Natural Product: NPC168829| Natural Product ID | NPC168829 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| Honokiol |
| IUPAC Name | 2-(4-hydroxy-3-prop-2-enylphenyl)-4-prop-2-enylphenol |
| Synonyms | Honokiol |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL16901 |
| PubChem CID |
72303 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | FVYXIJYOAGAUQK-UHFFFAOYSA-N |
| Standard InCHI | InChI=1S/C18H18O2/c1-3-5-13-7-9-18(20)16(11-13)14-8-10-17(19)15(12-14)6-4-2/h3-4,7-12,19-20H,1-2,5-6H2 |
| SMILES | C=CCc1ccc(c(c1)c1ccc(c(c1)CC=C)O)O |
  Calculated Properties| Molecular Weight:   | 266.13 | Volume:   | 299.26 Van der Waals volume.
|
| Dense:   | 0.889 | LogP:   | 3.802 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 3.462 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -3.488 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 5.0 | Rigid Bonds:   | 14.0 |
| TPSA:   | 40.46 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 2.0 |
| H-Bond Donor:   | 2.0 | Rings:   | 2.0 |
| Heavy Atoms:   | 2.0 |
| QED Drug-Likeness Score:   | 0.795 | GASA:   | 0.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 2.442 | Fsp3:   | 0.111 |
| MCE-18:   | 12.0 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Accepted | GSK Rule:   | Rejected |
| Golden Triangle Rule:   | Rejected | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.92 | Fluc inhibitor:   | 0.624 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.662 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.363 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.942 | Promiscuous compounds:   | 0.164 |
| Caco-2 Permeability:   | -4.611 | MDCK Permeability:   | -4.672 |
| Pgp-inhibitor:   | 0.592 | Pgp-substrate:   | 0.0 |
| PAMPA:   |
0.001 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.025 |
| 20% Bioavailability (F20%):   | 1.0 | 30% Bioavailability (F30%):   | 1.0 |
| 50% Bioavailability (F50%):   | 0.998 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.0 | MRP1:   | 0.052 |
| Plasma Protein Binding (PPB):   | 93.355% | Volume Distribution (VD):   | 0.328 |
| Fu: |
10.14% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 1.0 |
| OATP1B3 inhibitor:   | 1.0 | BCRP inhibitor:   | 0.974 |
| BSEP inhibitor:   | 1.0 |
| CYP1A2-inhibitor:   | 0.0 | CYP1A2-substrate:   | 0.99 |
| CYP2C19-inhibitor:   | 0.066 | CYP2C19-substrate:   | 0.054 |
| CYP2C9-inhibitor:   | 1.0 | CYP2C9-substrate:   | 0.0 |
| CYP2D6-inhibitor:   | 1.0 | CYP2D6-substrate:   | 0.998 |
| CYP3A4-inhibitor:   | 0.0 | CYP3A4-substrate:   | 1.0 |
| CYP2B6-substrate:   | 0.422 | CYP2C8-inhibitor:   | 1.0 |
| HLM stability:   |
0.079 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 13.722 | Half-life (T1/2):   | 1.054 |
| hERG Blockers:   | 0.11 | hERG Blockers (10um):   | 0.763 |
| Human Hepatotoxicity (H-HT):   | 0.382 | Drug-induced Liver Injury (DILI):   | 0.481 |
| AMES Toxicity:   | 0.504 | Rat Oral Acute Toxicity:   | 0.627 |
| Maximum Recommended Daily Dose:   | 0.678 | Skin Sensitization:   | 0.949 |
| Carcinogencity:   | 0.505 | Eye Corrosion:   | 0.377 |
| Eye Irritation:   | 0.986 | Respiratory Toxicity:   | 0.973 |
| Drug-induced Neurotoxicity:   | 0.648 | Ototoxicity:   | 0.195 |
| Hematotoxicity:   | 0.057 | Drug-induced Nephrotoxicity:   | 0.15 |
| Genotoxicity:   | 0.705 | RPMI-8226 Immunitoxicity:   | 0.083 |
| A549 Cytotoxicity:   | 0.542 | Hek293 Cytotoxicity:   | 0.733 |
| BCF:   |
1.346 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
3.795 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
4.573 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
4.109 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO15299 | Sandoricum koetjape | Species | Meliaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[10479314] |
| NPO12483 | Holarrhena floribunda | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[10650079] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | n.a. | tuber | n.a. |
PMID[12913245] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[1293938] |
| NPO15299 | Sandoricum koetjape | Species | Meliaceae | Eukaryota | stems | n.a. | n.a. |
PMID[1517737] |
| NPO13353 | Sedum sarmentosum | Species | Crassulaceae | Eukaryota | n.a. | aerial part | n.a. |
PMID[15577228] |
| NPO13465 | Salvia broussonetii | Species | Lamiaceae | Eukaryota | roots | n.a. | n.a. |
PMID[15969497] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[16181762] |
| NPO12483 | Holarrhena floribunda | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[16441070] |
| NPO4368 | Magnolia officinalis | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[1659613] |
| NPO4368 | Magnolia officinalis | Species | Magnoliaceae | Eukaryota | stem bark | n.a. | n.a. |
PMID[17918910] |
| NPO7490 | Aconitum japonicum | Species | Ranunculaceae | Eukaryota | roots | n.a. | n.a. |
PMID[18044843] |
| NPO11791 | Magnolia obovata | Species | Magnoliaceae | Eukaryota | n.a. | stem | n.a. |
PMID[18175990] |
| NPO4368 | Magnolia officinalis | Species | Magnoliaceae | Eukaryota | Stems; Barks | n.a. | n.a. |
PMID[19086868] |
| NPO12483 | Holarrhena floribunda | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[19299148] |
| NPO11791 | Magnolia obovata | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[21625478] |
| NPO13353 | Sedum sarmentosum | Species | Crassulaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[22085682] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | n.a. | root | n.a. |
PMID[22223386] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | Lateral roots | n.a. | n.a. |
PMID[22607495] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | n.a. | root | n.a. |
PMID[22628040] |
| NPO15299 | Sandoricum koetjape | Species | Meliaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[22672802] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | n.a. | root | n.a. |
PMID[22907155] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | n.a. | root | n.a. |
PMID[23225552] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[23707213] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | n.a. | root | n.a. |
PMID[23707213] |
| NPO4368 | Magnolia officinalis | Species | Magnoliaceae | Eukaryota | n.a. | bark | n.a. |
PMID[23823874] |
| NPO7490 | Aconitum japonicum | Species | Ranunculaceae | Eukaryota | n.a. | root | n.a. |
PMID[24190290] |
| NPO7490 | Aconitum japonicum | Species | Ranunculaceae | Eukaryota | n.a. | leaf | n.a. |
