Natural Product: NPC176814| Natural Product ID | NPC176814 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| Arctigenin |
| IUPAC Name | (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| Synonyms | (-)-Arctigenin; Arctigenin |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL435734 |
| PubChem CID |
64981 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | NQWVSMVXKMHKTF-JKSUJKDBSA-N |
| Standard InCHI | InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1 |
| SMILES | COc1ccc(C[C@H]2COC(=O)[C@@H]2Cc2ccc(c(c2)OC)O)cc1OC |
  Calculated Properties| Molecular Weight:   | 372.16 | Volume:   | 380.389 Van der Waals volume.
|
| Dense:   | 0.978 | LogP:   | 2.043 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 2.199 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -3.237 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 7.0 | Rigid Bonds:   | 18.0 |
| TPSA:   | 74.22 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 6.0 |
| H-Bond Donor:   | 1.0 | Rings:   | 3.0 |
| Heavy Atoms:   | 6.0 |
| QED Drug-Likeness Score:   | 0.753 | GASA:   | 0.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 3.048 | Fsp3:   | 0.381 |
| MCE-18:   | 57.724 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Rejected | GSK Rule:   | Rejected |
| Golden Triangle Rule:   | Rejected | BMS Rule:   | 0 |
| Chelating Alert:   | 1 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.196 | Fluc inhibitor:   | 0.317 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.021 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.275 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.285 | Promiscuous compounds:   | 0.311 |
| Caco-2 Permeability:   | -5.022 | MDCK Permeability:   | -4.715 |
| Pgp-inhibitor:   | 0.693 | Pgp-substrate:   | 0.246 |
| PAMPA:   |
0.024 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.029 |
| 20% Bioavailability (F20%):   | 0.858 | 30% Bioavailability (F30%):   | 0.741 |
| 50% Bioavailability (F50%):   | 0.902 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.0 | MRP1:   | 0.871 |
| Plasma Protein Binding (PPB):   | 95.756% | Volume Distribution (VD):   | -0.365 |
| Fu: |
4.065% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.998 |
| OATP1B3 inhibitor:   | 0.985 | BCRP inhibitor:   | 0.193 |
| BSEP inhibitor:   | 0.997 |
| CYP1A2-inhibitor:   | 0.104 | CYP1A2-substrate:   | 0.82 |
| CYP2C19-inhibitor:   | 1.0 | CYP2C19-substrate:   | 0.998 |
| CYP2C9-inhibitor:   | 0.0 | CYP2C9-substrate:   | 0.0 |
| CYP2D6-inhibitor:   | 0.0 | CYP2D6-substrate:   | 0.998 |
| CYP3A4-inhibitor:   | 1.0 | CYP3A4-substrate:   | 1.0 |
| CYP2B6-substrate:   | 0.0 | CYP2C8-inhibitor:   | 1.0 |
| HLM stability:   |
0.907 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 5.071 | Half-life (T1/2):   | 2.222 |
| hERG Blockers:   | 0.162 | hERG Blockers (10um):   | 0.611 |
| Human Hepatotoxicity (H-HT):   | 0.942 | Drug-induced Liver Injury (DILI):   | 0.95 |
| AMES Toxicity:   | 0.811 | Rat Oral Acute Toxicity:   | 0.27 |
| Maximum Recommended Daily Dose:   | 0.523 | Skin Sensitization:   | 0.904 |
| Carcinogencity:   | 0.724 | Eye Corrosion:   | 0.012 |
| Eye Irritation:   | 0.939 | Respiratory Toxicity:   | 0.336 |
| Drug-induced Neurotoxicity:   | 0.785 | Ototoxicity:   | 0.599 |
| Hematotoxicity:   | 0.618 | Drug-induced Nephrotoxicity:   | 0.887 |
| Genotoxicity:   | 0.978 | RPMI-8226 Immunitoxicity:   | 0.214 |
| A549 Cytotoxicity:   | 0.367 | Hek293 Cytotoxicity:   | 0.533 |
| BCF:   |
1.167 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
3.871 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
5.067 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
4.593 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO29314 | Mangifera indica | Species | Anacardiaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1246/bcsj.30.618] |
| NPO40017 | Ancistrocladus ealaensis | Species | Ancistrocladaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[11087584] |
| NPO24778 | Sesamum orientale | Species | Pedaliaceae | Eukaryota | n.a. | seed | n.a. |
PMID[11540412] |
| NPO1766 | Hymenaea courbaril | Species | Fabaceae | Eukaryota | n.a. | Suriname rain forest | n.a. |
PMID[11809056] |
| NPO12713 | Brachylaena ramiflora | Species | Asteraceae | Eukaryota | twigs | Madagascar rainforest | n.a. |
PMID[12193040] |
| NPO13045 | Kielmeyera albopunctata | Species | Calophyllaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[12762797] |
| NPO683 | Rosa canina | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[12880322] |
| NPO19805 | Forsythia viridissima | Species | Oleaceae | Eukaryota | n.a. | flower | n.a. |
PMID[15481244] |
| NPO3837 | Wikstroemia indica | Species | Thymelaeaceae | Eukaryota | n.a. | root | n.a. |
PMID[15635251] |
| NPO21387 | Forsythia suspensa | Species | Oleaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[17156960] |
| NPO27600 | Boesenbergia pandurata | Species | Zingiberaceae | Eukaryota | rhizomes | Pindaya Township, Shan State, Myanmar | 2004-NOV |
PMID[17896818] |
| NPO6779 | Sutherlandia frutescens | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18808182] |
| NPO12339 | Daphne feddei | Species | Thymelaeaceae | Eukaryota | stem bark | Kunming, Yunnan Province, China | n.a. |
PMID[18986199] |
| NPO3837 | Wikstroemia indica | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[19299148] |
| NPO9756 | Daphne genkwa | Species | Thymelaeaceae | Eukaryota | n.a. | flower | n.a. |
PMID[21916433] |
| NPO10449 | Arctium lappa | Species | Asteraceae | Eukaryota | n.a. | fruit | n.a. |
