NPASS drugs

Drug Information

Drug ID:	NPD1881
Drug Name:	Tioconazole
Molecular Formula:	C16H13Cl3N2OS
Canonical SMILES:	Clc1ccc(c(c1)Cl)C(Cn1ccnc1)OCc1ccsc1Cl
Standard InCHI:	InChI=1S/C16H13Cl3N2OS/c17-12-1-2-13(14(18)7-12)15(8-21-5-4-20-10-21)22-9-11-3-6-23-16(11)19/h1-7,10,15H,8-9H2
Standard InCHIKey:	QXHHHPZILQDDPS-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD1881

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	483
0.1-0.2	5463
0.2-0.3	10006
0.3-0.4	12080
0.4-0.5	2695
0.5-0.6	159
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6987	NPC471614
Remote Similarity	0.6207	NPC475920
Remote Similarity	0.6109	NPC54537
Remote Similarity	0.6009	NPC242923
Remote Similarity	0.5956	NPC257511
Remote Similarity	0.5911	NPC228206
Remote Similarity	0.5909	NPC239660
Remote Similarity	0.5909	NPC106235
Remote Similarity	0.5888	NPC161143
Remote Similarity	0.5843	NPC150447
Remote Similarity	0.583	NPC39092
Remote Similarity	0.583	NPC308906
Remote Similarity	0.5812	NPC12100
Remote Similarity	0.5806	NPC477806
Remote Similarity	0.5806	NPC477805
Remote Similarity	0.5806	NPC477795
Remote Similarity	0.5806	NPC477796
Remote Similarity	0.5789	NPC24990
Remote Similarity	0.5785	NPC160666
Remote Similarity	0.5775	NPC161242
Remote Similarity	0.5771	NPC75498
Remote Similarity	0.5721	NPC229160
Remote Similarity	0.5721	NPC25316
Remote Similarity	0.5721	NPC263485
Remote Similarity	0.5714	NPC469975
Remote Similarity	0.5714	NPC17305
Remote Similarity	0.5701	NPC476080
Remote Similarity	0.5701	NPC475534
Remote Similarity	0.5695	NPC280638
Remote Similarity	0.5693	NPC282531
Remote Similarity	0.5674	NPC475330
Remote Similarity	0.5648	NPC174652
Remote Similarity	0.5642	NPC284678
Remote Similarity	0.5614	NPC469308
Remote Similarity	0.5613	NPC476103

Drug Structure

NPD1881 OpenBabel08211701392D 23 25 0 0 1 0 0 0 0 0999 V2000 5.4128 -2.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5468 -3.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1691 -1.6092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -5.9049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8442 -5.6970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5468 -1.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8147 -4.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9487 -1.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0352 -4.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0827 -1.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4128 -1.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6808 -2.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6808 -1.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8147 -3.2024 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 0.9781 -0.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2788 -1.2024 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 2.8147 -1.2024 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1.7213 0.4612 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 0.3660 -5.0388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.9487 -4.7024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.9487 -2.7024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 12 1 0 0 0 0 2 13 1 0 0 0 0 3 6 2 0 0 0 0 3 11 1 0 0 0 0 4 5 2 0 0 0 0 4 20 1 0 0 0 0 5 21 1 0 0 0 0 6 23 1 0 0 0 0 7 12 2 0 0 0 0 7 14 1 0 0 0 0 8 15 1 0 0 0 0 8 21 1 0 0 0 0 9 11 1 0 0 0 0 9 22 1 0 0 0 0 10 20 2 0 0 0 0 10 21 1 0 0 0 0 11 16 2 0 0 0 0 12 17 1 0 0 0 0 13 14 2 0 0 0 0 13 15 1 0 0 0 0 14 18 1 0 0 0 0 15 22 1 0 0 0 0 16 19 1 0 0 0 0 16 23 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001268
DrugBank	DB01007
ChEMBL	CHEMBL1200438
IUPHAR/BPS
PharmaGKB	PA164746156
KEGG Drug	D00890
PubChem CID	5482
ChEBI	77898
CAS Number	65899-73-2

Drug Properties

Molecular Weight	385.98
ALogP	2.4448
MLogP	2.45
XLogP	4.138
HDA	3
HBD	0
Rotatable Bonds	9
TPSA	55.29
RO5 Violation	0