NPASS Compound

Natural Product: NPC61160

Natural Product ID	NPC61160
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	RSZMIQZFBLGYLQ-QWHYFGCJSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	101677163
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000238] Tannins [CHEMONTID:0001710] Hydrolyzable tannins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 175188 0 0 0 0 0 0 0 0999 V2000 10.7228 7.1129 0.1135 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8012 6.2960 -0.5210 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4142 6.5461 -1.7995 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9394 7.6352 -2.4927 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8585 8.4444 -1.8480 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2588 8.1938 -0.5445 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1781 9.0085 0.0887 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3793 9.5321 -2.5443 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5436 7.8901 -3.7872 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2975 5.1799 0.2164 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6937 4.8878 1.3774 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3066 4.3395 -0.3371 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8909 3.2416 0.5473 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8465 2.4584 -0.0686 C 0 0 2 0 0 0 0 0 0 0 0 0 6.1024 1.4759 0.9591 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2410 0.2184 0.2832 C 0 0 1 0 0 0 0 0 0 0 0 0 7.8347 0.0797 0.2037 C 0 0 2 0 0 0 0 0 0 0 0 0 8.1648 0.7643 -1.0379 C 0 0 2 0 0 0 0 0 0 0 0 0 9.4466 1.3132 -1.0440 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2655 1.8358 -1.1838 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0383 -1.2023 0.4992 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7571 -2.2155 0.0623 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5043 -2.0494 -0.9174 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6971 -3.5554 0.7416 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8767 -3.8372 1.4006 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0458 -4.9606 2.1649 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9932 -5.8276 2.2687 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8306 -5.5332 1.6078 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6479 -4.3797 0.8154 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3542 -4.3193 0.1365 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3920 -3.4085 0.1979 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2036 -3.6043 -0.5299 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9884 -4.7046 -1.3176 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0171 -5.6519 -1.3714 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1388 -5.4446 -0.6657 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1273 -6.4276 -0.7693 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7960 -6.7855 -2.1827 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8153 -4.9122 -2.0547 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3248 -2.0937 0.8709 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7072 -2.0465 1.9353 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8428 -0.9826 0.4564 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7199 -6.4143 1.6970 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0485 -6.9976 3.0184 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2542 -5.2279 2.8281 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7961 1.9440 1.1787 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3978 2.9529 1.9351 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4406 3.6023 2.4678 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1783 3.5705 2.3476 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1856 4.9858 2.2443 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0729 5.7624 2.4340 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8744 5.1710 2.7419 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8244 3.8030 2.8564 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9705 3.0282 2.6571 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8389 1.7030 2.8006 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8540 0.7932 2.4741 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2173 0.9854 1.6792 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2140 0.0143 1.4600 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1419 -1.1910 2.0596 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1913 -2.1806 2.2503 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9787 -2.8291 1.4190 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8684 -3.8561 1.8290 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9578 -4.2189 3.1284 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1755 -3.5746 4.0511 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3292 -2.5926 3.6146 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5330 -1.9016 4.5445 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2363 -3.9062 5.3907 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8515 -5.2471 3.5021 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3764 -2.4850 0.0095 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9254 -3.1008 -0.8866 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2691 -1.4690 -0.0134 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9274 -0.9312 -1.0651 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2179 0.2135 -1.8091 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7681 0.0374 -1.9517 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0957 -0.2086 -0.7700 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1231 0.4704 0.3962 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8411 1.4436 0.6051 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9626 0.6983 -2.8366 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2242 0.2292 -3.1143 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0278 -0.3792 -2.1095 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2232 -0.2948 -0.7191 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0695 -0.3824 0.2434 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9602 -1.2647 0.7353 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1470 -2.3605 0.3175 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7839 -0.7928 1.9032 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1970 -1.2239 3.0755 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6208 -0.7227 4.2742 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6228 0.1955 4.2555 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1993 0.6078 3.0892 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7911 0.1065 1.8297 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5479 0.5575 0.6783 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0793 1.0715 -0.4928 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8732 1.6235 -1.4663 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.2293 1.6708 -1.2922 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.7669 1.1576 -0.1371 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.9423 0.6149 0.8155 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4658 0.0733 1.9848 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.1544 1.2020 0.0478 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.0316 2.2430 -2.2881 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6740 