NPASS drugs

Drug Information

Drug ID:	NPD8253
Drug Name:	Faldaprevir
Molecular Formula:	C40H49BrN6O9S
Canonical SMILES:	C=C[C@@H]1C[C@]1(N=C([C@@H]1C[C@H](CN1C(=O)[C@H](C(C)(C)C)N=C(OC1CCCC1)O)Oc1cc(nc2c1ccc(c2Br)OC)c1csc(n1)N=C(C(C)C)O)O)C(=O)O
Standard InCHI:	InChI=1S/C40H49BrN6O9S/c1-8-21-17-40(21,36(51)52)46-34(49)27-15-23(18-47(27)35(50)32(39(4,5)6)44-38(53)56-22-11-9-10-12-22)55-29-16-25(26-19-57-37(43-26)45-33(48)20(2)3)42-31-24(29)13-14-28(54-7)30(31)41/h8,13-14,16,19-23,27,32H,1,9-12,15,17-18H2,2-7H3,(H,44,53)(H,46,49)(H,51,52)(H,43,45,48)/t21-,23-,27+,32-,40-/m1/s1
Standard InCHIKey:	LLGDPTDZOVKFDU-XUHJSTDZSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD8253

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	451
0.1-0.2	2790
0.2-0.3	10252
0.3-0.4	12000
0.4-0.5	3489
0.5-0.6	1728
0.6-0.7	180
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6909	NPC33064
Remote Similarity	0.6836	NPC54803
Remote Similarity	0.6836	NPC321592
Remote Similarity	0.6764	NPC95240
Remote Similarity	0.6764	NPC223409
Remote Similarity	0.6752	NPC118559
Remote Similarity	0.6752	NPC34580
Remote Similarity	0.6752	NPC304307
Remote Similarity	0.6752	NPC124920
Remote Similarity	0.6727	NPC100547
Remote Similarity	0.6722	NPC197881
Remote Similarity	0.6703	NPC322135
Remote Similarity	0.6691	NPC261251
Remote Similarity	0.6679	NPC14288
Remote Similarity	0.6667	NPC245055
Remote Similarity	0.6655	NPC214142
Remote Similarity	0.6645	NPC315411
Remote Similarity	0.6632	NPC472436
Remote Similarity	0.6631	NPC284888
Remote Similarity	0.6615	NPC216507
Remote Similarity	0.6601	NPC315061
Remote Similarity	0.6596	NPC82472
Remote Similarity	0.6595	NPC115282
Remote Similarity	0.6583	NPC470900
Remote Similarity	0.6571	NPC220852
Remote Similarity	0.6567	NPC314176
Remote Similarity	0.6565	NPC75609
Remote Similarity	0.6565	NPC140284
Remote Similarity	0.656	NPC184680
Remote Similarity	0.6549	NPC99891
Remote Similarity	0.6537	NPC474183
Remote Similarity	0.6537	NPC470785
Remote Similarity	0.6533	NPC478011
Remote Similarity	0.6533	NPC321939
Remote Similarity	0.6529	NPC472435
Remote Similarity	0.6525	NPC272549
Remote Similarity	0.652	NPC303658
Remote Similarity	0.6519	NPC251036
Remote Similarity	0.6514	NPC470901
Remote Similarity	0.6505	NPC478030
Remote Similarity	0.6503	NPC477633
Remote Similarity	0.6502	NPC285343
Remote Similarity	0.6481	NPC472434
Remote Similarity	0.6479	NPC470784
Remote Similarity	0.6477	NPC475196
Remote Similarity	0.6468	NPC475350
Remote Similarity	0.6468	NPC469589
Remote Similarity	0.6468	NPC145178
Remote Similarity	0.6468	NPC14877
Remote Similarity	0.6465	NPC314056
Remote Similarity	0.646	NPC153400
Remote Similarity	0.6426	NPC133609
Remote Similarity	0.6424	NPC478012
Remote Similarity	0.64	NPC469594
Remote Similarity	0.64	NPC478013
Remote Similarity	0.6387	NPC74969
Remote Similarity	0.6386	NPC28945
Remote Similarity	0.637	NPC194740
Remote Similarity	0.6364	NPC79386
Remote Similarity	0.6364	NPC305984
Remote Similarity	0.6355	NPC125181
Remote Similarity	0.6355	NPC242872
Remote Similarity	0.6355	NPC263117
Remote Similarity	0.6354	NPC128115
Remote Similarity	0.6349	NPC477634
Remote Similarity	0.6348	NPC189079
Remote Similarity	0.6338	NPC473105
Remote Similarity	0.6336	NPC477630
Remote Similarity	0.6336	NPC477635
Remote Similarity	0.6333	NPC315467
Remote Similarity	0.6321	NPC21638
Remote Similarity	0.6316	NPC471303
Remote Similarity	0.6314	NPC469592
Remote Similarity	0.6314	NPC471080
Remote Similarity	0.6299	NPC260909
Remote Similarity	0.6299	NPC153467
Remote Similarity	0.6299	NPC319232
Remote Similarity	0.6299	NPC24370
Remote Similarity	0.6272	NPC60621
Remote Similarity	0.6271	NPC314882
Remote Similarity	0.6268	NPC469858
Remote Similarity	0.6259	NPC313587
Remote Similarity	0.6259	NPC315893
Remote Similarity	0.6259	NPC181081
Remote Similarity	0.6259	NPC316110
Remote Similarity	0.6232	NPC115595
Remote Similarity	0.623	NPC314254
Remote Similarity	0.623	NPC313966
