NPASS drugs

Drug Information

Drug ID:	NPD3850
Drug Name:
Molecular Formula:	C20H20ClF2N3O3S
Canonical SMILES:	Fc1cc(Cl)c(cc1S(=O)(=O)Nc1ccccc1F)C(=O)N1CCN2[C@@H](C1)CCC2
Standard InCHI:	InChI=1S/C20H20ClF2N3O3S/c21-15-11-17(23)19(30(28,29)24-18-6-2-1-5-16(18)22)10-14(15)20(27)26-9-8-25-7-3-4-13(25)12-26/h1-2,5-6,10-11,13,24H,3-4,7-9,12H2/t13-/m1/s1
Standard InCHIKey:	AGPIHNZOZNKRGT-CYBMUJFWSA-N
Max Developmental Stage:	Clinical (unspecified phase)
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD3850

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	379
0.1-0.2	3565
0.2-0.3	11195
0.3-0.4	12100
0.4-0.5	3068
0.5-0.6	558
0.6-0.7	25
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6667	NPC162417
Remote Similarity	0.6667	NPC316104
Remote Similarity	0.6536	NPC181390
Remote Similarity	0.6529	NPC471164
Remote Similarity	0.6474	NPC313850
Remote Similarity	0.6242	NPC322433
Remote Similarity	0.6209	NPC477887
Remote Similarity	0.6168	NPC209389
Remote Similarity	0.6167	NPC117032
Remote Similarity	0.6154	NPC207428
Remote Similarity	0.6127	NPC469560
Remote Similarity	0.6111	NPC226143
Remote Similarity	0.6098	NPC268534
Remote Similarity	0.6087	NPC476440
Remote Similarity	0.6087	NPC276085
Remote Similarity	0.6082	NPC470205
Remote Similarity	0.6069	NPC122553
Remote Similarity	0.6061	NPC254698
Remote Similarity	0.6057	NPC470301
Remote Similarity	0.6039	NPC473418
Remote Similarity	0.6037	NPC257490
Remote Similarity	0.6033	NPC222029
Remote Similarity	0.6024	NPC192533
Remote Similarity	0.6012	NPC325599
Remote Similarity	0.6	NPC130251
Remote Similarity	0.5978	NPC84317
Remote Similarity	0.5967	NPC473329
Remote Similarity	0.5965	NPC194857
Remote Similarity	0.5965	NPC32858
Remote Similarity	0.5955	NPC136002
Remote Similarity	0.5939	NPC133003
Remote Similarity	0.5934	NPC66936
Remote Similarity	0.5915	NPC291962
Remote Similarity	0.5915	NPC177684
Remote Similarity	0.5914	NPC154478
Remote Similarity	0.5909	NPC207554
Remote Similarity	0.5906	NPC126458
Remote Similarity	0.5904	NPC189116
Remote Similarity	0.5904	NPC138293
Remote Similarity	0.5904	NPC113056
Remote Similarity	0.5901	NPC113099
Remote Similarity	0.5899	NPC478040
Remote Similarity	0.5879	NPC279385
Remote Similarity	0.5879	NPC258531
Remote Similarity	0.5879	NPC179605
Remote Similarity	0.5879	NPC161956
Remote Similarity	0.5879	NPC112373
Remote Similarity	0.5876	NPC471574
Remote Similarity	0.587	NPC295021
Remote Similarity	0.5864	NPC472118
Remote Similarity	0.5862	NPC300299
Remote Similarity	0.5859	NPC316141
Remote Similarity	0.5848	NPC187231
Remote Similarity	0.5846	NPC475094
Remote Similarity	0.5843	NPC103292
Remote Similarity	0.5843	NPC475915
Remote Similarity	0.5842	NPC214960
Remote Similarity	0.5842	NPC279527
Remote Similarity	0.5833	NPC167336
Remote Similarity	0.5829	NPC135601
Remote Similarity	0.5829	NPC471123
Remote Similarity	0.5829	NPC141612
Remote Similarity	0.5829	NPC17273
Remote Similarity	0.5808	NPC21429
Remote Similarity	0.5805	NPC313352
Remote Similarity	0.5803	NPC242269
Remote Similarity	0.5801	NPC324445
Remote Similarity	0.5799	NPC79698
Remote Similarity	0.5787	NPC2823
Remote Similarity	0.5787	NPC301760
Remote Similarity	0.578	NPC473962
Remote Similarity	0.5763	NPC83214
Remote Similarity	0.5759	NPC55529
Remote Similarity	0.5756	NPC473417
Remote Similarity	0.5756	NPC472245
Remote Similarity	0.5751	NPC318183
Remote Similarity	0.5743	NPC324091
Remote Similarity	0.5742	NPC291610
Remote Similarity	0.5741	NPC57051
Remote Similarity	0.573	NPC315051
Remote Similarity	0.5729	NPC63047
Remote Similarity	0.5729	NPC475248
Remote Similarity	0.5722	NPC161861
Remote Similarity	0.5722	NPC469537
Remote Similarity	0.5714	NPC472102
Remote Similarity	0.5714	NPC309531
Remote Similarity	0.5698	NPC22082
Remote Similarity	0.5698	NPC186284
Remote Similarity	0.5698	NPC321053
Remote Similarity	0.5692	NPC470548
Remote Similarity	0.5691	NPC470822
Remote Similarity	0.569	NPC40364
Remote Similarity	0.5689	NPC27833
Remote Similarity	0.5671	NPC218710
Remote Similarity	0.567	NPC292265
Remote Similarity	0.567	NPC355
Remote Similarity	0.5663	NPC220698
Remote Similarity	0.566	NPC172170
Remote Similarity	0.5652	NPC109787
Remote Similarity	0.5652	NPC134657
Remote Similarity	0.5641	NPC177261
Remote Similarity	0.5635	NPC14849
Remote Similarity	0.5625	NPC474473
Remote Similarity	0.5621	NPC39818
Remote Similarity	0.5614	NPC472244
Remote Similarity	0.5614	NPC470343
Remote Similarity	0.5612	NPC328611
Remote Similarity	0.5608	NPC104345
Remote Similarity	0.5608	NPC113946
Remote Similarity	0.5608	NPC61013
Remote Similarity	0.5607	NPC328590
Remote Similarity	0.5607	NPC150863
Remote Similarity	0.5606	NPC147298
Remote Similarity	0.5606	NPC131450
Remote Similarity	0.5606	NPC182057
Remote Similarity	0.5602	NPC176983

