NPASS Compound

Natural Product: NPC471900

Natural Product ID	NPC471900
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Lupeolic Acid
IUPAC Name	(1R,3aR,5aR,5bR,7aR,8R,9S,11aR,11bR,13aR,13bR)-9-hydroxy-3a,5a,5b,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-8-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3289105
PubChem CID	90644330
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 81 85 0 0 0 0 0 0 0 0999 V2000 -5.6683 1.3767 2.4356 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6105 0.4030 1.9906 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1165 -0.4346 2.8534 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2052 0.4947 0.5698 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4279 0.1602 -0.3102 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9978 -1.1245 -1.0448 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5536 -0.7141 -1.3387 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1432 -0.3889 0.1045 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7641 0.2038 0.0408 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.2802 0.7018 1.3512 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1357 1.2566 1.2688 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0288 0.3148 0.5322 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4859 0.0087 -0.8199 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8127 -0.7819 -0.5703 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5727 -1.9382 0.3730 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2645 -1.3877 -1.8607 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7092 -1.8216 -1.8695 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1510 1.2319 -1.6373 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4083 -0.8125 -1.6881 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7980 -0.2275 -1.7000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2666 -0.2512 -0.2388 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4858 0.6885 0.6047 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6809 2.1398 0.3128 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9149 0.4626 2.0546 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0391 -0.5401 2.1576 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1895 -0.1810 1.2794 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7391 -0.2168 -0.1530 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2332 -1.5684 -0.7060 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4350 0.8032 -0.9350 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1718 1.6440 -0.3560 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3399 0.9165 -2.3148 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7015 1.0381 1.6785 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6405 0.4742 -2.2243 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2132 2.3669 2.6683 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4065 1.5600 1.6249 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2394 0.9716 3.2979 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4509 -0.4438 3.8846 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3668 -1.1610 2.5995 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9583 1.5506 0.3223 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6323 0.9495 -1.0463 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2946 -0.1049 0.3181 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5838 -1.2998 -1.9426 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9417 -1.9677 -0.3317 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1265 -1.3853 0.6242 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8587 1.1047 -0.6068 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9234 1.5833 1.6317 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3738 0.0052 2.2087 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4934 1.2854 2.3397 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1025 2.2838 0.9328 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9742 -0.6615 1.1092 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3133 -2.7589 0.1238 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4215 -2.4441 0.1925 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7333 -1.7286 1.4262 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0860 -0.8165 -2.7646 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6654 -2.3387 -1.9958 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8790 -2.7656 -1.3355 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9941 -2.0007 -2.9278 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7338 1.1156 -2.2952 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9822 1.4652 -2.3712 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0024 2.1493 -1.0777 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4901 -1.8633 -1.4243 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9506 -0.7888 -2.7214 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4543 -0.9490 -2.2445 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8795 0.7534 -2.1526 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9573 -1.2880 0.1066 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0818 2.6978 1.0941 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3461 2.4679 -0.6775 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7045 2.4822 0.4697 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2677 1.3916 2.5350 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0930 0.0752 2.6853 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3913 -0.5107 3.2095 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6765 -1.5866 1.9967 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0036 -0.9351 1.4934 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2121 -1.8036 -0.2794 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3943 -1.4386 -1.8149 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4713 -2.3449 -0.6018 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3882 1.8753 -2.6892 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5693 0.9798 2.1466 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8725 0.3475 -3.0363 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4791 1.4481 -1.7753 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6197 0.5460 -2.7690 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 1 14 16 1 0 16 17 1 0 13 18 1 6 13 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 6 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 6 27 29 1 0 29 30 2 0 29 31 1 0 26 32 1 0 7 33 1 6 8 4 1 0 14 9 1 0 27 21 1 0 17 7 1 0 22 12 1 0 1 34 1 0 1 35 1 0 1 36 1 0 3 37 1 0 3 38 1 0 4 39 1 6 5 40 1 0 5 41 1 0 6 42 1 0 6 43 1 0 8 44 1 1 9 45 1 6 10 46 1 0 10 47 1 0 11 48 1 0 11 49 1 0 12 50 1 1 15 51 1 0 15 52 1 0 15 53 1 0 16 54 1 0 16 55 1 0 17 56 1 0 17 57 1 0 18 58 1 0 18 59 1 0 18 60 1 0 19 61 1 0 19 62 1 0 20 63 1 0 20 64 1 0 21 65 1 1 23 66 1 0 23 67 1 0 23 68 1 0 24 69 1 0 24 70 1 0 25 71 1 0 25 72 1 0 26 73 1 6 28 74 1 0 28 75 1 0 28 76 1 0 31 77 1 0 32 78 1 0 33 79 1 0 33 80 1 0 33 81 1 0 M END

Standard InCHIKey	NYJYXELDYSTZFI-SZTSEJDOSA-N
Standard InCHI	InChI=1S/C30H48O3/c1-18(2)19-10-13-26(3)16-17-28(5)20(24(19)26)8-9-21-27(4)14-12-23(31)30(7,25(32)33)22(27)11-15-29(21,28)6/h19-24,31H,1,8-17H2,2-7H3,(H,32,33)/t19-,20+,21+,22+,23-,24+,26+,27+,28+,29+,30+/m0/s1
SMILES	CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]1CC[C@H]3[C@@]([C@]1(C)CC2)(C)CC[C@@H]1[C@]3(C)CC[C@@H]([C@]1(C)C(=O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	456.36	Volume:	505.751 ? Van der Waals volume.
Dense:	0.902	LogP:	4.724 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.885 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.953 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	2.0	Rigid Bonds:	27.0
TPSA:	57.53 ? Topological Polar Surface Area.	H-Bond Acceptor:	3.0
H-Bond Donor:	2.0	Rings:	5.0
Heavy Atoms:	3.0

