NPASS Compound

Natural Product: NPC174922

Natural Product ID	NPC174922
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	SNNRXIOWEMKFFZ-JRBJUOCRSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	102063005
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids [CHEMONTID:0002380] Limonoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 92 99 0 0 0 0 0 0 0 0999 V2000 -4.6073 5.0899 -1.9125 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0339 3.8067 -1.4047 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6929 2.9952 -0.6157 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0661 3.3548 -0.2030 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0877 1.7686 -0.1520 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7726 1.0023 0.6159 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8188 1.3077 -0.4466 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2170 0.1575 -0.0259 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2051 -0.9749 -1.0591 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5834 -2.2899 -0.3557 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0265 -2.2579 1.0791 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0423 -2.1903 2.1300 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2211 -3.5522 1.3233 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0360 -3.2109 1.8900 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0453 -1.8379 2.0821 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8969 -1.3073 1.0860 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.0893 0.1227 0.9235 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.4374 1.0591 2.0120 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1305 2.3395 1.4381 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0699 2.1656 0.7576 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2591 0.6855 0.5932 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4055 0.1879 1.4024 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5142 0.6004 2.8215 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4043 -1.3514 1.5565 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6072 -2.0023 0.3854 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7253 0.3821 0.6153 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0145 0.0288 1.3287 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0631 0.5890 0.3414 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4790 -0.0197 -0.8981 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9784 0.3110 -0.7120 C 0 0 1 0 0 0 0 0 0 0 0 0 2.3322 0.3374 -2.0224 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8619 1.6447 -0.0634 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7544 -1.4826 -0.8563 C 0 0 1 0 0 0 0 0 0 0 0 0 6.1337 -1.6751 -1.4046 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9163 -1.9941 -0.3946 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2366 -2.0434 0.7846 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8467 -2.0068 0.5242 C 0 0 1 0 0 0 0 0 0 0 0 0 4.2708 -1.2783 1.5062 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8871 -2.2207 -1.6658 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1328 2.9264 -0.5053 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4777 2.6699 -1.5700 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9428 4.0686 -0.5870 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0113 4.8207 -1.8123 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1278 2.7748 1.4920 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1500 -3.3995 -1.0746 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0925 -4.3094 -1.5440 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3222 -4.1505 -1.3333 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6988 -5.5242 -2.3235 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8675 5.6041 -2.5585 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7625 5.7776 -1.0360 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5820 4.9524 -2.3807 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0370 3.5321 -1.6994 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7604 2.6057 -0.6439 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2036 3.2565 0.9066 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2886 4.3818 -0.4904 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0559 -0.2820 0.6608 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0420 -0.7410 -1.7722 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3007 -1.0334 -1.6416 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6878 -2.2477 -0.2281 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0710 -2.1988 1.6737 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0101 -1.3293 2.8129 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0564 -3.0943 2.8072 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0737 -4.0893 0.3593 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7752 -4.2429 1.9773 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1471 -1.6335 3.1190 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3774 -1.5911 0.0803 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5537 1.1259 2.1623 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0349 0.9131 2.9925 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4207 0.5148 -0.4738 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0212 -0.1273 3.5595 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1975 1.5460 3.1878 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5808 0.4989 3.2136 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1362 -1.6387 2.2972 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0705 -2.8497 0.4641 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2276 0.6241 2.2305 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0741 0.2699 0.5770 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9474 1.6910 0.2617 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8813 0.4432 -1.8155 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0805 0.3358 -2.8866 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5995 -0.4648 -2.2388 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8064 1.2951 -2.1872 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4849 -1.5845 -2.4233 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9925 -2.2005 -0.4695 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5326 -3.0958 0.5657 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2652 -2.2014 -2.5796 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2442 5.6002 -1.8269 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8972 4.1630 -2.6939 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0069 5.3005 -1.8786 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7943 3.5737 1.9283 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3970 -5.6212 -3.1860 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8084 -6.4409 -1.7148 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6828 -5.4148 -2.7583 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 1 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 1 22 24 1 0 24 25 1 0 22 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 6 30 32 1 0 29 33 1 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 1 0 37 38 1 0 33 39 1 6 20 40 1 0 40 41 2 0 40 42 1 0 42 43 1 0 20 44 1 1 10 45 1 0 45 46 1 0 46 47 2 0 46 48 1 0 17 8 1 0 30 26 1 0 37 33 1 0 16 11 1 0 21 17 1 0 26 32 1 6 24 15 1 0 38 27 1 0 1 49 1 0 1 50 1 0 1 51 1 0 2 52 1 0 4 53 1 0 4 54 1 0 4 55 1 0 8 56 1 1 9 57 1 0 9 58 1 0 10 59 1 1 12 60 1 0 12 61 1 0 12 62 1 0 13 63 1 0 13 64 1 0 15 65 1 1 16 66 1 6 18 67 1 0 18 68 1 0 21 69 1 6 23 70 1 0 23 71 1 0 23 72 1 0 24 73 1 1 25 74 1 0 27 75 1 1 28 76 1 0 28 77 1 0 29 78 1 6 31 79 1 0 31 80 1 0 31 81 1 0 34 82 1 0 35 83 1 0 37 84 1 6 39 85 1 0 43 86 1 0 43 87 1 0 43 88 1 0 44 89 1 0 48 90 1 0 48 91 1 0 48 92 1 0 M END

