Drug Information| Drug ID:   | NPD9581 |
| Drug Name:   | |
| Molecular Formula:   | C9H12N2O6 |
| Canonical SMILES:   | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1ccc(nc1=O)O |
| Standard InCHI:   | "InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1" |
| Standard InCHIKey:   | DRTQHJPVMGBUCF-XVFCMESISA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD9581Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC43246 |
| High Similarity | 1.0 | NPC229347 |
| High Similarity | 1.0 | NPC89051 |
| Remote Similarity | 0.6809 | NPC528272 |
| Remote Similarity | 0.6809 | NPC609606 |
| Remote Similarity | 0.6667 | NPC106780 |
| Remote Similarity | 0.6415 | NPC17892 |
| Remote Similarity | 0.6415 | NPC129613 |
| Remote Similarity | 0.62 | NPC163352 |
| Remote Similarity | 0.62 | NPC210456 |
| Remote Similarity | 0.5965 | NPC329277 |
| Remote Similarity | 0.5965 | NPC283698 |
| Remote Similarity | 0.5926 | NPC295031 |
| Remote Similarity | 0.5926 | NPC36985 |
| Remote Similarity | 0.5926 | NPC30820 |
| Remote Similarity | 0.5667 | NPC73765 |
| Remote Similarity | 0.5536 | NPC51116 |
| Remote Similarity | 0.549 | NPC325201 |
| Remote Similarity | 0.5385 | NPC505081 |
| Remote Similarity | 0.5385 | NPC598370 |
| Remote Similarity | 0.5385 | NPC603709 |
| Remote Similarity | 0.5362 | NPC155087 |
| Remote Similarity | 0.5362 | NPC149843 |
| Remote Similarity | 0.5362 | NPC50767 |
| Molecular Weight   | 244.07 |
| ALogP   | -2.5465 |
| MLogP   | 1.57 |
| XLogP   | -1.782 |
| HDA   | 8 |
| HBD   | 4 |
| Rotatable Bonds   | 6 |
| TPSA   | 122.82 |
| RO5 Violation   | 0 |