NPASS drugs

Drug Information

Drug ID:	NPD80
Drug Name:	Dextroamphetamine Sulfate
Molecular Formula:	2C9H13N.H2O4S
Canonical SMILES:	OS(=O)(=O)O.C[C@@H](Cc1ccccc1)N.C[C@@H](Cc1ccccc1)N
Standard InCHI:	"InChI=1S/2C9H13N.H2O4S/c21-8(10)7-9-5-3-2-4-6-9;1-5(2,3)4/h22-6,8H,7,10H2,1H3;(H2,1,2,3,4)/t2*8-;/m00./s1"
Standard InCHIKey:	PYHRZPFZZDCOPH-QXGOIDDHSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD80

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	126447
0.1-0.2	77634
0.2-0.3	6993
0.3-0.4	560
0.4-0.5	83
0.5-0.6	16
0.6-0.7	0
0.7-0.8	4
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7917	NPC112609
Intermediate Similarity	0.7917	NPC515509
Intermediate Similarity	0.7917	NPC599831
Intermediate Similarity	0.7917	NPC612027
Remote Similarity	0.5625	NPC10781
Remote Similarity	0.5625	NPC293628
Remote Similarity	0.5625	NPC122493
Remote Similarity	0.5625	NPC602629
Remote Similarity	0.5625	NPC605924
Remote Similarity	0.5625	NPC611640
Remote Similarity	0.5517	NPC581920
Remote Similarity	0.5517	NPC608468
Remote Similarity	0.5349	NPC327481
Remote Similarity	0.5227	NPC493123
Remote Similarity	0.5227	NPC607224
Remote Similarity	0.5172	NPC290638
Remote Similarity	0.5161	NPC84178
Remote Similarity	0.5143	NPC324569
Remote Similarity	0.5122	NPC319579
Remote Similarity	0.5116	NPC329508

Drug Structure

NPD80 OpenBabel08201723032D 31 30 0 0 1 0 0 0 0 0999 V2000 3.0981 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -3.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0981 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -4.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.5622 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0263 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1603 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0263 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2942 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1603 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4282 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5622 -2.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 9.2942 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6962 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.3301 -6.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3301 -7.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3301 -8.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3301 -7.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3301 -7.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -3.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -5.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6962 -0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8301 -2.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1962 -5.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8301 -6.1340 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 3 5 1 0 0 0 0 4 6 2 0 0 0 0 5 9 2 0 0 0 0 6 9 1 0 0 0 0 7 8 1 0 0 0 0 7 9 1 0 0 0 0 8 1 1 6 0 0 0 8 10 1 0 0 0 0 10 26 1 0 0 0 0 10 27 1 0 0 0 0 12 13 2 0 0 0 0 12 14 1 0 0 0 0 13 15 1 0 0 0 0 14 16 2 0 0 0 0 15 19 2 0 0 0 0 16 19 1 0 0 0 0 17 18 1 0 0 0 0 17 19 1 0 0 0 0 18 11 1 6 0 0 0 18 20 1 0 0 0 0 20 28 1 0 0 0 0 20 29 1 0 0 0 0 21 25 1 0 0 0 0 21 30 1 0 0 0 0 22 25 1 0 0 0 0 22 31 1 0 0 0 0 23 25 2 0 0 0 0 24 25 2 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	135.1
ALogP	-0.6866
MLogP	2.34
XLogP	3.582
HDA	1
HBD	1
Rotatable Bonds	4
TPSA	26.02
RO5 Violation	0