Drug Information| Drug ID:   | NPD9592 |
| Drug Name:   | Amphetamine Sulfate |
| Molecular Formula:   | C9H13N.H2O4S |
| Canonical SMILES:   | OS(=O)(=O)O.CC(Cc1ccccc1)N |
| Standard InCHI:   | "InChI=1S/C9H13N.H2O4S/c1-8(10)7-9-5-3-2-4-6-9;1-5(2,3)4/h2-6,8H,7,10H2,1H3;(H2,1,2,3,4)" |
| Standard InCHIKey:   | SOFQDLYSFOWTJX-UHFFFAOYSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9592Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7917 | NPC112609 |
| Intermediate Similarity | 0.7917 | NPC515509 |
| Intermediate Similarity | 0.7917 | NPC599831 |
| Intermediate Similarity | 0.7917 | NPC612027 |
| Remote Similarity | 0.5625 | NPC10781 |
| Remote Similarity | 0.5625 | NPC293628 |
| Remote Similarity | 0.5625 | NPC122493 |
| Remote Similarity | 0.5625 | NPC602629 |
| Remote Similarity | 0.5625 | NPC605924 |
| Remote Similarity | 0.5625 | NPC611640 |
| Remote Similarity | 0.5517 | NPC581920 |
| Remote Similarity | 0.5517 | NPC608468 |
| Remote Similarity | 0.5349 | NPC327481 |
| Remote Similarity | 0.5227 | NPC493123 |
| Remote Similarity | 0.5227 | NPC607224 |
| Remote Similarity | 0.5172 | NPC290638 |
| Remote Similarity | 0.5161 | NPC84178 |
| Remote Similarity | 0.5143 | NPC324569 |
| Remote Similarity | 0.5122 | NPC319579 |
| Remote Similarity | 0.5116 | NPC329508 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 135.1 |
| ALogP   | -0.6866 |
| MLogP   | 2.34 |
| XLogP   | 3.582 |
| HDA   | 1 |
| HBD   | 1 |
| Rotatable Bonds   | 4 |
| TPSA   | 26.02 |
| RO5 Violation   | 0 |