Drug Information| Drug ID:   | NPD7716 |
| Drug Name:   | Bromocriptine Mesylate |
| Molecular Formula:   | C32H40BrN5O5.CH4O3S |
| Canonical SMILES:   | CS(=O)(=O)O.CC(C[C@H]1C(=O)N2CCC[C@H]2[C@]2(N1C(=O)[C@@](O2)(N=C([C@H]1CN(C)[C@H]2C(=C1)c1cccc3c1c(C2)c([nH]3)Br)O)C(C)C)O)C |
| Standard InCHI:   | "InChI=1S/C32H40BrN5O5.CH4O3S/c1-16(2)12-24-29(40)37-11-7-10-25(37)32(42)38(24)30(41)31(43-32,17(3)4)35-28(39)18-13-20-19-8-6-9-22-26(19)21(27(33)34-22)14-23(20)36(5)15-18;1-5(2,3)4/h6,8-9,13,16-18,23-25,34,42H,7,10-12,14-15H2,1-5H3,(H,35,39);1H3,(H,2,3,4)/t18-,23-,24+,25+,31-,32+;/m1./s1" |
| Standard InCHIKey:   | NOJMTMIRQRDZMT-GSPXQYRGSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD7716Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.8077 | NPC230554 |
| Intermediate Similarity | 0.7596 | NPC155444 |
| Intermediate Similarity | 0.7596 | NPC224542 |
| Intermediate Similarity | 0.7596 | NPC137993 |
| Remote Similarity | 0.6789 | NPC58642 |
| Remote Similarity | 0.6789 | NPC49336 |
| Remote Similarity | 0.6789 | NPC249875 |
| Remote Similarity | 0.6491 | NPC56109 |
| Remote Similarity | 0.6491 | NPC306412 |
| Remote Similarity | 0.6491 | NPC203217 |
| Remote Similarity | 0.5798 | NPC273359 |
| Remote Similarity | 0.5798 | NPC191382 |
| Remote Similarity | 0.5546 | NPC24441 |
| Remote Similarity | 0.5546 | NPC284772 |
| Remote Similarity | 0.5546 | NPC127711 |
| Remote Similarity | 0.5424 | NPC225644 |
| Remote Similarity | 0.5294 | NPC315681 |
| Remote Similarity | 0.5294 | NPC326189 |
| Remote Similarity | 0.5294 | NPC557179 |
| Remote Similarity | 0.5294 | NPC607491 |
| Remote Similarity | 0.525 | NPC564493 |
| Remote Similarity | 0.5164 | NPC194808 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 653.22 |
| ALogP   | 0.0647 |
| MLogP   | 3.77 |
| XLogP   | 3.647 |
| HDA   | 10 |
| HBD   | 3 |
| Rotatable Bonds   | 13 |
| TPSA   | 121.7 |
| RO5 Violation   | 0 |