NPASS Compound

Natural Product: NPC302864

Natural Product ID	NPC302864
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	CYXOVJJXJAVKAX-UHFFFAOYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	120702
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001125] Steroid lactones [CHEMONTID:0001555] Cardenolides and derivatives [CHEMONTID:0001559] Cardenolide glycosides and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 83 88 0 0 0 0 0 0 0 0999 V2000 6.9025 -0.2381 2.8578 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2264 -0.0954 1.5122 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1920 -0.3482 0.3860 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5960 -1.2560 -0.6465 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1565 -0.8505 -0.9254 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3511 -0.7712 0.3560 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1588 -0.9913 1.4810 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7531 0.4760 0.4009 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3918 0.4623 0.4087 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7449 1.0607 1.6081 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2606 0.8073 1.6021 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3965 1.1556 0.3053 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3513 2.6870 0.1837 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3315 0.5386 -0.8588 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2847 0.8273 -2.1662 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7581 0.6944 -2.2440 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4704 1.2333 -1.0083 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8229 0.7780 0.2544 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1398 -0.6746 0.4850 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6106 -0.7285 0.5970 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0872 -1.1482 1.5979 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4423 -0.2658 -0.5206 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5757 -1.2311 -1.6433 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8686 0.0488 -0.0388 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7475 1.4093 0.5183 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5916 2.0889 -0.1849 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9483 1.0574 -1.0782 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4336 1.2411 -2.3427 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3902 -0.9947 0.8744 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7303 -0.7206 2.1206 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2024 -1.9317 2.7676 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6107 -2.0106 3.9853 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1234 -2.9320 1.8425 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6448 -2.4031 0.6546 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6558 -1.4952 -0.5302 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7664 1.0890 -0.8324 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2926 -1.1488 -1.8305 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8204 -2.3699 -2.2525 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5918 0.8253 -0.2462 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4175 0.4563 3.5786 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7479 -1.2779 3.2084 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0018 -0.0382 2.7629 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8852 0.9655 1.4450 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0948 -0.8329 0.8019 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6441 -2.3280 -0.3344 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1892 0.0856 -1.4840 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7565 -1.6282 -1.6211 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6105 -1.5694 0.3342 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0697 -0.6207 0.3743 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9270 2.1346 1.7386 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1305 0.5585 2.5454 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1760 1.4967 2.3821 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1077 -0.2372 1.9266 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2965 3.0098 -0.8655 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3072 3.1153 0.6064 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4583 3.1358 0.7502 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4642 -0.5485 -0.6336 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0703 1.8435 -2.5022 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1601 0.1220 -2.9257 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0921 1.3677 -3.0845 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0644 -0.3157 -2.5062 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2860 2.3514 -1.0590 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3410 1.3319 1.0929 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6847 -1.0640 1.4173 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5218 -1.8101 -1.6355 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7598 -1.9668 -1.7235 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5891 -0.6700 -2.5996 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5342 0.1360 -0.9535 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5734 1.5054 1.5856 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6546 2.0480 0.2997 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8885 2.5304 0.5367 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9346 2.9641 -0.8124 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3658 2.1341 -2.7058 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6967 0.2215 2.6531 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2901 -2.6263 -0.2232 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7036 -3.0005 0.4329 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3484 -2.3698 -0.2215 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7778 2.1750 -0.7638 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3170 0.6801 -1.7041 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3562 -2.1706 -3.2059 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0015 -3.0717 -2.4706 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5616 -2.7809 -1.5498 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7094 0.6834 -1.2333 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 20 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 24 29 1 0 29 30 2 0 30 31 1 0 31 32 2 0 31 33 1 0 33 34 1 0 19 35 1 0 14 36 1 0 4 37 1 0 37 38 1 0 3 39 1 0 7 2 1 0 36 9 1 0 18 12 1 0 27 22 1 0 34 29 1 0 27 17 1 0 1 40 1 0 1 41 1 0 1 42 1 0 2 43 1 0 3 44 1 0 4 45 1 0 5 46 1 0 5 47 1 0 6 48 1 0 9 49 1 0 10 50 1 0 10 51 1 0 11 52 1 0 11 53 1 0 13 54 1 0 13 55 1 0 13 56 1 0 14 57 1 0 15 58 1 0 15 59 1 0 16 60 1 0 16 61 1 0 17 62 1 0 18 63 1 0 19 64 1 0 23 65 1 0 23 66 1 0 23 67 1 0 24 68 1 0 25 69 1 0 25 70 1 0 26 71 1 0 26 72 1 0 28 73 1 0 30 74 1 0 34 75 1 0 34 76 1 0 35 77 1 0 36 78 1 0 36 79 1 0 38 80 1 0 38 81 1 0 38 82 1 0 39 83 1 0 M END

Standard InCHIKey	CYXOVJJXJAVKAX-UHFFFAOYSA-N
Standard InCHI	InChI=1S/C30H44O9/c1-15-25(32)21(36-4)13-23(38-15)39-18-7-9-28(2)17(12-18)5-6-20-24(28)26(33)27(34)29(3)19(8-10-30(20,29)35)16-11-22(31)37-14-16/h11,15,17-21,23-26,32-33,35H,5-10,12-14H2,1-4H3
SMILES	CC1C(C(CC(O1)OC1CCC2(C)C(CCC3C2C(C(=O)C2(C)C(CCC32O)C2=CC(=O)OC2)O)C1)OC)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	548.3	Volume:	547.3 ? Van der Waals volume.
Dense:	1.002	LogP:	1.41 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.055 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.631 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	4.0	Rigid Bonds:	33.0
TPSA:	131.75 ? Topological Polar Surface Area.	H-Bond Acceptor:	9.0
H-Bond Donor:	3.0	Rings:	6.0
Heavy Atoms:	9.0