PMID[24190290] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[24793215] |
| NPO13745 | Gynoxys verrucosa | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27057812] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | n.a. | root | n.a. |
PMID[27761113] |
| NPO15190 | Chloranthus fortunei | Species | Chloranthaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27997206] |
| NPO4368 | Magnolia officinalis | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28485933] |
| NPO6698 | Euphorbia pithyusa | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28671832] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[30892884] |
| NPO13274 | Illicium verum | Species | Schisandraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38790803] |
| NPO25118 | Centaurea benedicta | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[39771277] |
| NPO8583 | Angelica japonica | Species | Apiaceae | Eukaryota | n.a. | root | n.a. |
PMID[9987830] |
| NPO17336 | Benincasa hispida | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO20881 | Rheum officinale | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO4368 | Magnolia officinalis | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2568 | Posidonia oceanica | Species | Posidoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO28024 | Rheum palmatum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13274 | Illicium verum | Species | Schisandraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO11791 | Magnolia obovata | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO15299 | Sandoricum koetjape | Species | Meliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO15190 | Chloranthus fortunei | Species | Chloranthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO3482 | Alpinia flabellata | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO12018 | Alternaria bataticola | Species | Pleosporaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO8583 | Angelica japonica | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO10905 | Baccharis truncata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18026 | Bipolaris sacchari | Species | Pleosporaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7009 | Callyspongia spinosissima | Species | Callyspongiidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO25118 | Centaurea benedicta | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO27148 | Chuquiraga erinacea | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO11592 | Cuphea hyssopifolia | Species | Lythraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO5998 | Echinoclathria subhispida | Species | Microcionidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13617 | Eria rigida | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO17166 | Euphorbia palustris | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO6698 | Euphorbia pithyusa | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13228 | Farfugium japonicum | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO4282 | Fouquieria diguetii | Species | Fouquieriaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7844 | Fritillaria hupehensis | Species | Liliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13745 | Gynoxys verrucosa | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO12483 | Holarrhena floribunda | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2680 | Holothuria squamifera | Species | Holothuriidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO15992 | Hypogymnia vittata | Species | Parmeliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO9133 | Lathyrus latifolius | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO14194 | Mamestra brassicae | Species | Noctuidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO11246 | Ononis viscosa | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO8721 | Parectatosoma mocquerysi | Species | Anisacanthidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO15514 | Pedicularis rex | Species | Orobanchaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO273 | Phyllobates bicolor | Species | Dendrobatidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO10532 | Pinus edulis | Species | Pinaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2043 | Pseudocyphellaria coronata | Species | Lobariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO9538 | Pterocarpus erinaceus | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO10048 | Pyrus bourgaeana | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13465 | Salvia broussonetii | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13353 | Sedum sarmentosum | Species | Crassulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO14329 | Sigillina signifera | Species | Polycitoridae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO17358 | Sorbus torminalis | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO15405 | Suaeda maritima | Species | Chenopodiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13018 | Thelephora aurantiotincta | Species | Thelephoraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2070 | Thioalkalivibrio versutus | Species | Ectothiorhodospiraceae | Bacteria | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO14455 | Triunia erythrocarpa | Species | Proteaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO25238 | Rheum coreanum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7632 | Rheum tanguticum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7490 | Aconitum japonicum | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13274 | Illicium verum | Species | Schisandraceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO17336 | Benincasa hispida | Species | Cucurbitaceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO13274 | Illicium verum | Species | Schisandraceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO13274 | Illicium verum | Species | Schisandraceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO10532 | Pinus edulis | Species | Pinaceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO13274 | Illicium verum | Species | Schisandraceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO17336 | Benincasa hispida | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO10532 | Pinus edulis | Species | Pinaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO28024 | Rheum palmatum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO7490 | Aconitum japonicum | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO20881 | Rheum officinale | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO17336 | Benincasa hispida | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO30805 | Magnoliae officinalis | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO4368 | Magnolia officinalis | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO7632 | Rheum tanguticum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO13353 | Sedum sarmentosum | Species | Crassulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO13228 | Farfugium japonicum | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO17566 | Magnolia biloba | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO11791 | Magnolia obovata | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO13274 | Illicium verum | Species | Schisandraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO30822 | Flos magnoliae | Species | Lycaenidae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO7844 | Fritillaria hupehensis | Species | Liliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO13018 | Thelephora aurantiotincta | Species | Thelephoraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO12483 | Holarrhena floribunda | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO8583 | Angelica japonica | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO28024 | Rheum palmatum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO7632 | Rheum tanguticum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO15826 | Cortex magnoliae officinalis | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO4368 | Magnolia officinalis | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO20881 | Rheum officinale | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO13228 | Farfugium japonicum | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO13274 | Illicium verum | Species | Schisandraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO8583 | Angelica japonica | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO13353 | Sedum sarmentosum | Species | Crassulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO7844 | Fritillaria hupehensis | Species | Liliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO17336 | Benincasa hispida | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO15299 | Sandoricum koetjape | Species | Meliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO11791 | Magnolia obovata | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO13018 | Thelephora aurantiotincta | Species | Thelephoraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO17566 | Magnolia biloba | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO13441 | Flos magnoliae offcinalis | Species | Lycaenidae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO7490 | Aconitum japonicum | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO12483 | Holarrhena floribunda | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO23867 | Magnoliae officinalis praeparata | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO3482 | Alpinia flabellata | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO9133 | Lathyrus latifolius | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO28024 | Rheum palmatum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO4368 | Magnolia officinalis | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO7632 | Rheum tanguticum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO20881 | Rheum officinale | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO13274 | Illicium verum | Species | Schisandraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO13353 | Sedum sarmentosum | Species | Crassulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO17566 | Magnolia biloba | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO13228 | Farfugium japonicum | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO11791 | Magnolia obovata | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO17166 | Euphorbia palustris | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO9133 | Lathyrus latifolius | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO17336 | Benincasa hispida | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO4902 | Aconitum carmichaelii | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO28024 | Rheum palmatum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO20881 | Rheum officinale | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO4368 | Magnolia officinalis | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO11791 | Magnolia obovata | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO7490 | Aconitum japonicum | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO13274 | Illicium verum | Species | Schisandraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO7844 | Fritillaria hupehensis | Species | Liliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO25238 | Rheum coreanum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO7632 | Rheum tanguticum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO13353 | Sedum sarmentosum | Species | Crassulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO17336 | Benincasa hispida | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO14194 | Mamestra brassicae | Species | Noctuidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO8721 | Parectatosoma mocquerysi | Species | Anisacanthidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6698 | Euphorbia pithyusa | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO15514 | Pedicularis rex | Species | Orobanchaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO25118 | Centaurea benedicta | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO14329 | Sigillina signifera | Species | Polycitoridae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO15405 | Suaeda maritima | Species | Chenopodiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO20881 | Rheum officinale | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO8583 | Angelica japonica | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO12018 | Alternaria bataticola | Species | Pleosporaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO11592 | Cuphea hyssopifolia | Species | Lythraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4282 | Fouquieria diguetii | Species | Fouquieriaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2680 | Holothuria squamifera | Species | Holothuriidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10905 | Baccharis truncata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO11791 | Magnolia obovata | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13353 | Sedum sarmentosum | Species | Crassulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO15190 | Chloranthus fortunei | Species | Chloranthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10532 | Pinus edulis | Species | Pinaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13745 | Gynoxys verrucosa | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5998 | Echinoclathria subhispida | Species | Microcionidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13228 | Farfugium japonicum | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2568 | Posidonia oceanica | Species | Posidoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9133 | Lathyrus latifolius | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13617 | Eria rigida | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO12483 | Holarrhena floribunda | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2043 | Pseudocyphellaria coronata | Species | Lobariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9538 | Pterocarpus erinaceus | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7844 | Fritillaria hupehensis | Species | Liliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO15992 | Hypogymnia vittata | Species | Parmeliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17358 | Sorbus torminalis | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10048 | Pyrus bourgaeana | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO15299 | Sandoricum koetjape | Species | Meliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO27148 | Chuquiraga erinacea | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13274 | Illicium verum | Species | Schisandraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO273 | Phyllobates bicolor | Species | Dendrobatidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO11246 | Ononis viscosa | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7632 | Rheum tanguticum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO14455 | Triunia erythrocarpa | Species | Proteaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18026 | Bipolaris sacchari | Species | Pleosporaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17566 | Magnolia biloba | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17336 | Benincasa hispida | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17166 | Euphorbia palustris | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3482 | Alpinia flabellata | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7009 | Callyspongia spinosissima | Species | Callyspongiidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2070 | Thioalkalivibrio versutus | Species | Ectothiorhodospiraceae | Bacteria | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4368 | Magnolia officinalis | Species | Magnoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13018 | Thelephora aurantiotincta | Species | Thelephoraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13465 | Salvia broussonetii | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO28024 | Rheum palmatum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO25238 | Rheum coreanum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7490 | Aconitum japonicum | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 91.0 | % | PMID[19481465] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 88.3 | % | PMID[19481465] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 1800.0 | nM | PMID[19481465] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 2100.0 | nM | PMID[19481465] |
| NPT3 | Individual protein | Thioredoxin glutathione reductase | Schistosoma mansoni | Potency | = | 44668.4 | nM | PubChem BioAssay data set |
| NPT1861 | Individual protein | Mitochondrial import inner membrane translocase subunit TIM10 | Saccharomyces cerevisiae S288c | IC50 | = | 48800.0 | nM | PubChem BioAssay data set |
| NPT154 | Individual protein | Mothers against decapentaplegic homolog 3 | Homo sapiens | Potency | n.a. | 25118.9 | nM | PubChem BioAssay data set |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | n.a. | 29092.9 | nM | PubChem BioAssay data set |
| NPT156 | Individual protein | Sphingomyelin phosphodiesterase | Homo sapiens | Potency | n.a. | 316227.8 | nM | PubChem BioAssay data set |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | n.a. | 206.0 | nM | PubChem BioAssay data set |
| NPT101 | Individual protein | Glucagon-like peptide 1 receptor | Homo sapiens | Potency | n.a. | 14125.4 | nM | PubChem BioAssay data set |
| NPT159 | Individual protein | Aberrant vpr protein | Human immunodeficiency virus 1 | Potency | n.a. | 63095.7 | nM | PubChem BioAssay data set |
| NPT1287 | Individual protein | Cannabinoid CB2 receptor | Homo sapiens | Efficacy | = | 0.0 | % | PMID[24900561] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | Efficacy | = | 168.0 | % | PMID[24900561] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | EC50 | > | 10000.0 | nM | PMID[24900561] |
| NPT1287 | Individual protein | Cannabinoid CB2 receptor | Homo sapiens | Ki | = | 5610.0 | nM | PMID[24900561] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | Ki | = | 6460.0 | nM | PMID[24900561] |
| NPT161 | Individual protein | Rap guanine nucleotide exchange factor 4 | Homo sapiens | Potency | n.a. | 50118.7 | nM | PubChem BioAssay data set |
| NPT1287 | Individual protein | Cannabinoid CB2 receptor | Homo sapiens | Ki | = | 5.61 | nM | PMID[27078864] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | Ki | = | 6.46 | nM | PMID[27078864] |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 4466.8 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 22387.2 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT803 | Individual protein | Flap endonuclease 1 | Homo sapiens | Potency | n.a. | 70794.6 | nM | PubChem BioAssay data set |
| NPT25564 | Single protein | Platelet glycoprotein VI (GPVI) | Homo sapiens | Kd | = | 289000.0 | nM | PMID[32463237] |
| NPT497 | Individual protein | Maltase-glucoamylase | Homo sapiens | Inhibition | = | 17.1 | % | PMID[35617790] |
| NPT497 | Individual protein | Maltase-glucoamylase | Homo sapiens | Inhibition | = | 30.6 | % | PMID[36327695] |
