NPASS Compound

Natural Product: NPC198803

Natural Product ID	NPC198803
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	BRKJGVUPNGKMRP-IIAGFODCSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001549] Monoterpenoids [CHEMONTID:0001564] Bicyclic monoterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 93 95 0 0 0 0 0 0 0 0999 V2000 5.2664 3.1587 2.7669 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3727 2.7115 1.6324 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2234 1.4493 1.3419 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3389 0.9412 0.2137 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3124 0.0626 0.8027 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3169 -0.6308 -0.0149 C 0 0 1 0 0 0 0 0 0 0 0 0 1.9617 -1.4911 -1.1213 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5541 -1.6522 0.8237 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2499 -2.9553 0.9869 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5450 -3.0495 1.6235 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7286 -3.6421 2.8209 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0880 -3.6906 3.3933 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6083 -4.2453 3.5797 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8460 -1.9453 0.4481 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3634 -1.5734 -0.8907 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6923 -2.7394 -1.7884 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7213 -3.6460 -1.2752 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8077 -4.0105 -1.9257 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0476 -3.4883 -3.2920 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8269 -4.9363 -1.3457 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5308 -0.6509 -0.7078 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1768 0.4868 -0.0113 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2154 1.3796 0.3527 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4263 1.0146 0.0707 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0677 2.6600 1.0116 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2337 3.2389 1.5397 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2147 4.4621 2.1220 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0407 5.1808 2.2143 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8712 4.6616 1.7131 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9228 3.3971 1.1168 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7056 5.3785 1.8062 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7747 0.5804 0.3713 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4467 0.9148 1.5294 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3023 0.2495 -0.6745 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7164 1.4948 -1.3271 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4396 2.1830 -2.0370 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3606 2.4960 -3.3358 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8373 2.2035 -4.1668 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5233 3.1650 -3.9736 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3830 -0.7003 -1.6441 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1784 -0.7472 -2.8115 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7933 -0.8341 -1.1356 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6869 3.7735 0.8786 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4146 2.2941 3.4346 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2356 3.5260 2.3879 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7473 3.9851 3.2606 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7701 0.7028 1.9479 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1084 1.7648 -0.4115 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0972 0.3213 -0.3908 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7766 0.7597 1.5771 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8196 -0.6287 1.5395 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9769 -1.8164 -0.8823 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2429 -2.2805 -1.3837 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0327 -0.8603 -2.0548 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5780 -1.1844 1.8643 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5357 -3.5528 1.6798 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1735 -3.5993 0.0592 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4417 -2.6869 1.1574 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5378 -4.6949 3.2234 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7822 -2.9475 2.9010 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0766 -3.4987 4.4911 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1536 -5.1063 3.0230 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7932 -3.5189 3.7824 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9577 -4.6119 4.5486 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0513 -3.0687 0.5171 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5247 -1.5616 1.2370 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0752 -2.3451 -2.7775 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7937 -3.3630 -2.0035 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6200 -4.0864 -0.2612 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3104 -2.4238 -3.2410 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9209 -4.0078 -3.7601 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1319 -3.6508 -3.9040 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0070 -5.8005 -2.0008 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7900 -4.3700 -1.2775 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4789 -5.2962 -0.3475 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1514 2.6528 1.4615 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1646 4.8509 2.5123 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0583 6.1564 2.6865 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0106 3.0553 0.7033 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3209 5.7766 2.6560 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5265 1.4832 -2.0330 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9803 2.2445 -0.5117 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3221 2.4085 -1.4923 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7516 2.7087 -5.1518 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0010 1.1427 -4.3814 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7242 2.6863 -3.6625 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2379 3.6672 -4.9295 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9745 3.9260 -3.3043 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2733 2.3843 -4.2696 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1327 -0.3781 -1.9664 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6828 3.4420 0.5929 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6178 4.7123 1.4825 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3153 4.0727 -0.0098 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 6 5 1 1 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 2 3 11 12 1 0 11 13 1 0 8 14 1 0 14 15 1 0 15 16 1 6 16 17 1 0 17 18 2 3 18 19 1 0 18 20 1 0 15 21 1 0 21 22 2 0 22 23 1 0 23 24 2 0 23 25 1 0 25 26 2 0 26 27 1 0 27 28 2 0 28 29 1 0 29 30 2 0 29 31 1 0 22 32 1 0 32 33 2 0 32 34 1 0 34 35 1 6 35 36 1 0 36 37 2 3 37 38 1 0 37 39 1 0 34 40 1 0 40 41 2 0 21 42 1 0 2 43 1 0 34 6 1 0 40 15 1 0 30 25 1 0 1 44 1 0 1 45 1 0 1 46 1 0 3 47 1 0 4 48 1 0 4 49 1 0 5 50 1 0 5 51 1 0 7 52 1 0 7 53 1 0 7 54 1 0 8 55 1 1 9 56 1 0 9 57 1 0 10 58 1 0 12 59 1 0 12 60 1 0 12 61 1 0 13 62 1 0 13 63 1 0 13 64 1 0 14 65 1 0 14 66 1 0 16 67 1 0 16 68 1 0 17 69 1 0 19 70 1 0 19 71 1 0 19 72 1 0 20 73 1 0 20 74 1 0 20 75 1 0 26 76 1 0 27 77 1 0 28 78 1 0 30 79 1 0 31 80 1 0 35 81 1 0 35 82 1 0 36 83 1 0 38 84 1 0 38 85 1 0 38 86 1 0 39 87 1 0 39 88 1 0 39 89 1 0 42 90 1 0 43 91 1 0 43 92 1 0 43 93 1 0 M END

