NPASS drugs

Drug Information

Drug ID:	NPD3513
Drug Name:	Benfotiamine
Molecular Formula:	C19H23N4O6PS
Canonical SMILES:	O=CN(/C(=C(/SC(=O)c1ccccc1)CCOP(=O)(O)O)/C)Cc1cnc([nH]c1=N)C
Standard InCHI:	InChI=1S/C19H23N4O6PS/c1-13(23(12-24)11-16-10-21-14(2)22-18(16)20)17(8-9-29-30(26,27)28)31-19(25)15-6-4-3-5-7-15/h3-7,10,12H,8-9,11H2,1-2H3,(H2,20,21,22)(H2,26,27,28)/b17-13+
Standard InCHIKey:	BTNNPSLJPBRMLZ-GHRIWEEISA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD3513

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	96
0.1-0.2	1813
0.2-0.3	9046
0.3-0.4	13632
0.4-0.5	5643
0.5-0.6	623
0.6-0.7	37
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6627	NPC84317
Remote Similarity	0.6558	NPC207428
Remote Similarity	0.6548	NPC154478
Remote Similarity	0.6442	NPC324445
Remote Similarity	0.6364	NPC313722
Remote Similarity	0.6335	NPC2823
Remote Similarity	0.6329	NPC300299
Remote Similarity	0.6312	NPC473498
Remote Similarity	0.6286	NPC275467
Remote Similarity	0.6207	NPC475013
Remote Similarity	0.6197	NPC471447
Remote Similarity	0.6159	NPC27833
Remote Similarity	0.6149	NPC138293
Remote Similarity	0.6149	NPC132636
Remote Similarity	0.6149	NPC113056
Remote Similarity	0.6139	NPC32858
Remote Similarity	0.6139	NPC194857
Remote Similarity	0.6139	NPC325479
Remote Similarity	0.6136	NPC66490
Remote Similarity	0.6122	NPC476048
Remote Similarity	0.6111	NPC83214
Remote Similarity	0.6108	NPC13470
Remote Similarity	0.6107	NPC239357
Remote Similarity	0.6084	NPC45033
Remote Similarity	0.6081	NPC33742
Remote Similarity	0.6077	NPC182057
Remote Similarity	0.6077	NPC147298
Remote Similarity	0.6077	NPC131450
Remote Similarity	0.6059	NPC117032
Remote Similarity	0.6058	NPC256452
Remote Similarity	0.6026	NPC220698
Remote Similarity	0.6026	NPC477937
Remote Similarity	0.6025	NPC314835
Remote Similarity	0.6023	NPC295021
Remote Similarity	0.6022	NPC14849
Remote Similarity	0.6014	NPC143516
Remote Similarity	0.6	NPC248862
Remote Similarity	0.5988	NPC311658
Remote Similarity	0.5972	NPC130898
Remote Similarity	0.5972	NPC474804
Remote Similarity	0.5972	NPC474973
Remote Similarity	0.5964	NPC471680
Remote Similarity	0.5932	NPC471130
Remote Similarity	0.5928	NPC314114
Remote Similarity	0.592	NPC24617
Remote Similarity	0.5912	NPC328611
Remote Similarity	0.5909	NPC88970
Remote Similarity	0.5886	NPC114806
Remote Similarity	0.5879	NPC207554
Remote Similarity	0.5878	NPC275410
Remote Similarity	0.5844	NPC302169
Remote Similarity	0.5833	NPC477163
Remote Similarity	0.5806	NPC71684
Remote Similarity	0.58	NPC276949
Remote Similarity	0.58	NPC35850
Remote Similarity	0.5799	NPC119569
Remote Similarity	0.5796	NPC22746
Remote Similarity	0.5793	NPC167336
Remote Similarity	0.5789	NPC315276
Remote Similarity	0.5789	NPC14672
Remote Similarity	0.5789	NPC285926
Remote Similarity	0.5787	NPC189116
Remote Similarity	0.5784	NPC153554
Remote Similarity	0.5782	NPC473676
Remote Similarity	0.578	NPC473002
Remote Similarity	0.5765	NPC105717
Remote Similarity	0.5759	NPC101719
Remote Similarity	0.5756	NPC300443
Remote Similarity	0.5752	NPC470545
Remote Similarity	0.575	NPC111428
Remote Similarity	0.5749	NPC468984
Remote Similarity	0.5747	NPC469903
Remote Similarity	0.5745	NPC472258
Remote Similarity	0.5742	NPC200964
Remote Similarity	0.5741	NPC40364
Remote Similarity	0.574	NPC473804
Remote Similarity	0.574	NPC136002
Remote Similarity	0.5732	NPC474082
Remote Similarity	0.5732	NPC175726
Remote Similarity	0.5731	NPC283783
Remote Similarity	0.5723	NPC322433
Remote Similarity	0.5714	NPC470546
Remote Similarity	0.5714	NPC472245
Remote Similarity	0.5714	NPC300315
Remote Similarity	0.5714	NPC179224
Remote Similarity	0.5707	NPC471195
Remote Similarity	0.5707	NPC471196
Remote Similarity	0.5706	NPC313850
Remote Similarity	0.5706	NPC469901
Remote Similarity	0.5696	NPC222466
Remote Similarity	0.5691	NPC21429
Remote Similarity	0.5686	NPC470544
Remote Similarity	0.5683	NPC473661
Remote Similarity	0.568	NPC478040
Remote Similarity	0.5679	NPC126458
Remote Similarity	0.5672	NPC471155
Remote Similarity	0.5671	NPC162417
Remote Similarity	0.5671	NPC316104
Remote Similarity	0.5663	NPC89489
Remote Similarity	0.5663	NPC122553
Remote Similarity	0.5663	NPC77992
Remote Similarity	0.5662	NPC53492
Remote Similarity	0.566	NPC474479
Remote Similarity	0.5657	NPC473580
Remote Similarity	0.5652	NPC150863
Remote Similarity	0.5644	NPC270241
Remote Similarity	0.5643	NPC71140
Remote Similarity	0.5643	NPC474974
Remote Similarity	0.5641	NPC179605
Remote Similarity	0.5641	NPC279385
Remote Similarity	0.5638	NPC470127
Remote Similarity	0.5633	NPC6975
Remote Similarity	0.5632	NPC286551
Remote Similarity	0.5629	NPC474584
Remote Similarity	0.5622	NPC225400
Remote Similarity	0.5618	NPC469243
Remote Similarity	0.5618	NPC473003
Remote Similarity	0.5618	NPC475544
Remote Similarity	0.5618	NPC469902
Remote Similarity	0.5615	NPC88110
Remote Similarity	0.5605	NPC103292
Remote Similarity	0.5604	NPC280022
Remote Similarity	0.5604	NPC315388
Remote Similarity	0.5602	NPC43755

