NPASS Compound

Natural Product: NPC233210

Natural Product ID	NPC233210
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	CTDWCSXKZOYMNH-UHFFFAOYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001825] Polyterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 167166 0 0 0 0 0 0 0 0999 V2000 23.2217 3.8664 -1.0138 C 0 0 0 0 0 0 0 0 0 0 0 0 21.7767 3.4763 -1.3082 C 0 0 0 0 0 0 0 0 0 0 0 0 20.8890 4.6115 -1.2100 C 0 0 0 0 0 0 0 0 0 0 0 0 19.8957 4.8128 -0.4168 C 0 0 0 0 0 0 0 0 0 0 0 0 19.3150 3.9950 0.6524 C 0 0 0 0 0 0 0 0 0 0 0 0 19.9412 2.7200 0.9821 C 0 0 0 0 0 0 0 0 0 0 0 0 19.4165 1.5358 0.8908 C 0 0 0 0 0 0 0 0 0 0 0 0 18.0535 1.2466 0.4249 C 0 0 0 0 0 0 0 0 0 0 0 0 17.2752 0.5380 1.4636 C 0 0 0 0 0 0 0 0 0 0 0 0 16.7307 -0.6370 1.3503 C 0 0 0 0 0 0 0 0 0 0 0 0 16.8059 -1.4660 0.1368 C 0 0 0 0 0 0 0 0 0 0 0 0 15.3857 -1.7375 -0.3742 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7542 -0.3713 -0.5922 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3769 -0.4775 -1.1587 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4977 -1.3065 -0.3027 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3416 -0.7744 1.0807 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4242 -1.7299 1.8230 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0980 -1.7552 1.1822 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6696 -0.8968 0.3579 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2367 -2.7848 1.4823 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9503 -2.9767 0.9771 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9416 -1.9776 1.3277 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2496 -1.2066 0.5326 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4410 -1.2685 -0.9349 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1877 -0.2721 1.0641 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9219 -0.7007 0.3485 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7218 0.0672 0.7046 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6353 -0.5298 1.1027 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6139 -2.0136 1.2005 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4002 0.2172 1.4386 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7796 -0.1906 0.6558 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7970 -0.0241 -0.7671 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1850 0.6444 -1.6852 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9369 1.6362 -1.4599 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5063 0.5265 -3.1312 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6495 -0.3186 -3.4965 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9322 0.2532 -3.0476 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9508 -0.4309 -2.5959 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8750 -1.9186 -2.4959 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1979 0.2995 -2.2414 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5405 0.0678 -0.7661 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7842 0.8420 -0.5417 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9040 0.3197 -0.1486 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1000 1.2581 0.0314 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0954 -1.0893 0.1899 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0954 -1.7998 -0.7315 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3027 -3.1837 -0.3006 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4258 -3.8162 -0.0385 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3843 -5.2748 0.4071 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7363 -3.1656 -0.2159 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.5415 -3.0611 1.0678 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.8682 -2.4049 0.7473 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.0120 -2.9895 1.0419 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.9972 -4.3109 1.7006 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.3010 -2.3599 0.7010 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.0270 -1.0330 -0.0100 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.3238 -0.4323 -0.3697 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.7308 0.7408 -0.0117 C 0 0 0 0 0 0 0 0 0 0 0 0 -19.1058 1.1688 -0.4942 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.9468 1.6596 0.8335 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.6977 2.9070 