Standard InCHIKey	BRKJGVUPNGKMRP-IIAGFODCSA-N
Standard InCHI	InChI=1S/C38H50O5/c1-24(2)12-11-19-36(9)29(16-15-25(3)4)23-37(20-17-26(5)6)33(41)31(32(40)28-13-10-14-30(39)22-28)34(42)38(36,35(37)43)21-18-27(7)8/h10,12-15,17-18,22,29,39,41H,11,16,19-21,23H2,1-9H3/t29-,36+,37+,38-/m1/s1
SMILES	CC(=CCC[C@@]1(C)[C@H](CC=C(C)C)C[C@@]2(CC=C(C)C)C(=C(C(=O)c3cccc(c3)O)C(=O)[C@]1(CC=C(C)C)C2=O)O)C

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40144	Garcinia schomburgkiana	Species	Clusiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[27409517]
NPO40144	Garcinia schomburgkiana	Species	Clusiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Individual protein	1
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT3732	Individual protein	DNA polymerase lambda	Homo sapiens	IC50	=	5700.0	nM	PMID[27409517]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	IC50	=	6500.0	nM	PMID[27409517]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC198803 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6880
0.1-0.2	40524
0.2-0.3	2280
0.3-0.4	96
0.4-0.5	32
0.5-0.6	19
0.6-0.7	15
0.7-0.8	0
0.8-0.85	3
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8971	High Similarity	NPC25736
0.8485	Intermediate Similarity	NPC289358
0.8485	Intermediate Similarity	NPC4289
0.8485	Intermediate Similarity	NPC42384
0.7778	Intermediate Similarity	NPC5014
0.7639	Intermediate Similarity	NPC23667
0.7639	Intermediate Similarity	NPC157284
0.7162	Intermediate Similarity	NPC482621
0.7143	Intermediate Similarity	NPC482618
0.7051	Intermediate Similarity	NPC482617
0.7051	Intermediate Similarity	NPC482616
0.6986	Remote Similarity	NPC48949
0.6857	Remote Similarity	NPC149773
0.6842	Remote Similarity	NPC603871
0.6579	Remote Similarity	NPC165191
0.6579	Remote Similarity	NPC177501
0.6522	Remote Similarity	NPC259400
0.6522	Remote Similarity	NPC130591
0.6522	Remote Similarity	NPC234637
0.6447	Remote Similarity	NPC114333
0.6447	Remote Similarity	NPC28592
0.6447	Remote Similarity	NPC51531
0.6364	Remote Similarity	NPC473479
0.6364	Remote Similarity	NPC50615
0.6364	Remote Similarity	NPC141650
0.6154	Remote Similarity	NPC30846
0.5974	Remote Similarity	NPC46242
0.5974	Remote Similarity	NPC91887
0.5974	Remote Similarity	NPC93556
0.5897	Remote Similarity	NPC297797
0.589	Remote Similarity	NPC611064
0.575	Remote Similarity	NPC469857
0.575	Remote Similarity	NPC245760
0.561	Remote Similarity	NPC471971
0.561	Remote Similarity	NPC471972
0.561	Remote Similarity	NPC469855
0.5488	Remote Similarity	NPC294330
0.5357	Remote Similarity	NPC237441
0.5357	Remote Similarity	NPC469856
0.5294	Remote Similarity	NPC471970
0.5238	Remote Similarity	NPC469854
0.5238	Remote Similarity	NPC482619
0.5181	Remote Similarity	NPC479148
0.5119	Remote Similarity	NPC479151
0.5063	Remote Similarity	NPC473779

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC198803 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3181
0.1-0.2	5895
0.2-0.3	74
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data