Natural Product: NPC473429
Natural Product ID:   | NPC473429 |
Common Name*:   | Congo Red |
IUPAC Name:   | n.a. |
Synonyms:   | Congazone Sodium; Congo Red; NSC-75913 |
Standard InCHIKey:   | IQFVPQOLBLOTPF-HKXUKFGYSA-L |
Standard InCHI:   | InChI=1S/C32H24N6O6S2.2Na/c33-31-25-7-3-1-5-23(25)29(45(39,40)41)17-27(31)37-35-21-13-9-19(10-14-21)20-11-15-22(16-12-20)36-38-28-18-30(46(42,43)44)24-6-2-4-8-26(24)32(28)34;;/h1-18H,33-34H2,(H,39,40,41)(H,42,43,44);;/q;2*+1/p-2/b37-35+,38-36+;; |
SMILES:   | Nc1c(/N=N/c2ccc(cc2)c2ccc(cc2)/N=N/c2cc(c3c(c2N)cccc3)S(=O)(=O)[O-])cc(c2c1cccc2)S(=O)(=O)[O-].[Na+].[Na+]
|
Synthetic Gene Cluster:   |
n.a. |
ChEMBL Identifier:   |
CHEMBL429694 |
PubChem CID:   |
n.a. |
Chemical Classification**:   |
-
CHEMONTID:0000000 [Organic compounds]
-
[CHEMONTID:0002448] Benzenoids
-
[CHEMONTID:0002279] Benzene and substituted derivatives
[CHEMONTID:0000041] Biphenyls and derivatives[CHEMONTID:0003955] Benzidines
|
*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.
  Species Source
Organism ID |
Organism Name |
Taxonomy Level |
Family |
SuperKingdom |
Isolation Part |
Collection Location |
Collection Time |
Reference |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[12350137] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
rhizome |
n.a. |
n.a. |
PMID[12617587] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
Rhizomes |
n.a. |
n.a. |
PMID[23153397] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
leaf |
n.a. |
PMID[23901173] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[28068085] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[9584408] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
Rhizome |
n.a. |
n.a. |
Database[FooDB] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
Rhizome Essent. Oil |
n.a. |
n.a. |
Database[FooDB] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
Root |
n.a. |
n.a. |
Database[FooDB] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
|
n.a. |
n.a. |
Database[FooDB] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
|
Database[FooDB] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
Essential Oil |
n.a. |
n.a. |
Database[FooDB] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
Leaf |
n.a. |
n.a. |
Database[FooDB] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
|
Database[Phenol-Explorer] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO24124 |
Curcuma longa |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration
Organism ID |
NP ID |
Organism Material Preparation |
Organism Part |
NP Quantity (Standard) |
NP Quantity (Minimum) |
NP Quantity (Maximum) |
Quantity Unit |
Reference |
☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  Biological Activity
Activity Type |
# Activity |
EC50 |
1 |
ED50 |
2 |
IC50 |
18 |
Kd |
3 |
Ki |
8 |
Others |
51 |
Potency |
51 |
Activity Type |
# Activity |
Cell Line |
2 |
Individual Protein |
60 |
NON-MOLECULAR |
1 |
Others |
69 |
SINGLE PROTEIN |
2 |
Target ID |
Target Type |
Target Name |
Target Organism |
Activity Type |
Activity Relation |
Value |
Unit |
Reference |
NPT4219 |
Individual Protein |
Choline acetylase |
Homo sapiens |
Ki |
= |
100.0 |
nM |
PMID[480281] |
NPT2682 |
Individual Protein |
Alpha-chymotrypsin |
Bos taurus |
Concentration |
= |
40.0 |
uM |
PMID[480282] |
NPT654 |
Individual Protein |
Beta-lactamase |
Enterobacter cloacae |
Concentration |