0.0009 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.9053 3.8511 0.8432 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.4017 5.0393 1.0904 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.7214 5.4201 0.5373 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.6115 5.9878 1.9360 C 0 0 0 0 0 0 0 0 0 0 0 0 23.5008 3.3637 -0.0744 H 0 0 0 0 0 0 0 0 0 0 0 0 23.3058 4.9783 -0.9617 H 0 0 0 0 0 0 0 0 0 0 0 0 23.8676 3.5288 -1.8292 H 0 0 0 0 0 0 0 0 0 0 0 0 21.4388 2.5813 -0.8111 H 0 0 0 0 0 0 0 0 0 0 0 0 21.7391 3.1704 -2.4264 H 0 0 0 0 0 0 0 0 0 0 0 0 21.0787 5.4693 -1.9376 H 0 0 0 0 0 0 0 0 0 0 0 0 19.3193 5.8065 -0.5225 H 0 0 0 0 0 0 0 0 0 0 0 0 18.2125 3.9195 0.4650 H 0 0 0 0 0 0 0 0 0 0 0 0 19.3566 4.6339 1.6142 H 0 0 0 0 0 0 0 0 0 0 0 0 20.9895 2.8152 1.3868 H 0 0 0 0 0 0 0 0 0 0 0 0 20.0167 0.6581 1.1810 H 0 0 0 0 0 0 0 0 0 0 0 0 18.1180 0.6297 -0.5094 H 0 0 0 0 0 0 0 0 0 0 0 0 17.4797 2.1653 0.1165 H 0 0 0 0 0 0 0 0 0 0 0 0 17.1633 1.0845 2.4210 H 0 0 0 0 0 0 0 0 0 0 0 0 16.1798 -1.0128 2.2447 H 0 0 0 0 0 0 0 0 0 0 0 0 17.2100 -2.4888 0.3778 H 0 0 0 0 0 0 0 0 0 0 0 0 17.3282 -1.0106 -0.7030 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8690 -2.2968 0.4285 H 0 0 0 0 0 0 0 0 0 0 0 0 15.4303 -2.3440 -1.2913 H 0 0 0 0 0 0 0 0 0 0 0 0 15.3724 0.2471 -1.2757 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7694 0.1350 0.3895 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9101 0.5270 -1.2723 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4063 -0.8959 -2.1908 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9631 -2.3517 -0.2845 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5180 -1.5011 -0.8119 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7987 0.1881 1.0164 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2824 -0.6042 1.6041 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8815 -2.7521 1.6822 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3741 -1.5271 2.8915 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0721 -3.0164 -0.1490 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6507 -4.0170 1.3178 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7380 -1.8607 2.4147 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8203 -2.0863 -1.3909 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4751 -1.4226 -1.2600 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0312 -0.3198 -1.3830 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4154 0.7804 0.8990 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0865 -0.5025 2.1532 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1118 -0.5423 -0.7374 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7681 -1.7569 0.6023 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7827 1.1679 0.6336 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6570 -2.4086 1.6144 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3853 -2.3466 1.9578 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9100 -2.5126 0.2485 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5413 1.3172 1.5143 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1213 -0.0361 2.5318 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9210 -1.3173 0.9266 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7273 0.2323 1.1494 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5980 -0.7235 -1.2379 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7440 2.4639 -2.2244 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9138 2.1407 -0.5137 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9104 1.2275 -1.7712 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7280 1.5654 -3.5465 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4217 0.1671 -3.6949 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6364 -0.4323 -4.6214 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5431 -1.3826 -3.1215 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0573 1.3613 -3.0881 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4438 -2.1640 -1.5094 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2565 -2.3809 -3.2716 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9117 -2.3483 -2.4786 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0511 1.3891 -2.3638 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0471 0.0146 -2.8874 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7183 0.4203 -0.1222 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6931 -1.0000 -0.5920 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7811 1.9381 -0.7117 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7196 2.2736 0.1579 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5732 0.9469 0.9863 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8220 1.1336 -0.7748 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6227 -1.0902 1.2059 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1871 -1.6543 0.3640 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5267 -1.8690 -1.7150 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9852 -1.2033 -0.8854 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3700 -3.7788 -0.1785 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1630 -5.7678 -0.2083 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3920 -5.7132 0.2356 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7363 -5.3116 1.4583 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5976 -2.1401 -0.5809 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3416 -3.6747 -1.0107 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0204 -2.4736 1.8295 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7213 -4.0775 1.4546 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7730 -1.4408 0.2616 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.4152 -4.3187 2.6374 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.0281 -4.6031 1.9623 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.6054 -5.0913 1.0174 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.9504 -3.0074 0.0852 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.8202 -2.0918 1.6646 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.4455 -1.2735 -0.9548 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.4072 -0.3745 0.6093 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.9749 -1.0905 -1.0072 H 0 0 0 0 0 0 0 0 0 0 0 0 -18.9688 1.6640 -1.4586 H 0 0 0 0 0 0 0 0 0 0 0 0 -19.7626 0.3011 -0.6175 H 0 0 0 0 0 0 0 0 0 0 0 0 -19.4942 1.8460 0.3014 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.5679 2.0259 1.7118 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.0493 1.2508 1.2654 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.6303 3.3550 -0.3476 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.0953 2.6863 -0.9100 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.9334 3.5581 1.2480 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.9502 6.4829 0.7784 H 0 0 0 0 0 0 0 0 0 0 0 0 -18.5176 4.7315 0.8598 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.6420 5.3763 -0.5730 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.2979 6.6381 2.5198 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.9731 6.5628 1.2350 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.9134 5.4651 2.6217 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 3 4 5 1 0 5 6 1 0 6 7 2 3 7 8 1 0 8 9 1 0 9 10 2 3 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 20 21 1 0 21 22 1 0 22 23 2 3 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 2 3 28 29 1 0 28 30 1 0 30 31 1 0 31 32 1 0 32 33 2 3 33 34 1 0 33 35 1 0 35 36 1 0 36 37 1 0 37 38 2 3 38 39 1 0 38 40 1 0 40 41 1 0 41 42 1 0 42 43 2 3 43 44 1 0 43 45 1 0 45 46 1 0 46 47 1 0 47 48 2 3 48 49 1 0 48 50 1 0 50 51 1 0 51 52 1 0 52 53 2 3 53 54 1 0 53 55 1 0 55 56 1 0 56 57 1 0 57 58 2 3 58 59 1 0 58 60 1 0 60 61 1 0 61 62 1 0 62 63 2 3 63 64 1 0 63 65 1 0 1 66 1 0 1 67 1 0 1 68 1 0 2 69 1 0 2 70 1 0 3 71 1 0 4 72 1 0 5 73 1 0 5 74 1 0 6 75 1 0 7 76 1 0 8 77 1 0 8 78 1 0 9 79 1 0 10 80 1 0 11 81 1 0 11 82 1 0 12 83 1 0 12 84 1 0 13 85 1 0 13 86 1 0 14 87 1 0 14 88 1 0 15 89 1 0 15 90 1 0 16 91 1 0 16 92 1 0 17 93 1 0 17 94 1 0 21 95 1 0 21 96 1 0 22 97 1 0 24 98 1 0 24 99 1 0 24100 1 0 25101 1 0 25102 1 0 26103 1 0 26104 1 0 27105 1 0 29106 1 0 29107 1 0 29108 1 0 30109 1 0 30110 1 0 31111 1 0 31112 1 0 32113 1 0 34114 1 0 34115 1 0 34116 1 0 35117 1 0 35118 1 0 36119 1 0 36120 1 0 37121 1 0 39122 1 0 39123 1 0 39124 1 0 40125 1 0 40126 1 0 41127 1 0 41128 1 0 42129 1 0 44130 1 0 44131 1 0 44132 1 0 45133 1 0 45134 1 0 46135 1 0 46136 1 0 47137 1 0 49138 1 0 49139 1 0 49140 1 0 50141 1 0 50142 1 0 51143 1 0 51144 1 0 52145 1 0 54146 1 0 54147 1 0 54148 1 0 55149 1 0 55150 1 0 56151 1 0 56152 1 0 57153 1 0 59154 1 0 59155 1 0 59156 1 0 60157 1 0 60158 1 0 61159 1 0 61160 1 0 62161 1 0 64162 1 0 64163 1 0 64164 1 0 65165 1 0 65166 1 0 65167 1 0 M END