PMID[22396124] |
| NPO24241 | Taiwania cryptomerioides | Species | Cupressaceae | Eukaryota | n.a. | twig | n.a. |
PMID[22474975] |
| NPO32880 | uvaria dac | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[22676269] |
| NPO32880 | uvaria dac | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[23092429] |
| NPO10449 | Arctium lappa | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[23501116] |
| NPO9756 | Daphne genkwa | Species | Thymelaeaceae | Eukaryota | flower buds | n.a. | n.a. |
PMID[23558238] |
| NPO5985 | Klebsiella pneumoniae | Species | Enterobacteriaceae | Bacteria | n.a. | n.a. | n.a. |
PMID[24572278] |
| NPO3837 | Wikstroemia indica | Species | Thymelaeaceae | Eukaryota | n.a. | root | n.a. |
PMID[24660446] |
| NPO7267 | Glycosmis chlorosperma | Species | Rutaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[24798019] |
| NPO21387 | Forsythia suspensa | Species | Oleaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[26422318] |
| NPO6381 | Dendrobium crepidatum | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[26710212] |
| NPO9756 | Daphne genkwa | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27228307] |
| NPO29314 | Mangifera indica | Species | Anacardiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27466882] |
| NPO27600 | Boesenbergia pandurata | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27508308] |
| NPO27600 | Boesenbergia pandurata | Species | Zingiberaceae | Eukaryota | Rhizomes | n.a. | n.a. |
PMID[28099006] |
| NPO40018 | Ancistrocladus ileboensis | Species | Ancistrocladaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28121440] |
| NPO21387 | Forsythia suspensa | Species | Oleaceae | Eukaryota | Fruits | n.a. | n.a. |
PMID[28218000] |
| NPO41067 | Trigona minor | Species | Apidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28783356] |
| NPO40018 | Ancistrocladus ileboensis | Species | Ancistrocladaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29043798] |
| NPO40017 | Ancistrocladus ealaensis | Species | Ancistrocladaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29560715] |
| NPO19805 | Forsythia viridissima | Species | Oleaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[30676026] |
| NPO9756 | Daphne genkwa | Species | Thymelaeaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[31150241] |
| NPO24241 | Taiwania cryptomerioides | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31347365] |
| NPO40017 | Ancistrocladus ealaensis | Species | Ancistrocladaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31630523] |
| NPO9756 | Daphne genkwa | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31860304] |
| NPO40130 | Ferula hezarlalehzarica | Species | Apiaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[32163286] |
| NPO9756 | Daphne genkwa | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32223193] |
| NPO18636 | Cupressus macrocarpa | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32223924] |
| NPO40056 | Callistemon citrinus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32573227] |
| NPO40056 | Callistemon citrinus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[34028046] |
| NPO10398 | Myrica gale | Species | Myricaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[36903911] |
| NPO40056 | Callistemon citrinus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[37728015] |
| NPO8340 | Stachys sylvatica | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38769997] |
| NPO3837 | Wikstroemia indica | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[501363] |
| NPO3837 | Wikstroemia indica | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[7320737] |
| NPO24241 | Taiwania cryptomerioides | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[9014350] |
| NPO10449 | Arctium lappa | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO5039 | Cryptomonas ovata | Species | Cryptomonadaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29314 | Mangifera indica | Species | Anacardiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO24778 | Sesamum orientale | Species | Pedaliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO683 | Rosa canina | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO27600 | Boesenbergia pandurata | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40017 | Ancistrocladus ealaensis | Species | Ancistrocladaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7267 | Glycosmis chlorosperma | Species | Rutaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO21387 | Forsythia suspensa | Species | Oleaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO12339 | Daphne feddei | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO8175 | Acacia kempeana | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO16865.1 | Prunus serrulata var. spontanea | Varieties | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO28466 | Torreya nucifera | Species | Taxaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13014 | Ipomoea cairica | Species | Convolvulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO12235 | Trachelospermum jasminoides | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO10398 | Myrica gale | Species | Myricaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO3837 | Wikstroemia indica | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18636 | Cupressus macrocarpa | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO5235 | Laburnum watereri | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO24241 | Taiwania cryptomerioides | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO19805 | Forsythia viridissima | Species | Oleaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO850 | Metatrichia vesparium | Species | Trichiidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO3935 | Asplenium septentrionale | Species | Aspleniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO8340 | Stachys sylvatica | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2366 | Diospyros buxifolia | Species | Ebenaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7812 | Alhagi persarum | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO9756 | Daphne genkwa | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO1766 | Hymenaea courbaril | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO6979 | Baillonella toxisperma | Species | Sapotaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO26016 | Spheciospongia vagabunda | Species | Spirastrellidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO19459 | Dictyota kunthii | Species | Dictyotaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO5985 | Klebsiella pneumoniae | Species | Enterobacteriaceae | Bacteria | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO32880 | uvaria dac | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40056 | Callistemon citrinus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO24778 | Sesamum orientale | Species | Pedaliaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO29314 | Mangifera indica | Species | Anacardiaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO29314 | Mangifera indica | Species | Anacardiaceae | Eukaryota | Flower | n.a. | n.a. | Database[FooDB] |
| NPO10449 | Arctium lappa | Species | Asteraceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO29314 | Mangifera indica | Species | Anacardiaceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO24778 | Sesamum orientale | Species | Pedaliaceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO10449 | Arctium lappa | Species | Asteraceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO29314 | Mangifera indica | Species | Anacardiaceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO10449 | Arctium lappa | Species | Asteraceae | Eukaryota | Root | n.a. | n.a. | Database[FooDB] |
| NPO24778 | Sesamum orientale | Species | Pedaliaceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO10449 | Arctium lappa | Species | Asteraceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO29314 | Mangifera indica | Species | Anacardiaceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO10449 | Arctium lappa | Species | Asteraceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO24778 | Sesamum orientale | Species | Pedaliaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO29314 | Mangifera indica | Species | Anacardiaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO21387 | Forsythia suspensa | Species | Oleaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO10449 | Arctium lappa | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO13014 | Ipomoea cairica | Species | Convolvulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO24778 | Sesamum orientale | Species | Pedaliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO29314 | Mangifera indica | Species | Anacardiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO24241 | Taiwania cryptomerioides | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO9756 | Daphne genkwa | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO12235 | Trachelospermum jasminoides | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO3837 | Wikstroemia indica | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO683 | Rosa canina | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO14834 | Trachelospermum asiaticum | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO19805 | Forsythia viridissima | Species | Oleaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO4271 | Dendrobium thyrsiflorum | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO10449 | Arctium lappa | Species | Asteraceae | Eukaryota | n.a. | n.a. | Database[Phenol-Explorer] | |
| NPO29314 | Mangifera indica | Species | Anacardiaceae | Eukaryota | Fruits | n.a. | Database[Phenol-Explorer] | |
| NPO13014 | Ipomoea cairica | Species | Convolvulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO3837 | Wikstroemia indica | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO9756 | Daphne genkwa | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO29314 | Mangifera indica | Species | Anacardiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO8340 | Stachys sylvatica | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO24778 | Sesamum orientale | Species | Pedaliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO7267 | Glycosmis chlorosperma | Species | Rutaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO10449 | Arctium lappa | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO21387 | Forsythia suspensa | Species | Oleaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO24241 | Taiwania cryptomerioides | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO4271 | Dendrobium thyrsiflorum | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO12235 | Trachelospermum jasminoides | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO19805 | Forsythia viridissima | Species | Oleaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO10398 | Myrica gale | Species | Myricaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO683 | Rosa canina | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO18636 | Cupressus macrocarpa | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO14834 | Trachelospermum asiaticum | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO30739 | Forsythia suspense | Species | Oleaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO10449 | Arctium lappa | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO9756 | Daphne genkwa | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO24778 | Sesamum orientale | Species | Pedaliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO24241 | Taiwania cryptomerioides | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO3837 | Wikstroemia indica | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO683 | Rosa canina | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO12235 | Trachelospermum jasminoides | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO13014 | Ipomoea cairica | Species | Convolvulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO29314 | Mangifera indica | Species | Anacardiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO4271 | Dendrobium thyrsiflorum | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO10398 | Myrica gale | Species | Myricaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO24778 | Sesamum orientale | Species | Pedaliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO19805 | Forsythia viridissima | Species | Oleaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO10449 | Arctium lappa | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO12235 | Trachelospermum jasminoides | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO21387 | Forsythia suspensa | Species | Oleaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO9756 | Daphne genkwa | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO16865.1 | Prunus serrulata var. spontanea | Varieties | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO14834 | Trachelospermum asiaticum | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO7812 | Alhagi persarum | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29314 | Mangifera indica | Species | Anacardiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO27600 | Boesenbergia pandurata | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO12235 | Trachelospermum jasminoides | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO8175 | Acacia kempeana | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO12713 | Brachylaena ramiflora | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2525 | Castanopsis cuspidata | Species | Fagaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10398 | Myrica gale | Species | Myricaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO8476 | Teucrium lanigerum | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO19459 | Dictyota kunthii | Species | Dictyotaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6381 | Dendrobium crepidatum | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13014 | Ipomoea cairica | Species | Convolvulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO16865.1 | Prunus serrulata var. spontanea | Varieties | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5039 | Cryptomonas ovata | Species | Cryptomonadaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4271 | Dendrobium thyrsiflorum | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18636 | Cupressus macrocarpa | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5235 | Laburnum watereri | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9756 | Daphne genkwa | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6979 | Baillonella toxisperma | Species | Sapotaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4644 | Pteris pacifica | Species | Pteridaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4096 | Acanthias vulgaris | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO12339 | Daphne feddei | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3672 | Montanoa guatemalensis | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1766 | Hymenaea courbaril | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO26016 | Spheciospongia vagabunda | Species | Spirastrellidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO720 | Badilloa salicina | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6779 | Sutherlandia frutescens | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2011 | Decaisnea fargesii | Species | Lardizabalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6858 | Achillea tuzsonii | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO8312 | Polygonatum stenophyllum | Species | Asparagaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO25196 | Nuxia oppositifolia | Species | Stilbaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5985 | Klebsiella pneumoniae | Species | Enterobacteriaceae | Bacteria | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2366 | Diospyros buxifolia | Species | Ebenaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO14834 | Trachelospermum asiaticum | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO850 | Metatrichia vesparium | Species | Trichiidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2218 | Aframomum sulcatum | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10449 | Arctium lappa | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6760 | Saussurea conica | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO683 | Rosa canina | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO8340 | Stachys sylvatica | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO24778 | Sesamum orientale | Species | Pedaliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO21387 | Forsythia suspensa | Species | Oleaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3944 | Senecio variabilis | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10799 | Espeletia moritziana | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7601 | Centaurea cana | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO28466 | Torreya nucifera | Species | Taxaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO22995 | Oophaga histrionica | Species | Dendrobatidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO26373.1 | Microbispora rosea subsp. aerata | Subspecies | Streptosporangiaceae | Bacteria | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO11869 | Vernonia leopoldi | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7267 | Glycosmis chlorosperma | Species | Rutaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13045 | Kielmeyera albopunctata | Species | Calophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO24241 | Taiwania cryptomerioides | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3935 | Asplenium septentrionale | Species | Aspleniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5136 | Colliguaja salicifolia | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3837 | Wikstroemia indica | Species | Thymelaeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO10449 | Arctium lappa | Other (raw) | Seed | 16.66 | 16.66 | 16.66 | mg/100g | Database [DUKE] |
| NPO24778 | Sesamum orientale | Dried Or Powder | n.a. | 0.018999999 | n.a. | n.a. | mg/100g | Database [PHENOL EXPLORER] |
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT12 | Individual protein | Human immunodeficiency virus type 1 integrase | Human immunodeficiency virus 1 | Inhibition | < | 5.0 | % | PMID[8568830] |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | Potency | = | 2.5 | nM | PubChem BioAssay data set |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | AC50 | = | 15848.93 | nM | PubChem BioAssay data set |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | AC50 | = | 2.512 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | AC50 | = | 15848.93 | nM | PubChem BioAssay data set |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | AC50 | = | 31622.78 | nM | PubChem BioAssay data set |
| NPT1671 | Individual protein | AMP-activated protein kinase, alpha-2 subunit | Homo sapiens | Thermal melting change | = | -0.9 | degrees C | PMID[18077363] |
| NPT1672 | Individual protein | CaM kinase I delta | Homo sapiens | Thermal melting change | = | 0.1 | degrees C | PMID[18077363] |
| NPT1673 | Individual protein | CaM kinase I gamma | Homo sapiens | Thermal melting change | = | -0.3 | degrees C | PMID[18077363] |
| NPT1674 | Individual protein | CaM kinase II alpha | Homo sapiens | Thermal melting change | = | 0.1 | degrees C | PMID[18077363] |
| NPT1630 | Individual protein | CaM kinase II beta | Homo sapiens | Thermal melting change | = | 0.6 | degrees C | PMID[18077363] |
| NPT1675 | Individual protein | CaM kinase II delta | Homo sapiens | Thermal melting change | = | 0.2 | degrees C | PMID[18077363] |
| NPT1676 | Individual protein | CaM kinase II gamma | Homo sapiens | Thermal melting change | = | 0.3 | degrees C | PMID[18077363] |
| NPT1677 | Individual protein | CaM kinase IV | Homo sapiens | Thermal melting change | = | -0.5 | degrees C | PMID[18077363] |
| NPT1678 | Individual protein | CaM-kinase kinase beta | Homo sapiens | Thermal melting change | = | -0.9 | degrees C | PMID[18077363] |
| NPT1371 | Individual protein | Cyclin-dependent kinase 2 | Homo sapiens | Thermal melting change | = | 0.6 | degrees C | PMID[18077363] |
| NPT1571 | Individual protein | Cyclin-dependent kinase 6 | Homo sapiens | Thermal melting change | = | 0.4 | degrees C | PMID[18077363] |
| NPT1679 | Individual protein | Cyclin-dependent kinase-like 1 | Homo sapiens | Thermal melting change | = | -0.1 | degrees C | PMID[18077363] |
| NPT1680 | Individual protein | Serine/threonine-protein kinase Chk2 | Homo sapiens | Thermal melting change | = | -0.3 | degrees C | PMID[18077363] |
| NPT1682 | Individual protein | Dual specificity protein kinase CLK2 | Homo sapiens | Thermal melting change | = | -0.1 | degrees C | PMID[18077363] |
| NPT1683 | Individual protein | Dual specificity protein kinase CLK3 | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[18077363] |
| NPT1684 | Individual protein | Casein kinase I gamma 1 | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[18077363] |
| NPT1685 | Individual protein | Casein kinase I gamma 2 | Homo sapiens | Thermal melting change | = | 0.1 | degrees C | PMID[18077363] |
| NPT1686 | Individual protein | Casein kinase I isoform gamma-3 | Homo sapiens | Thermal melting change | = | 0.2 | degrees C | PMID[18077363] |
| NPT1687 | Individual protein | Death-associated protein kinase 3 | Homo sapiens | Thermal melting change | = | -0.3 | degrees C | PMID[18077363] |
| NPT1688 | Individual protein | Myotonin-protein kinase | Homo sapiens | Thermal melting change | = | 1.4 | degrees C | PMID[18077363] |
| NPT1689 | Individual protein | Tyrosine-protein kinase JAK1 | Homo sapiens | Thermal melting change | = | -0.1 | degrees C | PMID[18077363] |
| NPT1690 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 2 | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[18077363] |
| NPT1691 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 6 | Homo sapiens | Thermal melting change | = | 0.3 | degrees C | PMID[18077363] |
