NPASS Compound

Structure

NPC483965 OpenBabel06302215232D 25 25 0 0 1 0 0 0 0 0999 V2000 2.7321 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8660 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8660 4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 2.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1340 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7321 2.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4641 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3301 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.3301 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1962 -3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.4641 -3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.1340 0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8660 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5000 -0.8660 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5000 -1.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3660 -2.3660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -2.3660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 5 4 1 6 0 0 0 5 6 1 0 0 0 0 5 17 1 0 0 0 0 6 7 2 3 0 0 0 6 16 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 2 0 0 0 0 13 15 1 0 0 0 0 17 18 2 3 0 0 0 18 25 1 0 0 0 0 19 18 1 6 0 0 0 19 20 1 0 0 0 0 19 24 1 0 0 0 0 20 21 1 1 0 0 0 20 24 1 0 0 0 0 21 22 2 0 0 0 0 21 23 1 0 0 0 0 M END $$$$

Physi-Chem Properties

Molecular Weight:	357.2
Volume:	347.829
LogP:	-0.978
LogD:	-0.602
LogS:	-1.633
# Rotatable Bonds:	13
TPSA:	172.43
# H-Bond Aceptor:	10
# H-Bond Donor:	7
# Rings:	1
# Heavy Atoms:	10

MedChem Properties

QED Drug-Likeness Score:	0.13
Synthetic Accessibility Score:	3.481
Fsp3:	0.733
Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Accepted
GSK Rule:	Accepted
BMS Rule:	0
Golden Triangle Rule:	Accepted
Chelating Alert:	0
PAINS Alert:	0

ADMET Properties (ADMETlab2.0)

ADMET: Absorption

Caco-2 Permeability:	-6.373
MDCK Permeability:	0.0003870810614898801
Pgp-inhibitor:	0.009
Pgp-substrate:	0.981
Human Intestinal Absorption (HIA):	0.036
20% Bioavailability (F20%):	0.009
30% Bioavailability (F30%):	0.008

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.616
Plasma Protein Binding (PPB):	7.918951511383057%
Volume Distribution (VD):	0.349
Pgp-substrate:	80.15762329101562%

ADMET: Metabolism

CYP1A2-inhibitor:	0.01
CYP1A2-substrate:	0.04
CYP2C19-inhibitor:	0.045
CYP2C19-substrate:	0.051
CYP2C9-inhibitor:	0.035
CYP2C9-substrate:	0.036
CYP2D6-inhibitor:	0.045
CYP2D6-substrate:	0.154
CYP3A4-inhibitor:	0.009
CYP3A4-substrate:	0.022

ADMET: Excretion

Clearance (CL):	2.525
Half-life (T1/2):	0.393

ADMET: Toxicity

hERG Blockers:	0.102
Human Hepatotoxicity (H-HT):	0.095
Drug-inuced Liver Injury (DILI):	0.173
AMES Toxicity:	0.005
Rat Oral Acute Toxicity:	0.397
Maximum Recommended Daily Dose:	0.009
Skin Sensitization:	0.128
Carcinogencity:	0.026
Eye Corrosion:	0.003
Eye Irritation:	0.007
Respiratory Toxicity:	0.029

Download Data

Data Type	Select
General Info & Identifiers & Properties
Structure MOL file
Source Organisms
Biological Activities
Similar NPs/Drugs

Natural Product: NPC483965

Natural Product ID:	NPC483965
*Common Name:**	LTLYEAJONXGNFG-DCAQKATOSA-N
IUPAC Name:	n.a.
Synonyms:
Standard InCHIKey:	LTLYEAJONXGNFG-DCAQKATOSA-N
Standard InCHI:	InChI=1S/C15H27N5O5/c1-8(2)7-9(20-13(22)10-11(25-10)14(23)24)12(21)18-5-3-4-6-19-15(16)17/h8-11H,3-7H2,1-2H3,(H,18,21)(H,20,22)(H,23,24)(H4,16,17,19)/t9-,10-,11-/m0/s1
SMILES:	CC(C)C[C@@H](C(=NCCCCNC(=N)N)O)N=C([C@@H]1[C@@H](C(=O)O)O1)O
Synthetic Gene Cluster:	n.a.
ChEMBL Identifier:	n.a.
PubChem CID:	123985
Chemical Classification:**	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000002] Organoheterocyclic compounds [CHEMONTID:0000159] Epoxides [CHEMONTID:0001864] Oxirane carboxylic acids and derivatives [CHEMONTID:0002409] Oxirane carboxylic acids

