NPASS Compound

Natural Product: NPC101863

Natural Product ID	NPC101863
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	AQHKWALTXQHZKK-GLDUGTPFSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	11758552
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 99104 0 0 0 0 0 0 0 0999 V2000 -5.0812 -3.3259 1.8381 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5305 -2.6863 0.7807 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6972 -3.4083 -0.5158 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8613 -1.2325 0.9018 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3005 -1.0205 0.4164 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1637 -0.2255 -0.8919 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9616 0.6321 -0.4843 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3459 1.3696 -1.6064 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0427 1.9704 -1.0685 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0815 0.8113 -0.7284 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8715 0.0773 -1.9942 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7406 0.0825 0.3968 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8773 -0.8393 1.1851 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6640 -0.0054 1.6394 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9651 0.4095 0.3881 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5050 0.7047 0.5997 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7149 1.6247 1.7569 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1735 -0.6076 0.9374 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0393 -1.1634 -0.1295 C 0 0 2 0 0 0 0 0 0 0 0 0 3.0462 -0.2078 -0.7146 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5341 1.2146 -0.8045 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8678 1.6966 -2.2276 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2603 2.1207 0.1219 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0603 1.1781 -0.7046 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3505 2.4415 -1.1551 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0547 1.9699 -1.5689 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7487 1.4446 -0.3138 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.0868 2.6624 0.4945 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2275 -0.2589 0.0546 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3827 -0.7647 -0.5228 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3796 -1.1715 -1.7111 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6427 -0.8455 0.2201 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7258 -1.3286 -0.3467 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0162 -1.4493 0.3033 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0821 -1.9787 -0.4113 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3341 -2.1208 0.1458 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5592 -1.7338 1.4474 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5033 -1.2104 2.1523 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2402 -1.0639 1.5991 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8278 -1.8677 2.0413 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3150 -1.8438 -1.1363 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0475 -0.4657 -0.0521 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4681 1.5220 0.5575 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1179 1.6404 1.7322 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5194 2.3760 0.1544 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8322 -4.3642 1.7795 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9605 -2.8079 2.7726 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7030 -4.5137 -0.3015 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8111 -3.2632 -1.1867 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6453 -3.1679 -1.0263 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7587 -0.9340 1.9622 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9098 -0.4887 1.1542 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7695 -1.9810 0.1638 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8785 -0.8822 -1.7117 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0581 0.3935 -1.0769 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1925 0.8085 -2.5268 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9953 2.2401 -1.8580 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3432 2.4479 -0.0948 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6315 2.6574 -1.7971 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6755 -0.5486 -2.3675 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9501 -0.5338 -2.0502 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7477 0.8662 -2.8014 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0058 0.8988 1.1421 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5794 -1.7598 0.6865 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4197 -1.0357 2.1484 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1123 0.8476 2.1951 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0494 -0.5762 2.3415 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9534 -0.5056 -0.2772 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0256 2.6366 1.5165 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2293 1.5966 2.3780 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4865 1.2257 2.4823 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8060 -0.5283 1.8706 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4236 -1.3996 1.1926 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6459 -1.9891 0.3515 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2864 -0.6170 -1.7214 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0862 1.4227 -2.9417 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8128 1.2289 -2.5673 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0771 2.7992 -2.1957 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3939 1.7643 1.1421 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3095 2.2289 -0.2919 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8392 3.1468 0.0381 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7407 0.3922 -1.4599 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3307 3.2311 -0.4120 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8649 2.8221 -2.0600 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8158 1.1319 -2.2884 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6129 2.7806 -2.0278 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2210 3.2000 0.9052 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5484 3.3963 -0.2343 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8123 2.5330 1.2889 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6763 -0.4998 1.2543 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6198 -1.6610 -1.3977 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8916 -2.2812 -1.4393 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1231 -2.5401 -0.4633 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6568 -0.8983 3.1803 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4185 -0.6489 2.1699 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4451 -2.6164 1.6986 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7496 -2.4914 -0.6638 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9469 -1.1455 -0.9528 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1009 2.8593 0.8262 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 6 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 1 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 1 20 29 1 0 29 30 1 0 30 31 2 0 30 32 1 0 32 33 2 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 2 0 37 38 1 0 38 39 2 0 37 40 1 0 19 41 1 0 12 42 1 0 7 43 1 1 43 44 2 0 43 45 1 0 42 4 1 0 42 7 1 0 27 10 1 0 39 34 1 0 27 15 1 0 24 16 1 0 1 46 1 0 1 47 1 0 3 48 1 0 3 49 1 0 3 50 1 0 4 51 1 1 5 52 1 0 5 53 1 0 6 54 1 0 6 55 1 0 8 56 1 0 8 57 1 0 9 58 1 0 9 59 1 0 11 60 1 0 11 61 1 0 11 62 1 0 12 63 1 1 13 64 1 0 13 65 1 0 14 66 1 0 14 67 1 0 15 68 1 6 17 69 1 0 17 70 1 0 17 71 1 0 18 72 1 0 18 73 1 0 19 74 1 1 20 75 1 6 22 76 1 0 22 77 1 0 22 78 1 0 23 79 1 0 23 80 1 0 23 81 1 0 24 82 1 6 25 83 1 0 25 84 1 0 26 85 1 0 26 86 1 0 28 87 1 0 28 88 1 0 28 89 1 0 32 90 1 0 33 91 1 0 35 92 1 0 36 93 1 0 38 94 1 0 39 95 1 0 40 96 1 0 41 97 1 0 42 98 1 6 45 99 1 0 M END