0.9668 -0.9934 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9415 1.8702 -0.7138 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3117 -0.1529 -1.7191 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2164 1.5571 3.0775 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0519 0.7154 5.4696 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0253 -1.1550 5.4709 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9698 -0.7106 -4.2221 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3347 -0.4564 -5.5124 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9137 0.6398 -5.7705 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0802 -1.4064 -6.6062 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4222 -1.0667 -7.9095 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2114 -1.9461 -8.9589 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6601 -3.1710 -8.7169 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3141 -3.5324 -7.4377 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5314 -2.6338 -6.3878 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7564 -4.7842 -7.2181 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4476 -4.0670 -9.7793 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5400 -1.6221 -10.2611 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0066 -1.3878 2.8590 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9685 -0.4707 3.0889 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0448 -0.7337 3.8967 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1086 -2.6772 3.4467 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4115 3.2702 3.1796 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2529 5.9875 2.9311 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1194 7.1591 2.3195 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0590 6.9289 1.1426 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6912 5.9421 -2.3540 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0424 9.1813 1.0964 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2655 10.4704 -2.1632 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2382 8.1633 -4.4952 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6480 3.7558 1.4708 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8443 2.6716 0.7380 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0225 3.1770 -0.4027 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7252 1.7117 1.8305 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0237 0.5208 -0.8599 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2042 0.7559 1.0605 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1226 0.1171 -1.9532 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5698 1.9544 -1.7820 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6980 -3.1175 1.2704 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4011 -2.8433 -0.4529 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0133 -6.2371 -1.1503 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4723 -7.0465 -2.8928 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8990 -4.9367 -3.0849 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0274 -6.3453 2.4079 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4309 -7.7742 2.9097 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6875 -4.4139 3.2810 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1377 5.4695 1.9924 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3096 1.9218 1.1090 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4364 -4.3271 1.0238 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9460 -1.1689 5.1161 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5979 -3.2781 6.1331 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4627 -5.0048 4.2990 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1041 -1.7288 -1.8930 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3424 1.0765 -1.0104 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2844 0.8280 -2.5811 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6100 -0.9026 -2.5778 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7267 1.0750 -3.6830 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9563 -1.5189 -2.2437 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9211 0.8665 -0.7250 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4009 -1.9794 3.0334 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3413 2.0349 -2.3408 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4520 -0.1071 2.0956 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.5585 2.1357 0.0113 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5555 3.0929 -2.0517 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1534 2.3112 3.7708 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4607 0.7476 6.3044 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1857 -1.7206 5.4577 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8486 -0.1020 -8.0911 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2581 -2.9410 -5.3899 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8635 -5.2633 -6.3088 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6333 -5.0612 -9.6390 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8723 -2.4056 -10.8477 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9818 -0.6108 3.4980 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0639 -3.4485 2.8246 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9015 3.4559 4.0230 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1798 6.8518 3.4880 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4709 7.5833 1.6424 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 2 0 6 7 1 0 5 8 1 0 4 9 1 0 2 10 1 0 10 11 2 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 17 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 24 25 2 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 2 0 31 32 1 0 32 33 2 0 33 34 1 0 34 35 2 0 35 36 1 0 34 37 1 0 33 38 1 0 31 39 1 0 39 40 2 0 39 41 1 0 28 42 1 0 27 43 1 0 26 44 1 0 15 45 1 0 45 46 1 0 46 47 2 0 46 48 1 0 48 49 2 0 49 50 1 0 50 51 2 0 51 52 1 0 52 53 2 0 53 54 1 0 54 55 1 0 55 56 2 0 56 57 1 0 57 58 2 0 58 59 1 0 59 60 2 0 60 61 1 0 61 62 2 0 62 63 1 0 63 64 2 0 64 65 1 0 63 66 1 0 62 67 1 0 60 68 1 0 68 69 2 0 68 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 2 0 72 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 81 82 1 0 82 83 2 0 82 84 1 0 84 85 2 0 85 86 1 0 86 87 2 0 87 88 1 0 88 89 2 0 89 90 1 0 90 91 2 0 91 92 1 0 92 93 2 0 93 94 1 0 94 95 2 0 95 96 1 0 94 97 1 0 93 98 1 0 91 99 1 0 99100 2 0 99101 1 0 88102 1 0 87103 1 0 86104 1 0 78105 1 0 105106 1 0 106107 2 0 106108 1 0 108109 2 0 109110 1 0 110111 2 0 111112 1 0 112113 2 0 112114 1 0 111115 1 0 110116 1 0 58117 1 0 117118 2 0 118119 1 0 117120 1 0 52121 1 0 51122 1 0 50123 1 0 6 1 1 0 20 14 1 0 29 24 1 0 35 30 1 0 53 48 1 0 118 55 1 0 41 16 1 0 75 57 1 0 101 79 1 0 113108 1 0 64 59 1 0 80 71 1 0 89 84 1 0 95 90 1 0 1124 1 0 3125 1 0 7126 1 0 8127 1 0 9128 1 0 13129 1 0 13130 1 0 14131 1 6 15132 1 1 16133 1 6 17134 1 1 18135 1 6 19136 1 0 25137 1 0 32138 1 0 36139 1 0 37140 1 0 38141 1 0 42142 1 0 43143 1 0 44144 1 0 49145 1 0 56146 1 0 61147 1 0 65148 1 0 66149 1 0 67150 1 0 71151 1 6 72152 1 1 73153 1 0 73154 1 0 78155 1 6 79156 1 6 80157 1 6 85158 1 0 92159 1 0 96160 1 0 97161 1 0 98162 1 0 102163 1 0 103164 1 0 104165 1 0 109166 1 0 113167 1 0 114168 1 0 115169 1 0 116170 1 0 119171 1 0 120172 1 0 121173 1 0 122174 1 0 123175 1 0 M END

