Drug Information| Drug ID:   | NPD7962 |
| Drug Name:   | Prednimustine |
| Molecular Formula:   | C35H45Cl2NO6 |
| Canonical SMILES:   | ClCCN(c1ccc(cc1)CCCC(=O)OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)C=C[C@]12C)CCCl |
| Standard InCHI:   | "InChI=1S/C35H45Cl2NO6/c1-33-14-12-26(39)20-24(33)8-11-27-28-13-15-35(43,34(28,2)21-29(40)32(27)33)30(41)22-44-31(42)5-3-4-23-6-9-25(10-7-23)38(18-16-36)19-17-37/h6-7,9-10,12,14,20,27-29,32,40,43H,3-5,8,11,13,15-19,21-22H2,1-2H3/t27-,28-,29-,32+,33-,34-,35-/m0/s1" |
| Standard InCHIKey:   | HFVNWDWLWUCIHC-GUPDPFMOSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD7962Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6386 | NPC44063 |
| Remote Similarity | 0.6386 | NPC235800 |
| Remote Similarity | 0.6386 | NPC611921 |
| Remote Similarity | 0.5233 | NPC334061 |
| Remote Similarity | 0.5233 | NPC611819 |
| Molecular Weight   | 645.26 |
| ALogP   | 0.8689 |
| MLogP   | 4.32 |
| XLogP   | 5.704 |
| HDA   | 7 |
| HBD   | 2 |
| Rotatable Bonds   | 19 |
| TPSA   | 104.14 |
| RO5 Violation   | 2 |