Drug Information| Drug ID: | NPD9287 |
| Drug Name: | |
| Molecular Formula: | C7H8N2O4 |
| Canonical SMILES: | ONC(=C1C=C(O)C(=O)C(=C1)O)N |
| Standard InCHI: | InChI=1S/C7H8N2O4/c8-7(9-13)3-1-4(10)6(12)5(11)2-3/h1-2,9-11,13H,8H2 |
| Standard InCHIKey: | XNZIUZXTCXGBPF-UHFFFAOYSA-N |
| Max Developmental Stage: | Clinical (unspecified phase) |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD9287Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6557 | NPC137396 |
| Remote Similarity | 0.6333 | NPC313553 |
| Remote Similarity | 0.629 | NPC46565 |
| Remote Similarity | 0.629 | NPC229046 |
| Remote Similarity | 0.6102 | NPC110396 |
| Remote Similarity | 0.6094 | NPC129710 |
| Remote Similarity | 0.6 | NPC297280 |
| Remote Similarity | 0.597 | NPC320421 |
| Remote Similarity | 0.5932 | NPC106547 |
| Remote Similarity | 0.5873 | NPC22329 |
| Remote Similarity | 0.5833 | NPC158853 |
| Remote Similarity | 0.5735 | NPC281195 |
| Remote Similarity | 0.5714 | NPC220191 |
| Remote Similarity | 0.5634 | NPC53109 |
| Remote Similarity | 0.5634 | NPC143168 |