Drug Structure

NPD3513 OpenBabel08211703112D 35 36 0 0 0 0 0 0 0 0999 V2000 3.4641 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9282 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9282 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -4.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -4.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -2.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -1.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -2.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 13 1 0 0 0 0 2 14 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 7 2 0 0 0 0 6 15 2 0 0 0 0 7 15 1 0 0 0 0 8 9 1 0 0 0 0 8 17 1 0 0 0 0 9 29 1 0 0 0 0 10 16 2 0 0 0 0 10 21 1 0 0 0 0 11 16 1 0 0 0 0 11 23 1 0 0 0 0 12 23 1 0 0 0 0 12 24 2 0 0 0 0 13 17 2 0 0 0 0 13 23 1 0 0 0 0 14 21 2 0 0 0 0 14 22 1 0 0 0 0 15 19 1 0 0 0 0 16 18 1 0 0 0 0 17 31 1 0 0 0 0 18 20 2 0 0 0 0 18 22 1 0 0 0 0 19 25 2 0 0 0 0 19 31 1 0 0 0 0 20 32 1 0 0 0 0 22 33 1 0 0 0 0 26 30 1 0 0 0 0 26 34 1 0 0 0 0 27 30 1 0 0 0 0 27 35 1 0 0 0 0 28 30 2 0 0 0 0 29 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	466.11
ALogP	-2.1197
MLogP	2.23
XLogP	0.969
HDA	10
HBD	4
Rotatable Bonds	15
TPSA	187.49
RO5 Violation	1