MedChem Properties

QED Drug-Likeness Score:	0.436	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.838	Fsp³:	0.9
MCE-18:	104.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.946	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.488	Promiscuous compounds:	0.193

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.45	MDCK Permeability:	-5.114
Pgp-inhibitor:	0.022	Pgp-substrate:	0.008
PAMPA:	0.708 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.136	30% Bioavailability (F30%):	0.089
50% Bioavailability (F50%):	0.859

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.841	MRP1:	0.989
Plasma Protein Binding (PPB):	97.074%	Volume Distribution (VD):	-0.163
Fu:	3.433% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.989	BCRP inhibitor:	0.222
BSEP inhibitor:	0.856

ADMET: Metabolism

CYP1A2-inhibitor:	0.001	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.03	CYP2C19-substrate:	0.264
CYP2C9-inhibitor:	0.549	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.71	CYP3A4-substrate:	0.978
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.242
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

3.357

Half-life (T1/2):

1.037

ADMET: Toxicity

hERG Blockers:	0.042	hERG Blockers (10um):	0.118
Human Hepatotoxicity (H-HT):	0.762	Drug-induced Liver Injury (DILI):	0.703
AMES Toxicity:	0.183	Rat Oral Acute Toxicity:	0.421
Maximum Recommended Daily Dose:	0.37	Skin Sensitization:	0.986
Carcinogencity:	0.982	Eye Corrosion:	0.813
Eye Irritation:	0.969	Respiratory Toxicity:	0.948
Drug-induced Neurotoxicity:	0.046	Ototoxicity:	0.421
Hematotoxicity:	0.546	Drug-induced Nephrotoxicity:	0.905
Genotoxicity:	0.598	RPMI-8226 Immunitoxicity:	0.019
A549 Cytotoxicity:	0.104	Hek293 Cytotoxicity:	0.255
BCF:	1.785 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.264 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.404 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.985 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33055	boswellia spp.	Species	Burseraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24844534]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1
IC50	6

Activity Type	# Activity
Individual protein	4
Cell line	1
Non-molecular	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT324	Individual protein	Cyclooxygenase-1	Ovis aries	IC50	>	10000.0	nM	PMID[18222568]
NPT31	Individual protein	Cyclooxygenase-2	Homo sapiens	IC50	>	10000.0	nM	PMID[23149304]
NPT956	Individual protein	Prostaglandin E synthase	Homo sapiens	Activity	=	43.1	%	PMID[23360104]
NPT956	Individual protein	Prostaglandin E synthase	Homo sapiens	IC50	=	8500.0	nM	PMID[8126698]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT136	Cell line	SK-N-SH	Homo sapiens	IC50	=	4100.0	nM	PMID[21970540]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	4100.0	nM	PMID[24844534]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC471900 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25546
0.1-0.2	20912
0.2-0.3	2836
0.3-0.4	430
0.4-0.5	94
0.5-0.6	30
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7049	Intermediate Similarity	NPC213832
0.6207	Remote Similarity	NPC192638
0.6207	Remote Similarity	NPC25511
0.6207	Remote Similarity	NPC600137
0.6154	Remote Similarity	NPC471901
0.5833	Remote Similarity	NPC102708
0.5714	Remote Similarity	NPC11035
0.5652	Remote Similarity	NPC252714
0.55	Remote Similarity	NPC35652
0.5484	Remote Similarity	NPC14112
0.5469	Remote Similarity	NPC269396
0.5417	Remote Similarity	NPC471902
0.5397	Remote Similarity	NPC248830
0.5397	Remote Similarity	NPC212241
0.5362	Remote Similarity	NPC57954
0.5303	Remote Similarity	NPC245866
0.5278	Remote Similarity	NPC287118
0.5238	Remote Similarity	NPC202540
0.5231	Remote Similarity	NPC66105
0.5217	Remote Similarity	NPC602347
0.5217	Remote Similarity	NPC611352
0.5161	Remote Similarity	NPC80297
0.5161	Remote Similarity	NPC146563
0.5161	Remote Similarity	NPC475727
0.5161	Remote Similarity	NPC116119
0.5152	Remote Similarity	NPC298168
0.5152	Remote Similarity	NPC143133
0.5147	Remote Similarity	NPC264317
0.5147	Remote Similarity	NPC294438
0.5143	Remote Similarity	NPC86372
0.5079	Remote Similarity	NPC43300
0.5075	Remote Similarity	NPC12774
0.5072	Remote Similarity	NPC488164
0.5072	Remote Similarity	NPC264005
0.507	Remote Similarity	NPC608351

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC471900 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6277
0.1-0.2	2791
0.2-0.3	71
0.3-0.4	10
0.4-0.5	0
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5147	Remote Similarity	NPD7520	Phase 1

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data