NPASS Compound

Natural Product: NPC294330

Natural Product ID	NPC294330
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Garcimultiflorone D
IUPAC Name	n.a.
Synonyms	Garcimultiflorone D
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1215427
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001549] Monoterpenoids [CHEMONTID:0001564] Bicyclic monoterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 97 99 0 0 0 0 0 0 0 0999 V2000 7.5891 -1.3102 -1.2824 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2410 -1.8037 -0.8701 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1234 -1.4040 -1.5154 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8396 -1.9255 -1.0596 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8278 -0.8803 -0.6346 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6378 -1.5420 -0.1247 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4191 -0.9042 0.3599 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4750 -2.0813 0.8522 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7984 -1.9965 0.1654 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.6404 -3.2074 0.4581 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9684 -3.4308 1.8646 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5816 -4.5109 2.4957 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7926 -5.5436 1.7842 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9192 -4.7309 3.9333 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4958 -0.6618 0.3350 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6142 -0.3275 1.8234 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8946 -0.7806 -0.1647 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6615 0.3599 -0.3505 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2168 1.1000 -1.5045 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6211 0.3837 -2.7262 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1719 1.3079 -3.8048 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3784 2.0755 -3.4072 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1193 2.2472 -4.3228 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5377 0.4637 -4.8712 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2025 1.4347 0.6182 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9553 2.4251 0.7391 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0476 1.2691 1.3451 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5415 0.0166 1.4781 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1423 -0.3641 2.6448 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6765 2.3646 2.0240 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6247 1.9656 2.8565 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4600 3.7762 1.9569 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1518 4.5014 0.9852 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3965 5.8784 1.1014 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0117 6.5493 2.2274 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6072 5.8612 3.2229 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8404 4.5123 3.0993 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9984 6.5578 4.3704 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2280 7.9143 2.3989 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3587 -0.2894 -0.7826 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0397 -0.3325 -1.8990 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7217 0.2708 -1.5381 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0162 0.2304 -2.8544 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3749 1.6595 -1.0479 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1712 -2.7491 0.2723 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7145 -0.2860 -0.8705 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6798 -1.2705 -2.3935 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3827 -1.9569 -0.8671 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2539 -0.7280 -2.3099 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3420 -2.5758 -1.8477 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9579 -2.6515 -0.2026 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4161 -0.4099 0.2830 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0203 -2.3055 0.6577 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3189 -2.2916 -0.9459 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5431 -2.1319 1.9257 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0237 -3.0580 0.5262 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5721 -2.0612 -0.9421 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4640 -3.2999 -0.2369 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9509 -4.0769 0.1557 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5605 -2.7094 2.4473 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6400 -6.4291 2.4624 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3817 -5.9007 0.8914 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8276 -5.1315 1.4526 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0273 -4.8118 4.0622 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4927 -3.9281 4.5879 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4933 -5.6756 4.3094 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6871 -0.3492 2.1550 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2901 0.6941 1.9864 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9860 -0.9679 2.4521 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5529 -1.0259 0.7329 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0517 -1.6360 -0.8297 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3259 0.1802 -0.5172 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9792 1.8436 -1.1503 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3690 1.7986 -1.8280 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3049 -0.4551 -2.5548 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7368 -0.0953 -3.2561 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3217 2.5996 -2.4341 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4651 2.9206 -4.1573 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3273 1.5092 -3.5315 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1058 1.9887 -3.9775 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2987 3.3089 -3.9984 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1253 2.3057 -5.4513 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8784 -0.4150 -4.5219 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0712 -1.2667 3.0843 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4140 4.0547 0.0524 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8894 6.4140 0.3026 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3322 4.0309 3.9242 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3782 6.0586 5.1500 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5809 8.5154 2.4217 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9241 1.1143 -3.4776 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3104 -0.6957 -3.3101 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5890 1.6726 0.0385 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3675 1.9243 -1.3441 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1478 2.3460 -1.4980 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8633 -3.7779 -0.0620 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5148 -2.3731 1.0802 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1716 -2.8810 0.7220 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 7 6 1 6 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 2 3 12 13 1 0 12 14 1 0 9 15 1 0 15 16 1 0 15 17 1 0 15 18 1 0 18 19 1 6 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 21 24 1 0 18 25 1 0 25 26 2 0 25 27 1 0 27 28 2 0 28 29 1 0 27 30 1 0 30 31 2 0 30 32 1 0 32 33 2 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 2 0 36 38 1 0 35 39 1 0 18 40 1 0 40 41 2 0 5 42 1 0 42 43 2 0 42 44 1 0 2 45 1 0 28 7 1 0 37 32 1 0 40 7 1 0 1 46 1 0 1 47 1 0 1 48 1 0 3 49 1 0 4 50 1 0 4 51 1 0 5 52 1 1 6 53 1 0 6 54 1 0 8 55 1 0 8 56 1 0 9 57 1 6 10 58 1 0 10 59 1 0 11 60 1 0 13 61 1 0 13 62 1 0 13 63 1 0 14 64 1 0 14 65 1 0 14 66 1 0 16 67 1 0 16 68 1 0 16 69 1 0 17 70 1 0 17 71 1 0 17 72 1 0 19 73 1 0 19 74 1 0 20 75 1 0 20 76 1 0 22 77 1 0 22 78 1 0 22 79 1 0 23 80 1 0 23 81 1 0 23 82 1 0 24 83 1 0 29 84 1 0 33 85 1 0 34 86 1 0 37 87 1 0 38 88 1 0 39 89 1 0 43 90 1 0 43 91 1 0 44 92 1 0 44 93 1 0 44 94 1 0 45 95 1 0 45 96 1 0 45 97 1 0 M END

