NPASS Compound

Structure

NPC159092 OpenBabel07101718312D 96100 0 0 1 0 0 0 0 0999 V2000 7.3286 10.3854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1537 7.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1679 -0.6782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9794 -2.1609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.1144 5.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3640 0.3218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9684 0.6637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0593 5.9551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5977 5.2016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9331 1.3755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4453 7.3092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4358 -0.6782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.6841 1.8728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4980 3.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2741 0.0728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4580 6.4877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5587 9.7840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7559 -2.6820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4348 9.9231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8689 -2.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1212 9.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3144 -1.9928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9979 9.7574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8445 9.0074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3953 -1.7606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7610 5.4020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0339 0.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0073 9.8948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3497 -2.0591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.6975 5.7527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8999 0.3218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6503 8.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.0133 3.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4980 1.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0263 9.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3399 -2.1689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.3048 4.1306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7660 1.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2049 7.4350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8958 -0.4908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6712 3.0175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3787 3.6823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9523 9.4589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9891 6.0378 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1679 0.3218 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5031 -1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.1779 4.8319 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4980 0.8218 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 10.0762 1.1152 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.1049 5.6566 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 10.6163 5.0099 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9966 1.7261 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 11.2807 6.3228 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4358 0.3218 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0077 9.8672 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3402 -2.1964 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0897 9.3249 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.3213 -1.9772 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4518 8.1891 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 8.1239 -1.1265 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 15.4694 5.1169 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7660 0.8218 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 16.0768 3.4949 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6320 2.3218 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 10.4525 2.0417 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3236 4.6808 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7263 4.0160 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2687 2.6884 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 9.5525 0.2633 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7286 6.5831 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 9.3476 7.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0526 5.6871 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.3019 0.8218 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 10.3442 5.9722 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5698 0.8218 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6973 -0.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8977 10.8611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2852 -3.1949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4069 1.7432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3141 4.8182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7259 4.0436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2501 2.4967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1195 8.3341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8880 4.7008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3019 1.8218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0405 -1.4709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.9122 2.5085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6320 3.3218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3583 -0.3289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6209 7.0346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.4060 5.4676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6320 0.3218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2237 8.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2578 -1.6265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9174 6.8766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 43 1 0 0 0 0 4 46 1 0 0 0 0 13 87 1 0 0 0 0 14 88 1 0 0 0 0 15 89 1 0 0 0 0 16 90 1 0 0 0 0 17 19 2 0 0 0 0 17 21 1 0 0 0 0 18 20 2 0 0 0 0 18 22 1 0 0 0 0 23 28 1 0 0 0 0 23 43 2 0 0 0 0 24 32 2 0 0 0 0 24 43 1 0 0 0 0 25 29 1 0 0 0 0 25 46 2 0 0 0 0 26 30 1 0 0 0 0 26 44 1 0 0 0 0 27 31 1 0 0 0 0 27 45 1 0 0 0 0 28 55 1 0 0 0 0 29 56 1 0 0 0 0 32 71 1 0 0 0 0 33 47 1 0 0 0 0 33 63 1 0 0 0 0 34 48 1 0 0 0 0 34 64 1 0 0 0 0 35 55 1 0 0 0 0 35 57 1 0 0 0 0 36 56 1 0 0 0 0 36 58 1 0 0 0 0 37 61 1 0 0 0 0 37 63 1 0 0 0 0 38 62 1 0 0 0 0 38 64 1 0 0 0 0 39 59 1 0 0 0 0 39 70 1 0 0 0 0 40 60 1 0 0 0 0 40 69 1 0 0 0 0 41 65 1 0 0 0 0 41 67 1 0 0 0 0 42 66 1 0 0 0 0 42 68 1 0 0 0 0 44 2 1 1 0 0 0 44 72 1 0 0 0 0 45 3 1 1 0 0 0 45 73 1 0 0 0 0 46 76 1 0 0 0 0 47 5 1 1 0 0 0 47 91 1 0 0 0 0 48 6 1 1 0 0 0 48 92 1 0 0 0 0 49 7 1 6 0 0 0 49 65 1 0 0 0 0 49 69 1 0 0 0 0 50 8 1 6 0 0 0 50 66 1 0 0 0 0 50 70 1 0 0 0 0 51 9 1 1 0 0 0 51 67 1 0 0 0 0 51 74 1 0 0 0 0 52 10 1 1 0 0 0 52 68 1 0 0 0 0 52 75 1 0 0 0 0 53 11 1 1 0 0 0 53 72 1 0 0 0 0 54 12 1 1 0 0 0 54 73 1 0 0 0 0 55 77 1 1 0 0 0 56 78 1 1 0 0 0 57 19 1 1 0 0 0 57 93 1 0 0 0 0 58 20 1 1 0 0 0 58 94 1 0 0 0 0 59 21 1 6 0 0 0 59 93 1 0 0 0 0 60 22 1 6 0 0 0 60 94 1 0 0 0 0 61 30 1 6 0 0 0 61 91 1 0 0 0 0 62 31 1 6 0 0 0 62 92 1 0 0 0 0 63 87 1 1 0 0 0 64 88 1 1 0 0 0 65 79 1 6 0 0 0 66 80 1 6 0 0 0 67 81 1 6 0 0 0 68 82 1 6 0 0 0 69 89 1 1 0 0 0 70 90 1 1 0 0 0 71 83 2 0 0 0 0 71 95 1 0 0 0 0 72 84 1 6 0 0 0 73 85 1 6 0 0 0 74 53 1 6 0 0 0 74 95 1 0 0 0 0 75 54 1 6 0 0 0 75 96 1 0 0 0 0 76 86 2 0 0 0 0 76 96 1 0 0 0 0 M END $$$$

