NPASS Compound

Natural Product: NPC83569

Natural Product ID	NPC83569
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Dehydrotrametenonic Acid
IUPAC Name	6-methyl-2-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]hept-5-enoic acid
Synonyms	Dehydrotrametenonic Acid; Dehydrotrametenonicacid
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL226528
PubChem CID	44424826
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 77 80 0 0 0 0 0 0 0 0999 V2000 7.7722 0.0174 0.8664 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7574 1.0746 0.6580 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7910 0.9056 -0.2140 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7164 -0.3547 -0.9959 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4194 -1.0223 -0.7114 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1887 -0.1716 -1.0584 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9948 -1.0080 -0.7034 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1247 -1.3576 0.8044 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7221 -1.5185 1.3242 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1440 -1.2802 0.1299 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6892 -0.2797 -0.6419 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7733 0.9934 0.1715 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0122 -0.0091 -1.9137 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4231 0.4402 -1.6596 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1068 0.1375 -0.5693 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4440 -0.6796 0.4326 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0482 -0.8542 1.6090 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3795 -0.2380 1.9077 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1803 -0.2904 0.5925 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4967 0.6257 -0.3475 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3081 2.0375 0.2340 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2208 0.8252 -1.6492 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6407 1.2484 -1.4420 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3146 0.5221 -0.3699 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5438 0.4049 -0.3904 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6268 -0.1138 0.7896 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2789 -1.5011 0.9142 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9480 0.6081 2.0804 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4025 -2.5544 -0.6430 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2972 0.1005 -2.4976 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5690 -0.4521 -3.3402 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2388 1.0054 -2.9523 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8191 2.3417 1.4335 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5238 0.3177 1.6383 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2766 -0.1962 -0.1069 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2747 -0.8912 1.2564 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0294 1.6937 -0.3748 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5207 -1.0586 -0.6094 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9337 -0.2256 -2.0776 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3630 -1.9820 -1.2444 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4094 -1.2691 0.3794 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2288 0.7546 -0.4431 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9242 -1.8781 -1.3330 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6188 -0.5377 1.3276 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7281 -2.2817 0.9142 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4974 -0.8485 2.1770 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5873 -2.5711 1.6456 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4353 1.7076 -0.3926 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1650 0.8682 1.1787 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2145 1.4611 0.2488 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0081 -0.8363 -2.6226 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4683 0.8862 -2.4004 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8818 1.0401 -2.4275 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5329 -1.4585 2.3314 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3244 0.7588 2.3344 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8973 -0.9417 2.5977 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9779 -1.3383 0.2147 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8755 2.6181 -0.6368 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2556 2.5290 0.4554 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5391 2.0769 1.0053 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7233 1.7194 -2.1399 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1837 -0.0370 -2.3245 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7481 2.3367 -1.2444 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2278 1.0749 -2.3912 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1272 -1.8883 1.9339 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6705 -2.1683 0.2367 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3258 -1.4874 0.5830 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0161 -0.1583 2.8969 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2547 1.4146 2.3201 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0067 0.9771 1.9637 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8650 -2.3646 -1.6089 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1362 -3.1320 -0.0242 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4725 -3.1892 -0.7715 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6089 0.8871 -3.9023 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0507 2.3094 2.2451 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4830 3.1673 0.7446 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8219 2.5380 1.8569 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 11 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 2 0 24 26 1 0 26 27 1 0 26 28 1 0 10 29 1 6 6 30 1 0 30 31 2 0 30 32 1 0 2 33 1 0 11 7 1 0 20 15 1 0 16 10 1 0 26 19 1 0 1 34 1 0 1 35 1 0 1 36 1 0 3 37 1 0 4 38 1 0 4 39 1 0 5 40 1 0 5 41 1 0 6 42 1 0 7 43 1 6 8 44 1 0 8 45 1 0 9 46 1 0 9 47 1 0 12 48 1 0 12 49 1 0 12 50 1 0 13 51 1 0 13 52 1 0 14 53 1 0 17 54 1 0 18 55 1 0 18 56 1 0 19 57 1 6 21 58 1 0 21 59 1 0 21 60 1 0 22 61 1 0 22 62 1 0 23 63 1 0 23 64 1 0 27 65 1 0 27 66 1 0 27 67 1 0 28 68 1 0 28 69 1 0 28 70 1 0 29 71 1 0 29 72 1 0 29 73 1 0 32 74 1 0 33 75 1 0 33 76 1 0 33 77 1 0 M END

Standard InCHIKey	PLNOCPRTFZIBRT-DBAPKEHCSA-N
Standard InCHI	InChI=1S/C30H44O3/c1-19(2)9-8-10-20(26(32)33)21-13-17-30(7)23-11-12-24-27(3,4)25(31)15-16-28(24,5)22(23)14-18-29(21,30)6/h9,11,14,20-21,24H,8,10,12-13,15-18H2,1-7H3,(H,32,33)/t20?,21-,24+,28-,29-,30+/m1/s1
SMILES	CC(=CCCC([C@H]1CC[C@@]2([C@]1(C)CC=C1C2=CC[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)C(=O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	452.33	Volume:	506.399 ? Van der Waals volume.
Dense:	0.893	LogP:	5.454 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.019 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.397 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	5.0	Rigid Bonds:	23.0
TPSA:	54.37 ? Topological Polar Surface Area.	H-Bond Acceptor:	3.0
H-Bond Donor:	1.0	Rings:	4.0
Heavy Atoms:	3.0