Drug Structure

NPD3850 OpenBabel08211704332D 31 34 0 0 1 0 0 0 0 0999 V2000 2.5981 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0827 2.9345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1691 3.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9781 1.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5000 2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5000 2.5981 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0000 -0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 3.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 -1.7321 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.0000 1.7321 0.0000 N 0 0 3 0 0 0 0 0 0 0 0 0 -4.0000 1.7321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.5000 2.5981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 5 1 0 0 0 0 2 6 1 0 0 0 0 3 4 1 0 0 0 0 3 7 1 0 0 0 0 4 13 1 0 0 0 0 5 16 2 0 0 0 0 6 18 2 0 0 0 0 7 25 1 0 0 0 0 8 9 1 0 0 0 0 8 25 1 0 0 0 0 9 26 1 0 0 0 0 10 14 2 0 0 0 0 10 19 1 0 0 0 0 11 15 2 0 0 0 0 11 17 1 0 0 0 0 12 13 1 0 0 0 0 12 26 1 0 0 0 0 13 25 1 6 0 0 0 14 15 1 0 0 0 0 14 20 1 0 0 0 0 15 21 1 0 0 0 0 16 18 1 0 0 0 0 16 22 1 0 0 0 0 17 19 2 0 0 0 0 17 23 1 0 0 0 0 18 24 1 0 0 0 0 19 30 1 0 0 0 0 20 26 1 0 0 0 0 20 27 2 0 0 0 0 24 30 1 0 0 0 0 24 31 1 0 0 0 0 28 30 2 0 0 0 0 29 30 2 0 0 0 0 M END $$$$

External Identifiers

TTD	DNCL002937
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	46851313
ChEBI
CAS Number

Drug Properties

Molecular Weight	455.09
ALogP	-0.4344
MLogP	2.56
XLogP	2.971
HDA	6
HBD	1
Rotatable Bonds	8
TPSA	78.1
RO5 Violation	0