Drug Information| Drug ID:   | NPD634 |
| Drug Name:   | ONO-2506 |
| Molecular Formula:   | C11H22O2 |
| Canonical SMILES:   | CCCCCC[C@H](C(=O)O)CCC |
| Standard InCHI:   | "InChI=1S/C11H22O2/c1-3-5-6-7-9-10(8-4-2)11(12)13/h10H,3-9H2,1-2H3,(H,12,13)/t10-/m1/s1" |
| Standard InCHIKey:   | YCYMCMYLORLIJX-SNVBAGLBSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD634Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7619 | NPC209943 |
| Intermediate Similarity | 0.7619 | NPC3531 |
| Intermediate Similarity | 0.7619 | NPC611608 |
| Intermediate Similarity | 0.7083 | NPC173651 |
| Remote Similarity | 0.6667 | NPC325452 |
| Remote Similarity | 0.6667 | NPC503229 |
| Remote Similarity | 0.6667 | NPC604864 |
| Remote Similarity | 0.6552 | NPC499790 |
| Remote Similarity | 0.6538 | NPC72722 |
| Remote Similarity | 0.6538 | NPC249885 |
| Remote Similarity | 0.6538 | NPC603405 |
| Remote Similarity | 0.6071 | NPC484598 |
| Remote Similarity | 0.6071 | NPC53642 |
| Remote Similarity | 0.6071 | NPC470325 |
| Remote Similarity | 0.6071 | NPC570056 |
| Remote Similarity | 0.5714 | NPC324504 |
| Remote Similarity | 0.5714 | NPC482480 |
| Remote Similarity | 0.5714 | NPC482481 |
| Remote Similarity | 0.5667 | NPC510850 |
| Remote Similarity | 0.5667 | NPC597575 |
| Remote Similarity | 0.5652 | NPC227863 |
| Remote Similarity | 0.56 | NPC252843 |
| Remote Similarity | 0.5312 | NPC572699 |
| Remote Similarity | 0.5172 | NPC472328 |
| Remote Similarity | 0.5172 | NPC515806 |
| Remote Similarity | 0.5172 | NPC559923 |
| Remote Similarity | 0.5161 | NPC524557 |
| TTD   | DNC000660; DCL000905 |
| DrugBank   | DB05343 |
| ChEMBL   | CHEMBL3187683 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 208925 |
| ChEBI   | |
| CAS Number   | 185517-21-9 |
| Molecular Weight   | 186.16 |
| ALogP   | -1.2107 |
| MLogP   | 2.45 |
| XLogP   | 4.449 |
| HDA   | 2 |
| HBD   | 1 |
| Rotatable Bonds   | 11 |
| TPSA   | 37.3 |
| RO5 Violation   | 0 |