Standard InCHIKey	RSZMIQZFBLGYLQ-QWHYFGCJSA-N
Standard InCHI	InChI=1S/C75H52O48/c76-23-1-14(2-24(77)42(23)86)65(102)112-12-34-59(61-63(74(111)115-34)121-71(108)19-8-30(83)46(90)53(97)38(19)36-17(69(106)119-61)6-28(81)44(88)51(36)95)118-73(110)22-10-32(85)49(93)57(101)58(22)114-33-11-21-41(56(100)50(33)94)40-16(5-27(80)48(92)55(40)99)68(105)117-60-35(13-113-67(21)104)116-75(123-66(103)15-3-25(78)43(87)26(79)4-15)64-62(60)120-70(107)18-7-29(82)45(89)52(96)37(18)39-20(72(109)122-64)9-31(84)47(91)54(39)98/h1-11,34-35,59-64,74-101,111H,12-13H2/t34-,35-,59-,60-,61+,62+,63-,64-,74-,75+/m1/s1
SMILES	c1c(cc(c(c1O)O)O)C(=O)OC[C@@H]1[C@H]([C@H]2[C@H]([C@H](O)O1)OC(=O)c1cc(c(c(c1-c1c(cc(c(c1O)O)O)C(=O)O2)O)O)O)OC(=O)c1cc(c(c(c1Oc1cc2c(-c3c(cc(c(c3O)O)O)C(=O)O[C@@H]3[C@@H](COC2=O)O[C@H]([C@H]2[C@H]3OC(=O)c3cc(c(c(c3-c3c(cc(c(c3O)O)O)C(=O)O2)O)O)O)OC(=O)c2cc(c(c(c2)O)O)O)c(c1O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1720.16	Volume:	1512.983 ? Van der Waals volume.
Dense:	1.137	LogP:	-1.881 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	-3.088 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.538 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	97.0
TPSA:	810.6 ? Topological Polar Surface Area.	H-Bond Acceptor:	48.0
H-Bond Donor:	27.0	Rings:	14.0
Heavy Atoms:	48.0

MedChem Properties

QED Drug-Likeness Score:	0.056	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.249	Fsp³:	0.16
MCE-18:	338.299 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	1	PAINS Alert:	1
Colloidal aggregators:	1.0	Fluc inhibitor:	0.07 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.324 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.667 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.615	Promiscuous compounds:	0.991

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-9.298	MDCK Permeability:	-4.596
Pgp-inhibitor:	0.0	Pgp-substrate:	0.0
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	1.0	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	78.472%	Volume Distribution (VD):	-0.079
Fu:	10.35% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.993
OATP1B3 inhibitor:	0.98	BCRP inhibitor:	0.545
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.902
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.056

Half-life (T1/2):