Standard InCHIKey	CTDWCSXKZOYMNH-UHFFFAOYSA-N
Standard InCHI	InChI=1S/C63H102O2/c1-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-51-63(64)65-53-52-62(11)50-34-49-61(10)48-33-47-60(9)46-32-45-59(8)44-31-43-58(7)42-30-41-57(6)40-29-39-56(5)38-28-37-55(4)36-27-35-54(2)3/h13-14,16-17,19-20,35,37,39,41,43,45,47,49,52H,12,15,18,21-34,36,38,40,42,44,46,48,50-51,53H2,1-11H3
SMILES	CCC=CCC=CCC=CCCCCCCCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	890.79	Volume:	1081.51 ? Van der Waals volume.
Dense:	0.824	LogP:	21.729 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	9.468 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-18.906 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	40.0	Rigid Bonds:	13.0
TPSA:	26.3 ? Topological Polar Surface Area.	H-Bond Acceptor:	2.0
H-Bond Donor:	0.0	Rings:	0.0
Heavy Atoms:	2.0

MedChem Properties

QED Drug-Likeness Score:	0.035	GASA:	0.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	3.996	Fsp³:	0.603
MCE-18:	0.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	1.0	Fluc inhibitor:	0.013 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.0 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.667	Promiscuous compounds:	0.077

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.92	MDCK Permeability:	-4.774
Pgp-inhibitor:	1.0	Pgp-substrate:	0.012
PAMPA:	0.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.027	30% Bioavailability (F30%):	0.08
50% Bioavailability (F50%):	0.993

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.975	MRP1:	1.0
Plasma Protein Binding (PPB):	98.55%	Volume Distribution (VD):	0.11
Fu:	0.558% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.993
OATP1B3 inhibitor:	0.898	BCRP inhibitor:	0.038
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	1.0
CYP2C19-inhibitor:	0.998	CYP2C19-substrate:	0.001
CYP2C9-inhibitor:	1.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	1.0	CYP2D6-substrate:	1.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	1.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.999 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

5.856

Half-life (T1/2):

