NPASS drugs

Drug Information

Drug ID:	NPD7717
Drug Name:	Bromocriptine
Molecular Formula:	C32H40BrN5O5
Canonical SMILES:	CC(C[C@H]1C(=O)N2CCC[C@H]2[C@]2(N1C(=O)[C@@](O2)(N=C([C@H]1CN(C)[C@H]2C(=C1)c1cccc3c1c(C2)c([nH]3)Br)O)C(C)C)O)C
Standard InCHI:	"InChI=1S/C32H40BrN5O5/c1-16(2)12-24-29(40)37-11-7-10-25(37)32(42)38(24)30(41)31(43-32,17(3)4)35-28(39)18-13-20-19-8-6-9-22-26(19)21(27(33)34-22)14-23(20)36(5)15-18/h6,8-9,13,16-18,23-25,34,42H,7,10-12,14-15H2,1-5H3,(H,35,39)/t18-,23-,24+,25+,31-,32+/m1/s1"
Standard InCHIKey:	OZVBMTJYIDMWIL-AYFBDAFISA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD7717

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	97119
0.1-0.2	113033
0.2-0.3	1497
0.3-0.4	19
0.4-0.5	38
0.5-0.6	17
0.6-0.7	5
0.7-0.8	7
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.798	NPC155444
Intermediate Similarity	0.798	NPC224542
Intermediate Similarity	0.798	NPC137993
Intermediate Similarity	0.7596	NPC230554
Intermediate Similarity	0.7115	NPC58642
Intermediate Similarity	0.7115	NPC49336
Intermediate Similarity	0.7115	NPC249875
Remote Similarity	0.6789	NPC56109
Remote Similarity	0.6789	NPC306412
Remote Similarity	0.6789	NPC203217
Remote Similarity	0.6053	NPC273359
Remote Similarity	0.6053	NPC191382
Remote Similarity	0.5789	NPC24441
Remote Similarity	0.5789	NPC284772
Remote Similarity	0.5789	NPC127711
Remote Similarity	0.5664	NPC225644
Remote Similarity	0.5526	NPC315681
Remote Similarity	0.5526	NPC326189
Remote Similarity	0.5526	NPC557179
Remote Similarity	0.5526	NPC607491
Remote Similarity	0.5478	NPC564493
Remote Similarity	0.5385	NPC194808
Remote Similarity	0.5172	NPC562624
Remote Similarity	0.5172	NPC593275
Remote Similarity	0.5128	NPC511970
Remote Similarity	0.5128	NPC543983
Remote Similarity	0.5128	NPC586782
Remote Similarity	0.5128	NPC596345
Remote Similarity	0.5042	NPC510468

Drug Structure

NPD7717 OpenBabel08211712032D 46 52 0 0 1 0 0 0 0 0999 V2000 -1.4336 4.7198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6240 3.5300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7286 -1.9595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3247 -1.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0806 3.4535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4786 -0.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1547 -0.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6790 -0.2892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2784 -0.2900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1949 -0.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3065 0.5245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9983 3.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0799 0.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6798 2.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2804 2.0202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6853 3.7812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3724 -1.2316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2802 1.0966 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.6794 0.6341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8798 1.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4797 2.0192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2789 0.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8800 2.0198 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2501 2.1554 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7536 0.2782 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.4792 1.0955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2795 2.4806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4385 0.6109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1888 1.9041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4073 1.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7554 0.6114 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8149 0.5295 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 7.5301 3.4145 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0 8.0787 1.0951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.5970 1.0970 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.0803 2.4817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.4405 0.9655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.5631 1.4680 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4382 -0.3608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8758 2.5914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9368 2.3335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4266 -0.2256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0126 0.8445 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2797 -0.8469 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0786 -1.1329 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 16 1 0 0 0 0 2 16 1 0 0 0 0 3 17 1 0 0 0 0 4 17 1 0 0 0 0 5 36 1 0 0 0 0 6 8 2 0 0 0 0 6 9 1 0 0 0 0 7 10 1 0 0 0 0 7 11 1 0 0 0 0 8 19 1 0 0 0 0 9 22 2 0 0 0 0 10 25 1 0 0 0 0 11 37 1 0 0 0 0 12 16 1 0 0 0 0 13 18 1 0 0 0 0 13 20 2 0 0 0 0 14 21 1 0 0 0 0 15 18 1 0 0 0 0 15 36 1 0 0 0 0 18 28 1 1 0 0 0 19 20 1 0 0 0 0 19 26 2 0 0 0 0 20 23 1 0 0 0 0 21 26 1 0 0 0 0 21 27 2 0 0 0 0 22 26 1 0 0 0 0 22 34 1 0 0 0 0 23 14 1 6 0 0 0 23 36 1 0 0 0 0 24 12 1 6 0 0 0 24 29 1 0 0 0 0 24 38 1 0 0 0 0 25 32 1 6 0 0 0 25 37 1 0 0 0 0 27 33 1 0 0 0 0 27 34 1 0 0 0 0 28 35 2 3 0 0 0 28 39 1 0 0 0 0 29 37 1 0 0 0 0 29 40 2 0 0 0 0 30 31 1 0 0 0 0 30 38 1 0 0 0 0 30 41 2 0 0 0 0 31 17 1 1 0 0 0 31 35 1 0 0 0 0 31 43 1 0 0 0 0 32 38 1 0 0 0 0 32 42 1 6 0 0 0 32 43 1 0 0 0 0 34 44 1 0 0 0 0 39 45 1 0 0 0 0 42 46 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001462; DAP000282
DrugBank	DB01200
ChEMBL	CHEMBL493
IUPHAR/BPS	35
PharmaGKB	PA448671
KEGG Drug	D03165
PubChem CID	31100
ChEBI	3181
CAS Number	25614-03-3

Drug Properties

Molecular Weight	653.22
ALogP	0.0647
MLogP	3.77
XLogP	3.647
HDA	10
HBD	3
Rotatable Bonds	13
TPSA	121.7
RO5 Violation	0