Drug Information| Drug ID:   | NPD5378 |
| Drug Name:   | Amikacin |
| Molecular Formula:   | C22H43N5O13 |
| Canonical SMILES:   | NCC[C@@H](C(=N[C@@H]1C[C@H](N)[C@H]([C@@H]([C@H]1O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)N)O)O)O[C@H]1O[C@H](CN)[C@H]([C@@H]([C@H]1O)O)O)O)O |
| Standard InCHI:   | "InChI=1S/C22H43N5O13/c23-2-1-8(29)20(36)27-7-3-6(25)18(39-22-16(34)15(33)13(31)9(4-24)37-22)17(35)19(7)40-21-14(32)11(26)12(30)10(5-28)38-21/h6-19,21-22,28-35H,1-5,23-26H2,(H,27,36)/t6-,7+,8-,9+,10+,11-,12+,13+,14+,15-,16+,17-,18+,19-,21+,22+/m0/s1" |
| Standard InCHIKey:   | LKCWBDHBTVXHDL-RMDFUYIESA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD5378Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC330590 |
| Remote Similarity | 0.6203 | NPC612045 |
| Remote Similarity | 0.6176 | NPC43850 |
| Remote Similarity | 0.6176 | NPC485811 |
| Remote Similarity | 0.6176 | NPC505645 |
| Remote Similarity | 0.6176 | NPC599806 |
| Remote Similarity | 0.5972 | NPC477060 |
| Remote Similarity | 0.5972 | NPC506438 |
| Remote Similarity | 0.5972 | NPC608466 |
| Molecular Weight   | 585.29 |
| ALogP   | -8.5812 |
| MLogP   | 1.9 |
| XLogP   | -6.078 |
| HDA   | 18 |
| HBD   | 13 |
| Rotatable Bonds   | 23 |
| TPSA   | 335.43 |
| RO5 Violation   | 2 |