= |
3.9 |
uM |
PMID[480282] |
NPT502 |
Individual Protein |
Beta-galactosidase |
Homo sapiens |
Concentration |
= |
100.0 |
uM |
PMID[480282] |
NPT2818 |
Individual Protein |
Dihydrofolate reductase |
Homo sapiens |
Concentration |
= |
0.4 |
uM |
PMID[480282] |
NPT56 |
Individual Protein |
Beta-lactamase AmpC |
Escherichia coli K-12 |
IC50 |
= |
4000.0 |
nM |
PMID[480283] |
NPT56 |
Individual Protein |
Beta-lactamase AmpC |
Escherichia coli K-12 |
Inhibition |
= |
92.0 |
% |
PMID[480283] |
NPT56 |
Individual Protein |
Beta-lactamase AmpC |
Escherichia coli K-12 |
Inhibition |
= |
20.0 |
% |
PMID[480283] |
NPT654 |
Individual Protein |
Beta-lactamase |
Enterobacter cloacae |
Inhibition |
= |
81.0 |
% |
PMID[480283] |
NPT56 |
Individual Protein |
Beta-lactamase AmpC |
Escherichia coli K-12 |
IC50 |
= |
3900.0 |
nM |
PMID[480284] |
NPT1569 |
Individual Protein |
Chymotrypsin C |
Homo sapiens |
IC50 |
= |
40000.0 |
nM |
PMID[480284] |
NPT6232 |
Individual Protein |
Dihydrofolate reductase |
Gallus gallus |
IC50 |
= |
400.0 |
nM |
PMID[480284] |
NPT502 |
Individual Protein |
Beta-galactosidase |
Homo sapiens |
IC50 |
= |
100000.0 |
nM |
PMID[480284] |
NPT56 |
Individual Protein |
Beta-lactamase AmpC |
Escherichia coli K-12 |
Decrease in IC50 |
= |
11.0 |
n.a. |
PMID[480284] |
NPT56 |
Individual Protein |
Beta-lactamase AmpC |
Escherichia coli K-12 |
Increase in IC50 |
= |
15.0 |
n.a. |
PMID[480284] |
NPT56 |
Individual Protein |
Beta-lactamase AmpC |
Escherichia coli K-12 |
IC50 |
= |
650.0 |
nM |
PMID[480284] |
NPT56 |
Individual Protein |
Beta-lactamase AmpC |
Escherichia coli K-12 |
IC50 |
= |
340000.0 |
nM |
PMID[480284] |
NPT56 |
Individual Protein |
Beta-lactamase AmpC |
Escherichia coli K-12 |
IC50 |
= |
340.0 |
nM |
PMID[480285] |
NPT56 |
Individual Protein |
Beta-lactamase AmpC |
Escherichia coli K-12 |
IC50 |
= |
2200.0 |
nM |
PMID[480285] |
NPT66 |
Individual Protein |
Acetylcholinesterase |
Electrophorus electricus |
Inhibition |
= |
99.8 |
% |
PMID[480288] |
NPT66 |
Individual Protein |
Acetylcholinesterase |
Electrophorus electricus |
Inhibition |
= |
99.5 |
% |
PMID[480288] |
NPT681 |
Cell Line |
PC-12 |
Rattus norvegicus |
ED50 |
= |
37.5 |
ug ml-1 |
PMID[480298] |
NPT681 |
Cell Line |
PC-12 |
Rattus norvegicus |
ED50 |
= |
39.2 |
ug ml-1 |
PMID[480298] |
NPT4418 |
Individual Protein |
Autotaxin |
Homo sapiens |
Inhibition |
= |
5.288 |
% |
PMID[480300] |
NPT4418 |
Individual Protein |
Autotaxin |
Homo sapiens |
Inhibition |
= |
14.6 |
% |
PMID[480300] |
NPT4418 |
Individual Protein |
Autotaxin |
Homo sapiens |
Inhibition |
= |
36.68 |
% |
PMID[480300] |
NPT4418 |
Individual Protein |
Autotaxin |
Homo sapiens |
Inhibition |
= |
54.93 |
% |
PMID[480300] |
NPT4418 |
Individual Protein |
Autotaxin |
Homo sapiens |
Inhibition |
= |
77.35 |
% |
PMID[480300] |
NPT4418 |
Individual Protein |
Autotaxin |
Homo sapiens |
Inhibition |
= |
91.16 |
% |
PMID[480300] |
NPT4418 |
Individual Protein |
Autotaxin |
Homo sapiens |
Inhibition |
= |
94.63 |
% |
PMID[480300] |
NPT4418 |
Individual Protein |
Autotaxin |
Homo sapiens |
Inhibition |
= |
99.84 |
% |
PMID[480300] |
NPT4418 |
Individual Protein |
Autotaxin |
Homo sapiens |
Inhibition |
= |
99.86 |
% |
PMID[480300] |
NPT6495 |
Individual Protein |
Ectonucleotide pyrophosphatase/phosphodiesterase family member 7 |
Homo sapiens |
Inhibition |
= |
2.0 |
% |
PMID[480300] |
