NPASS Compound

Natural Product: NPC152897

Natural Product ID	NPC152897
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Polyporenic Acid B
IUPAC Name	(2R)-2-[(5R,10S,13R,14R,16R,17R)-16-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL461276
PubChem CID	9805290
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001445] Bile acids, alcohols and derivatives [CHEMONTID:0002194] Hydroxy bile acids, alcohols and derivatives [CHEMONTID:0000260] Monohydroxy bile acids, alcohols and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 81 84 0 0 0 0 0 0 0 0999 V2000 6.9096 0.8575 0.3286 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8855 1.7301 -0.3432 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4906 3.0773 -0.5985 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3412 1.1359 -1.5892 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4479 1.8229 -2.7162 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6807 -0.2079 -1.5998 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4610 -0.1882 -0.6573 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8166 -1.5285 -0.6797 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6313 -1.7400 0.1616 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8005 -1.5555 1.6470 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3695 -1.2753 2.1497 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4978 -1.4837 0.9324 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6702 -2.9768 0.7563 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7616 -0.7574 0.9017 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5880 -0.6987 1.9268 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8860 0.0335 1.9211 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3987 -0.0104 0.4924 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8108 0.3564 0.3166 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6543 -0.8638 0.7226 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3084 1.5266 1.0858 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1224 0.5879 -1.1183 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0373 0.0678 -1.7264 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2409 1.5281 -1.8523 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8335 1.0083 -1.7474 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3870 0.7561 -0.3240 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1065 2.1214 0.2603 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1467 -0.0570 -0.3260 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3867 -0.1509 -1.4280 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1366 -0.9493 -1.4756 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4422 -0.8752 -0.1059 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6034 0.5652 0.2850 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2772 -2.7188 2.2597 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8677 -2.5134 -0.2974 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2302 -3.4779 -0.9971 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4858 -2.3368 0.9305 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8845 0.8606 -0.1862 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0913 1.3129 1.3422 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5399 -0.1666 0.5462 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0412 1.8534 0.3793 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8740 3.4661 0.3807 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3628 3.0190 -1.2648 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7502 3.8100 -0.9791 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0683 1.4435 -3.6684 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9152 2.7830 -2.7297 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3975 -0.9780 -1.3153 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3369 -0.4277 -2.6305 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8262 0.6178 -1.0927 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8437 0.1360 0.3148 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6197 -1.7637 -1.7741 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2474 -2.8056 0.0550 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4078 -0.6797 1.8803 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2805 -0.2909 2.5966 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1325 -2.0334 2.9221 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0258 -3.5682 1.4370 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6855 -3.3094 -0.2819 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7165 -3.1842 1.1383 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3099 -1.2121 2.8311 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8387 1.0325 2.3471 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5918 -0.5664 2.5313 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2820 -1.0891 0.1793 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0919 -1.7492 0.3602 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6481 -0.8282 0.2665 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6909 -0.9457 1.8343 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8589 1.6813 2.0658 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4092 1.3537 1.2803 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3109 2.4422 0.4353 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3396 2.5605 -1.4370 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4825 1.5708 -2.9363 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7689 0.0626 -2.3048 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1255 1.7971 -2.1366 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9310 2.8803 -0.5332 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2343 2.1483 0.9363 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9574 2.5061 0.8582 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7233 0.3809 -2.2914 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3105 -1.9783 -1.8479 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6017 -0.4981 -2.1759 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5135 0.7974 0.8581 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5760 1.2588 -0.5812 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2383 0.9083 0.9489 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1961 -2.5695 3.2387 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2969 -2.8488 1.2351 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 2 0 4 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 6 12 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 18 21 1 0 21 22 2 0 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 25 27 1 0 27 28 2 0 28 29 1 0 29 30 1 0 30 31 1 1 10 32 1 0 8 33 1 0 33 34 2 0 33 35 1 0 30 9 1 0 30 12 1 0 27 14 1 0 25 17 1 0 1 36 1 0 1 37 1 0 1 38 1 0 2 39 1 0 3 40 1 0 3 41 1 0 3 42 1 0 5 43 1 0 5 44 1 0 6 45 1 0 6 46 1 0 7 47 1 0 7 48 1 0 8 49 1 6 9 50 1 1 10 51 1 6 11 52 1 0 11 53 1 0 13 54 1 0 13 55 1 0 13 56 1 0 15 57 1 0 16 58 1 0 16 59 1 0 17 60 1 6 19 61 1 0 19 62 1 0 19 63 1 0 20 64 1 0 20 65 1 0 20 66 1 0 23 67 1 0 23 68 1 0 24 69 1 0 24 70 1 0 26 71 1 0 26 72 1 0 26 73 1 0 28 74 1 0 29 75 1 0 29 76 1 0 31 77 1 0 31 78 1 0 31 79 1 0 32 80 1 0 35 81 1 0 M END