Standard InCHIKey	SNNRXIOWEMKFFZ-JRBJUOCRSA-N
Standard InCHI	InChI=1S/C34H44O14/c1-8-15(2)24(37)46-19-12-18(45-16(3)35)28(4)13-43-21-22(28)31(19)14-44-33(40,26(38)41-7)25(31)29(5,23(21)36)34-20-11-17(30(34,6)48-34)32(39)9-10-42-27(32)47-20/h8-10,17-23,25,27,36,39-40H,11-14H2,1-7H3/b15-8+/t17-,18-,19+,20+,21-,22+,23-,25+,27+,28-,29-,30+,31+,32+,33+,34+/m1/s1
SMILES	C/C=C(C)/C(=O)O[C@H]1C[C@H]([C@@]2(C)CO[C@@H]3[C@@H]2[C@@]21CO[C@@]([C@H]2[C@@](C)([C@@H]3O)[C@@]12[C@@H]3C[C@H]([C@]1(C)O2)[C@]1(C=CO[C@H]1O3)O)(C(=O)OC)O)OC(=O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	676.27	Volume:	638.049 ? Van der Waals volume.
Dense:	1.06	LogP:	0.983 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.465 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.032 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	37.0
TPSA:	189.04 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	3.0	Rings:	8.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.159	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.537	Fsp³:	0.794
MCE-18:	212.033 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.581	Fluc inhibitor:	0.011 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.012 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.09	Promiscuous compounds:	0.865

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.525	MDCK Permeability:	-5.061
Pgp-inhibitor:	0.022	Pgp-substrate:	0.922
PAMPA:	0.998 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.039
20% Bioavailability (F20%):	0.979	30% Bioavailability (F30%):	0.99
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.999
Plasma Protein Binding (PPB):	51.074%	Volume Distribution (VD):	-0.257
Fu:	47.954% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.998
OATP1B3 inhibitor:	0.746	BCRP inhibitor:	0.002
BSEP inhibitor:	0.876

ADMET: Metabolism

CYP1A2-inhibitor:	0.154	CYP1A2-substrate:	0.096
CYP2C19-inhibitor:	0.112	CYP2C19-substrate:	0.001
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.003
CYP2D6-inhibitor:	0.001	CYP2D6-substrate:	0.567
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.001
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.994
HLM stability:	0.985 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.79

Half-life (T1/2):

2.382

ADMET: Toxicity

hERG Blockers:	0.012	hERG Blockers (10um):	0.112
Human Hepatotoxicity (H-HT):	0.371	Drug-induced Liver Injury (DILI):	0.808
AMES Toxicity:	0.979	Rat Oral Acute Toxicity:	0.947
Maximum Recommended Daily Dose:	0.946	Skin Sensitization:	1.0
Carcinogencity:	0.496	Eye Corrosion:	0.0
Eye Irritation:	0.045	Respiratory Toxicity:	0.959
Drug-induced Neurotoxicity:	0.612	Ototoxicity:	0.853
Hematotoxicity:	0.512	Drug-induced Nephrotoxicity:	0.982
Genotoxicity:	0.996	RPMI-8226 Immunitoxicity:	0.57
A549 Cytotoxicity:	0.188	Hek293 Cytotoxicity:	0.248
BCF:	0.457 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.59 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.76 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.746 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO3846	Melia indica	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO3846	Melia indica	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO3846	Melia indica	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO3846	Melia indica	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC174922 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22025
0.1-0.2	26869
0.2-0.3	926
0.3-0.4	22
0.4-0.5	2
0.5-0.6	5
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	3
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8889	High Similarity	NPC16729
0.8889	High Similarity	NPC475462
0.8889	High Similarity	NPC120958
0.7041	Intermediate Similarity	NPC48813
0.6869	Remote Similarity	NPC48414
0.68	Remote Similarity	NPC5153
0.6327	Remote Similarity	NPC256618
0.6176	Remote Similarity	NPC219058
0.6038	Remote Similarity	NPC471172
0.6019	Remote Similarity	NPC194854
0.5962	Remote Similarity	NPC42206
0.537	Remote Similarity	NPC601017
0.537	Remote Similarity	NPC601069
0.537	Remote Similarity	NPC608590
0.5248	Remote Similarity	NPC475376

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC174922 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7544
0.1-0.2	1600
0.2-0.3	6
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data