Standard InCHIKey	AQHKWALTXQHZKK-GLDUGTPFSA-N
Standard InCHI	InChI=1S/C39H54O6/c1-23(2)26-16-19-39(34(43)44)21-20-37(6)27(32(26)39)13-14-30-36(5)22-28(41)33(35(3,4)29(36)17-18-38(30,37)7)45-31(42)15-10-24-8-11-25(40)12-9-24/h8-12,15,26-30,32-33,40-41H,1,13-14,16-22H2,2-7H3,(H,43,44)/b15-10+/t26-,27+,28+,29-,30+,32+,33-,36-,37+,38+,39-/m0/s1
SMILES	C=C(C)[C@@H]1CC[C@@]2(CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)C[C@H]([C@@H](C(C)(C)[C@@H]5CC[C@@]34C)OC(=O)/C=C/c3ccc(cc3)O)O)[C@@H]12)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	618.39	Volume:	666.047 ? Van der Waals volume.
Dense:	0.928	LogP:	5.002 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.952 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.453 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	6.0	Rigid Bonds:	35.0
TPSA:	104.06 ? Topological Polar Surface Area.	H-Bond Acceptor:	6.0
H-Bond Donor:	3.0	Rings:	6.0
Heavy Atoms:	6.0

MedChem Properties

QED Drug-Likeness Score:	0.175	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.043	Fsp³:	0.692
MCE-18:	163.636 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.989	Fluc inhibitor:	0.963 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.026 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.12	Promiscuous compounds:	0.179

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.517	MDCK Permeability:	-5.135
Pgp-inhibitor:	0.026	Pgp-substrate:	0.0
PAMPA:	0.713 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.491	30% Bioavailability (F30%):	0.844
50% Bioavailability (F50%):	0.995

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.718
Plasma Protein Binding (PPB):	98.066%	Volume Distribution (VD):	-0.045
Fu:	1.734% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.006
BSEP inhibitor:	0.978

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.014
CYP2C9-inhibitor:	0.001	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.307
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.988
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.334

Half-life (T1/2):

1.259

ADMET: Toxicity

hERG Blockers:	0.116	hERG Blockers (10um):	0.126
Human Hepatotoxicity (H-HT):	0.707	Drug-induced Liver Injury (DILI):	0.783
AMES Toxicity:	0.182	Rat Oral Acute Toxicity:	0.083
Maximum Recommended Daily Dose:	0.697	Skin Sensitization:	0.972
Carcinogencity:	0.835	Eye Corrosion:	0.017
Eye Irritation:	0.788	Respiratory Toxicity:	0.789
Drug-induced Neurotoxicity:	0.074	Ototoxicity:	0.602
Hematotoxicity:	0.19	Drug-induced Nephrotoxicity:	0.835
Genotoxicity:	0.555	RPMI-8226 Immunitoxicity:	0.017
A549 Cytotoxicity:	0.049	Hek293 Cytotoxicity:	0.337
BCF:	0.763 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.013 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.491 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.912 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40939	Syzygium corticosum	Species	Myrtaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[30057155]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	6

