NPASS drugs

Drug Information

Drug ID:	NPD6628
Drug Name:	fonsartan
Molecular Formula:	C26H32N4O5S2
Canonical SMILES:	CCCN=C(NS(=O)(=O)c1ccccc1c1ccc(cc1)C[n+]1c(CCCC)[nH]c(c1C(=O)[O-])SC)[O-]
Standard InCHI:	InChI=1S/C26H32N4O5S2/c1-4-6-11-22-28-24(36-3)23(25(31)32)30(22)17-18-12-14-19(15-13-18)20-9-7-8-10-21(20)37(34,35)29-26(33)27-16-5-2/h7-10,12-15H,4-6,11,16-17H2,1-3H3,(H3,27,29,31,32,33)/p-2
Standard InCHIKey:	AFQWJYTYICCMGN-UHFFFAOYSA-L
Max Developmental Stage:	Discontinued
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD6628

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	498
0.1-0.2	6009
0.2-0.3	16917
0.3-0.4	4188
0.4-0.5	2346
0.5-0.6	912
0.6-0.7	20
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6787	NPC469308
Remote Similarity	0.6559	NPC477418
Remote Similarity	0.6559	NPC477420
Remote Similarity	0.6383	NPC267811
Remote Similarity	0.632	NPC116555
Remote Similarity	0.6225	NPC114209
Remote Similarity	0.6204	NPC315715
Remote Similarity	0.618	NPC71238
Remote Similarity	0.6175	NPC39092
Remote Similarity	0.6111	NPC314557
Remote Similarity	0.6102	NPC54981
Remote Similarity	0.6083	NPC317054
Remote Similarity	0.6048	NPC935
Remote Similarity	0.6048	NPC267078
Remote Similarity	0.6034	NPC477419
Remote Similarity	0.6034	NPC477417
Remote Similarity	0.6031	NPC41982
Remote Similarity	0.6024	NPC474357
Remote Similarity	0.6016	NPC187145
Remote Similarity	0.6008	NPC470323
Remote Similarity	0.5992	NPC74619
Remote Similarity	0.5991	NPC474791
Remote Similarity	0.5983	NPC79356
Remote Similarity	0.5983	NPC102592
Remote Similarity	0.5981	NPC469975
Remote Similarity	0.5975	NPC266249
Remote Similarity	0.5973	NPC16659
Remote Similarity	0.5968	NPC69843
Remote Similarity	0.5933	NPC148592
Remote Similarity	0.5932	NPC150447
Remote Similarity	0.5928	NPC265710
Remote Similarity	0.5924	NPC123839
Remote Similarity	0.592	NPC328924
Remote Similarity	0.5911	NPC135601
Remote Similarity	0.5911	NPC17273
Remote Similarity	0.5911	NPC141612
Remote Similarity	0.5909	NPC238945
Remote Similarity	0.5903	NPC324091
Remote Similarity	0.5893	NPC21429
Remote Similarity	0.5887	NPC323244
Remote Similarity	0.5885	NPC282531
Remote Similarity	0.5882	NPC473380
Remote Similarity	0.5882	NPC240088
Remote Similarity	0.5875	NPC31385
Remote Similarity	0.5875	NPC75726
Remote Similarity	0.5875	NPC110602
Remote Similarity	0.5874	NPC191415
Remote Similarity	0.587	NPC294693
Remote Similarity	0.5868	NPC177996
Remote Similarity	0.5868	NPC147983
Remote Similarity	0.5867	NPC476341
Remote Similarity	0.5867	NPC133003
Remote Similarity	0.5865	NPC243850
Remote Similarity	0.586	NPC470203
Remote Similarity	0.5859	NPC171393
Remote Similarity	0.5859	NPC295452
Remote Similarity	0.5851	NPC282247
Remote Similarity	0.5841	NPC300238
Remote Similarity	0.5833	NPC63109
Remote Similarity	0.5826	NPC477979
Remote Similarity	0.5814	NPC470204
Remote Similarity	0.5806	NPC19170
Remote Similarity	0.5787	NPC471944
Remote Similarity	0.5785	NPC478030
Remote Similarity	0.5781	NPC473376
Remote Similarity	0.578	NPC470509
Remote Similarity	0.5779	NPC79386
Remote Similarity	0.5778	NPC102755
Remote Similarity	0.5775	NPC476219
Remote Similarity	0.5775	NPC476297
Remote Similarity	0.5771	NPC63279
Remote Similarity	0.5766	NPC151635
Remote Similarity	0.5759	NPC88110
Remote Similarity	0.5748	NPC297642
Remote Similarity	0.5744	NPC471193
Remote Similarity	0.5744	NPC6865
Remote Similarity	0.5744	NPC471194
Remote Similarity	0.5744	NPC153980
Remote Similarity	0.5742	NPC204141
Remote Similarity	0.5738	NPC470732
Remote Similarity	0.5738	NPC317701
Remote Similarity	0.5738	NPC470731
Remote Similarity	0.5737	NPC297862
Remote Similarity	0.5735	NPC216159
Remote Similarity	0.5733	NPC280638
Remote Similarity	0.5714	NPC132539
Remote Similarity	0.5714	NPC477633
Remote Similarity	0.5708	NPC49217
Remote Similarity	0.5702	NPC72956
Remote Similarity	0.5702	NPC94752
Remote Similarity	0.5702	NPC242923
Remote Similarity	0.5699	NPC478013
Remote Similarity	0.5696	NPC329961
Remote Similarity	0.5696	NPC122427
Remote Similarity	0.569	NPC471191
Remote Similarity	0.569	NPC326422
Remote Similarity	0.5684	NPC272483
Remote Similarity	0.5684	NPC141454
Remote Similarity	0.5679	NPC471603
Remote Similarity	0.5673	NPC471192
Remote Similarity	0.567	NPC248454
Remote Similarity	0.5668	NPC48317
Remote Similarity	0.5656	NPC91895
Remote Similarity	0.5654	NPC316756
Remote Similarity	0.565	NPC469938
Remote Similarity	0.5648	NPC299594
Remote Similarity	0.5647	NPC165538
Remote Similarity	0.5646	NPC42483
Remote Similarity	0.5641	NPC472293
Remote Similarity	0.564	NPC64216
Remote Similarity	0.564	NPC229893
Remote Similarity	0.5619	NPC469896
Remote Similarity	0.5616	NPC8104
Remote Similarity	0.5615	NPC118940
Remote Similarity	0.5607	NPC143325
Remote Similarity	0.5607	NPC165599
Remote Similarity	0.5607	NPC138562
Remote Similarity	0.5605	NPC252572
Remote Similarity	0.5602	NPC323927
Remote Similarity	0.56	NPC145885
Remote Similarity	0.56	NPC253987
Remote Similarity	0.56	NPC284775
Remote Similarity	0.56	NPC14113
Remote Similarity	0.56	NPC84827