NPT6494 |
Individual Protein |
Ectonucleotide pyrophosphatase/phosphodiesterase family member 6 |
Homo sapiens |
Inhibition |
= |
-3.0 |
% |
PMID[480300] |
NPT4418 |
Individual Protein |
Autotaxin |
Homo sapiens |
Ki |
= |
1890.0 |
nM |
PMID[480300] |
NPT4418 |
Individual Protein |
Autotaxin |
Homo sapiens |
Inhibition |
= |
82.0 |
% |
PMID[480300] |
NPT4418 |
Individual Protein |
Autotaxin |
Homo sapiens |
IC50 |
= |
1310.0 |
nM |
PMID[480300] |
NPT6245 |
Individual Protein |
PH domain leucine-rich repeat-containing protein phosphatase 2 |
Homo sapiens |
IC50 |
= |
33000.0 |
nM |
PMID[480305] |
NPT66 |
Individual Protein |
Acetylcholinesterase |
Electrophorus electricus |
Inhibition |
= |
97.0 |
% |
PMID[480307] |
NPT5463 |
Individual Protein |
Cystine/glutamate transporter |
Homo sapiens |
Activity |
= |
82.0 |
% |
PMID[480308] |
NPT66 |
Individual Protein |
Acetylcholinesterase |
Electrophorus electricus |
Inhibition |
= |
97.0 |
% |
PMID[480309] |
NPT66 |
Individual Protein |
Acetylcholinesterase |
Electrophorus electricus |
Inhibition |
= |
96.5 |
% |
PMID[480309] |
NPT50 |
Individual Protein |
Tyrosyl-DNA phosphodiesterase 1 |
Homo sapiens |
Potency |
n.a. |
33498.3 |
nM |
PMID[480312] |
NPT50 |
Individual Protein |
Tyrosyl-DNA phosphodiesterase 1 |
Homo sapiens |
Potency |
n.a. |
10593.1 |
nM |
PMID[480312] |
NPT204 |
Individual Protein |
Acetylcholinesterase |
Homo sapiens |
Imax |
= |
95.4 |
% |
PMID[480313] |
NPT204 |
Individual Protein |
Acetylcholinesterase |
Homo sapiens |
Inhibition |
= |
89.0 |
% |
PMID[480320] |
NPT153 |
Individual Protein |
Androgen Receptor |
Homo sapiens |
Potency |
n.a. |
10682.2 |
nM |
PMID[19084294] |
NPT153 |
Individual Protein |
Androgen Receptor |
Homo sapiens |
Potency |
n.a. |
26603.2 |
nM |
PMID[17074796] |
NPT153 |
Individual Protein |
Androgen Receptor |
Homo sapiens |
Potency |
n.a. |
15339.7 |
nM |
PMID[20923180] |
NPT35 |
Others |
n.a. |
|
LogP |
= |
0.16 |
n.a. |
PMID[480280] |
NPT35 |
Others |
n.a. |
|
Kd |
= |
1500.0 |
nM |
PMID[480280] |
NPT35 |
Others |
n.a. |
|
Kd |
= |
1100.0 |
nM |
PMID[480280] |
NPT2 |
Others |
Unspecified |
|
Bmax |
= |
2.6 |
n.a. |
PMID[480280] |
NPT2 |
Others |
Unspecified |
|
Bmax |
= |
0.6 |
n.a. |
PMID[480280] |
NPT2 |
Others |
Unspecified |
|
DLS Concentration |
= |
750.0 |
uM |
PMID[480284] |
NPT78 |
Individual Protein |
Beta amyloid A4 protein |
Homo sapiens |
Ki |
> |
1000.0 |
nM |
PMID[480286] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
1650.0 |
nM |
PMID[480288] |
NPT78 |
Individual Protein |
Beta amyloid A4 protein |
Homo sapiens |
Inhibition |
= |
78.8 |
% |
PMID[480290] |
NPT2 |
Others |
Unspecified |
|
Ki |
> |
10000.0 |
nM |
PMID[480291] |
NPT2 |
Others |
Unspecified |
|
Ki |
> |
10000.0 |
nM |
PMID[480292] |
NPT2 |
Others |
Unspecified |
|
Kd |
= |
13000.0 |
nM |
PMID[480293] |
NPT2 |
Others |
Unspecified |
|
Inhibition |
= |
1.4 |
% |
PMID[480294] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
10000.0 |
nM |
PMID[480294] |
NPT78 |
Individual Protein |
Beta amyloid A4 protein |
Homo sapiens |
Inhibition |
= |
78.8 |
% |
PMID[480296] |
NPT78 |
Individual Protein |
Beta amyloid A4 protein |
Homo sapiens |
Ki |
> |
1000.0 |
nM |
PMID[480299] |
NPT2 |
Others |
Unspecified |
|
Drug uptake |
= |
31.0 |
% |
PMID[480302] |
NPT22902 |
SINGLE PROTEIN |
Eukaryotic peptide chain release factor GTP-binding subunit |