| NPT1431 | Individual protein | Mitogen-activated protein kinase kinase kinase 5 | Homo sapiens | Thermal melting change | = | 0.2 | degrees C | PMID[18077363] |
| NPT1616 | Individual protein | MAP kinase p38 beta | Homo sapiens | Thermal melting change | = | -0.2 | degrees C | PMID[18077363] |
| NPT281 | Individual protein | MAP kinase ERK1 | Homo sapiens | Thermal melting change | = | -0.4 | degrees C | PMID[18077363] |
| NPT1692 | Individual protein | Mitogen-activated protein kinase 6 | Homo sapiens | Thermal melting change | = | 0.2 | degrees C | PMID[18077363] |
| NPT1693 | Individual protein | Serine/threonine-protein kinase MST4 | Homo sapiens | Thermal melting change | = | -0.3 | degrees C | PMID[18077363] |
| NPT1658 | Individual protein | Serine/threonine-protein kinase NEK2 | Homo sapiens | Thermal melting change | = | 1.1 | degrees C | PMID[18077363] |
| NPT1657 | Individual protein | Serine/threonine-protein kinase NEK6 | Homo sapiens | Thermal melting change | = | -0.7 | degrees C | PMID[18077363] |
| NPT1694 | Individual protein | Serine/threonine-protein kinase OSR1 | Homo sapiens | Thermal melting change | = | -0.1 | degrees C | PMID[18077363] |
| NPT1695 | Individual protein | Serine/threonine-protein kinase PAK 4 | Homo sapiens | Thermal melting change | = | 0.8 | degrees C | PMID[18077363] |
| NPT1696 | Individual protein | Serine/threonine-protein kinase PAK7 | Homo sapiens | Thermal melting change | = | 0.1 | degrees C | PMID[18077363] |
| NPT1697 | Individual protein | Serine/threonine-protein kinase PAK6 | Homo sapiens | Thermal melting change | = | 0.1 | degrees C | PMID[18077363] |
| NPT1698 | Individual protein | Serine/threonine-protein kinase PCTAIRE-1 | Homo sapiens | Thermal melting change | = | -0.1 | degrees C | PMID[18077363] |
| NPT1699 | Individual protein | 3-phosphoinositide dependent protein kinase-1 | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[18077363] |
| NPT1265 | Individual protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | Thermal melting change | = | -0.3 | degrees C | PMID[18077363] |
| NPT1700 | Individual protein | Serine/threonine-protein kinase PIM2 | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[18077363] |
| NPT1701 | Individual protein | Serine/threonine-protein kinase PIM3 | Homo sapiens | Thermal melting change | = | 0.6 | degrees C | PMID[18077363] |
| NPT1702 | Individual protein | Serine/threonine-protein kinase PLK4 | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[18077363] |
| NPT1703 | Individual protein | cAMP-dependent protein kinase alpha-catalytic subunit | Homo sapiens | Thermal melting change | = | 0.2 | degrees C | PMID[18077363] |
| NPT1704 | Individual protein | Serine/threonine-protein kinase RIO2 | Homo sapiens | Thermal melting change | = | -0.2 | degrees C | PMID[18077363] |
| NPT1705 | Individual protein | Ribosomal protein S6 kinase alpha 3 | Homo sapiens | Thermal melting change | = | -0.2 | degrees C | PMID[18077363] |
| NPT1705 | Individual protein | Ribosomal protein S6 kinase alpha 3 | Homo sapiens | Thermal melting change | = | -0.1 | degrees C | PMID[18077363] |
| NPT1706 | Individual protein | Serine/threonine-protein kinase 2 | Homo sapiens | Thermal melting change | = | -0.5 | degrees C | PMID[18077363] |
| NPT1707 | Individual protein | Serine/threonine-protein kinase 10 | Homo sapiens | Thermal melting change | = | 0.7 | degrees C | PMID[18077363] |
| NPT1708 | Individual protein | Serine/threonine-protein kinase 16 | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[18077363] |
| NPT1709 | Individual protein | Serine/threonine-protein kinase 17A | Homo sapiens | Thermal melting change | = | 1.4 | degrees C | PMID[18077363] |
| NPT1710 | Individual protein | Serine/threonine-protein kinase 38 | Homo sapiens | Thermal melting change | = | 0.5 | degrees C | PMID[18077363] |
| NPT1693 | Individual protein | Serine/threonine-protein kinase MST4 | Homo sapiens | Thermal melting change | = | 0.2 | degrees C | PMID[18077363] |
| NPT1711 | Individual protein | Serine/threonine-protein kinase MST1 | Homo sapiens | Thermal melting change | = | 0.8 | degrees C | PMID[18077363] |
| NPT1712 | Individual protein | TRAF2- and NCK-interacting kinase | Homo sapiens | Thermal melting change | = | -0.2 | degrees C | PMID[18077363] |
| NPT1713 | Individual protein | PDZ-binding kinase | Homo sapiens | Thermal melting change | = | -0.7 | degrees C | PMID[18077363] |
| NPT1715 | Individual protein | Serine/threonine-protein kinase VRK2 | Homo sapiens | Thermal melting change | = | 0.5 | degrees C | PMID[18077363] |
| NPT1717 | Individual protein | Serine/threonine-protein kinase 25 | Homo sapiens | Thermal melting change | = | 0.1 | degrees C | PMID[18077363] |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 1122.0 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 6309.6 | nM | PubChem BioAssay data set |
| NPT22961 | Single protein | Inactive serine/threonine-protein kinase VRK3 | Homo sapiens | Thermal melting change | = | 0.4 | degrees C | PMID[18077363] |
| NPT491 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 1 | Homo sapiens | IC50 | = | 1.0 | nM | PMID[18077363] |
| NPT831 | Individual protein | Serine/threonine-protein kinase PLK1 | Homo sapiens | Thermal melting change | = | 0.1 | degrees C | PMID[18077363] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 13.38 | % | DOI[10.6019/CHEMBL4495564] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 2.974 | % | DOI[10.6019/CHEMBL4495564] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -1.36 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -24.98 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Thermal melting change | = | -0.2 | degrees C | PMID[18077363] |
