NPASS drugs

Drug Information

Drug ID:	NPD8398
Drug Name:
Molecular Formula:	C44H40BrCl2N3O8
Canonical SMILES:	COc1cc(C(=N[C@H]([C@H](CN(C(=O)CCN2C(=O)c3c(C2=O)cccc3)CCc2ccc(cc2Cl)Cl)O)Cc2cccc(c2)Oc2ccccc2)O)c(cc1OC)Br
Standard InCHI:	InChI=1S/C44H40BrCl2N3O8/c1-56-39-24-34(35(45)25-40(39)57-2)42(53)48-37(22-27-9-8-12-31(21-27)58-30-10-4-3-5-11-30)38(51)26-49(19-17-28-15-16-29(46)23-36(28)47)41(52)18-20-50-43(54)32-13-6-7-14-33(32)44(50)55/h3-16,21,23-25,37-38,51H,17-20,22,26H2,1-2H3,(H,48,53)/t37-,38-/m0/s1
Standard InCHIKey:	DQHKQRXAVNDAFY-UWXQCODUSA-N
Max Developmental Stage:	Clinical (unspecified phase)
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD8398

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	340
0.1-0.2	1586
0.2-0.3	6254
0.3-0.4	7187
0.4-0.5	7454
0.5-0.6	7776
0.6-0.7	293
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6831	NPC82056
Remote Similarity	0.6818	NPC38964
Remote Similarity	0.681	NPC144314
Remote Similarity	0.6781	NPC50548
Remote Similarity	0.6767	NPC149962
Remote Similarity	0.6691	NPC329480
Remote Similarity	0.6682	NPC164608
Remote Similarity	0.6681	NPC123859
Remote Similarity	0.6679	NPC323858
Remote Similarity	0.6653	NPC242728
Remote Similarity	0.6638	NPC276120
Remote Similarity	0.6637	NPC32064
Remote Similarity	0.6623	NPC29531
Remote Similarity	0.6609	NPC473892
Remote Similarity	0.6609	NPC475658
Remote Similarity	0.6603	NPC314743
Remote Similarity	0.6602	NPC213529
Remote Similarity	0.6581	NPC471563
Remote Similarity	0.6553	NPC319774
Remote Similarity	0.6522	NPC138083
Remote Similarity	0.6509	NPC124626
Remote Similarity	0.65	NPC254581
Remote Similarity	0.6494	NPC49172
Remote Similarity	0.6481	NPC64140
Remote Similarity	0.6481	NPC174122
Remote Similarity	0.6446	NPC116701
Remote Similarity	0.6444	NPC475654
Remote Similarity	0.6444	NPC471031
Remote Similarity	0.6444	NPC469689
Remote Similarity	0.6438	NPC234069
Remote Similarity	0.6438	NPC141405
Remote Similarity	0.6438	NPC473409
Remote Similarity	0.6438	NPC82741
Remote Similarity	0.6426	NPC318805
Remote Similarity	0.6426	NPC41122
Remote Similarity	0.6409	NPC3921
Remote Similarity	0.6402	NPC267414
Remote Similarity	0.6387	NPC234318
Remote Similarity	0.6386	NPC313327
Remote Similarity	0.6379	NPC315542
Remote Similarity	0.6379	NPC476202
Remote Similarity	0.6372	NPC150879
Remote Similarity	0.6371	NPC85381
Remote Similarity	0.6356	NPC473716
Remote Similarity	0.6356	NPC475597
Remote Similarity	0.6336	NPC195538
Remote Similarity	0.6336	NPC473562
Remote Similarity	0.6329	NPC94499
Remote Similarity	0.6328	NPC315914
Remote Similarity	0.6327	NPC250846
Remote Similarity	0.6327	NPC268503
Remote Similarity	0.6327	NPC240841
Remote Similarity	0.6327	NPC42549
Remote Similarity	0.6327	NPC317272
Remote Similarity	0.6327	NPC256012
Remote Similarity	0.6325	NPC249996
Remote Similarity	0.6325	NPC471591
Remote Similarity	0.632	NPC329816
Remote Similarity	0.6318	NPC281629
Remote Similarity	0.6314	NPC9482
Remote Similarity	0.6311	NPC475768
Remote Similarity	0.6309	NPC30779
Remote Similarity	0.6303	NPC469721
Remote Similarity	0.6298	NPC162694
Remote Similarity	0.6286	NPC16249
Remote Similarity	0.6281	NPC316164
Remote Similarity	0.6271	NPC283207
Remote Similarity	0.6266	NPC286119
Remote Similarity	0.6261	NPC473941
Remote Similarity	0.6256	NPC90984
Remote Similarity	0.6255	NPC95426
Remote Similarity	0.6255	NPC311357
Remote Similarity	0.6255	NPC16357
Remote Similarity	0.6255	NPC302245
Remote Similarity	0.625	NPC24228
Remote Similarity	0.6245	NPC170101
Remote Similarity	0.6239	NPC233650
Remote Similarity	0.6239	NPC90998
Remote Similarity	0.6239	NPC182052
Remote Similarity	0.6239	NPC54654
Remote Similarity	0.6239	NPC8836
Remote Similarity	0.6239	NPC271013
Remote Similarity	0.6239	NPC7715
Remote Similarity	0.6239	NPC15414
Remote Similarity	0.6239	NPC181796
Remote Similarity	0.6239	NPC251735
Remote Similarity	0.6239	NPC290005
Remote Similarity	0.6239	NPC279228