Standard InCHIKey	KPKYWYZPIVAHKU-WMNQUVFJSA-N
Standard InCHI	InChI=1S/C31H46O4/c1-18(2)19(3)9-10-20(27(34)35)26-23(32)17-31(8)22-11-12-24-28(4,5)25(33)14-15-29(24,6)21(22)13-16-30(26,31)7/h11,13,18,20,23-24,26,32H,3,9-10,12,14-17H2,1-2,4-8H3,(H,34,35)/t20-,23-,24+,26+,29-,30-,31+/m1/s1
SMILES	CC(C)C(=C)CC[C@H]([C@H]1[C@@H](C[C@@]2(C)C3=CC[C@H]4C(C)(C)C(=O)CC[C@]4(C)C3=CC[C@]12C)O)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	482.34	Volume:	532.485 ? Van der Waals volume.
Dense:	0.906	LogP:	3.83 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.021 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.009 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	6.0	Rigid Bonds:	23.0
TPSA:	74.6 ? Topological Polar Surface Area.	H-Bond Acceptor:	4.0
H-Bond Donor:	2.0	Rings:	4.0
Heavy Atoms:	4.0

MedChem Properties

QED Drug-Likeness Score:	0.411	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.087	Fsp³:	0.742
MCE-18:	83.111 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.896	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.056 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.003 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.361	Promiscuous compounds:	0.09

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.454	MDCK Permeability:	-4.982
Pgp-inhibitor:	0.011	Pgp-substrate:	0.0
PAMPA:	0.923 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.006	30% Bioavailability (F30%):	0.006
50% Bioavailability (F50%):	0.962

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003	MRP1:	0.999
Plasma Protein Binding (PPB):	90.086%	Volume Distribution (VD):	-0.033
Fu:	11.978% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.047
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.008
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.415
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.254 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.844

Half-life (T1/2):

0.72

ADMET: Toxicity

hERG Blockers:	0.026	hERG Blockers (10um):	0.099
Human Hepatotoxicity (H-HT):	0.512	Drug-induced Liver Injury (DILI):	0.179
AMES Toxicity:	0.157	Rat Oral Acute Toxicity:	0.368
Maximum Recommended Daily Dose:	0.256	Skin Sensitization:	0.907
Carcinogencity:	0.536	Eye Corrosion:	0.011
Eye Irritation:	0.272	Respiratory Toxicity:	0.504
Drug-induced Neurotoxicity:	0.216	Ototoxicity:	0.672
Hematotoxicity:	0.556	Drug-induced Nephrotoxicity:	0.831
Genotoxicity:	0.855	RPMI-8226 Immunitoxicity:	0.1
A549 Cytotoxicity:	0.056	Hek293 Cytotoxicity:	0.119
BCF:	0.627 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.467 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.179 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.304 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO21659	Daedalea quercina	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11014261]
NPO8228	Piptoporus betulinus	Species	Fomitopsidaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11099232]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11975480]
NPO8228	Piptoporus betulinus	Species	Fomitopsidaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12932134]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	epidermis of the sclerotia	n.a.	n.a.	PMID[19746919]
NPO40022	Antrodia heteromorpha	Species	Fomitopsidaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[27266877]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[27808511]
NPO20918	Pseudotsuga menziesii	Species	Pinaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[34216094]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8984162]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20918	Pseudotsuga menziesii	Species	Pinaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6117	Poria	Species	Coccinellidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8228	Piptoporus betulinus	Species	Fomitopsidaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13371	Paepalanthus ramosus	Species	Eriocaulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO22868	Pulsatilla dahurica	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21659	Daedalea quercina	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20795	Melicope melanophloia	Species	Rutaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21268	Heliotropium ramosissimum	Species	Heliotropiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO21268	Heliotropium ramosissimum	Species	Heliotropiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO6117	Poria	Species	Coccinellidae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO22868	Pulsatilla dahurica	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO20918	Pseudotsuga menziesii	Species	Pinaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO18205	Brevibacterium iodinum	Species	Brevibacteriaceae	Bacteria	n.a.	n.a.	n.a.	Database[UNPD]
NPO20036	Mallotus pallidus	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13371	Paepalanthus ramosus	Species	Eriocaulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO22868	Pulsatilla dahurica	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO21659	Daedalea quercina	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO25850	Urochloa ruziziensis	Species	Poaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO21268	Heliotropium ramosissimum	Species	Heliotropiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO20795	Melicope melanophloia	Species	Rutaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO23577	Wolfiporia cocos	Species	Coriolaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	5
IC50	5
Inhibition	2