Activity Type	# Activity
Cell line	5
Individual protein	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT721	Individual protein	Nuclear factor NF-kappa-B p65 subunit	Homo sapiens	IC50	=	4700.0	nM	PMID[30057155]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT139	Cell line	HT-29	Homo sapiens	IC50	>	10000.0	nM	PMID[30057155]
NPT82	Cell line	MDA-MB-231	Homo sapiens	IC50	>	10000.0	nM	PMID[30057155]
NPT400	Cell line	MDA-MB-435	Homo sapiens	IC50	>	10000.0	nM	PMID[30057155]
NPT377	Cell line	OVCAR-3	Homo sapiens	IC50	>	10000.0	nM	PMID[30057155]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC101863 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6425
0.1-0.2	36943
0.2-0.3	6006
0.3-0.4	315
0.4-0.5	108
0.5-0.6	35
0.6-0.7	14
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8675	High Similarity	NPC475138
0.8118	Intermediate Similarity	NPC248287
0.8118	Intermediate Similarity	NPC234548
0.764	Intermediate Similarity	NPC486700
0.764	Intermediate Similarity	NPC275312
0.7333	Intermediate Similarity	NPC8102
0.7333	Intermediate Similarity	NPC66894
0.6947	Remote Similarity	NPC205392
0.6947	Remote Similarity	NPC105942
0.6915	Remote Similarity	NPC487491
0.66	Remote Similarity	NPC487488
0.66	Remote Similarity	NPC487489
0.6598	Remote Similarity	NPC304110
0.6598	Remote Similarity	NPC25491
0.6598	Remote Similarity	NPC27518
0.6598	Remote Similarity	NPC611516
0.6495	Remote Similarity	NPC605663
0.6383	Remote Similarity	NPC252133
0.62	Remote Similarity	NPC487490
0.6129	Remote Similarity	NPC486699
0.604	Remote Similarity	NPC178093
0.598	Remote Similarity	NPC482051
0.598	Remote Similarity	NPC324798
0.598	Remote Similarity	NPC479742
0.5833	Remote Similarity	NPC290349
0.5789	Remote Similarity	NPC11266
0.5701	Remote Similarity	NPC481234
0.5701	Remote Similarity	NPC118033
0.5701	Remote Similarity	NPC479431
0.5684	Remote Similarity	NPC486706
0.5684	Remote Similarity	NPC486705
0.5631	Remote Similarity	NPC487492
0.5607	Remote Similarity	NPC601567
0.5607	Remote Similarity	NPC606631
0.5581	Remote Similarity	NPC4309
0.5567	Remote Similarity	NPC486695
0.5545	Remote Similarity	NPC171007
0.5545	Remote Similarity	NPC190849
0.5521	Remote Similarity	NPC478273
0.5472	Remote Similarity	NPC479745
0.5464	Remote Similarity	NPC486708
0.5455	Remote Similarity	NPC160506
0.5238	Remote Similarity	NPC482052
0.5189	Remote Similarity	NPC488205
0.5172	Remote Similarity	NPC488506
0.5172	Remote Similarity	NPC220498
0.5155	Remote Similarity	NPC486709
0.5146	Remote Similarity	NPC486697
0.51	Remote Similarity	NPC148404
0.51	Remote Similarity	NPC35212
0.5094	Remote Similarity	NPC172311
0.5057	Remote Similarity	NPC264317
0.5057	Remote Similarity	NPC294438
0.505	Remote Similarity	NPC478270
0.505	Remote Similarity	NPC478271
0.5048	Remote Similarity	NPC22676

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC101863 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	2855
0.1-0.2	6123
0.2-0.3	166
0.3-0.4	2
0.4-0.5	2
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5455	Remote Similarity	NPD8035	Phase 2
0.5057	Remote Similarity	NPD7520	Phase 1

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data