NPASS Compound

Natural Product: NPC486697

Natural Product ID	NPC486697
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	DZMQWNKUIRPRBY-PMILXXDKSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	132525296
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 101106 0 0 0 0 0 0 0 0999 V2000 -4.7943 3.8231 0.9944 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0839 2.6166 1.4219 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9899 2.3200 2.8735 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5029 1.5629 0.4834 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8574 0.9848 0.8739 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7525 -0.5214 0.7582 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6111 -0.6268 -0.2609 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0626 -1.9987 -0.3574 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6820 -2.0074 -0.9220 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7733 -0.9755 -0.3010 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5829 -1.3835 1.1323 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3861 0.4124 -0.3374 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4569 1.4455 0.1801 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0063 1.2624 -0.0129 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5291 -0.1599 -0.1434 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4748 -0.8782 -1.0679 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7283 -0.1325 -2.3607 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0200 -2.2564 -1.4718 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4394 -2.2263 -1.9314 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1918 -1.7127 -0.7614 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6469 -1.9159 -0.7408 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9254 -3.3048 -0.1415 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3252 -1.8885 -2.0813 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1161 -0.8457 0.1905 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8675 -0.0972 0.6987 C 0 0 2 0 0 0 0 0 0 0 0 0 1.4198 -0.6392 1.9773 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0089 -1.6757 2.4398 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4022 -0.1351 2.7609 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0530 -0.7570 4.0077 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9062 -0.2571 -0.4574 C 0 0 2 0 0 0 0 0 0 0 0 0 1.3902 0.6947 -1.5049 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0689 0.0232 -0.3412 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3170 0.1800 0.2540 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5211 -0.5044 1.2854 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3313 1.0706 -0.2662 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1541 1.8399 -1.3937 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1735 2.6741 -1.8349 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3659 2.7337 -1.1445 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5724 1.9651 0.0009 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5343 1.1528 0.4014 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7680 2.0234 0.6950 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9111 1.2194 1.8462 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4107 3.5417 -1.5347 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6518 0.3448 0.4425 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1461 -0.1264 -1.5228 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3151 0.3215 -1.6485 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3893 -0.1136 -2.6810 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8466 4.0903 -0.0507 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4935 4.5807 1.6960 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4972 1.3411 3.0081 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9688 2.4056 3.3850 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3251 3.0679 3.3580 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5239 1.9916 -0.5361 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7024 1.4299 0.3587 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9974 1.1950 1.9664 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6537 -0.9970 0.3625 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4579 -0.9925 1.7283 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1989 -2.6052 0.5619 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7022 -2.5413 -1.1209 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6963 -2.0254 -2.0098 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2321 -3.0040 -0.6217 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8388 -2.2278 1.2440 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4411 -0.5677 1.8384 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5418 -1.8816 1.4707 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6650 0.6974 -1.3841 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6761 1.7123 1.2595 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7152 2.4166 -0.3518 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5944 1.9091 -0.8449 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4743 1.6786 0.8941 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6775 -0.6332 0.8506 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9970 -0.4485 -3.1650 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6698 0.9478 -2.2832 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7016 -0.4617 -2.8184 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0977 -2.9944 -0.6573 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6384 -2.5707 -2.3242 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7216 -3.2854 -2.0885 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5823 -1.7031 -2.8718 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7773 -2.2615 0.1419 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1149 -3.6363 0.5167 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9012 -4.0187 -1.0186 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9331 -3.3776 0.2692 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8372 -2.8683 -2.3242 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1733 -1.1505 -2.1053 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6197 -1.7453 -2.9321 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5473 -1.3355 1.1105 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2096 0.9757 0.7804 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3828 -1.8186 4.0187 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0059 -0.6253 4.2547 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6874 -0.2292 4.7749 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5855 1.6691 -0.9595 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3587 0.3942 -1.8938 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 0.9453 -2.3056 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2219 1.7882 -1.9270 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0329 3.2791 -2.7226 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6872 0.5463 1.2983 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9019 1.4567 2.2963 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9575 0.1508 1.5434 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0835 1.3357 2.5567 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2702 3.1602 -1.9077 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5067 -0.1070 1.4608 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7887 -0.1245 -3.6109 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 1 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 6 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 28 29 1 0 25 30 1 0 30 31 1 6 24 32 1 0 32 33 1 0 33 34 2 0 33 35 1 0 35 36 2 0 36 37 1 0 37 38 2 0 38 39 1 0 39 40 2 0 39 41 1 0 41 42 1 0 38 43 1 0 12 44 1 0 7 45 1 6 45 46 2 0 45 47 1 0 44 4 1 0 44 7 1 0 16 10 1 0 30 20 1 0 40 35 1 0 30 15 1 0 1 48 1 0 1 49 1 0 3 50 1 0 3 51 1 0 3 52 1 0 4 53 1 6 5 54 1 0 5 55 1 0 6 56 1 0 6 57 1 0 8 58 1 0 8 59 1 0 9 60 1 0 9 61 1 0 11 62 1 0 11 63 1 0 11 64 1 0 12 65 1 6 13 66 1 0 13 67 1 0 14 68 1 0 14 69 1 0 15 70 1 1 17 71 1 0 17 72 1 0 17 73 1 0 18 74 1 0 18 75 1 0 19 76 1 0 19 77 1 0 20 78 1 1 22 79 1 0 22 80 1 0 22 81 1 0 23 82 1 0 23 83 1 0 23 84 1 0 24 85 1 1 25 86 1 1 29 87 1 0 29 88 1 0 29 89 1 0 31 90 1 0 31 91 1 0 31 92 1 0 36 93 1 0 37 94 1 0 40 95 1 0 42 96 1 0 42 97 1 0 42 98 1 0 43 99 1 0 44100 1 1 47101 1 0 M END