| NPT28439 | Single protein | Angiotensin-converting enzyme 2 | Homo sapiens | Kd | = | 16980.0 | nM | PMID[35617790] |
| NPT497 | Individual protein | Maltase-glucoamylase | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[35617790] |
| NPT54 | Individual protein | Nonstructural protein 1 | Influenza A virus | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT4770 | Individual protein | High-affinity choline transporter | Homo sapiens | IC50 | n.a. | 12022.64 | nM | PubChem BioAssay data set |
| NPT888 | Individual protein | 78 kDa glucose-regulated protein | Homo sapiens | Potency | n.a. | 17782.8 | nM | PubChem BioAssay data set |
| NPT67 | Individual protein | Cholinesterase | Equus caballus | Inhibition | = | 7.62 | % | PMID[23062825] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.005676 | % | DOI[10.6019/CHEMBL4495564] |
| NPT4542 | Individual protein | NAD-dependent deacetylase sirtuin 3 | Homo sapiens | EC50 | = | 170.0 | nM | PMID[34605238] |
| NPT4542 | Individual protein | NAD-dependent deacetylase sirtuin 3 | Homo sapiens | Inhibition | = | 73.4 | % | PMID[36191547] |
| NPT4542 | Individual protein | NAD-dependent deacetylase sirtuin 3 | Homo sapiens | Kd | = | 290.0 | nM | PMID[36191547] |
| NPT4542 | Individual protein | NAD-dependent deacetylase sirtuin 3 | Homo sapiens | Kd | = | 2990.0 | nM | PMID[36191547] |
| NPT4542 | Individual protein | NAD-dependent deacetylase sirtuin 3 | Homo sapiens | Activity | = | 107.7 | % | PMID[36191547] |
| NPT4542 | Individual protein | NAD-dependent deacetylase sirtuin 3 | Homo sapiens | Emax | = | 0.91 | % | PMID[34605238] |
| NPT4542 | Individual protein | NAD-dependent deacetylase sirtuin 3 | Homo sapiens | Inhibition | = | 67.9 | % | PMID[36191547] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -7.14 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT4542 | Individual protein | NAD-dependent deacetylase sirtuin 3 | Homo sapiens | Kd | = | 1010.0 | nM | PMID[36191547] |
| NPT4542 | Individual protein | NAD-dependent deacetylase sirtuin 3 | Homo sapiens | Inhibition | = | 98.3 | % | PMID[36191547] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 5.3 | % | PMID[36651644] |
| NPT4542 | Individual protein | NAD-dependent deacetylase sirtuin 3 | Homo sapiens | Kd | = | 970.0 | nM | PMID[36191547] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 4.9 | % | PMID[36651644] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -11.83 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT4542 | Individual protein | NAD-dependent deacetylase sirtuin 3 | Homo sapiens | Kd | = | 40000.0 | nM | PMID[37439550] |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 17782.8 | nM | PubChem BioAssay data set |
| NPT59 | Individual protein | DNA polymerase beta | Homo sapiens | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT60 | Individual protein | Lysosomal alpha-glucosidase | Homo sapiens | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT2643 | Protein complex | GABA-A receptor; GABA-A site (alpha1/beta2 interface) | Homo sapiens | Smax | = | 1034.0 | % | PMID[21699169] |
| NPT2643 | Protein complex | GABA-A receptor; GABA-A site (alpha1/beta2 interface) | Homo sapiens | EC50 | = | 39300.0 | nM | PMID[21699169] |
| NPT2643 | Protein complex | GABA-A receptor; GABA-A site (alpha1/beta2 interface) | Homo sapiens | Activity | = | 376.0 | % | PMID[21699169] |
| NPT478 | Individual protein | Ataxin-2 | Homo sapiens | Potency | n.a. | 28183.8 | nM | PubChem BioAssay data set |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | -3.48 | % | PMID[23062825] |
| NPT920 | Individual protein | Alpha-synuclein | Homo sapiens | Potency | n.a. | 35481.3 | nM | PubChem BioAssay data set |
| NPT535 | Individual protein | Parathyroid hormone receptor | Homo sapiens | Potency | n.a. | 44668.4 | nM | PubChem BioAssay data set |
| NPT29661 | Single protein | Spike glycoprotein | Severe acute respiratory syndrome coronavirus 2 | Kd | = | 25010.0 | nM | PMID[35617790] |
| NPT570 | Individual protein | Arachidonate 5-lipoxygenase | Homo sapiens | Inhibition | = | 94.0 | % | PMID[19481465] |
| NPT570 | Individual protein | Arachidonate 5-lipoxygenase | Homo sapiens | IC50 | = | 4200.0 | nM | PMID[19481465] |
| NPT546 | Individual protein | Retinoid X receptor alpha | Homo sapiens | EC50 | = | 11800.0 | nM | PMID[20695472] |
| NPT442 | Individual protein | Ferritin light chain | Equus caballus | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT442 | Individual protein | Ferritin light chain | Equus caballus | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT442 | Individual protein | Ferritin light chain | Equus caballus | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT197 | Protein-protein interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 11220.2 | nM | PubChem BioAssay data set |
| NPT197 | Protein-protein interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT197 | Protein-protein interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT532 | Individual protein | Lysine-specific demethylase 4A | Homo sapiens | Potency | n.a. | 63095.7 | nM | PubChem BioAssay data set |
| NPT4120 | Individual protein | G-protein coupled receptor 55 | Homo sapiens | Inhibition | = | 42.0 | % | PMID[24900561] |
| NPT493 | Individual protein | Neuraminidase | Influenza A virus | IC50 | = | 1390.0 | nM | PMID[24313801] |
| NPT493 | Individual protein | Neuraminidase | Influenza A virus | IC50 | = | 30100.0 | nM | PMID[24313801] |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 15848.9 | nM | PubChem BioAssay data set |
| NPT546 | Individual protein | Retinoid X receptor alpha | Homo sapiens | ED50 | = | 11.8 | uM | PMID[24959987] |
| NPT1007 | Protein complex | GABA-A receptor; alpha-1/beta-2/gamma-2 | Homo sapiens | Emax | = | 78.0 | % | PMID[26410663] |
| NPT1007 | Protein complex | GABA-A receptor; alpha-1/beta-2/gamma-2 | Homo sapiens | EC50 | = | 76200.0 | nM | PMID[26410663] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 16500.0 | nM | PMID[21853991] |
| NPT4254 | Cell line | SVR | Mus musculus | Inhibition | = | 60.0 | % | PMID[17587572] |
| NPT4254 | Cell line | SVR | Mus musculus | Inhibition | = | 85.0 | % | PMID[17587572] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 10900.0 | nM | PMID[17587572] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 22500.0 | nM | PMID[17587572] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | > | 5.0 | ug.mL-1 | PMID[17918910] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | > | 5.0 | ug.mL-1 | PMID[17918910] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | > | 5.0 | ug.mL-1 | PMID[17918910] |
