Drug Information| Drug ID:   | NPD3201 |
| Drug Name:   | Kanamycin Sulfate |
| Molecular Formula:   | C18H36N4O11.H2O4S |
| Canonical SMILES:   | OS(=O)(=O)O.OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@@H]([C@H]([C@@H]2O)O[C@H]2O[C@H](CN)[C@H]([C@@H]([C@H]2O)O)O)N)[C@@H]([C@H]([C@@H]1O)N)O |
| Standard InCHI:   | "InChI=1S/C18H36N4O11.H2O4S/c19-2-6-10(25)12(27)13(28)18(30-6)33-16-5(21)1-4(20)15(14(16)29)32-17-11(26)8(22)9(24)7(3-23)31-17;1-5(2,3)4/h4-18,23-29H,1-3,19-22H2;(H2,1,2,3,4)/t4-,5+,6-,7-,8+,9-,10-,11-,12+,13-,14-,15+,16-,17-,18-;/m1./s1" |
| Standard InCHIKey:   | OOYGSFOGFJDDHP-KMCOLRRFSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD3201Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC477060 |
| High Similarity | 1.0 | NPC506438 |
| High Similarity | 1.0 | NPC608466 |
| High Similarity | 0.902 | NPC43850 |
| High Similarity | 0.902 | NPC485811 |
| High Similarity | 0.902 | NPC505645 |
| High Similarity | 0.902 | NPC599806 |
| Intermediate Similarity | 0.7333 | NPC607776 |
| Remote Similarity | 0.65 | NPC552868 |
| Remote Similarity | 0.65 | NPC611754 |
| Remote Similarity | 0.5972 | NPC330590 |
| Remote Similarity | 0.5972 | NPC612045 |
| Remote Similarity | 0.5968 | NPC314408 |
| Remote Similarity | 0.5968 | NPC611979 |
| Remote Similarity | 0.5738 | NPC509178 |
| Remote Similarity | 0.5738 | NPC539096 |
| Remote Similarity | 0.5738 | NPC581607 |
| Remote Similarity | 0.5714 | NPC552436 |
| Remote Similarity | 0.5455 | NPC605029 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 484.24 |
| ALogP   | -7.4937 |
| MLogP   | 1.79 |
| XLogP   | -5.486 |
| HDA   | 15 |
| HBD   | 11 |
| Rotatable Bonds   | 17 |
| TPSA   | 282.61 |
| RO5 Violation   | 2 |