Standard InCHIKey	DZMQWNKUIRPRBY-PMILXXDKSA-N
Standard InCHI	InChI=1S/C39H54O8/c1-21(2)23-14-17-39(34(43)44)19-18-36(5)24(29(23)39)11-13-28-37(36,6)16-15-27-35(3,4)31(30(33(42)46-9)38(27,28)7)47-32(41)22-10-12-25(40)26(20-22)45-8/h10,12,20,23-24,27-31,40H,1,11,13-19H2,2-9H3,(H,43,44)/t23-,24+,27-,28-,29+,30+,31-,36+,37+,38-,39-/m0/s1
SMILES	C=C(C)[C@@H]1CC[C@@]2(CC[C@]3(C)[C@H](CC[C@H]4[C@@]3(C)CC[C@H]3C(C)(C)[C@H]([C@H](C(=O)OC)[C@]43C)OC(=O)c3ccc(c(c3)OC)O)[C@@H]12)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	650.38	Volume:	683.628 ? Van der Waals volume.
Dense:	0.951	LogP:	5.269 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.052 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.635 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	34.0
TPSA:	119.36 ? Topological Polar Surface Area.	H-Bond Acceptor:	8.0
H-Bond Donor:	2.0	Rings:	6.0
Heavy Atoms:	8.0

MedChem Properties

QED Drug-Likeness Score:	0.238	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.102	Fsp³:	0.718
MCE-18:	169.06 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	1	PAINS Alert:	0
Colloidal aggregators:	0.801	Fluc inhibitor:	0.012 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.163	Promiscuous compounds:	0.185

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.336	MDCK Permeability:	-4.914
Pgp-inhibitor:	0.153	Pgp-substrate:	0.0
PAMPA:	0.225 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.053	30% Bioavailability (F30%):	0.103
50% Bioavailability (F50%):	0.96

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	1.0
Plasma Protein Binding (PPB):	98.323%	Volume Distribution (VD):	-0.145
Fu:	1.497% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.993	BCRP inhibitor:	0.09
BSEP inhibitor:	0.878

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.752	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.998	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.987
HLM stability:	0.002 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.068

Half-life (T1/2):

1.182

ADMET: Toxicity

hERG Blockers:	0.077	hERG Blockers (10um):	0.168
Human Hepatotoxicity (H-HT):	0.525	Drug-induced Liver Injury (DILI):	0.849
AMES Toxicity:	0.238	Rat Oral Acute Toxicity:	0.228
Maximum Recommended Daily Dose:	0.565	Skin Sensitization:	0.973
Carcinogencity:	0.908	Eye Corrosion:	0.016
Eye Irritation:	0.554	Respiratory Toxicity:	0.796
Drug-induced Neurotoxicity:	0.083	Ototoxicity:	0.487
Hematotoxicity:	0.256	Drug-induced Nephrotoxicity:	0.838
Genotoxicity:	0.841	RPMI-8226 Immunitoxicity:	0.028
A549 Cytotoxicity:	0.094	Hek293 Cytotoxicity:	0.218
BCF:	0.632 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.945 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.376 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.849 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO5986	Ziziphus jujuba	Species	Rhamnaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[27617953]
NPO5986	Ziziphus jujuba	Species	Rhamnaceae	Eukaryota	Roots	n.a.	n.a.	PMID[28257196]
NPO5986	Ziziphus jujuba	Species	Rhamnaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO5986	Ziziphus jujuba	Species	Rhamnaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO5986	Ziziphus jujuba	Species	Rhamnaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO5986	Ziziphus jujuba	Species	Rhamnaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO5986	Ziziphus jujuba	Species	Rhamnaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	1900.0	nM	PMID[27617953]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC486697 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5461
0.1-0.2	39783
0.2-0.3	4374
0.3-0.4	175
0.4-0.5	45
0.5-0.6	15
0.6-0.7	2
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8171	Intermediate Similarity	NPC486695
0.7303	Intermediate Similarity	NPC97475
0.7303	Intermediate Similarity	NPC486696
0.6224	Remote Similarity	NPC205392
0.6224	Remote Similarity	NPC105942
0.5914	Remote Similarity	NPC486708
0.5806	Remote Similarity	NPC486706
0.5806	Remote Similarity	NPC486705
0.5625	Remote Similarity	NPC290349
0.5581	Remote Similarity	NPC486704
0.5579	Remote Similarity	NPC486699
0.5354	Remote Similarity	NPC248287
0.5354	Remote Similarity	NPC234548
0.5248	Remote Similarity	NPC8102
0.5248	Remote Similarity	NPC66894
0.5196	Remote Similarity	NPC486700
0.5196	Remote Similarity	NPC275312
0.5146	Remote Similarity	NPC101863
0.5104	Remote Similarity	NPC486709
0.5096	Remote Similarity	NPC487491

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC486697 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	2140
0.1-0.2	6745
0.2-0.3	261
0.3-0.4	1
0.4-0.5	3
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data