Remote Similarity	0.6239	NPC229373
Remote Similarity	0.6239	NPC222661
Remote Similarity	0.6239	NPC285931
Remote Similarity	0.6239	NPC223690
Remote Similarity	0.6239	NPC311973
Remote Similarity	0.6239	NPC258657
Remote Similarity	0.6239	NPC217748
Remote Similarity	0.6239	NPC328155
Remote Similarity	0.6239	NPC290582
Remote Similarity	0.6239	NPC49075
Remote Similarity	0.6239	NPC239824
Remote Similarity	0.6239	NPC104196
Remote Similarity	0.6239	NPC42663
Remote Similarity	0.6239	NPC185639
Remote Similarity	0.6234	NPC264938
Remote Similarity	0.6233	NPC247639
Remote Similarity	0.6233	NPC25084
Remote Similarity	0.623	NPC473460
Remote Similarity	0.6229	NPC116465
Remote Similarity	0.6229	NPC212237
Remote Similarity	0.6229	NPC65312
Remote Similarity	0.6229	NPC139783
Remote Similarity	0.6229	NPC230098
Remote Similarity	0.6228	NPC100425
Remote Similarity	0.6226	NPC248903
Remote Similarity	0.6224	NPC46744
Remote Similarity	0.6224	NPC70290
Remote Similarity	0.6224	NPC124302
Remote Similarity	0.6224	NPC14622
Remote Similarity	0.6224	NPC73020
Remote Similarity	0.6224	NPC215098
Remote Similarity	0.6223	NPC99723
Remote Similarity	0.6213	NPC254441
Remote Similarity	0.6213	NPC167116
Remote Similarity	0.6213	NPC274716
Remote Similarity	0.6211	NPC134858
Remote Similarity	0.6211	NPC169743
Remote Similarity	0.6208	NPC33256
Remote Similarity	0.6208	NPC477258
Remote Similarity	0.6207	NPC222524
Remote Similarity	0.6207	NPC35680
Remote Similarity	0.6204	NPC473422
Remote Similarity	0.6203	NPC22115
Remote Similarity	0.6203	NPC208890
Remote Similarity	0.6203	NPC275680
Remote Similarity	0.6196	NPC313627
Remote Similarity	0.6196	NPC148124
Remote Similarity	0.6195	NPC50380
Remote Similarity	0.6195	NPC179250
Remote Similarity	0.6192	NPC24260
Remote Similarity	0.619	NPC2314
Remote Similarity	0.619	NPC329992
Remote Similarity	0.6187	NPC26928
Remote Similarity	0.6184	NPC474858
Remote Similarity	0.6183	NPC469731
Remote Similarity	0.618	NPC475396
Remote Similarity	0.6179	NPC314946
Remote Similarity	0.6179	NPC476500
Remote Similarity	0.6176	NPC206900
Remote Similarity	0.6173	NPC120671
Remote Similarity	0.6173	NPC314100
Remote Similarity	0.6173	NPC226652
Remote Similarity	0.6173	NPC72788
Remote Similarity	0.6169	NPC316292
Remote Similarity	0.6167	NPC478091
Remote Similarity	0.6167	NPC473589
Remote Similarity	0.6167	NPC478092
Remote Similarity	0.6167	NPC30182
Remote Similarity	0.616	NPC470951
Remote Similarity	0.616	NPC169387
Remote Similarity	0.616	NPC477259
Remote Similarity	0.6157	NPC99724
Remote Similarity	0.6157	NPC210140
Remote Similarity	0.6154	NPC314596
Remote Similarity	0.6151	NPC102245
Remote Similarity	0.6147	NPC10908
Remote Similarity	0.6147	NPC317439
Remote Similarity	0.6147	NPC115284
Remote Similarity	0.6147	NPC108434
Remote Similarity	0.6147	NPC317145
Remote Similarity	0.6147	NPC276890
Remote Similarity	0.6147	NPC198498
Remote Similarity	0.6147	NPC225130
Remote Similarity	0.6147	NPC227060
Remote Similarity	0.6147	NPC63646
Remote Similarity	0.6147	NPC76682
Remote Similarity	0.6147	NPC475215
Remote Similarity	0.6145	NPC328287
Remote Similarity	0.614	NPC35345
Remote Similarity	0.6137	NPC293093
Remote Similarity	0.6137	NPC241704
Remote Similarity	0.6134	NPC141440
Remote Similarity	0.6126	NPC328856
Remote Similarity	0.6126	NPC180210
Remote Similarity	0.6126	NPC321226
Remote Similarity	0.6126	NPC314914
Remote Similarity	0.6126	NPC478046
Remote Similarity	0.6126	NPC478047
Remote Similarity	0.6125	NPC478093
Remote Similarity	0.6122	NPC328700
Remote Similarity	0.6122	NPC202771
Remote Similarity	0.6122	NPC2173
Remote Similarity	0.6122	NPC119818
Remote Similarity	0.6121	NPC129518
Remote Similarity	0.6121	NPC41376
Remote Similarity	0.6121	NPC251580
Remote Similarity	0.6121	NPC12424
Remote Similarity	0.6114	NPC329717
Remote Similarity	0.6109	NPC182119
Remote Similarity	0.6109	NPC274661
Remote Similarity	0.6109	NPC48490
Remote Similarity	0.6109	NPC82457

