NPASS drugs

Drug Information

Drug ID:	NPD9580
Drug Name:
Molecular Formula:	C9H12N2O6
Canonical SMILES:	OCC1OC(C(C1O)O)n1ccc(nc1=O)O
Standard InCHI:	"InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)"
Standard InCHIKey:	DRTQHJPVMGBUCF-UHFFFAOYSA-N
Max Developmental Stage:	Clinical (unspecified phase)
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD9580

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	117746
0.1-0.2	90111
0.2-0.3	3639
0.3-0.4	155
0.4-0.5	64
0.5-0.6	14
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	3

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC43246
High Similarity	1.0	NPC229347
High Similarity	1.0	NPC89051
Remote Similarity	0.6809	NPC528272
Remote Similarity	0.6809	NPC609606
Remote Similarity	0.6667	NPC106780
Remote Similarity	0.6415	NPC17892
Remote Similarity	0.6415	NPC129613
Remote Similarity	0.62	NPC163352
Remote Similarity	0.62	NPC210456
Remote Similarity	0.5965	NPC329277
Remote Similarity	0.5965	NPC283698
Remote Similarity	0.5926	NPC295031
Remote Similarity	0.5926	NPC36985
Remote Similarity	0.5926	NPC30820
Remote Similarity	0.5667	NPC73765
Remote Similarity	0.5536	NPC51116
Remote Similarity	0.549	NPC325201
Remote Similarity	0.5385	NPC505081
Remote Similarity	0.5385	NPC598370
Remote Similarity	0.5385	NPC603709
Remote Similarity	0.5362	NPC155087
Remote Similarity	0.5362	NPC149843
Remote Similarity	0.5362	NPC50767

Drug Structure

NPD9580 OpenBabel08211713452D 21 22 0 0 1 0 0 0 0 0999 V2000 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3554 -2.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9487 -1.7024 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4487 -0.8364 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -1.7796 -0.0933 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.3500 -2.7205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4432 -0.7319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9875 0.8849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9706 -1.4945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9377 -1.9115 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8500 0.1817 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9385 1.1939 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 5 1 0 0 0 0 2 11 1 0 0 0 0 3 4 1 0 0 0 0 3 12 1 0 0 0 0 4 6 1 0 0 0 0 4 17 1 0 0 0 0 5 10 2 0 0 0 0 5 13 1 0 0 0 0 6 7 1 0 0 0 0 6 14 1 0 0 0 0 7 8 1 0 0 0 0 7 15 1 0 0 0 0 8 11 1 0 0 0 0 8 17 1 0 0 0 0 9 10 1 0 0 0 0 9 11 1 0 0 0 0 9 16 2 0 0 0 0 12 18 1 0 0 0 0 13 19 1 0 0 0 0 14 20 1 0 0 0 0 15 21 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DCL001019
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	1177
ChEBI
CAS Number

Drug Properties

Molecular Weight	244.07
ALogP	-2.5465
MLogP	1.57
XLogP	-1.782
HDA	8
HBD	4
Rotatable Bonds	6
TPSA	122.82
RO5 Violation	0