Drug Information| Drug ID:   | NPD9618 |
| Drug Name:   | Metaraminol |
| Molecular Formula:   | C9H13NO2 |
| Canonical SMILES:   | C[C@@H]([C@@H](c1cccc(c1)O)O)N |
| Standard InCHI:   | "InChI=1S/C9H13NO2/c1-6(10)9(12)7-3-2-4-8(11)5-7/h2-6,9,11-12H,10H2,1H3/t6-,9-/m0/s1" |
| Standard InCHIKey:   | WXFIGDLSSYIKKV-RCOVLWMOSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD9618Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6207 | NPC164514 |
| Remote Similarity | 0.6207 | NPC303611 |
| Remote Similarity | 0.6207 | NPC108606 |
| Remote Similarity | 0.6207 | NPC199972 |
| Remote Similarity | 0.6207 | NPC603328 |
| Remote Similarity | 0.6207 | NPC611672 |
| Remote Similarity | 0.5714 | NPC474073 |
| Remote Similarity | 0.5714 | NPC137096 |
| Remote Similarity | 0.5714 | NPC612014 |
| Remote Similarity | 0.5128 | NPC506855 |
| TTD   | DAP000225 |
| DrugBank   | DB00610 |
| ChEMBL   | CHEMBL1201319 |
| IUPHAR/BPS   | 7229 |
| PharmaGKB   | PA164748761 |
| KEGG Drug   | |
| PubChem CID   | 5906 |
| ChEBI   | 6794 |
| CAS Number   | 54-49-9 |
| Molecular Weight   | 167.09 |
| ALogP   | -1.72 |
| MLogP   | 2.12 |
| XLogP   | 0.534 |
| HDA   | 2 |
| HBD   | 3 |
| Rotatable Bonds   | 6 |
| TPSA   | 66.48 |
| RO5 Violation   | 0 |