Remote Similarity	0.6228	NPC475816
Remote Similarity	0.6224	NPC323752
Remote Similarity	0.6224	NPC323198
Remote Similarity	0.6221	NPC195788
Remote Similarity	0.6221	NPC237901
Remote Similarity	0.6218	NPC472098
Remote Similarity	0.6209	NPC67658
Remote Similarity	0.6209	NPC152768
Remote Similarity	0.6209	NPC148183
Remote Similarity	0.6205	NPC478009
Remote Similarity	0.6199	NPC81939
Remote Similarity	0.6194	NPC131486
Remote Similarity	0.6186	NPC124300
Remote Similarity	0.6186	NPC39092
Remote Similarity	0.6177	NPC310618
Remote Similarity	0.6177	NPC475666
Remote Similarity	0.6168	NPC174758
Remote Similarity	0.6164	NPC291609
Remote Similarity	0.6162	NPC110151
Remote Similarity	0.6159	NPC264176
Remote Similarity	0.6157	NPC310118
Remote Similarity	0.6154	NPC160666
Remote Similarity	0.6148	NPC470586
Remote Similarity	0.6146	NPC325976
Remote Similarity	0.6135	NPC478141
Remote Similarity	0.6133	NPC284685
Remote Similarity	0.6133	NPC478006
Remote Similarity	0.6132	NPC475720
Remote Similarity	0.6132	NPC474192
Remote Similarity	0.6125	NPC311357
Remote Similarity	0.6119	NPC326363
Remote Similarity	0.6117	NPC472111
Remote Similarity	0.6111	NPC63279
Remote Similarity	0.6109	NPC477796
Remote Similarity	0.6109	NPC174672
Remote Similarity	0.6109	NPC477795
Remote Similarity	0.6109	NPC477806
Remote Similarity	0.6109	NPC477805
Remote Similarity	0.6107	NPC473041
Remote Similarity	0.6107	NPC244543
Remote Similarity	0.6107	NPC329982
Remote Similarity	0.6105	NPC59827
Remote Similarity	0.6105	NPC184933
Remote Similarity	0.6098	NPC478010
Remote Similarity	0.6098	NPC260434
Remote Similarity	0.6092	NPC97746
Remote Similarity	0.609	NPC297642
Remote Similarity	0.6088	NPC470504
Remote Similarity	0.6081	NPC257511
Remote Similarity	0.608	NPC216369
Remote Similarity	0.6078	NPC175150
Remote Similarity	0.6078	NPC243633
Remote Similarity	0.6075	NPC207620
Remote Similarity	0.607	NPC60006
Remote Similarity	0.6066	NPC295898
Remote Similarity	0.6062	NPC477586
Remote Similarity	0.6062	NPC477585
Remote Similarity	0.6062	NPC477590
Remote Similarity	0.6062	NPC477588
Remote Similarity	0.6061	NPC165964
Remote Similarity	0.6061	NPC26543
Remote Similarity	0.6055	NPC141053
Remote Similarity	0.6053	NPC477526
Remote Similarity	0.6037	NPC477527
Remote Similarity	0.6036	NPC274982
Remote Similarity	0.6035	NPC125597
Remote Similarity	0.6033	NPC88923
Remote Similarity	0.6033	NPC100734
Remote Similarity	0.6033	NPC315634
Remote Similarity	0.6028	NPC315804
Remote Similarity	0.6028	NPC298436
Remote Similarity	0.6028	NPC471762
Remote Similarity	0.6028	NPC315822
Remote Similarity	0.6028	NPC313804
Remote Similarity	0.6026	NPC472789
Remote Similarity	0.6021	NPC470501
Remote Similarity	0.6021	NPC469554
Remote Similarity	0.602	NPC171393
Remote Similarity	0.602	NPC295452
Remote Similarity	0.6015	NPC122427
Remote Similarity	0.6015	NPC329961
Remote Similarity	0.6014	NPC469734
Remote Similarity	0.6014	NPC287208
Remote Similarity	0.6007	NPC279401
Remote Similarity	0.6007	NPC472066
Remote Similarity	0.6007	NPC41982
Remote Similarity	0.6007	NPC472067
Remote Similarity	0.6007	NPC79293
Remote Similarity	0.6007	NPC472031
Remote Similarity	0.6007	NPC242923
Remote Similarity	0.6	NPC50562
Remote Similarity	0.6	NPC4910
Remote Similarity	0.5993	NPC477589
Remote Similarity	0.5993	NPC472068
Remote Similarity	0.5993	NPC477587
Remote Similarity	0.5987	NPC473800
Remote Similarity	0.5986	NPC470502
Remote Similarity	0.598	NPC478080
Remote Similarity	0.598	NPC303374
Remote Similarity	0.598	NPC78609
Remote Similarity	0.5979	NPC473449
Remote Similarity	0.5979	NPC245348
Remote Similarity	0.5974	NPC150447
Remote Similarity	0.5972	NPC66777
Remote Similarity	0.5972	NPC311906
Remote Similarity	0.5971	NPC219664
Remote Similarity	0.597	NPC204970
Remote Similarity	0.597	NPC165538
Remote Similarity	0.5957	NPC475910
Remote Similarity	0.5956	NPC18487
Remote Similarity	0.5952	NPC168922
Remote Similarity	0.5951	NPC477533