Physi-Chem Properties

Molecular Weight:	1362.92
Volume:	1437.618
LogP:	7.292
LogD:	4.332
LogS:	-5.392
# Rotatable Bonds:	16
TPSA:	288.28
# H-Bond Aceptor:	20
# H-Bond Donor:	8
# Rings:	5
# Heavy Atoms:	20

MedChem Properties

QED Drug-Likeness Score:	0.053
Synthetic Accessibility Score:	8.368
Fsp3:	0.842
Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted
GSK Rule:	Rejected
BMS Rule:	1
Golden Triangle Rule:	Rejected
Chelating Alert:	0
PAINS Alert:	0

ADMET Properties (ADMETlab2.0)

ADMET: Absorption

Caco-2 Permeability:	-5.161
MDCK Permeability:	0.0003474639670457691
Pgp-inhibitor:	1.0
Pgp-substrate:	1.0
Human Intestinal Absorption (HIA):	0.812
20% Bioavailability (F20%):	0.0
30% Bioavailability (F30%):	0.137

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0
Plasma Protein Binding (PPB):	70.20291900634766%
Volume Distribution (VD):	0.702
Pgp-substrate:	20.634458541870117%

ADMET: Metabolism

CYP1A2-inhibitor:	0.0
CYP1A2-substrate:	0.06
CYP2C19-inhibitor:	0.0
CYP2C19-substrate:	0.784
CYP2C9-inhibitor:	0.0
CYP2C9-substrate:	0.001
CYP2D6-inhibitor:	0.0
CYP2D6-substrate:	0.008
CYP3A4-inhibitor:	0.913
CYP3A4-substrate:	0.91

ADMET: Excretion

Clearance (CL):	4.222
Half-life (T1/2):	0.009

ADMET: Toxicity

hERG Blockers:	0.652
Human Hepatotoxicity (H-HT):	0.997
Drug-inuced Liver Injury (DILI):	0.306
AMES Toxicity:	0.112
Rat Oral Acute Toxicity:	0.004
Maximum Recommended Daily Dose:	0.999
Skin Sensitization:	0.979
Carcinogencity:	0.033
Eye Corrosion:	0.003
Eye Irritation:	0.006
Respiratory Toxicity:	0.658

Download Data

Data Type	Select
General Info & Identifiers & Properties
Structure MOL file
Source Organisms
Biological Activities
Similar NPs/Drugs

Natural Product: NPC159092

Natural Product ID:	NPC159092
*Common Name:**	Hurghadolide A
IUPAC Name:	n.a.
Synonyms:
Standard InCHIKey:	PBOKTYWXRURPFG-ZHYZYMJSSA-N
Standard InCHI:	InChI=1S/C76H130O20/c1-43-23-28-55(77)35-57-19-17-21-59(93-57)39-70(90-16)50(8)66(80)42-68(82)52(10)75(54(12)73(85)45(3)27-31-62-38-64(88-14)34-48(6)92-62)96-76(86)46(4)25-29-56(78)36-58-20-18-22-60(94-58)40-69(89-15)49(7)65(79)41-67(81)51(9)74(95-71(83)32-24-43)53(11)72(84)44(2)26-30-61-37-63(87-13)33-47(5)91-61/h17-20,23-25,32,44-45,47-70,72-75,77-82,84-85H,21-22,26-31,33-42H2,1-16H3/b32-24+,43-23+,46-25+/t44-,45-,47-,48-,49-,50-,51-,52-,53-,54-,55-,56-,57-,58-,59-,60-,61-,62-,63+,64+,65-,66-,67+,68+,69-,70-,72-,73-,74-,75-/m0/s1
SMILES:	C/C/1=CC[C@@H](C[C@@H]2C=CC[C@@H](C[C@@H]([C@@H](C)[C@H](C[C@H]([C@H](C)[C@@H]([C@@H](C)[C@H]([C@@H](C)CC[C@H]3C[C@@H](C[C@H](C)O3)OC)O)OC(=O)/C(=C/C[C@@H](C[C@@H]3C=CC[C@@H](C[C@@H]([C@@H](C)[C@H](C[C@H]([C@H](C)[C@@H]([C@@H](C)[C@H]([C@@H](C)CC[C@H]4C[C@@H](C[C@H](C)O4)OC)O)OC(=O)C=C1)O)O)OC)O3)O)/C)O)O)OC)O2)O
Synthetic Gene Cluster:	n.a.
ChEMBL Identifier:	CHEMBL500428
PubChem CID:	44566239
Chemical Classification:**	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000147] Macrolides and analogues

