18579783] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 3.7 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 329.4 | nM | PubChem BioAssay data set |
| NPT433 | Subcellular | Liver microsomes | Homo sapiens | Stability | = | 15.0 | % | PMID[23360475] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 9.2 | % | DOI[10.21203/rs.3.rs-23951/v1] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.17 | % | DOI[10.6019/CHEMBL4495565] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.08 | % | DOI[10.6019/CHEMBL4495565] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Activity | = | 100.0 | ng/ml | PMID[33823394] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 288.0 | nM | PMID[33823394] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 0.069 | ug.mL-1 | PMID[33823394] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 15800.0 | nM | PMID[36375335] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 114.0 | nM | PMID[33823394] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 10.0 | ug.mL-1 | PMID[22819942] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 0.5 | ug.mL-1 | PMID[26253635] |
| NPT602 | Organism | Mycobacterium smegmatis | Mycobacterium smegmatis | MIC | = | 6.0 | ug.mL-1 | PMID[26253635] |
| NPT1513 | Organism | Mycobacterium avium | Mycobacterium avium | MIC | = | 4.0 | ug.mL-1 | PMID[26253635] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 1.0 | ug.mL-1 | PMID[30295480] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC>90 | = | 7.59 | ug ml-1 | PMID[30295480] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 1.6e-05 | ug.mL-1 | PMID[28628823] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | GI50 | = | 2.25 | ug.mL-1 | PMID[20373766] |
| NPT523 | Organism | Malassezia furfur | Malassezia furfur | MIC | = | 4.0 | ug.mL-1 | PMID[28720329] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 0.5 | ug.mL-1 | PMID[28720329] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 195.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | n.a. | 330.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | n.a. | 2800.0 | nM | PubChem BioAssay data set |
| NPT475 | Organism | Plasmodium yoelii | Plasmodium yoelii | IC50 | = | 225.1 | nM | PMID[22096101] |
| NPT475 | Organism | Plasmodium yoelii | Plasmodium yoelii | Schizont size | = | 89.55 | um | PMID[22096101] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 2511.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 707.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 501.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 68.44 | % | PMID[22819942] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 4.09 | % | PMID[22819942] |
| NPT790 | Organism | Mycobacterium tuberculosis H37Rv | Mycobacterium tuberculosis H37Rv | MIC | = | 1.0 | ug.mL-1 | PMID[26253635] |
| NPT790 | Organism | Mycobacterium tuberculosis H37Rv | Mycobacterium tuberculosis H37Rv | MBC90 | = | 1.0 | ug ml-1 | PMID[23360475] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 10000.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 8912.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 16360.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 11220.2 | nM | PubChem BioAssay data set |
| NPT486 | Organism | Toxoplasma gondii | Toxoplasma gondii | ID50 | = | 0.031 | uM | PMID[18824607] |
| NPT2 | Others | Unspecified | n.a. | CC50 | n.a. | 17498.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | CC50 | > | 20000.0 | nM | PubChem BioAssay data set |
| NPT486 | Organism | Toxoplasma gondii | Toxoplasma gondii | ID50 | = | 0.14 | uM | PMID[23321561] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 41.0 | % | PMID[28720329] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 42.0 | % | PMID[28720329] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 46.0 | % | PMID[28720329] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 80.0 | % | PMID[28720329] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Homo sapiens | n.a. | permeability | = | 601.0 | ucm/s | PMID[23360475] |
| Homo sapiens | n.a. | permeability | = | 225.0 | ucm/s | PMID[23360475] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC207554 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 0.6964 | Remote Similarity | NPC150308 |
| 0.5645 | Remote Similarity | NPC475594 |
| 0.5517 | Remote Similarity | NPC83214 |
| 0.5397 | Remote Similarity | NPC88970 |
| 0.5385 | Remote Similarity | NPC474081 |
| 0.5385 | Remote Similarity | NPC474041 |
| 0.5385 | Remote Similarity | NPC473815 |
| 0.5231 | Remote Similarity | NPC471130 |
| 0.5224 | Remote Similarity | NPC475761 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC207554 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
