NPASS drugs

Drug Information

Drug ID:	NPD5676
Drug Name:	Pholcodine
Molecular Formula:	C23H30N2O4
Canonical SMILES:	CN1CC[C@@]23[C@@H]4[C@H]1Cc1c3c(O[C@H]2[C@H](C=C4)O)c(cc1)OCCN1CCOCC1
Standard InCHI:	"InChI=1S/C23H30N2O4/c1-24-7-6-23-16-3-4-18(26)22(23)29-21-19(5-2-15(20(21)23)14-17(16)24)28-13-10-25-8-11-27-12-9-25/h2-5,16-18,22,26H,6-14H2,1H3/t16-,17+,18-,22-,23-/m0/s1"
Standard InCHIKey:	GPFAJKDEDBRFOS-FKQDBXSBSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD5676

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	68085
0.1-0.2	142473
0.2-0.3	1091
0.3-0.4	44
0.4-0.5	15
0.5-0.6	13
0.6-0.7	9
0.7-0.8	8
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.831	NPC140577
Intermediate Similarity	0.831	NPC146628
Intermediate Similarity	0.7778	NPC43069
Intermediate Similarity	0.7778	NPC235802
Intermediate Similarity	0.7778	NPC262786
Intermediate Similarity	0.7778	NPC163601
Intermediate Similarity	0.7778	NPC2073
Intermediate Similarity	0.7778	NPC319632
Intermediate Similarity	0.7778	NPC612004
Intermediate Similarity	0.7	NPC44953
Remote Similarity	0.6154	NPC26746
Remote Similarity	0.6067	NPC143927
Remote Similarity	0.6	NPC328423
Remote Similarity	0.6	NPC74436
Remote Similarity	0.6	NPC232533
Remote Similarity	0.6	NPC298343
Remote Similarity	0.6	NPC566104
Remote Similarity	0.6	NPC607466
Remote Similarity	0.6	NPC608460
Remote Similarity	0.5926	NPC485664
Remote Similarity	0.561	NPC23347
Remote Similarity	0.561	NPC203778
Remote Similarity	0.561	NPC322178
Remote Similarity	0.5366	NPC318674
Remote Similarity	0.5366	NPC305440
Remote Similarity	0.5366	NPC214629
Remote Similarity	0.5366	NPC67346
Remote Similarity	0.5366	NPC174783
Remote Similarity	0.5366	NPC599847
Remote Similarity	0.5301	NPC160593
Remote Similarity	0.5294	NPC580459
Remote Similarity	0.5057	NPC311781

Drug Structure

NPD5676 OpenBabel08211708292D 30 35 0 0 1 0 0 0 0 0999 V2000 3.5842 -2.8361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3914 -2.8359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6520 -1.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6520 -0.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1523 -2.3966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1301 -1.9575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8910 -3.2754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5346 -1.3541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6936 0.1594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3034 -0.4596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4084 -1.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5674 0.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7870 -1.1705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1305 -2.8359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3696 -2.3966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8911 -1.5182 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8910 -2.3968 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8911 0.2391 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.1522 -1.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3696 -1.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3913 -1.0787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1302 -0.2003 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.1301 -1.0789 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.6519 -2.8361 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.1772 -0.5515 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.8911 1.1177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9248 -0.7351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9131 -1.0786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0983 1.4964 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 24 1 0 0 0 0 2 5 2 0 0 0 0 2 15 1 0 0 0 0 3 4 2 0 0 0 0 3 16 1 0 0 0 0 4 18 1 0 0 0 0 5 19 1 0 0 0 0 6 7 1 0 0 0 0 7 24 1 0 0 0 0 8 11 1 0 0 0 0 8 25 1 0 0 0 0 9 12 1 0 0 0 0 9 25 1 0 0 0 0 10 13 1 0 0 0 0 10 25 1 0 0 0 0 11 27 1 0 0 0 0 12 27 1 0 0 0 0 13 28 1 0 0 0 0 14 15 1 0 0 0 0 15 20 2 0 0 0 0 16 17 1 0 0 0 0 16 23 1 1 0 0 0 17 14 1 6 0 0 0 17 24 1 0 0 0 0 18 22 1 0 0 0 0 18 26 1 1 0 0 0 19 21 2 0 0 0 0 19 28 1 0 0 0 0 20 21 1 0 0 0 0 20 23 1 0 0 0 0 21 29 1 0 0 0 0 22 23 1 1 0 0 0 22 29 1 0 0 0 0 23 6 1 6 0 0 0 26 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank	DB09209
ChEMBL	CHEMBL2105224
IUPHAR/BPS	9086
PharmaGKB
KEGG Drug	D07385
PubChem CID	0
ChEBI	53579
CAS Number	509-67-1

Drug Properties

Molecular Weight	398.22
ALogP	-0.3636
MLogP	3.33
XLogP	-0.114
HDA	6
HBD	1
Rotatable Bonds	6
TPSA	54.4
RO5 Violation	0