*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40198	Metrodorea stipularis	Species	Rutaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25375026]
NPO40680	Marine cyanobacterium from Guam	Strain	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[29087712]

☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	NP ID	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	1
IC50	69
Ki	13
Others	70

Activity Type	# Activity
Cell Line	1
Individual Protein	67
NON-MOLECULAR	9
Organism	41
Others	27
SINGLE PROTEIN	8

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT469	Individual Protein	Cathepsin L	Homo sapiens	IC50	=	47.0	nM	PMID[9784105]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	IC50	=	16.0	nM	PMID[9784105]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	Inhibition	~	24.0	%	PMID[10617079]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	Inhibition	~	29.0	%	PMID[10617079]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	Inhibition	~	52.0	%	PMID[10617079]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	Inhibition	~	75.0	%	PMID[10617079]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	Inhibition	~	90.0	%	PMID[10617079]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	Inhibition	~	95.0	%	PMID[10617079]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	Inhibition	~	98.0	%	PMID[10617079]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	Inhibition	~	100.0	%	PMID[10617079]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	IC50	=	0.0049	ug.mL-1	PMID[10617079]
NPT3939	Individual Protein	Falcipain 2	Plasmodium falciparum	IC50	=	58.0	nM	PMID[15887974]
NPT3939	Individual Protein	Falcipain 2	Plasmodium falciparum	IC50	=	15.0	nM	PMID[16509575]
NPT279	Individual Protein	Leukocyte elastase	Homo sapiens	IC50	>	300000.0	nM	PMID[17145787]
NPT3939	Individual Protein	Falcipain 2	Plasmodium falciparum	IC50	=	15.0	nM	PMID[15588096]
NPT3939	Individual Protein	Falcipain 2	Plasmodium falciparum	Ki	=	290.0	nM	PMID[18232656]
NPT6386	Individual Protein	Dipeptidyl peptidase I	Homo sapiens	IC50	=	770.0	nM	PMID[17535802]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	IC50	=	10.0	nM	PMID[17535802]
NPT469	Individual Protein	Cathepsin L	Homo sapiens	IC50	=	13.0	nM	PMID[17535802]
NPT5085	Individual Protein	Cathepsin H	Homo sapiens	IC50	=	190.0	nM	PMID[17535802]
NPT5930	Individual Protein	Cathepsin S	Homo sapiens	IC50	=	7.0	nM	PMID[17535802]
NPT201	Individual Protein	Papain	Carica papaya	IC50	=	47.0	nM	PMID[18995931]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	Ki	=	16000.0	nM	PMID[19709887]
NPT469	Individual Protein	Cathepsin L	Homo sapiens	IC50	=	47.0	nM	PMID[19709887]
NPT3939	Individual Protein	Falcipain 2	Plasmodium falciparum	IC50	=	47.0	nM	PMID[20045640]
NPT469	Individual Protein	Cathepsin L	Homo sapiens	Inhibition	=	-1.3	%	PMID[20481438]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	Inhibition	=	75.0	%	PMID[20481438]
NPT3939	Individual Protein	Falcipain 2	Plasmodium falciparum	Ki	=	40300.0	nM	PMID[20434817]
NPT3939	Individual Protein	Falcipain 2	Plasmodium falciparum	Ki	=	290.0	nM	PMID[20598553]
NPT3939	Individual Protein	Falcipain 2	Plasmodium falciparum	Ratio	=	1586000.0	n.a.	PMID[20598553]
NPT3939	Individual Protein	Falcipain 2	Plasmodium falciparum	IC50	=	111.7	nM	PMID[21295887]
NPT5082	Individual Protein	Cysteine protease falcipain-3	Plasmodium falciparum	IC50	=	481.5	nM	PMID[21295887]