Activity Type	# Activity
Cell line	6
Organism	2
Others	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT80	Cell line	Raji	Homo sapiens	Activity	=	70.0	%	PMID[11975480]
NPT81	Cell line	A549	Homo sapiens	IC50	=	19800.0	nM	PMID[23092389]
NPT111	Cell line	K562	Homo sapiens	IC50	=	26300.0	nM	PMID[27808511]
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	31800.0	nM	PMID[27808511]
NPT404	Cell line	CCRF-CEM	Homo sapiens	IC50	=	25500.0	nM	PMID[27808511]
NPT112	Cell line	MOLT-4	Homo sapiens	IC50	=	27600.0	nM	PMID[27808511]
NPT2	Others	Unspecified	n.a.	Activity	=	0.0	%	PMID[11975480]
NPT2	Others	Unspecified	n.a.	Activity	=	26.3	%	PMID[11975480]
NPT2	Others	Unspecified	n.a.	Activity	=	68.7	%	PMID[11975480]
NPT2	Others	Unspecified	n.a.	Activity	=	92.6	%	PMID[11975480]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT32	Organism	Mus musculus	Mus musculus	Inhibition	=	49.0	%	PMID[12932134]
NPT32	Organism	Mus musculus	Mus musculus	Inhibition	=	83.0	%	PMID[23092389]

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC152897 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	18207
0.1-0.2	27913
0.2-0.3	3384
0.3-0.4	268
0.4-0.5	51
0.5-0.6	18
0.6-0.7	7
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8594	High Similarity	NPC155676
0.8462	Intermediate Similarity	NPC263347
0.8125	Intermediate Similarity	NPC66429
0.7313	Intermediate Similarity	NPC45324
0.7313	Intermediate Similarity	NPC162001
0.7164	Intermediate Similarity	NPC69279
0.7101	Intermediate Similarity	NPC484967
0.7042	Intermediate Similarity	NPC288464
0.7042	Intermediate Similarity	NPC477813
0.7042	Intermediate Similarity	NPC607198
0.6714	Remote Similarity	NPC484966
0.6667	Remote Similarity	NPC54689
0.662	Remote Similarity	NPC123854
0.6429	Remote Similarity	NPC48866
0.625	Remote Similarity	NPC484975
0.625	Remote Similarity	NPC186810
0.625	Remote Similarity	NPC321301
0.5946	Remote Similarity	NPC484968
0.5833	Remote Similarity	NPC222845
0.5833	Remote Similarity	NPC296577
0.5714	Remote Similarity	NPC484969
0.5694	Remote Similarity	NPC83569
0.5676	Remote Similarity	NPC243866
0.5658	Remote Similarity	NPC7165
0.56	Remote Similarity	NPC48647
0.5467	Remote Similarity	NPC45269
0.5467	Remote Similarity	NPC77168
0.5443	Remote Similarity	NPC469432
0.5395	Remote Similarity	NPC477812
0.52	Remote Similarity	NPC247406
0.519	Remote Similarity	NPC478312
0.5135	Remote Similarity	NPC89077
0.5132	Remote Similarity	NPC87552
0.5065	Remote Similarity	NPC206810
0.5065	Remote Similarity	NPC203035

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC152897 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5826
0.1-0.2	3205
0.2-0.3	119
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data