Saccharomyces cerevisiae |
Inhibition |
= |
100.0 |
% |
PMID[480303] |
NPT2 |
Others |
Unspecified |
|
Inhibition |
= |
100.0 |
% |
PMID[480303] |
NPT2 |
Others |
Unspecified |
|
Inhibition |
= |
92.0 |
% |
PMID[480303] |
NPT2 |
Others |
Unspecified |
|
Inhibition |
= |
20.0 |
% |
PMID[480303] |
NPT20529 |
NON-MOLECULAR |
NON-PROTEIN TARGET |
n.a. |
IC50 |
= |
5500.0 |
nM |
PMID[480306] |
NPT2 |
Others |
Unspecified |
|
Activity |
= |
31.0 |
% |
PMID[480308] |
NPT2 |
Others |
Unspecified |
|
Activity |
= |
0.0 |
% |
PMID[480308] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
2000.0 |
nM |
PMID[480310] |
NPT2 |
Others |
Unspecified |
|
Inhibition |
= |
60.3 |
% |
PMID[480311] |
NPT2 |
Others |
Unspecified |
|
Inhibition |
= |
93.1 |
% |
PMID[480311] |
NPT2 |
Others |
Unspecified |
|
Ratio |
> |
22.0 |
n.a. |
PMID[480314] |
NPT27 |
Others |
Unspecified |
|
LC50 |
> |
10000.0 |
nM |
PMID[480314] |
NPT2 |
Others |
Unspecified |
|
EC50 |
= |
450.0 |
nM |
PMID[480314] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
3533.8 |
nM |
PMID[480312] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
14125.4 |
nM |
PMID[480312] |
NPT78 |
Individual Protein |
Beta amyloid A4 protein |
Homo sapiens |
Inhibition |
= |
76.6 |
% |
PMID[480315] |
NPT78 |
Individual Protein |
Beta amyloid A4 protein |
Homo sapiens |
Inhibition |
= |
93.2 |
% |
PMID[480315] |
NPT78 |
Individual Protein |
Beta amyloid A4 protein |
Homo sapiens |
IC50 |
= |
1300.0 |
nM |
PMID[480316] |
NPT78 |
Individual Protein |
Beta amyloid A4 protein |
Homo sapiens |
Inhibition |
= |
86.5 |
% |
PMID[480317] |
NPT78 |
Individual Protein |
Beta amyloid A4 protein |
Homo sapiens |
IC50 |
= |
1300.0 |
nM |
PMID[480318] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
24532.2 |
nM |
PubChem BioAssay data set |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
23710.1 |
nM |
PMID[15387645] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
13333.2 |
nM |
PMID[1294697] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
24311.8 |
nM |
PMID[16408017] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
5442.7 |
nM |
PMID[23102654] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
13333.2 |
nM |
PMID[25028062] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
10590.9 |
nM |
PMID[26115570] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
26603.2 |
nM |
Open TG-GATES in vivo data: Biochemistry |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
9869.5 |
nM |
PMID[25016370] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
30606.7 |
nM |
PMID[17095213] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
27278.3 |
nM |
PMID[15104491] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
13333.2 |
nM |
PMID[9051914] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
9678.7 |
nM |
PMID[19928832] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
4323.3 |
nM |
PMID[24164206] |
NPT74 |
Individual Protein |
Proto-oncogene c-JUN |
Homo sapiens |
Potency |
n.a. |
2186.4 |
nM |
DOI[10.1016/S0960-894X(97)00029-2] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
54920.8 |
nM |
PMID[20155971] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
61068.4 |
nM |
PMID[17850214] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
24311.8 |
nM |
PMID[15497961] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
4323.3 |
nM |