*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.

Species Source

Show entries

Search:

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO22214	Theonella swinhoei	Species	Theonellidae	Eukaryota	n.a.	n.a.	n.a.	PMID[32191460]
NPO22214	Theonella swinhoei	Species	Theonellidae	Eukaryota	n.a.	n.a.	n.a.	PMID[30346758]
NPO22214	Theonella swinhoei	Species	Theonellidae	Eukaryota	n.a.	n.a.	n.a.	PMID[29989811]
NPO22214	Theonella swinhoei	Species	Theonellidae	Eukaryota	n.a.	n.a.	n.a.	PMID[27548648]
NPO22214	Theonella swinhoei	Species	Theonellidae	Eukaryota	n.a.	n.a.	n.a.	PMID[27213234]
NPO22214	Theonella swinhoei	Species	Theonellidae	Eukaryota	n.a.	n.a.	n.a.	PMID[23830699]
NPO22214	Theonella swinhoei	Species	Theonellidae	Eukaryota	n.a.	n.a.	n.a.	PMID[21428459]
NPO22214	Theonella swinhoei	Species	Theonellidae	Eukaryota	n.a.	n.a.	n.a.	PMID[20078073]
NPO22214	Theonella swinhoei	Species	Theonellidae	Eukaryota	n.a.	palau	n.a.	PMID[20078073]
NPO22214	Theonella swinhoei	Species	Theonellidae	Eukaryota	n.a.	Indonesian	n.a.	PMID[19961178]

Showing 1 to 10 of 17 entries

Previous1 2Next

☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Show entries

Search:

Organism ID	NP ID	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference
No data available in table

Showing 0 to 0 of 0 entries

PreviousNext

☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2
MIC	2

Activity Type	# Activity
Cell Line	2
Organism	2

Show entries

Search:

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT393	Cell Line	HCT-116	Homo sapiens	IC50	=	365.0	nM	PMID[496316]
NPT393	Cell Line	HCT-116	Homo sapiens	IC50	=	0.5	ug.mL-1	PMID[496316]
NPT20	Organism	Candida albicans	Candida albicans	MIC	=	31.3	ug.mL-1	PMID[496316]

Showing 1 to 3 of 3 entries

Previous1Next

☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.

Chemically structural similarity: I. Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient

● The left chart: Distribution of similarity level between NPC159092 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	189
0.1-0.2	994
0.2-0.3	3856
0.3-0.4	7700
0.4-0.5	15993
0.5-0.6	9148
0.6-0.7	4406
0.7-0.8	366
0.8-0.85	22
0.85-0.9	15
0.9-0.95	3
0.95-1	5

Show entries

Search:

Similarity Score	Similarity Level	Natural Product ID
0.9884	High Similarity	NPC206679
0.9884	High Similarity	NPC471324
0.9884	High Similarity	NPC114172
0.977	High Similarity	NPC109406
0.9655	High Similarity	NPC476084

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Chemically structural similarity: II. Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC159092 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	163
0.1-0.2	1098
0.2-0.3	3489
0.3-0.4	2855
0.4-0.5	1126
0.5-0.6	333
0.6-0.7	80
0.7-0.8	5
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Show entries

Search:

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.828	Intermediate Similarity	NPD7838	Discovery
0.8247	Intermediate Similarity	NPD8029	Clinical (unspecified phase)
0.7708	Intermediate Similarity	NPD6698	Approved
0.7708	Intermediate Similarity	NPD46	Approved
0.7273	Intermediate Similarity	NPD7983	Approved

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Bioactivity similarity: Similar Natural Products in NPASS

Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.

Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data