NPT201	Individual Protein	Papain	Carica papaya	IC50	=	2.0	nM	PMID[22071522]
NPT66	Individual Protein	Acetylcholinesterase	Electrophorus electricus	Inhibition	=	-7.43	%	PMID[23062825]
NPT3939	Individual Protein	Falcipain 2	Plasmodium falciparum	Inhibition	=	92.0	%	DOI[10.1007/s00044-011-9854-3]
NPT3939	Individual Protein	Falcipain 2	Plasmodium falciparum	IC50	=	20.0	nM	DOI[10.1007/s00044-011-9854-3]
NPT201	Individual Protein	Papain	Carica papaya	Ki	=	5080.0	nM	PMID[23834438]
NPT3579	Individual Protein	Calpain 1	Homo sapiens	IC50	=	100.0	nM	PMID[23834438]
NPT201	Individual Protein	Papain	Carica papaya	IC50	=	7.0	nM	PMID[24077527]
NPT3595	Individual Protein	Cathepsin K	Homo sapiens	IC50	=	4.0	nM	DOI[10.1039/C1MD00129A]
NPT469	Individual Protein	Cathepsin L	Homo sapiens	IC50	=	16.0	nM	DOI[10.1039/C1MD00129A]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	IC50	=	5.0	nM	DOI[10.1039/C1MD00129A]
NPT201	Individual Protein	Papain	Carica papaya	IC50	=	120.0	nM	DOI[10.1039/C2MD20011B]
NPT214	Individual Protein	Cathepsin B	Homo sapiens	IC50	=	40.0	nM	PMID[25375026]
NPT469	Individual Protein	Cathepsin L	Homo sapiens	IC50	=	30.0	nM	PMID[25375026]
NPT469	Individual Protein	Cathepsin L	Homo sapiens	Ki	=	30.0	nM	PMID[28763614]
NPT3939	Individual Protein	Falcipain 2	Plasmodium falciparum	IC50	=	250.0	nM	PMID[28763614]
NPT470	Individual Protein	Rhodesain	Trypanosoma brucei rhodesiense	Ki	=	35.0	nM	PMID[28763614]
NPT1547	Individual Protein	Cathepsin D	Homo sapiens	Inhibition	=	60.0	%	PMID[29087712]
NPT737	Cell Line	HUVEC	Homo sapiens	Inhibition	=	80.0	%	PMID[30962115]
NPT470	Individual Protein	Rhodesain	Trypanosoma brucei rhodesiense	Inhibition	=	100.0	%	PMID[32527539]
NPT470	Individual Protein	Rhodesain	Trypanosoma brucei rhodesiense	Inhibition	=	36.0	%	PMID[31284086]
NPT470	Individual Protein	Rhodesain	Trypanosoma brucei rhodesiense	Inhibition	=	100.0	%	PMID[31284086]
NPT5930	Individual Protein	Cathepsin S	Homo sapiens	Inhibition	=	99.9	%	PMID[31284086]
NPT2	Others	Unspecified		Ratio	=	0.33	n.a.	PMID[9784105]
NPT27	Others	Unspecified		Inhibition	=	90.0	%	PMID[10669559]
NPT485	Organism	Plasmodium falciparum (isolate K1 / Thailand)	Plasmodium falciparum K1	IC50	=	2500.0	nM	PMID[15887974]
NPT18808	SINGLE PROTEIN	Cysteine protease falcipain-3	Plasmodium falciparum	IC50	=	75.0	nM	PMID[16509575]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	EC50	=	2900.0	nM	PMID[17088482]
NPT2	Others	Unspecified		IC50	>	300000.0	nM	PMID[17145787]
NPT18809	SINGLE PROTEIN	Lysosomal protective protein	Homo sapiens	IC50	>	300000.0	nM	PMID[17145787]
NPT837	Individual Protein	Carboxylesterase	Sus scrofa	IC50	>	300000.0	nM	PMID[17145787]
NPT18808	SINGLE PROTEIN	Cysteine protease falcipain-3	Plasmodium falciparum	IC50	=	35.0	nM	PMID[15588096]
NPT791	Individual Protein	Cruzipain	Trypanosoma cruzi	Inhibition	=	100.0	%	PMID[17960923]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	5300.0	nM	PMID[18232656]
NPT2	Others	Unspecified		Ki	=	290.0	nM	PMID[19296600]
NPT2	Others	Unspecified		Inhibition	=	36.0	%	PMID[18845442]
NPT2	Others	Unspecified		Inhibition	=	97.4	%	PMID[19586036]
NPT2	Others	Unspecified		IC50	=	17.0	nM	PMID[19586036]
NPT2	Others	Unspecified		Ki	=	290.0	nM	PMID[19709887]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	5300.0	nM	PMID[19709887]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	3200.0	nM	PMID[20131843]
NPT2	Others	Unspecified		Ki	=	25.0	nM	PMID[20131843]
NPT2	Others	Unspecified		Ki	=	220.0	nM	PMID[20131843]