Standard InCHIKey	BWJVAZLOCUCVOO-DDFNXOHMSA-N
Standard InCHI	InChI=1S/C38H52O7/c1-22(2)11-13-26(24(5)6)20-37-21-27(15-12-23(3)4)36(9,10)38(34(37)44,18-17-35(7,8)45)33(43)30(32(37)42)31(41)25-14-16-28(39)29(40)19-25/h11-12,14,16,19,26-27,39-40,42,45H,5,13,15,17-18,20-21H2,1-4,6-10H3/t26-,27-,37-,38+/m1/s1
SMILES	CC(=CC[C@H](C[C@@]12C[C@@H](CC=C(C)C)C(C)(C)[C@@](CCC(C)(C)O)(C(=O)C(=C1O)C(=O)c1ccc(c(c1)O)O)C2=O)C(=C)C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	620.37	Volume:	675.302 ? Van der Waals volume.
Dense:	0.919	LogP:	5.625 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.457 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.847 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	22.0
TPSA:	132.13 ? Topological Polar Surface Area.	H-Bond Acceptor:	7.0
H-Bond Donor:	4.0	Rings:	3.0
Heavy Atoms:	7.0

MedChem Properties

QED Drug-Likeness Score:	0.061	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.687	Fsp³:	0.553
MCE-18:	107.763 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	1	PAINS Alert:	1
Colloidal aggregators:	0.927	Fluc inhibitor:	0.097 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.051 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.249 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.491	Promiscuous compounds:	0.216

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.046	MDCK Permeability:	-4.708
Pgp-inhibitor:	0.0	Pgp-substrate:	0.037
PAMPA:	0.985 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.0	30% Bioavailability (F30%):	0.0
50% Bioavailability (F50%):	0.128

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.437	MRP1:	0.898
Plasma Protein Binding (PPB):	89.759%	Volume Distribution (VD):	0.055
Fu:	12.505% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.829
OATP1B3 inhibitor:	0.033	BCRP inhibitor:	0.001
BSEP inhibitor:	0.001

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.047
CYP2C19-inhibitor:	0.984	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.987
CYP3A4-inhibitor:	0.709	CYP3A4-substrate:	0.96
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.577
HLM stability:	0.787 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

3.522

Half-life (T1/2):