9.623

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.998
Human Hepatotoxicity (H-HT):	0.084	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	1.0	Rat Oral Acute Toxicity:	0.003
Maximum Recommended Daily Dose:	0.964	Skin Sensitization:	1.0
Carcinogencity:	0.016	Eye Corrosion:	0.0
Eye Irritation:	0.558	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.0	Drug-induced Nephrotoxicity:	0.02
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.0
A549 Cytotoxicity:	1.0	Hek293 Cytotoxicity:	0.246
BCF:	-1.028 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.105 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	3.901 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.192 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO12926	Dendrospora tenella	Species	n.a.	Eukaryota	n.a.	n.a.	n.a.	PMID[10217713]
NPO13919	Agathis microstachya	Species	Araucariaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12771	Eucalyptus alba	Species	Myrtaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12431	Cytospora rhizophorae	Species	Valsaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6238	Pseudo-nitzschia multiseries	Species	Bacillariaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO10422	Penicillium thymicola	Species	Aspergillaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13415	Securigera coronilla	Species	Romaleidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20658	Lonicera caerulea	Species	Caprifoliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO11384	Tibouchina semidecandra	Species	Melastomataceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12926	Dendrospora tenella	Species	n.a.	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13091	Helianthus ciliaris	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7310	Corchorus trilocularis	Species	Malvaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO13091	Helianthus ciliaris	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO4425	Delphinium honanense	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12926	Dendrospora tenella	Species	n.a.	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7310	Corchorus trilocularis	Species	Malvaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO10049	Coleophoma empetri	Species	n.a.	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO9097	Solanum hypomalacophyllum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO6238	Pseudo-nitzschia multiseries	Species	Bacillariaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12245	Lasiosiphon burchellii	Species	Thymelaeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13919	Agathis microstachya	Species	Araucariaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12431	Cytospora rhizophorae	Species	Valsaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO10422	Penicillium thymicola	Species	Aspergillaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO20658	Lonicera caerulea	Species	Caprifoliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13518	Senecio stabianus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28041	Scaevola taccada	Species	Goodeniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO11384	Tibouchina semidecandra	Species	Melastomataceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13625	Salacia beddomei	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12771	Eucalyptus alba	Species	Myrtaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13415	Securigera coronilla	Species	Romaleidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13091	Helianthus ciliaris	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC61160 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	28648
0.1-0.2	20836
0.2-0.3	247
0.3-0.4	56
0.4-0.5	22
0.5-0.6	12
0.6-0.7	17
0.7-0.8	0
0.8-0.85	6
0.85-0.9	3
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8864	High Similarity	NPC488887
0.8864	High Similarity	NPC488886
0.8571	High Similarity	NPC290289
0.8478	Intermediate Similarity	NPC469652
0.8478	Intermediate Similarity	NPC486025
0.8478	Intermediate Similarity	NPC486024
0.8235	Intermediate Similarity	NPC483712
0.8235	Intermediate Similarity	NPC158214
0.8235	Intermediate Similarity	NPC214202
0.7416	Intermediate Similarity	NPC223534
0.7283	Intermediate Similarity	NPC187632
0.7283	Intermediate Similarity	NPC240200
0.7283	Intermediate Similarity	NPC488885
0.7273	Intermediate Similarity	NPC40078
0.7128	Intermediate Similarity	NPC194439
0.7128	Intermediate Similarity	NPC33724
0.7	Intermediate Similarity	NPC112211
0.7	Intermediate Similarity	NPC254925
0.6837	Remote Similarity	NPC488884
0.6699	Remote Similarity	NPC220876
0.6667	Remote Similarity	NPC97924
0.6538	Remote Similarity	NPC93065
0.6465	Remote Similarity	NPC116108
0.6415	Remote Similarity	NPC31208
0.6415	Remote Similarity	NPC160543
0.6373	Remote Similarity	NPC469649
0.6364	Remote Similarity	NPC483711
0.6265	Remote Similarity	NPC47521
0.619	Remote Similarity	NPC43918
0.619	Remote Similarity	NPC261411
0.619	Remote Similarity	NPC190204
0.6118	Remote Similarity	NPC469651
0.6071	Remote Similarity	NPC175793
0.6071	Remote Similarity	NPC159913
0.6019	Remote Similarity	NPC471091
0.5981	Remote Similarity	NPC260521
0.598	Remote Similarity	NPC469650
0.5946	Remote Similarity	NPC174140
0.5938	Remote Similarity	NPC269625
0.5663	Remote Similarity	NPC31034
0.5221	Remote Similarity	NPC486110
0.5119	Remote Similarity	NPC114791
0.5119	Remote Similarity	NPC104222
0.5119	Remote Similarity	NPC210501
0.5119	Remote Similarity	NPC318826
0.5119	Remote Similarity	NPC141331
0.5077	Remote Similarity	NPC3474

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC61160 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6953
0.1-0.2	2194
0.2-0.3	3
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data