PMID[12027740] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
17211.4 |
nM |
DrugMatrix in vitro pharmacology data |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
34652.7 |
nM |
PMID[20439614] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
21864.4 |
nM |
PMID[19786608] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
26603.2 |
nM |
PMID[8035429] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
17367.5 |
nM |
PMID[10743948] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
61622.2 |
nM |
DrugMatrix in vitro pharmacology data |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
29849.3 |
nM |
PMID[19467602] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
6852 |
nM |
PMID[10579870] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
34341.3 |
nM |
PMID[18977148] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
9678.7 |
nM |
PMID[23360521] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
61622.2 |
nM |
PMID[16933889] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
34341.3 |
nM |
PMID[18183025] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
54427.3 |
nM |
PubChem BioAssay data set |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
16785.5 |
nM |
PMID[23398362] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
27278.3 |
nM |
PMID[14987059] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
10590.9 |
nM |
PMID[21458279] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
17211.4 |
nM |
PMID[26000707] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
21313.8 |
nM |
PMID[23642481] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
17211.4 |
nM |
PMID[19572611] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
18833.6 |
nM |
PMID[22444684] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
21131.7 |
nM |
PubChem BioAssay data set |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
29849.3 |
nM |
PMID[24479418] |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
10590.9 |
nM |
DrugMatrix in vitro pharmacology data |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
27278.3 |
nM |
Open TG-GATES in vivo data: Organ Weight |
NPT2 |
Others |
Unspecified |
|
Potency |
n.a. |
30606.7 |
nM |
PMID[8201310] |
☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.
  Chemically structural similarity: I. Similar Active Natural Products in NPASS
Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
●  The left chart: Distribution of similarity level between NPC473429 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 1393 |
0.1-0.2 | 13847 |
0.2-0.3 | 16837 |
0.3-0.4 | 9353 |
0.4-0.5 | 1213 |
0.5-0.6 | 44 |
0.6-0.7 | 8 |
0.7-0.8 | 1 |
0.8-0.85 | 0 |
0.85-0.9 | 0 |
0.9-0.95 | 0 |
0.95-1 | 1 |
  Chemically structural similarity: II. Similar Clinical/Approved Drugs
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC473429 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 601 |
0.1-0.2 | 1323 |
0.2-0.3 | 1197 |
0.3-0.4 | 4305 |
0.4-0.5 | 1566 |
0.5-0.6 | 143 |
0.6-0.7 | 15 |
0.7-0.8 | 0 |
0.8-0.85 | 0 |
0.85-0.9 | 0 |
0.9-0.95 | 0 |
0.95-1 | 0 |
Similarity Score |
Similarity Level |
Drug ID |
Developmental Stage |
0.7102 |
Intermediate Similarity |
NPD7845 |
Approved |
0.7093 |
Intermediate Similarity |
NPD7848 |
Approved |
0.7006 |
Intermediate Similarity |
NPD7846 |
Approved |
0.6968 |
Remote Similarity |
NPD5518 |
Clinical (unspecified phase) |
0.6906 |
Remote Similarity |