| NPT80 | Cell line | Raji | Homo sapiens | Activity | = | 60.0 | % | PMID[1659613] |
| NPT80 | Cell line | Raji | Homo sapiens | Activity | > | 80.0 | % | PMID[1659613] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 100.0 | mm3 | PMID[18762427] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 150.0 | mm3 | PMID[18762427] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 270.0 | mm3 | PMID[18762427] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 600.0 | mm3 | PMID[18762427] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 900.0 | mm3 | PMID[18762427] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 21100.0 | nM | PMID[19589678] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 30500.0 | nM | PMID[19589678] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 35000.0 | nM | PMID[21853991] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 41200.0 | nM | PMID[19589678] |
| NPT737 | Cell line | HUVEC | Homo sapiens | IC50 | = | 52600.0 | nM | PMID[21853991] |
| NPT737 | Cell line | HUVEC | Homo sapiens | Activity | = | 38.5 | % | PMID[21853991] |
| NPT737 | Cell line | HUVEC | Homo sapiens | Inhibition | = | 51.4 | % | PMID[21853991] |
| NPT65 | Cell line | HepG2 | Homo sapiens | Potency | n.a. | 28183.8 | nM | PubChem BioAssay data set |
| NPT3908 | Cell line | N2a | Mus musculus | Activity | = | 41.03 | % | PMID[22209461] |
| NPT2644 | Cell line | UACC-903 | Homo sapiens | IC50 | = | 7450.0 | nM | PMID[22533983] |
| NPT2644 | Cell line | UACC-903 | Homo sapiens | IC50 | = | 5100.0 | nM | PMID[22533983] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 12510.0 | nM | PMID[22533983] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 7750.0 | nM | PMID[22533983] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 23050.0 | nM | PMID[22533983] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 13240.0 | nM | PMID[22533983] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 50.5 | % | PMID[22533983] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 61.1 | % | PMID[22533983] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 72.9 | % | PMID[22533983] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 37.9 | % | PMID[22533983] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 28.1 | % | PMID[22533983] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 21.7 | % | PMID[22533983] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 11.6 | % | PMID[22533983] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 10.8 | % | PMID[22533983] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 5.4 | % | PMID[22533983] |
| NPT71 | Cell line | HEK293 | Homo sapiens | Inhibition | = | 59.3 | % | PMID[24018191] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 9.3 | ug.mL-1 | PMID[27259399] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 6.1 | ug.mL-1 | PMID[27259399] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 5.0 | ug.mL-1 | PMID[27259399] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 55.0 | % | PMID[27259399] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 36.0 | % | PMID[27259399] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 45.0 | % | PMID[27259399] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | IC50 | = | 30200.0 | nM | PMID[30006164] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 38460.0 | nM | PMID[30006164] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 35310.0 | nM | PMID[30006164] |
| NPT1820 | Cell line | NCI-H1650 | Homo sapiens | IC50 | = | 37350.0 | nM | PMID[30006164] |
| NPT3377 | Cell line | PC-9 | n.a. | IC50 | = | 36720.0 | nM | PMID[30006164] |
| NPT2476 | Cell line | NCI-H441 | Homo sapiens | IC50 | = | 33320.0 | nM | PMID[30006164] |
| NPT2466 | Cell line | NCI-H358 | Homo sapiens | IC50 | = | 31570.0 | nM | PMID[30006164] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | Activity | = | 67.42 | % | PMID[30006164] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | Activity | = | 6.54 | % | PMID[30006164] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | Activity | = | 18.55 | % | PMID[30006164] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | Activity | = | 43.8 | % | PMID[30006164] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | Activity | = | 7.97 | % | PMID[30006164] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | Activity | = | 0.87 | % | PMID[30006164] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | Activity | = | 47.4 | % | PMID[30006164] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | Activity | = | 11.8 | % | PMID[30006164] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | Activity | = | 73.0 | % | PMID[30006164] |
| NPT34 | Cell line | BV-2 | Mus musculus | Activity | = | 118.4 | % | PMID[30472026] |
| NPT34 | Cell line | BV-2 | Mus musculus | IC50 | = | 17000.0 | nM | PMID[30472026] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 23910.0 | nM | PMID[31278004] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 35410.0 | nM | PMID[31278004] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 34300.0 | nM | PMID[31278004] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 33880.0 | nM | PMID[31278004] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 19050.0 | nM | PMID[31278004] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 32900.0 | nM | PMID[31278004] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 34100.0 | nM | PMID[31278004] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 22100.0 | nM | PMID[31278004] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 29700.0 | nM | PMID[31278004] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 28400.0 | nM | PMID[31278004] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 62000.0 | nM | PMID[31278004] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 25000.0 | nM | PMID[30733086] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 35000.0 | nM | PMID[30733086] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 40000.0 | nM | PMID[30733086] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 53.0 | % | PMID[30733086] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 41800.0 | nM | PMID[31831382] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 38040.0 | nM | PMID[32996316] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 31580.0 | nM | PMID[32996316] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 23850.0 | nM | PMID[32996316] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 31580.0 | nM | PMID[32996316] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | IC50 | = | 31240.0 | nM | PMID[32996316] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 29030.0 | nM | PMID[32996316] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 47650.0 | nM | PMID[36332549] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 44890.0 | nM | PMID[34605238] |