| NPT22960 | Single protein | Serine/threonine-protein kinase VRK1 | Homo sapiens | Thermal melting change | = | 0.7 | degrees C | PMID[18077363] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT461 | Cell line | PANC-1 | Homo sapiens | PC100 | = | 1.0 | uM | PMID[17896818] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | CD100 | = | 1.0 | uM | PMID[19572611] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 10.0 | nM | PMID[18077363] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | PC50 | = | 0.4 | uM | PMID[19572611] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 260000.0 | nM | PMID[18986199] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | PC50 | = | 1.7 | uM | PMID[22676269] |
| NPT2107 | Cell line | PSN1 | Homo sapiens | PC50 | = | 1.9 | uM | PMID[22676269] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | PC50 | = | 0.67 | uM | PMID[22676269] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | PC50 | = | 1.0 | uM | PMID[23092429] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | PC50 | = | 0.8 | uM | PMID[32057581] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 6570.0 | nM | PMID[25571795] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[25571795] |
| NPT839 | Cell line | L6 | Rattus norvegicus | FC | = | 1.75 | n.a. | PMID[25941553] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | PC50 | = | 0.83 | uM | PMID[29043798] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | PC50 | = | 0.5 | uM | PMID[28947153] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | PC50 | = | 1.9 | uM | PMID[30070833] |
| NPT2309 | Cell line | CAPAN-1 | Homo sapiens | PC50 | = | 1.2 | uM | PMID[28947153] |
| NPT2107 | Cell line | PSN1 | Homo sapiens | PC50 | = | 0.7 | uM | PMID[28947153] |
| NPT116 | Cell line | HL-60 | Homo sapiens | EC50 | = | 12000.0 | nM | PMID[28754364] |
| NPT165 | Cell line | HeLa | Homo sapiens | EC50 | > | 100000.0 | nM | PMID[28754364] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | PC50 | = | 0.7 | uM | PMID[32631550] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 572700.0 | nM | PMID[30237124] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Inhibition | = | 79.1 | % | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Inhibition | = | 66.8 | % | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | IC50 | = | 2200.0 | nM | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 8.66 | % | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 1.43 | % | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 83.08 | % | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 6.84 | % | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 4.13 | % | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 1.03 | % | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 89.2 | % | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 5.64 | % | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 2.23 | % | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 1.06 | % | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 90.44 | % | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 6.29 | % | PMID[30878830] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | PC50 | = | 0.9 | uM | PMID[32163286] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 2.8 | ug.mL-1 | PMID[32223924] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 1.1 | ug.mL-1 | PMID[32223924] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 0.8 | ug.mL-1 | PMID[32223924] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 13000.0 | nM | PMID[32359854] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | PC50 | = | 0.7 | uM | PMID[34008971] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | PC50 | = | 0.7 | uM | PMID[35395369] |
| NPT2107 | Cell line | PSN1 | Homo sapiens | PC50 | = | 0.7 | uM | PMID[33753259] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | PC50 | = | 0.7 | uM | PMID[33753259] |
| NPT839 | Cell line | L6 | Rattus norvegicus | Activity | = | 146.0 | % | PMID[34772527] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 relative | = | 2600.0 | nM | ECBD screening data for assay EOS300108 |
| NPT839 | Cell line | L6 | Rattus norvegicus | Activity | = | 23.5 | pmol/uL | PMID[34772527] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | PC50 | = | 1.9 | uM | PMID[33753259] |
| NPT171 | Cell line | MRC5 | Homo sapiens | CC50 | = | 76000.0 | nM | PMID[17239594] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Cytotoxicity | = | 1.0 | uM | PMID[18725180] |
| NPT1114 | Organism | Human immunodeficiency virus | Human immunodeficiency virus | Activity | = | 60.0 | % | PMID[9834179] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 0.61 | % | DOI[10.21203/rs.3.rs-23951/v1] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 0.46 | % | DOI[10.6019/CHEMBL4495565] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.06 | % | DOI[10.6019/CHEMBL4495565] |