MedChem Properties

QED Drug-Likeness Score:	0.439	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.798	Fsp³:	0.733
MCE-18:	78.769 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.899	Fluc inhibitor:	0.004 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.021 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.014 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.59	Promiscuous compounds:	0.012

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.672	MDCK Permeability:	-4.714
Pgp-inhibitor:	0.314	Pgp-substrate:	0.0
PAMPA:	0.894 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.008	30% Bioavailability (F30%):	0.004
50% Bioavailability (F50%):	0.723

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.153	MRP1:	0.992
Plasma Protein Binding (PPB):	90.599%	Volume Distribution (VD):	-0.061
Fu:	9.708% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.114
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.349	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.05	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.865
HLM stability:	0.01 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

7.103

Half-life (T1/2):

0.428

ADMET: Toxicity

hERG Blockers:	0.066	hERG Blockers (10um):	0.157
Human Hepatotoxicity (H-HT):	0.681	Drug-induced Liver Injury (DILI):	0.235
AMES Toxicity:	0.116	Rat Oral Acute Toxicity:	0.267
Maximum Recommended Daily Dose:	0.427	Skin Sensitization:	0.863
Carcinogencity:	0.649	Eye Corrosion:	0.05
Eye Irritation:	0.679	Respiratory Toxicity:	0.57
Drug-induced Neurotoxicity:	0.311	Ototoxicity:	0.557
Hematotoxicity:	0.432	Drug-induced Nephrotoxicity:	0.707
Genotoxicity:	0.551	RPMI-8226 Immunitoxicity:	0.079
A549 Cytotoxicity:	0.1	Hek293 Cytotoxicity:	0.221
BCF:	1.322 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.247 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.644 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.023 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11975480]
NPO33546	Poria coco	Species	n.a.	Eukaryota	n.a.	Yunnan, Kunming, China	n.a.	PMID[17488130]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	epidermis of the sclerotia	n.a.	n.a.	PMID[19746919]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[27808511]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8984162]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2
Inhibition	4
Activity	1

Activity Type	# Activity
Individual protein	1
Cell line	2
Organism	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1044	Individual protein	DNA topoisomerase II alpha	Homo sapiens	IC50	=	37500.0	nM	PMID[23092389]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT80	Cell line	Raji	Homo sapiens	Activity	=	310.0	%	PMID[17488130]
NPT2477	Cell line	NUGC-3	Homo sapiens	IC50	=	63600.0	nM	PMID[23092389]
NPT164	Organism	Human herpesvirus 4	Human herpesvirus 4	Inhibition	=	0.0	%	PMID[17488130]
NPT164	Organism	Human herpesvirus 4	Human herpesvirus 4	Inhibition	=	30.1	%	PMID[17488130]
NPT164	Organism	Human herpesvirus 4	Human herpesvirus 4	Inhibition	=	71.0	%	PMID[17488130]
NPT164	Organism	Human herpesvirus 4	Human herpesvirus 4	Inhibition	=	94.2	%	PMID[17488130]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC83569 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26624
0.1-0.2	20931
0.2-0.3	2018
0.3-0.4	210
0.4-0.5	46
0.5-0.6	15
0.6-0.7	10
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8033	Intermediate Similarity	NPC69279
0.7077	Intermediate Similarity	NPC66429
0.6769	Remote Similarity	NPC84271
0.6769	Remote Similarity	NPC102414
0.6719	Remote Similarity	NPC201912
0.6719	Remote Similarity	NPC38350
0.6719	Remote Similarity	NPC601139
0.6716	Remote Similarity	NPC608955
0.6418	Remote Similarity	NPC87552
0.6269	Remote Similarity	NPC147066
0.6212	Remote Similarity	NPC196827
0.6	Remote Similarity	NPC469406
0.5909	Remote Similarity	NPC170793
0.5735	Remote Similarity	NPC4166
0.5735	Remote Similarity	NPC311092
0.5694	Remote Similarity	NPC152897
0.5616	Remote Similarity	NPC155676
0.5541	Remote Similarity	NPC478312
0.5507	Remote Similarity	NPC89077
0.5429	Remote Similarity	NPC470048
0.5417	Remote Similarity	NPC77168
0.5278	Remote Similarity	NPC44181
0.5278	Remote Similarity	NPC606857
0.527	Remote Similarity	NPC96496
0.5132	Remote Similarity	NPC285702
0.5132	Remote Similarity	NPC166745
0.5132	Remote Similarity	NPC235464

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC83569 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6816
0.1-0.2	2272
0.2-0.3	61
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data