NPD7847 |
Approved |
0.6813 |
Remote Similarity |
NPD7849 |
Approved |
0.6667 |
Remote Similarity |
NPD6820 |
Approved |
0.6667 |
Remote Similarity |
NPD6822 |
Approved |
0.6585 |
Remote Similarity |
NPD8353 |
Approved |
0.6585 |
Remote Similarity |
NPD8355 |
Approved |
0.6538 |
Remote Similarity |
NPD6821 |
Approved |
0.6527 |
Remote Similarity |
NPD6574 |
Clinical (unspecified phase) |
0.6506 |
Remote Similarity |
NPD8354 |
Approved |
0.6467 |
Remote Similarity |
NPD5606 |
Discontinued |
0.6377 |
Remote Similarity |
NPD4321 |
Approved |
0.6216 |
Remote Similarity |
NPD1596 |
Approved |
0.6159 |
Remote Similarity |
NPD2338 |
Clinical (unspecified phase) |
0.6129 |
Remote Similarity |
NPD572 |
Clinical (unspecified phase) |
0.6102 |
Remote Similarity |
NPD5412 |
Discontinued |
0.6096 |
Remote Similarity |
NPD2039 |
Approved |
0.6096 |
Remote Similarity |
NPD2038 |
Approved |
0.6087 |
Remote Similarity |
NPD716 |
Approved |
0.6037 |
Remote Similarity |
NPD1590 |
Approved |
0.597 |
Remote Similarity |
NPD8314 |
Clinical (unspecified phase) |
0.5926 |
Remote Similarity |
NPD9108 |
Approved |
0.5922 |
Remote Similarity |
NPD5531 |
Discontinued |
0.5896 |
Remote Similarity |
NPD7822 |
Phase 1 |
0.5872 |
Remote Similarity |
NPD1854 |
Approved |
0.5851 |
Remote Similarity |
NPD2310 |
Clinical (unspecified phase) |
0.5843 |
Remote Similarity |
NPD2750 |
Approved |
0.5833 |
Remote Similarity |
NPD964 |
Approved |
0.5833 |
Remote Similarity |
NPD7765 |
Discovery |
0.5827 |
Remote Similarity |
NPD9188 |
Approved |
0.5823 |
Remote Similarity |
NPD3240 |
Phase 2 |
0.5822 |
Remote Similarity |
NPD1824 |
Discontinued |
0.581 |
Remote Similarity |
NPD4645 |
Clinical (unspecified phase) |
0.58 |
Remote Similarity |
NPD1311 |
Approved |
0.5789 |
Remote Similarity |
NPD1312 |
Approved |
0.5789 |
Remote Similarity |
NPD4644 |
Clinical (unspecified phase) |
0.5778 |
Remote Similarity |
NPD5921 |
Clinical (unspecified phase) |
0.5762 |
Remote Similarity |
NPD4674 |
Clinical (unspecified phase) |
0.5761 |
Remote Similarity |
NPD5840 |
Discontinued |
0.5756 |
Remote Similarity |
NPD1890 |
Clinical (unspecified phase) |
0.575 |
Remote Similarity |
NPD2815 |
Clinical (unspecified phase) |
0.5749 |
Remote Similarity |
NPD1938 |
Clinical (unspecified phase) |
0.5745 |
Remote Similarity |
NPD9352 |
Approved |
0.5741 |
Remote Similarity |
NPD9485 |
Approved |
0.5714 |
Remote Similarity |
NPD7969 |
Clinical (unspecified phase) |
0.5695 |
Remote Similarity |
NPD2913 |
Approved |
0.5695 |
Remote Similarity |
NPD2914 |
Approved |
0.5674 |
Remote Similarity |
NPD3093 |
Approved |
0.5669 |
Remote Similarity |
NPD2131 |
Approved |
0.5664 |
Remote Similarity |
NPD4737 |
Phase 2 |
0.5664 |
Remote Similarity |
NPD9353 |
Approved |
0.5657 |
Remote Similarity |
NPD917 |
Clinical (unspecified phase) |
0.565 |
Remote Similarity |
NPD3784 |
Discontinued |
0.5647 |
Remote Similarity |
NPD5819 |
Phase 2 |
0.5625 |
Remote Similarity |
NPD4042 |
Phase 2 |
0.5625 |
Remote Similarity |
NPD4045 |
Phase 2 |
0.5622 |
Remote Similarity |
NPD3348 |
Phase 2 |
0.5616 |
Remote Similarity |
NPD2795 |
Clinical (unspecified phase) |
0.5614 |
Remote Similarity |
NPD7017 |
Clinical (unspecified phase) |
0.5608 |
Remote Similarity |
NPD278 |
Approved |
0.5604 |
Remote Similarity |
NPD4320 |
Clinical (unspecified phase) |
0.56
|
Remote Similarity |
NPD1636 |
Approved |