NPASS drugs

Drug Information

Drug ID:	NPD9654
Drug Name:	VAS-203
Molecular Formula:	C9H16N6O2
Canonical SMILES:	CC(C(C1CN=c2c(N1)c(N)[nH]c(=N)[nH]2)O)O
Standard InCHI:	InChI=1S/C9H16N6O2/c1-3(16)6(17)4-2-12-8-5(13-4)7(10)14-9(11)15-8/h3-4,6,13,16-17H,2H2,1H3,(H5,10,11,12,14,15)
Standard InCHIKey:	NDSDGUULXHNXGA-UHFFFAOYSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD9654

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	62
0.1-0.2	16522
0.2-0.3	12025
0.3-0.4	1688
0.4-0.5	476
0.5-0.6	101
0.6-0.7	15
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9125	NPC242077
Remote Similarity	0.6747	NPC323762
Remote Similarity	0.6262	NPC322449
Remote Similarity	0.6262	NPC62845
Remote Similarity	0.6262	NPC166242
Remote Similarity	0.6262	NPC92874
Remote Similarity	0.6262	NPC189854
Remote Similarity	0.6238	NPC216278
Remote Similarity	0.6224	NPC328806
Remote Similarity	0.6204	NPC325900
Remote Similarity	0.6204	NPC10897
Remote Similarity	0.6168	NPC314398
Remote Similarity	0.6168	NPC239705
Remote Similarity	0.6168	NPC314413
Remote Similarity	0.6122	NPC190334
Remote Similarity	0.6122	NPC62927
Remote Similarity	0.5979	NPC229249
Remote Similarity	0.5943	NPC328914
Remote Similarity	0.5914	NPC315780
Remote Similarity	0.581	NPC90240
Remote Similarity	0.5789	NPC293799
Remote Similarity	0.5783	NPC204709
Remote Similarity	0.5755	NPC328779
Remote Similarity	0.5747	NPC41429
Remote Similarity	0.5726	NPC313813
Remote Similarity	0.5714	NPC280946
Remote Similarity	0.5714	NPC226769
Remote Similarity	0.5714	NPC6166
Remote Similarity	0.566	NPC120887
Remote Similarity	0.562	NPC245534
Remote Similarity	0.5619	NPC329384

Drug Structure

NPD9654 OpenBabel08211713452D 25 26 0 0 1 0 0 0 0 0999 V2000 4.3301 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -1.5000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 2.5981 -1.5000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -2.0000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -0.0000 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -2.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -3.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -3.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -3.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -2.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 -1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -3.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 4 1 0 0 0 0 2 12 1 0 0 0 0 3 6 1 0 0 0 0 3 16 1 0 0 0 0 4 6 1 0 0 0 0 4 13 1 0 0 0 0 5 7 2 0 0 0 0 5 8 1 0 0 0 0 5 13 1 0 0 0 0 6 17 1 0 0 0 0 7 10 1 0 0 0 0 7 14 1 0 0 0 0 8 12 2 0 0 0 0 8 15 1 0 0 0 0 9 11 2 0 0 0 0 9 14 1 0 0 0 0 9 15 1 0 0 0 0 10 18 1 0 0 0 0 10 19 1 0 0 0 0 11 20 1 0 0 0 0 13 21 1 0 0 0 0 14 22 1 0 0 0 0 15 23 1 0 0 0 0 16 24 1 0 0 0 0 17 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB000799
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	240.13
ALogP	-2.8079
MLogP	1.57
XLogP	0.002
HDA	8
HBD	7
Rotatable Bonds	6
TPSA	138.78
RO5 Violation	1