Drug Structure

NPD8398 OpenBabel08211713022D 60 65 0 0 1 0 0 0 0 0999 V2000 6.9282 -6.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -6.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2583 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2583 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3923 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0827 1.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5827 2.0685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5263 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6603 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3923 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5263 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5263 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5827 0.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5827 2.0685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7942 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9282 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7942 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5263 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6603 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5827 0.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0827 1.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 -0.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1962 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0622 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9135 -0.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1045 0.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -3.0000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 5.5000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 2.5000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1215 -1.3849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6386 1.6637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9282 -5.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -6.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6603 -3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -2.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 56 1 0 0 0 0 2 57 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 10 1 0 0 0 0 5 11 2 0 0 0 0 6 7 2 0 0 0 0 6 13 1 0 0 0 0 7 14 1 0 0 0 0 8 9 2 0 0 0 0 8 12 1 0 0 0 0 9 27 1 0 0 0 0 10 30 2 0 0 0 0 11 30 1 0 0 0 0 12 31 2 0 0 0 0 13 32 2 0 0 0 0 14 33 2 0 0 0 0 15 16 2 0 0 0 0 15 28 1 0 0 0 0 16 29 1 0 0 0 0 17 19 1 0 0 0 0 17 28 1 0 0 0 0 18 20 1 0 0 0 0 18 41 1 0 0 0 0 19 49 1 0 0 0 0 20 50 1 0 0 0 0 21 27 2 0 0 0 0 21 31 1 0 0 0 0 22 27 1 0 0 0 0 23 29 2 0 0 0 0 23 36 1 0 0 0 0 24 34 2 0 0 0 0 24 39 1 0 0 0 0 25 35 2 0 0 0 0 25 40 1 0 0 0 0 26 49 1 0 0 0 0 28 36 2 0 0 0 0 29 46 1 0 0 0 0 30 58 1 0 0 0 0 31 58 1 0 0 0 0 32 33 1 0 0 0 0 32 43 1 0 0 0 0 33 44 1 0 0 0 0 34 35 1 0 0 0 0 34 42 1 0 0 0 0 35 45 1 0 0 0 0 36 47 1 0 0 0 0 37 22 1 6 0 0 0 37 38 1 0 0 0 0 37 48 1 0 0 0 0 38 26 1 6 0 0 0 38 51 1 0 0 0 0 39 40 2 0 0 0 0 39 56 1 0 0 0 0 40 57 1 0 0 0 0 41 49 1 0 0 0 0 41 52 2 0 0 0 0 42 48 2 3 0 0 0 42 53 1 0 0 0 0 43 50 1 0 0 0 0 43 54 2 0 0 0 0 44 50 1 0 0 0 0 44 55 2 0 0 0 0 51 59 1 0 0 0 0 53 60 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB018026
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	9876120
ChEBI
CAS Number

Drug Properties

Molecular Weight	887.14
ALogP	0.3594
MLogP	4.76
XLogP	9.822
HDA	8
HBD	2
Rotatable Bonds	25
TPSA	138.2
RO5 Violation	2