0.868

ADMET: Toxicity

hERG Blockers:	0.162	hERG Blockers (10um):	0.636
Human Hepatotoxicity (H-HT):	0.031	Drug-induced Liver Injury (DILI):	0.0
AMES Toxicity:	0.016	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.048	Skin Sensitization:	1.0
Carcinogencity:	0.048	Eye Corrosion:	0.94
Eye Irritation:	0.956	Respiratory Toxicity:	0.81
Drug-induced Neurotoxicity:	0.083	Ototoxicity:	0.235
Hematotoxicity:	0.011	Drug-induced Nephrotoxicity:	0.217
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.037
A549 Cytotoxicity:	0.093	Hek293 Cytotoxicity:	0.01
BCF:	-0.458 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	5.842 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	8.665 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	7.093 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO25715	Senna siamea	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10757709]
NPO2130	Ehretia dicksonii	Species	Ehretiaceae	Eukaryota	n.a.	leaf	n.a.	PMID[10830513]
NPO2130	Ehretia dicksonii	Species	Ehretiaceae	Eukaryota	n.a.	twig	n.a.	PMID[10830513]
NPO2130	Ehretia dicksonii	Species	Ehretiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10830513]
NPO6774	Khaya senegalensis	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12193039]
NPO25715	Senna siamea	Species	Fabaceae	Eukaryota	n.a.	leaf	n.a.	PMID[17685627]
NPO1103	Dioscorea japonica	Species	Dioscoreaceae	Eukaryota	rhizomes	n.a.	n.a.	PMID[21353549]
NPO13504	Lotus japonicus	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21510636]
NPO25715	Senna siamea	Species	Fabaceae	Eukaryota	Stems	n.a.	n.a.	PMID[23078294]
NPO6774	Khaya senegalensis	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[23210623]
NPO25715	Senna siamea	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[23513740]
NPO14089	Hypericum ascyron	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[30379546]
NPO14089	Hypericum ascyron	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[31596079]
NPO11882	Cedrus libani	Species	Pinaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32092041]
NPO13076	Cephalaria grossheimii	Species	Caprifoliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO25715	Senna siamea	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13504	Lotus japonicus	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO14615	Streptomyces paulus	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6179	Aframomum amaniense	Species	Zingiberaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO14504	Alectoria divergens	Species	Parmeliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO14200	Aristolochia zollingeriana	Species	Aristolochiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO3199	Balanophora involucrata	Species	Balanophoraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1661	Bartramia pomiformis	Species	Bartramiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7752	Beilschmiedia anacardioides	Species	Lauraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO11882	Cedrus libani	Species	Pinaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6774	Khaya senegalensis	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO25774	Virola multinervia	Species	Myristicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO10012	Triaenophora rupestris	Species	Orobanchaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO10865	Sextonia rubra	Species	Lauraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13907	Senecio renardii	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO14289	Pieris napi	Species	Pieridae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12414	Penicillium paxilli	Species	Aspergillaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7169	Nama hispidum	Species	Namaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13701	Melaleuca rhaphiophylla	Species	Myrtaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO3458	Lupinus verbasciformis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO10389	Larix cajanderi	Species	Pinaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12234	Khaya ivorensis	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12061	Justicia paniculata	Species	Acanthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12910	Ixeris stolonifera	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12069	Isaria felina	Species	Cordycipitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO14089	Hypericum ascyron	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO2130	Ehretia dicksonii	Species	Ehretiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1103	Dioscorea japonica	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9669	Dictyopteris acrostichoides	Species	Dictyotaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12585	Craspidospermum verticillatum	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21498	Coccus ilicis	Species	Coccidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12754	Cerinthe minor	Species	Boraginaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13907	Senecio renardii	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO1103	Dioscorea japonica	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO25774	Virola multinervia	Species	Myristicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO14089	Hypericum ascyron	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO3199	Balanophora involucrata	Species	Balanophoraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO1103	Dioscorea japonica	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO25774	Virola multinervia	Species	Myristicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO14089	Hypericum ascyron	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO25715	Senna siamea	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO13907	Senecio renardii	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO14089	Hypericum ascyron	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO1103	Dioscorea japonica	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO14504	Alectoria divergens	Species	Parmeliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO14200	Aristolochia zollingeriana	Species	Aristolochiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13504	Lotus japonicus	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO14089	Hypericum ascyron	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12910	Ixeris stolonifera	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13907	Senecio renardii	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO1661	Bartramia pomiformis	Species	Bartramiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12069	Isaria felina	Species	Cordycipitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13701	Melaleuca rhaphiophylla	Species	Myrtaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO25715	Senna siamea	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO1103	Dioscorea japonica	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12414	Penicillium paxilli	Species	Aspergillaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO25774	Virola multinervia	Species	Myristicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO3199	Balanophora involucrata	Species	Balanophoraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO2130	Ehretia dicksonii	Species	Ehretiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO9669	Dictyopteris acrostichoides	Species	Dictyotaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO3458	Lupinus verbasciformis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO21498	Coccus ilicis	Species	Coccidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO6179	Aframomum amaniense	Species	Zingiberaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12585	Craspidospermum verticillatum	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12061	Justicia paniculata	Species	Acanthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13076	Cephalaria grossheimii	Species	Caprifoliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO6774	Khaya senegalensis	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12234	Khaya ivorensis	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO14615	Streptomyces paulus	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	Database[UNPD]
NPO12754	Cerinthe minor	Species	Boraginaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO11882	Cedrus libani	Species	Pinaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO10865	Sextonia rubra	Species	Lauraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO10389	Larix cajanderi	Species	Pinaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7752	Beilschmiedia anacardioides	Species	Lauraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7169	Nama hispidum	Species	Namaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO10012	Triaenophora rupestris	Species	Orobanchaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO14289	Pieris napi	Species	Pieridae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC233210 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27166
0.1-0.2	20836
0.2-0.3	1659
0.3-0.4	156
0.4-0.5	30
0.5-0.6	7
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.6136	Remote Similarity	NPC10316
0.6136	Remote Similarity	NPC135698
0.6136	Remote Similarity	NPC200845
0.6038	Remote Similarity	NPC34883
0.5909	Remote Similarity	NPC197467
0.5455	Remote Similarity	NPC47946
0.5455	Remote Similarity	NPC26600
0.5435	Remote Similarity	NPC28779
0.54	Remote Similarity	NPC271921
0.5333	Remote Similarity	NPC139545
0.5094	Remote Similarity	NPC473772

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC233210 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7588
0.1-0.2	1476
0.2-0.3	73
0.3-0.4	8
0.4-0.5	2
0.5-0.6	2
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6591	Remote Similarity	NPD6927	Phase 3
0.5333	Remote Similarity	NPD5343	Phase 4
0.5106	Remote Similarity	NPD6096	Phase 4

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data