Drug Information| Drug ID:   | NPD8847 |
| Drug Name:   | Pyroglutamic Acid |
| Molecular Formula:   | C5H7NO3 |
| Canonical SMILES:   | OC(=O)[C@@H]1CCC(=N1)O |
| Standard InCHI:   | "InChI=1S/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/t3-/m0/s1" |
| Standard InCHIKey:   | ODHCTXKNWHHXJC-VKHMYHEASA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD8847Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC19576 |
| High Similarity | 1.0 | NPC29950 |
| High Similarity | 1.0 | NPC79291 |
| Remote Similarity | 0.625 | NPC173721 |
| Remote Similarity | 0.6 | NPC219251 |
| Remote Similarity | 0.5882 | NPC157538 |
| Remote Similarity | 0.56 | NPC69250 |
| Remote Similarity | 0.5588 | NPC132762 |
| Remote Similarity | 0.5588 | NPC303433 |
| Remote Similarity | 0.5556 | NPC127739 |
| Remote Similarity | 0.5484 | NPC9289 |
| Remote Similarity | 0.5429 | NPC65815 |
| Remote Similarity | 0.5429 | NPC21078 |
| Remote Similarity | 0.5417 | NPC157866 |
| Remote Similarity | 0.5357 | NPC322946 |
| Remote Similarity | 0.5312 | NPC308901 |
| Remote Similarity | 0.5185 | NPC589841 |
| Remote Similarity | 0.5152 | NPC66332 |
| Remote Similarity | 0.5152 | NPC23569 |
| Remote Similarity | 0.5143 | NPC301349 |
| Remote Similarity | 0.5135 | NPC245419 |
| Remote Similarity | 0.5135 | NPC470110 |
| Remote Similarity | 0.5135 | NPC85644 |
| Remote Similarity | 0.5135 | NPC576887 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 129.04 |
| ALogP   | -0.7317 |
| MLogP   | 1.57 |
| XLogP   | -0.647 |
| HDA   | 4 |
| HBD   | 2 |
| Rotatable Bonds   | 3 |
| TPSA   | 69.89 |
| RO5 Violation   | 0 |