1.555

ADMET: Toxicity

hERG Blockers:	0.029	hERG Blockers (10um):	0.298
Human Hepatotoxicity (H-HT):	0.665	Drug-induced Liver Injury (DILI):	0.324
AMES Toxicity:	0.203	Rat Oral Acute Toxicity:	0.278
Maximum Recommended Daily Dose:	0.385	Skin Sensitization:	0.997
Carcinogencity:	0.696	Eye Corrosion:	0.0
Eye Irritation:	0.247	Respiratory Toxicity:	0.667
Drug-induced Neurotoxicity:	0.003	Ototoxicity:	0.896
Hematotoxicity:	0.377	Drug-induced Nephrotoxicity:	0.583
Genotoxicity:	0.912	RPMI-8226 Immunitoxicity:	0.065
A549 Cytotoxicity:	0.335	Hek293 Cytotoxicity:	0.071
BCF:	1.795 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	5.29 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	7.363 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	6.887 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO5049	Garcinia multiflora	Species	Clusiaceae	Eukaryota	stems	n.a.	n.a.	PMID[12932126]
NPO5049	Garcinia multiflora	Species	Clusiaceae	Eukaryota	twigs	n.a.	n.a.	PMID[20681570]
NPO5049	Garcinia multiflora	Species	Clusiaceae	Eukaryota	Twigs and leaves	Taichung, Taiwan	1993-Aug	PMID[9322359]
NPO5049	Garcinia multiflora	Species	Clusiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO5049	Garcinia multiflora	Species	Clusiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO5049	Garcinia multiflora	Species	Clusiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO5049	Garcinia multiflora	Species	Clusiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO5049	Garcinia multiflora	Species	Clusiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1
Ratio	3

Activity Type	# Activity
Non-molecular	1
Others	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	17500.0	nM	PMID[20681570]
NPT2	Others	Unspecified	n.a.	Ratio	<=	3.0	n.a.	PMID[18955522]
NPT2	Others	Unspecified	n.a.	Ratio	>	3.0	n.a.	PMID[18955522]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC294330 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7668
0.1-0.2	40325
0.2-0.3	1751
0.3-0.4	41
0.4-0.5	28
0.5-0.6	14
0.6-0.7	17
0.7-0.8	0
0.8-0.85	1
0.85-0.9	3
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8529	High Similarity	NPC46242
0.8529	High Similarity	NPC91887
0.8529	High Similarity	NPC93556
0.8194	Intermediate Similarity	NPC469854
0.7671	Intermediate Similarity	NPC469857
0.7671	Intermediate Similarity	NPC245760
0.76	Intermediate Similarity	NPC469856
0.7467	Intermediate Similarity	NPC471971
0.7467	Intermediate Similarity	NPC471972
0.7467	Intermediate Similarity	NPC469855
0.7397	Intermediate Similarity	NPC297797
0.7286	Intermediate Similarity	NPC149773
0.7273	Intermediate Similarity	NPC471970
0.6709	Remote Similarity	NPC237441
0.6623	Remote Similarity	NPC51531
0.6582	Remote Similarity	NPC603871
0.6538	Remote Similarity	NPC165191
0.6538	Remote Similarity	NPC30846
0.6538	Remote Similarity	NPC177501
0.6486	Remote Similarity	NPC473779
0.6447	Remote Similarity	NPC289358
0.6447	Remote Similarity	NPC4289
0.6447	Remote Similarity	NPC42384
0.641	Remote Similarity	NPC114333
0.641	Remote Similarity	NPC28592
0.6329	Remote Similarity	NPC473479
0.6329	Remote Similarity	NPC50615
0.6329	Remote Similarity	NPC141650
0.6049	Remote Similarity	NPC479151
0.6024	Remote Similarity	NPC479146
0.5976	Remote Similarity	NPC5014
0.5854	Remote Similarity	NPC23667
0.5854	Remote Similarity	NPC157284
0.5732	Remote Similarity	NPC479148
0.5698	Remote Similarity	NPC482618
0.5663	Remote Similarity	NPC482621
0.5658	Remote Similarity	NPC611064
0.5632	Remote Similarity	NPC482617
0.5632	Remote Similarity	NPC482616
0.56	Remote Similarity	NPC259400
0.56	Remote Similarity	NPC130591
0.56	Remote Similarity	NPC234637
0.5488	Remote Similarity	NPC198803
0.5301	Remote Similarity	NPC473527

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC294330 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3773
0.1-0.2	5332
0.2-0.3	45
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data