Drug Information| Drug ID: | NPD9286 |
| Drug Name: | |
| Molecular Formula: | C7H8N2O3 |
| Canonical SMILES: | ON/C(=C1/C=CC(=O)C(=C1)O)/N |
| Standard InCHI: | InChI=1S/C7H8N2O3/c8-7(9-12)4-1-2-5(10)6(11)3-4/h1-3,9,11-12H,8H2/b7-4- |
| Standard InCHIKey: | UYRMXZIBPZVBNO-DAXSKMNVSA-N |
| Max Developmental Stage: | Clinical (unspecified phase) |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD9286Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6667 | NPC229046 |
| Remote Similarity | 0.6667 | NPC46565 |
| Remote Similarity | 0.6393 | NPC137396 |
| Remote Similarity | 0.6207 | NPC158853 |
| Remote Similarity | 0.6167 | NPC313553 |
| Remote Similarity | 0.6094 | NPC297280 |
| Remote Similarity | 0.6061 | NPC281195 |
| Remote Similarity | 0.5938 | NPC129710 |
| Remote Similarity | 0.5821 | NPC320421 |
| Remote Similarity | 0.5806 | NPC220191 |
| Remote Similarity | 0.5769 | NPC304788 |
| Remote Similarity | 0.5763 | NPC106547 |
| Remote Similarity | 0.5714 | NPC22329 |
| Remote Similarity | 0.5667 | NPC110396 |
| Remote Similarity | 0.5614 | NPC111474 |
| Remote Similarity | 0.5614 | NPC2741 |