NPT2	Others	Unspecified		Ki	=	290.0	nM	PMID[19715342]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	5300.0	nM	PMID[19715342]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	9300.0	nM	PMID[20434817]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	2511.89	nM	PMID[19734910]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	3981.07	nM	PMID[19734910]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	3162.28	nM	PMID[19734910]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	6309.57	nM	PMID[19734910]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	3690.0	nM	PMID[18443109]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	5880.0	nM	PMID[18443109]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	1940.0	nM	PMID[21295887]
NPT2	Others	Unspecified		IC50	=	47.33	nM	PMID[21376591]
NPT2	Others	Unspecified		IC50	=	55.0	nM	PMID[21500839]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	1955.0	nM	PMID[19435664]
NPT2	Others	Unspecified		IC50	=	84.0	nM	PMID[19435664]
NPT2	Others	Unspecified		IC50	=	9.0	nM	PMID[19435664]
NPT2	Others	Unspecified		IC50	=	110.0	nM	PMID[22071522]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	1940.0	nM	PMID[22071522]
NPT2	Others	Unspecified		Inhibition	=	97.4	%	PMID[22192590]
NPT2	Others	Unspecified		IC50	=	17.0	nM	PMID[22192590]
NPT2	Others	Unspecified		IC50	=	24.6	nM	PMID[22683112]
NPT791	Individual Protein	Cruzipain	Trypanosoma cruzi	Inhibition	=	62.0	%	PMID[22840495]
NPT2	Others	Unspecified		Inhibition	=	92.0	%	PMID[23040894]
NPT2	Others	Unspecified		IC50	=	20.0	nM	PMID[23040894]
NPT67	Individual Protein	Cholinesterase	Equus caballus	Inhibition	=	12.05	%	PMID[23062825]
NPT25048	SINGLE PROTEIN	Calpain 1	Sus scrofa	FC	=	1.0	n.a.	PMID[23834438]
NPT25048	SINGLE PROTEIN	Calpain 1	Sus scrofa	Ki	=	3960.0	nM	PMID[23834438]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	1940.0	nM	PMID[24077527]
NPT2	Others	Unspecified		IC50	=	60.0	nM	PMID[24077527]
NPT2	Others	Unspecified		IC50	=	17.0	nM	PMID[24530004]
NPT2	Others	Unspecified		IC50	=	30.0	nM	DOI[10.1039/C1MD00129A]
NPT2	Others	Unspecified		IC50	=	60.0	nM	DOI[10.1039/C2MD20011B]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	IC50	=	1940.0	nM	DOI[10.1039/C2MD20011B]
NPT20529	NON-MOLECULAR	NON-PROTEIN TARGET	n.a.	Activity	=	3.15	n.a.	PMID[25137549]
NPT485	Organism	Plasmodium falciparum (isolate K1 / Thailand)	Plasmodium falciparum K1	Activity	=	0.55	n.a.	PMID[25137549]
NPT485	Organism	Plasmodium falciparum (isolate K1 / Thailand)	Plasmodium falciparum K1	Activity	=	0.39	n.a.	PMID[25137549]
NPT485	Organism	Plasmodium falciparum (isolate K1 / Thailand)	Plasmodium falciparum K1	Activity	=	1.45	n.a.	PMID[25137549]
NPT485	Organism	Plasmodium falciparum (isolate K1 / Thailand)	Plasmodium falciparum K1	Activity	=	2.11	n.a.	PMID[25137549]
NPT485	Organism	Plasmodium falciparum (isolate K1 / Thailand)	Plasmodium falciparum K1	Activity	=	0.5	n.a.	PMID[25137549]
NPT485	Organism	Plasmodium falciparum (isolate K1 / Thailand)	Plasmodium falciparum K1	Activity	=	2.07	n.a.	PMID[25137549]
NPT20529	NON-MOLECULAR	NON-PROTEIN TARGET	n.a.	Activity	=	3.85	n.a.	PMID[25137549]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	Activity	=	1.78	n.a.	PMID[25137549]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	Activity	=	0.91	n.a.	PMID[25137549]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	Activity	=	1.4	n.a.	PMID[25137549]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	Activity	=	1.2	n.a.	PMID[25137549]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	Activity	=	0.76	n.a.	PMID[25137549]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	Activity	=	1.22	n.a.	PMID[25137549]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	Activity	=	2.1	n.a.	PMID[25137549]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	Activity	=	1.44	n.a.	PMID[25137549]