MedChem Properties

QED Drug-Likeness Score:	0.358	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.43	Fsp³:	0.867
MCE-18:	111.429 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.019	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.015 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.19 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.072	Promiscuous compounds:	0.002

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.558	MDCK Permeability:	-5.107
Pgp-inhibitor:	0.0	Pgp-substrate:	0.871
PAMPA:	0.998 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.656
20% Bioavailability (F20%):	0.006	30% Bioavailability (F30%):	0.104
50% Bioavailability (F50%):	0.854

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.039	MRP1:	0.999
Plasma Protein Binding (PPB):	46.642%	Volume Distribution (VD):	-0.193
Fu:	57.912% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.883	BCRP inhibitor:	0.0
BSEP inhibitor:	0.222

ADMET: Metabolism

CYP1A2-inhibitor:	0.03	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.739	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.168	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.963	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.101	CYP2C8-inhibitor:	0.0
HLM stability:	0.058 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

6.97

Half-life (T1/2):

3.906

ADMET: Toxicity

hERG Blockers:	0.155	hERG Blockers (10um):	0.561
Human Hepatotoxicity (H-HT):	0.824	Drug-induced Liver Injury (DILI):	0.478
AMES Toxicity:	0.863	Rat Oral Acute Toxicity:	0.948
Maximum Recommended Daily Dose:	0.993	Skin Sensitization:	0.446
Carcinogencity:	0.742	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.748
Drug-induced Neurotoxicity:	0.339	Ototoxicity:	0.954
Hematotoxicity:	0.243	Drug-induced Nephrotoxicity:	0.451
Genotoxicity:	0.958	RPMI-8226 Immunitoxicity:	0.54
A549 Cytotoxicity:	0.245	Hek293 Cytotoxicity:	0.843
BCF:	0.698 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.764 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.581 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.481 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO9481	Strophanthus divaricatus	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9481	Strophanthus divaricatus	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO9481	Strophanthus divaricatus	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO9481	Strophanthus divaricatus	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC302864 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	14104
0.1-0.2	31220
0.2-0.3	4223
0.3-0.4	118
0.4-0.5	140
0.5-0.6	36
0.6-0.7	10
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7439	Intermediate Similarity	NPC84949
0.7439	Intermediate Similarity	NPC480562
0.7439	Intermediate Similarity	NPC74945
0.7439	Intermediate Similarity	NPC31354
0.7439	Intermediate Similarity	NPC69576
0.6778	Remote Similarity	NPC603096
0.6706	Remote Similarity	NPC99080
0.6667	Remote Similarity	NPC483822
0.6444	Remote Similarity	NPC103534
0.6444	Remote Similarity	NPC44899
0.6444	Remote Similarity	NPC304260
0.6444	Remote Similarity	NPC29639
0.6437	Remote Similarity	NPC152615
0.6136	Remote Similarity	NPC34390
0.6	Remote Similarity	NPC180079
0.5934	Remote Similarity	NPC484202
0.5824	Remote Similarity	NPC290693
0.5778	Remote Similarity	NPC477580
0.573	Remote Similarity	NPC471633
0.5714	Remote Similarity	NPC199428
0.5714	Remote Similarity	NPC109448
0.5714	Remote Similarity	NPC310341
0.5652	Remote Similarity	NPC484212
0.5591	Remote Similarity	NPC93883
0.5556	Remote Similarity	NPC99620
0.5455	Remote Similarity	NPC55532
0.5368	Remote Similarity	NPC268326
0.5368	Remote Similarity	NPC153085
0.5312	Remote Similarity	NPC72260
0.5269	Remote Similarity	NPC5311
0.5263	Remote Similarity	NPC179412
0.5263	Remote Similarity	NPC471356
0.5258	Remote Similarity	NPC173555
0.5189	Remote Similarity	NPC475419
0.5158	Remote Similarity	NPC250556
0.5152	Remote Similarity	NPC115349
0.5149	Remote Similarity	NPC486143
0.5149	Remote Similarity	NPC486142
0.5149	Remote Similarity	NPC486149
0.5143	Remote Similarity	NPC329636
0.5106	Remote Similarity	NPC479356
0.5106	Remote Similarity	NPC469750
0.5106	Remote Similarity	NPC479355
0.5104	Remote Similarity	NPC471353
0.5104	Remote Similarity	NPC305574
0.5053	Remote Similarity	NPC76572
0.5053	Remote Similarity	NPC193382
0.5049	Remote Similarity	NPC329986
0.5049	Remote Similarity	NPC140092
0.5049	Remote Similarity	NPC486146
0.5047	Remote Similarity	NPC120390

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC302864 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5908
0.1-0.2	3132
0.2-0.3	95
0.3-0.4	2
0.4-0.5	4
0.5-0.6	6
0.6-0.7	3
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6105	Remote Similarity	NPD8377	Phase 4
0.6042	Remote Similarity	NPD8378	Pre-clinical
0.6042	Remote Similarity	NPD8379	Approved
0.5591	Remote Similarity	NPD7516	Pre-clinical
0.5484	Remote Similarity	NPD8335	Phase 4
0.5312	Remote Similarity	NPD8294	Phase 4
0.5258	Remote Similarity	NPD8296	Phase 4
0.5158	Remote Similarity	NPD7507	Pre-clinical
0.5104	Remote Similarity	NPD8380	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data