Drug Information| Drug ID:   | NPD5497 |
| Drug Name:   | |
| Molecular Formula:   | C23H23ClN2O3 |
| Canonical SMILES:   | C/C=C/1C2C=C(CC1(N/C=C1/C=C(Cl)C=C(C1=O)OC)c1c(C2)nc(cc1)O)C |
| Standard InCHI:   | "InChI=1S/C23H23ClN2O3/c1-4-17-14-7-13(2)11-23(17,18-5-6-21(27)26-19(18)9-14)25-12-15-8-16(24)10-20(29-3)22(15)28/h4-8,10,12,14,25H,9,11H2,1-3H3,(H,26,27)/b15-12-,17-4+" |
| Standard InCHIKey:   | GYTJFKCCTYZWGL-WQOXWKGMSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD5497Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 410.14 |
| ALogP   | 1.1027 |
| MLogP   | 3.33 |
| XLogP   | 2.972 |
| HDA   | 4 |
| HBD   | 2 |
| Rotatable Bonds   | 8 |
| TPSA   | 71.45 |
| RO5 Violation   | 0 |