Drug Structure

NPD6628 OpenBabel08211710072D 39 41 0 0 0 0 0 0 0 0999 V2000 0.6679 1.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 3.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0112 4.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8759 2.1389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5000 2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8269 2.4479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5701 1.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5211 2.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1391 2.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 3.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0902 1.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5000 0.8660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.8301 3.0388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 1.5000 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0 6.2981 0.8006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8333 2.4479 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 -1.0000 1.7321 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 -0.0000 1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4179 3.8479 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 3.2423 3.8479 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 4 1 0 0 0 0 2 5 1 0 0 0 0 3 36 1 0 0 0 0 4 6 1 0 0 0 0 5 16 1 0 0 0 0 6 11 1 0 0 0 0 7 8 2 0 0 0 0 7 9 1 0 0 0 0 8 10 1 0 0 0 0 9 20 2 0 0 0 0 10 21 2 0 0 0 0 11 22 1 0 0 0 0 12 14 1 0 0 0 0 12 18 2 0 0 0 0 13 15 2 0 0 0 0 13 18 1 0 0 0 0 14 19 2 0 0 0 0 15 19 1 0 0 0 0 16 27 1 0 0 0 0 17 18 1 0 0 0 0 17 30 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 21 37 1 0 0 0 0 22 28 1 0 0 0 0 22 30 2 0 0 0 0 23 24 2 0 0 0 0 23 25 1 0 0 0 0 23 30 1 0 0 0 0 24 28 1 0 0 0 0 24 36 1 0 0 0 0 25 31 2 0 0 0 0 25 32 1 0 0 0 0 26 27 2 3 0 0 0 26 29 1 0 0 0 0 26 33 1 0 0 0 0 28 38 1 0 0 0 0 29 37 1 0 0 0 0 29 39 1 0 0 0 0 34 37 2 0 0 0 0 35 37 2 0 0 0 0 M CHG 3 30 1 32 -1 33 -1 M END $$$$

External Identifiers

TTD	DIB012702
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	543.17
ALogP	-4.5169
MLogP	3.11
XLogP	6.275
HDA	8
HBD	2
Rotatable Bonds	18
TPSA	175.07
RO5 Violation	2