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	Activity	=	3.0	n.a.	PMID[25137549]
NPT485	Organism	Plasmodium falciparum (isolate K1 / Thailand)	Plasmodium falciparum K1	Activity	=	1.69	n.a.	PMID[25137549]
NPT485	Organism	Plasmodium falciparum (isolate K1 / Thailand)	Plasmodium falciparum K1	Activity	=	0.67	n.a.	PMID[25137549]
NPT485	Organism	Plasmodium falciparum (isolate K1 / Thailand)	Plasmodium falciparum K1	Activity	=	1.25	n.a.	PMID[25137549]
NPT20529	NON-MOLECULAR	NON-PROTEIN TARGET	n.a.	Activity	=	1.06	n.a.	PMID[25137549]
NPT20529	NON-MOLECULAR	NON-PROTEIN TARGET	n.a.	Activity	=	2.05	n.a.	PMID[25137549]
NPT20529	NON-MOLECULAR	NON-PROTEIN TARGET	n.a.	Activity	=	1.33	n.a.	PMID[25137549]
NPT20529	NON-MOLECULAR	NON-PROTEIN TARGET	n.a.	Activity	=	0.8	n.a.	PMID[25137549]
NPT20529	NON-MOLECULAR	NON-PROTEIN TARGET	n.a.	Activity	=	0.45	n.a.	PMID[25137549]
NPT20529	NON-MOLECULAR	NON-PROTEIN TARGET	n.a.	Activity	=	1.32	n.a.	PMID[25137549]
NPT20529	NON-MOLECULAR	NON-PROTEIN TARGET	n.a.	Activity	=	1.15	n.a.	PMID[25137549]
NPT2	Others	Unspecified		IC50	=	125.0	nM	PMID[26112378]
NPT791	Individual Protein	Cruzipain	Trypanosoma cruzi	Inhibition	=	100.0	%	PMID[27475533]
NPT791	Individual Protein	Cruzipain	Trypanosoma cruzi	IC50	=	400.0	nM	PMID[27475533]
NPT20556	SINGLE PROTEIN	Replicase polyprotein 1ab	Severe acute respiratory syndrome coronavirus 2	Inhibition	=	10.6	%	DOI[10.6019/CHEMBL4495564]
NPT20555	ORGANISM	SARS-CoV-2	Severe acute respiratory syndrome coronavirus 2	Inhibition	=	0.3	%	DOI[10.6019/CHEMBL4495565]
NPT791	Individual Protein	Cruzipain	Trypanosoma cruzi	Inhibition	=	32.0	%	PMID[31284086]
NPT791	Individual Protein	Cruzipain	Trypanosoma cruzi	Inhibition	=	96.0	%	PMID[31284086]
NPT791	Individual Protein	Cruzipain	Trypanosoma cruzi	Inhibition	=	92.4	%	PMID[31284086]
NPT791	Individual Protein	Cruzipain	Trypanosoma cruzi	Inhibition	=	100.0	%	PMID[31284086]
NPT791	Individual Protein	Cruzipain	Trypanosoma cruzi	Inhibition	=	94.3	%	PMID[31284086]
NPT18815	SINGLE PROTEIN	Cathepsin B	Rattus norvegicus	Inhibition	=	99.1	%	PMID[31284086]
NPT18815	SINGLE PROTEIN	Cathepsin B	Rattus norvegicus	Inhibition	=	100.1	%	PMID[31284086]

☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.

Chemically structural similarity: I. Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient

● The left chart: Distribution of similarity level between NPC483965 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	243
0.1-0.2	11786
0.2-0.3	23431
0.3-0.4	6146
0.4-0.5	829
0.5-0.6	241
0.6-0.7	20
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID

Chemically structural similarity: II. Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC483965 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	83
0.1-0.2	2465
0.2-0.3	5087
0.3-0.4	1142
0.4-0.5	303
0.5-0.6	65
0.6-0.7	3
0.7-0.8	1
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage

Bioactivity similarity: Similar Natural Products in NPASS

Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.

Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data