Drug Structure

NPD8253 OpenBabel08211713002D 61 66 0 0 1 0 0 0 0 0999 V2000 3.6165 3.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4013 -1.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2202 -2.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3897 6.5240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3032 6.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4997 5.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9641 5.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7030 3.1264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3454 0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1544 1.3424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5363 1.3424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8454 2.2935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 5.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3660 6.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2026 3.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 3.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0107 1.3229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0116 4.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3090 0.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1865 -1.8271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5984 2.1319 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 7.8454 2.2935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 4.0388 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5000 4.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 2.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 1.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1808 2.8364 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.2321 5.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 4.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2321 4.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3660 4.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0820 4.7205 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.1810 -1.7226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5875 1.9229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6753 3.8070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4119 0.3048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6643 4.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4942 5.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0052 1.2184 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.0981 4.0388 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0 -0.3660 3.0388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.3090 0.9511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.0765 4.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.5878 -0.8090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.9997 1.1138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6808 3.7024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7688 -2.5316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5820 1.8183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2631 2.9979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8241 -0.5042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4064 0.2003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6588 4.1205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0981 6.0388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 4.5388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2576 3.1025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 1.3621 -3.4451 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9887 0.9048 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9942 1.0093 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0656 5.0341 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 8 2 0 0 0 0 2 20 1 0 0 0 0 3 20 1 0 0 0 0 4 39 1 0 0 0 0 5 39 1 0 0 0 0 6 39 1 0 0 0 0 7 54 1 0 0 0 0 8 21 1 0 0 0 0 9 10 1 0 0 0 0 9 11 1 0 0 0 0 10 12 1 0 0 0 0 11 22 1 0 0 0 0 12 22 1 0 0 0 0 13 14 2 0 0 0 0 13 24 1 0 0 0 0 14 28 1 0 0 0 0 15 23 1 0 0 0 0 15 27 1 0 0 0 0 16 25 2 0 0 0 0 16 29 1 0 0 0 0 17 21 1 0 0 0 0 17 40 1 0 0 0 0 18 23 1 0 0 0 0 18 47 1 0 0 0 0 19 26 2 0 0 0 0 19 57 1 0 0 0 0 20 33 1 0 0 0 0 21 40 1 1 0 0 0 22 56 1 0 0 0 0 23 55 1 1 0 0 0 24 29 2 0 0 0 0 24 31 1 0 0 0 0 25 26 1 0 0 0 0 25 42 1 0 0 0 0 26 43 1 0 0 0 0 27 34 1 6 0 0 0 27 47 1 0 0 0 0 28 30 2 0 0 0 0 28 54 1 0 0 0 0 29 55 1 0 0 0 0 30 31 1 0 0 0 0 30 41 1 0 0 0 0 31 42 2 0 0 0 0 32 35 1 6 0 0 0 32 39 1 0 0 0 0 32 44 1 0 0 0 0 33 45 2 3 0 0 0 33 48 1 0 0 0 0 34 46 2 3 0 0 0 34 49 1 0 0 0 0 35 47 1 0 0 0 0 35 50 2 0 0 0 0 36 51 2 0 0 0 0 36 52 1 0 0 0 0 37 43 2 0 0 0 0 37 45 1 0 0 0 0 37 57 1 0 0 0 0 38 44 2 3 0 0 0 38 53 1 0 0 0 0 38 56 1 0 0 0 0 40 36 1 1 0 0 0 40 46 1 0 0 0 0 48 58 1 0 0 0 0 49 59 1 0 0 0 0 52 60 1 0 0 0 0 53 61 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DCL001157
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	42601552
ChEBI
CAS Number

Drug Properties

Molecular Weight	868.25
ALogP	1.3309
MLogP	3.99
XLogP	5.798
HDA	13
HBD	4
Rotatable Bonds	27
TPSA	237.09
RO5 Violation	3