| NPT28438 | Unchecked | Unchecked | n.a. | PC50 | = | 0.8 | uM | PMID[33753259] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | PC50 | = | 1.5 | uM | PMID[22676269] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | PC50 | = | 0.5 | uM | PMID[24216090] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | PC50 | = | 0.85 | uM | PMID[24380769] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | PC50 | = | 1.27 | uM | PMID[27117432] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | < | 50.0 | % | PMID[27117432] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 856.8 | mm3 | PMID[27117432] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | FC | = | 2.2 | n.a. | PMID[27117432] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | PC50 | = | 0.8 | uM | PMID[27466882] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | IC50 | = | 2100.0 | nM | PMID[17239594] |
| NPT24 | Organism | Human immunodeficiency virus 1 | Human immunodeficiency virus 1 | EC50 | = | 420.0 | nM | PMID[9834179] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/IC50 | = | 36.0 | n.a. | PMID[17239594] |
| NPT2 | Others | Unspecified | n.a. | MIC | = | 69000.0 | nM | PMID[9834179] |
| NPT2 | Others | Unspecified | n.a. | MIC | = | 57000.0 | nM | PMID[9834179] |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 1778.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 1122.0 | nM | PubChem BioAssay data set |
| NPT486 | Organism | Toxoplasma gondii | Toxoplasma gondii | IC50 | = | 586400.0 | nM | PMID[30237124] |
| NPT486 | Organism | Toxoplasma gondii | Toxoplasma gondii | Inhibition | = | 75.9 | % | PMID[30237124] |
| NPT486 | Organism | Toxoplasma gondii | Toxoplasma gondii | Activity | = | 18.4 | % | PMID[30237124] |
| NPT486 | Organism | Toxoplasma gondii | Toxoplasma gondii | IC50 | = | 586400.0 | nM | PMID[38107170] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT486 | Organism | Toxoplasma gondii | Toxoplasma gondii | Survival | = | 16.0 | % | PMID[30237124] |
| NPT486 | Organism | Toxoplasma gondii | Toxoplasma gondii | mortality | = | 10.0 | day | PMID[30237124] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC176814 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 1.0 | High Similarity | NPC300776 |
| 1.0 | High Similarity | NPC4982 |
| 1.0 | High Similarity | NPC606629 |
| 0.8776 | High Similarity | NPC68779 |
| 0.8776 | High Similarity | NPC108598 |
| 0.8491 | Intermediate Similarity | NPC106920 |
| 0.8491 | Intermediate Similarity | NPC15811 |
| 0.8448 | Intermediate Similarity | NPC478703 |
| 0.8448 | Intermediate Similarity | NPC478704 |
| 0.8393 | Intermediate Similarity | NPC282291 |
| 0.8393 | Intermediate Similarity | NPC166137 |
| 0.8113 | Intermediate Similarity | NPC273657 |
| 0.7818 | Intermediate Similarity | NPC5310 |
| 0.7755 | Intermediate Similarity | NPC223807 |
| 0.7627 | Intermediate Similarity | NPC216223 |
| 0.717 | Intermediate Similarity | NPC211386 |
| 0.6957 | Remote Similarity | NPC299706 |
| 0.6957 | Remote Similarity | NPC115466 |
| 0.6957 | Remote Similarity | NPC61604 |
| 0.6833 | Remote Similarity | NPC145569 |
| 0.6825 | Remote Similarity | NPC478705 |
| 0.6786 | Remote Similarity | NPC205915 |
| 0.6452 | Remote Similarity | NPC487679 |
| 0.6452 | Remote Similarity | NPC487678 |
| 0.6441 | Remote Similarity | NPC102908 |
| 0.6429 | Remote Similarity | NPC487680 |
| 0.6415 | Remote Similarity | NPC227217 |
| 0.6415 | Remote Similarity | NPC117780 |
| 0.629 | Remote Similarity | NPC31751 |
| 0.623 | Remote Similarity | NPC100675 |
| 0.623 | Remote Similarity | NPC601691 |
| 0.6182 | Remote Similarity | NPC607444 |
| 0.6071 | Remote Similarity | NPC110958 |
| 0.6071 | Remote Similarity | NPC19890 |
| 0.6066 | Remote Similarity | NPC110699 |
| 0.6066 | Remote Similarity | NPC106055 |
| 0.6038 | Remote Similarity | NPC31344 |
| 0.6038 | Remote Similarity | NPC317769 |
| 0.6038 | Remote Similarity | NPC72796 |
| 0.6 | Remote Similarity | NPC176586 |
| 0.6 | Remote Similarity | NPC210354 |
| 0.5968 | Remote Similarity | NPC293757 |
| 0.5968 | Remote Similarity | NPC668 |
| 0.5902 | Remote Similarity | NPC191158 |
| 0.5902 | Remote Similarity | NPC177644 |
| 0.5873 | Remote Similarity | NPC485282 |
| 0.5873 | Remote Similarity | NPC485283 |
| 0.5873 | Remote Similarity | NPC485281 |
| 0.5811 | Remote Similarity | NPC245615 |
| 0.5797 | Remote Similarity | NPC158635 |
| 0.5797 | Remote Similarity | NPC229882 |
| 0.5714 | Remote Similarity | NPC606339 |
| 0.5692 | Remote Similarity | NPC64201 |
| 0.5625 | Remote Similarity | NPC610284 |
| 0.5606 | Remote Similarity | NPC169973 |
| 0.5522 | Remote Similarity | NPC120852 |
| 0.5522 | Remote Similarity | NPC174512 |
| 0.5424 | Remote Similarity | NPC92693 |
| 0.541 | Remote Similarity | NPC275950 |
| 0.5385 | Remote Similarity | NPC81067 |
| 0.5385 | Remote Similarity | NPC67247 |
| 0.5385 | Remote Similarity | NPC602945 |
| 0.5373 | Remote Similarity | NPC608199 |
| 0.5333 | Remote Similarity | NPC274356 |
| 0.5333 | Remote Similarity | NPC173308 |
| 0.5333 | Remote Similarity | NPC181079 |
| 0.5333 | Remote Similarity | NPC40237 |
| 0.5333 | Remote Similarity | NPC101748 |
| 0.5323 | Remote Similarity | NPC253481 |
| 0.5323 | Remote Similarity | NPC253722 |
| 0.5263 | Remote Similarity | NPC325295 |
| 0.5263 | Remote Similarity | NPC76308 |
| 0.519 | Remote Similarity | NPC486549 |
| 0.519 | Remote Similarity | NPC486548 |
| 0.5125 | Remote Similarity | NPC486546 |
| 0.5094 | Remote Similarity | NPC165133 |
| 0.5094 | Remote Similarity | NPC242885 |
| 0.5094 | Remote Similarity | NPC95614 |
| 0.5094 | Remote Similarity | NPC232316 |
| 0.5079 | Remote Similarity | NPC475875 |
| 0.5077 | Remote Similarity | NPC610652 |
| 0.5075 | Remote Similarity | NPC29599 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC176814 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| NPD |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
