Drug Information| Drug ID: | NPD838 |
| Drug Name: | Tolbutamide |
| Molecular Formula: | C12H18N2O3S |
| Canonical SMILES: | CCCCN=C(NS(=O)(=O)c1ccc(cc1)C)O |
| Standard InCHI: | InChI=1S/C12H18N2O3S/c1-3-4-9-13-12(15)14-18(16,17)11-7-5-10(2)6-8-11/h5-8H,3-4,9H2,1-2H3,(H2,13,14,15) |
| Standard InCHIKey: | JLRGJRBPOGGCBT-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD; ChEMBL; IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD838Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Molecular Weight | 270.10 |
| ALogP | -0.595 |
| MLogP | 2.12 |
| XLogP | 3.36 |
| HDA | 5 |
| HBD | 2 |
| Rotatable Bonds | 9 |
| TPSA | 87.14 |
| RO5 Violation | 0 |