| NPT660 | Cell line | SW480 | Homo sapiens | IC50 | = | 15140.0 | nM | PMID[36332549] |
| NPT2170 | Cell line | RKO | Homo sapiens | IC50 | = | 11420.0 | nM | PMID[36332549] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | > | 70.0 | % | PMID[33360794] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | MNTD | = | 50.0 | uM | PMID[35617790] |
| NPT927 | Cell line | PBMC | Homo sapiens | CC50 | = | 16100.0 | nM | PMID[16722664] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | = | 22500.0 | nM | PMID[16722664] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | CC50 | = | 10900.0 | nM | PMID[16722664] |
| NPT927 | Cell line | PBMC | Homo sapiens | Ratio CC50/EC50 | = | 5.0 | n.a. | PMID[16722664] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | = | 88900.0 | nM | PMID[17663539] |
| NPT27091 | Protein complex | Gamma-aminobutyric acid receptor subunit alpha-5/beta-2 | Homo sapiens | Smax | = | 347.0 | % | PMID[21699169] |
| NPT27091 | Protein complex | Gamma-aminobutyric acid receptor subunit alpha-5/beta-2 | Homo sapiens | EC50 | = | 23400.0 | nM | PMID[21699169] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 8275.3 | nM | PubChem BioAssay data set |
| NPT878 | Organism | Streptococcus mutans | Streptococcus mutans | MIC | = | 10.0 | ug.mL-1 | PMID[29402745] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -6.33 | % | DOI[10.21203/rs.3.rs-23951/v1] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.06 | % | DOI[10.6019/CHEMBL4495565] |
| NPT22964 | Cell line | CNE2Z | Homo sapiens | IC50 | = | 31270.0 | nM | PMID[31831382] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 50000.0 | nM | PMID[35617790] |
| NPT729 | Organism | Micrococcus luteus | Micrococcus luteus | MIC100 | = | 32.0 | ug ml-1 | PMID[34432450] |
| NPT1190 | Organism | Salmonella enterica | Salmonella enterica | MIC100 | > | 128.0 | ug ml-1 | PMID[34432450] |
| NPT878 | Organism | Streptococcus mutans | Streptococcus mutans | MIC | = | 66.6 | ug.mL-1 | PMID[34458737] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 36100.0 | nM | PMID[19589678] |
| NPT27092 | Protein complex | Gamma-aminobutyric acid receptor subunit alpha-3/ beta-2 | Homo sapiens | Smax | = | 2386.0 | % | PMID[21699169] |
| NPT27093 | Protein complex | Gamma-aminobutyric acid receptor subunit alpha-2/beta-2 | Homo sapiens | Smax | = | 1130.0 | % | PMID[21699169] |
| NPT25346 | Protein complex | GABA-A receptor alpha-1/beta-3 | Homo sapiens | Smax | = | 878.0 | % | PMID[21699169] |
| NPT27092 | Protein complex | Gamma-aminobutyric acid receptor subunit alpha-3/ beta-2 | Homo sapiens | EC50 | = | 52400.0 | nM | PMID[21699169] |
| NPT27093 | Protein complex | Gamma-aminobutyric acid receptor subunit alpha-2/beta-2 | Homo sapiens | EC50 | = | 46400.0 | nM | PMID[21699169] |
| NPT25346 | Protein complex | GABA-A receptor alpha-1/beta-3 | Homo sapiens | EC50 | = | 59600.0 | nM | PMID[21699169] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 65400.0 | nM | PMID[21853991] |
| NPT20 | Organism | Candida albicans | Candida albicans | MIC | = | 16.0 | ug.mL-1 | PMID[28051303] |
| NPT330 | Organism | Trichophyton mentagrophytes | Trichophyton mentagrophytes | MIC | = | 25.0 | ug.mL-1 | PMID[28051303] |
| NPT20 | Organism | Candida albicans | Candida albicans | MIC | = | 32.0 | ug.mL-1 | PMID[29402745] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | = | 8.0 | ug.mL-1 | PMID[29402745] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 32.0 | ug.mL-1 | PMID[29402745] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 256.0 | ug.mL-1 | PMID[29402745] |
| NPT20 | Organism | Candida albicans | Candida albicans | Inhibition | = | 3.92 | % | DOI[10.6019/CHEMBL4513141] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Inhibition | = | 7.54 | % | DOI[10.6019/CHEMBL4513141] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC100 | = | 32.0 | ug ml-1 | PMID[34432450] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 32.0 | ug.mL-1 | PMID[35820350] |
| NPT20 | Organism | Candida albicans | Candida albicans | MIC | = | 4.0 | ug.mL-1 | PMID[37787457] |
| NPT25144 | Cell line | HepG2-CD81 | Homo sapiens | HEPG2TOX ASSAY - CC50 | > | 12.4 | uM | PMID[30523084] |
| NPT25144 | Cell line | HepG2-CD81 | Homo sapiens | HEPG2TOX ASSAY - CC90 | > | 12.4 | uM | PMID[30523084] |
| NPT24 | Organism | Human immunodeficiency virus 1 | Human immunodeficiency virus 1 | EC50 | = | 3300.0 | nM | PMID[17587572] |
| NPT24 | Organism | Human immunodeficiency virus 1 | Human immunodeficiency virus 1 | EC90 | = | 22.7 | uM | PMID[17587572] |
| NPT1515 | Organism | SARS coronavirus | SARS coronavirus | EC50 | = | 6500.0 | nM | PMID[17663539] |
| NPT1515 | Organism | SARS coronavirus | SARS coronavirus | Inhibition | < | 25.0 | % | PMID[17663539] |
| NPT1515 | Organism | SARS coronavirus | SARS coronavirus | Inhibition | = | 25.0 | % | PMID[17663539] |
| NPT25344 | Protein complex | Gamma-aminobutyric acid receptor subunit alpha-1/ beta-1 | Homo sapiens | Smax | = | 260.0 | % | PMID[21699169] |
| NPT25344 | Protein complex | Gamma-aminobutyric acid receptor subunit alpha-1/ beta-1 | Homo sapiens | EC50 | = | 57000.0 | nM | PMID[21699169] |
| NPT191 | Organism | Hepatitis C virus | Hepatitis C virus | EC50 | = | 9400.0 | nM | PMID[24400834] |
| NPT22158 | Cell line | HCC827 | Homo sapiens | IC50 | = | 33880.0 | nM | PMID[30006164] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC90 | > | 256.0 | ug.mL-1 | PMID[29402745] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | = | 16.0 | ug.mL-1 | PMID[29402745] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 50.0 | ug.mL-1 | PMID[29402745] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 16.0 | ug.mL-1 | PMID[29402745] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | MIC | = | 16.0 | ug.mL-1 | PMID[29402745] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC | = | 32.0 | ug.mL-1 | PMID[29402745] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | > | 256.0 | ug.mL-1 | PMID[29402745] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 256.0 | ug.mL-1 | PMID[29402745] |
