Drug Information| Drug ID:   | NPD223 |
| Drug Name:   | |
| Molecular Formula:   | C10H12N4O6S |
| Canonical SMILES:   | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1c(=O)sc2c1[nH]c(=N)nc2O |
| Standard InCHI:   | "InChI=1S/C10H12N4O6S/c11-9-12-6-5(7(18)13-9)21-10(19)14(6)8-4(17)3(16)2(1-15)20-8/h2-4,8,15-17H,1H2,(H3,11,12,13,18)/t2-,3-,4-,8-/m1/s1" |
| Standard InCHIKey:   | TZYVRXZQAWPIAB-FCLHUMLKSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD223Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 316.05 |
| ALogP   | -1.7239 |
| MLogP   | 1.35 |
| XLogP   | -1.44 |
| HDA   | 10 |
| HBD   | 6 |
| Rotatable Bonds   | 6 |
| TPSA   | 184 |
| RO5 Violation   | 1 |