| NPT474 | Organism | Plasmodium berghei | Plasmodium berghei | LUCIFERASE INFECTION ASSAY - IC50 | > | 12.4 | uM | PMID[30523084] |
| NPT474 | Organism | Plasmodium berghei | Plasmodium berghei | LUCIFERASE INFECTION ASSAY - IC90 | > | 12.4 | uM | PMID[30523084] |
| NPT474 | Organism | Plasmodium berghei | Plasmodium berghei | LUCIFERASE EXPRESSION CONTROL - IC50 | = | 11.4 | uM | PMID[30523084] |
| NPT474 | Organism | Plasmodium berghei | Plasmodium berghei | LUCIFERASE EXPRESSION CONTROL - IC90 | = | 11.4 | uM | PMID[30523084] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Inhibition | = | 4.96 | % | DOI[10.6019/CHEMBL4513141] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | Inhibition | = | 34.04 | % | DOI[10.6019/CHEMBL4513141] |
| NPT21742 | Cell line | L02 | Homo sapiens | IC50 | = | 25490.0 | nM | PMID[32996316] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 64.0 | ug.mL-1 | PMID[35820350] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 128.0 | ug.mL-1 | PMID[35820350] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | > | 128.0 | ug.mL-1 | PMID[35820350] |
| NPT20950 | Cell line | Erythrocyte | n.a. | HC50 | = | 534.1 | ug ml-1 | PMID[34432450] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 128.0 | ug.mL-1 | PMID[35820350] |
| NPT175 | Organism | Enterococcus faecalis | Enterococcus faecalis | MIC100 | = | 64.0 | ug ml-1 | PMID[34432450] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC100 | > | 128.0 | ug ml-1 | PMID[34432450] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC100 | > | 128.0 | ug ml-1 | PMID[34432450] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC100 | = | 64.0 | ug ml-1 | PMID[34432450] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 0.0 | % | PMID[1659613] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 18.5 | % | PMID[1659613] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 69.4 | % | PMID[1659613] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 90.1 | % | PMID[1659613] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 100.0 | % | PMID[1659613] |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 18356.4 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 244.0 | % | PMID[21699169] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 116.0 | % | PMID[21699169] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 101.0 | % | PMID[21699169] |
| NPT2 | Others | Unspecified | n.a. | EC50 | = | 36200.0 | nM | PMID[21699169] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 31622.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 11220.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | AC50 | > | 39000.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 25118.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 1258.9 | nM | PubChem BioAssay data set |
| NPT22036 | Cell line | HL | Homo sapiens | Activity | = | 8.8 | % | PMID[29043803] |
| NPT194 | Organism | Dengue virus 2 | Dengue virus 2 | Activity | > | 90.0 | % | PMID[31128447] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | Inhibition | = | 25.67 | % | DOI[10.6019/CHEMBL4513141] |
| NPT27094 | Cell line | I10 | Mus musculus | IC50 | = | 31110.0 | nM | PMID[31831382] |
| NPT29139 | Protein complex | Glutamate NMDA receptor; GRIN1/GRIN2B | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[38665828] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | = | 13.7 | n.a. | PMID[17663539] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT32 | Organism | Mus musculus | Mus musculus | TIME | = | 0.001028 | hr | PMID[9461663] |
| NPT32 | Organism | Mus musculus | Mus musculus | TIME | = | 0.001111 | hr | PMID[9461663] |
| NPT32 | Organism | Mus musculus | Mus musculus | TIME | = | 0.002528 | hr | PMID[9461663] |
| NPT32 | Organism | Mus musculus | Mus musculus | TIME | = | 0.003028 | hr | PMID[9461663] |
| NPT32 | Organism | Mus musculus | Mus musculus | TIME | = | 0.003417 | hr | PMID[9461663] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 1.38 | % | PMID[30006164] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 6.1 | % | PMID[30006164] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 6.92 | % | PMID[30006164] |
| NPT617 | Organism | Danio rerio | Danio rerio | Inhibition | < | 25.0 | % | PMID[21853991] |
| NPT617 | Organism | Danio rerio | Danio rerio | Inhibition | = | 25.0 | % | PMID[21853991] |
| NPT617 | Organism | Danio rerio | Danio rerio | Inhibition | = | 50.0 | % | PMID[21853991] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 138.9 | uM | PMID[15109665] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 142.1 | uM | PMID[15109665] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Control | = | 95.6 | % | PMID[11934579] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Control | = | 106.0 | % | PMID[11934579] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Control | = | 113.0 | % | PMID[11934579] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Control | = | 143.0 | % | PMID[11934579] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Control | = | 29.7 | % | PMID[11934579] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 4000.0 | mm | PMID[26539813] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | TIME | = | 0.5 | hr | PMID[26539813] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Candida albicans | n.a. | Drug uptake | n.a. | n.a. | n.a. | PMID[37787457] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC168829 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 0.7955 | Intermediate Similarity | NPC44732 |
| 0.7045 | Intermediate Similarity | NPC216216 |
| 0.6512 | Remote Similarity | NPC54765 |
| 0.6486 | Remote Similarity | NPC288411 |
| 0.6458 | Remote Similarity | NPC228988 |
| 0.5714 | Remote Similarity | NPC35344 |
| 0.56 | Remote Similarity | NPC141003 |
| 0.5455 | Remote Similarity | NPC95344 |
| 0.5333 | Remote Similarity | NPC295034 |
| 0.5333 | Remote Similarity | NPC308689 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC168829 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| NPD |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
