NPASS drugs

Drug Information

Drug ID:	NPD4004
Drug Name:	Naltrexone
Molecular Formula:	C20H23NO4
Canonical SMILES:	O=C1CC[C@@]2([C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)CC2CC2)ccc1O)O
Standard InCHI:	"InChI=1S/C20H23NO4/c22-13-4-3-12-9-15-20(24)6-5-14(23)18-19(20,16(12)17(13)25-18)7-8-21(15)10-11-1-2-11/h3-4,11,15,18,22,24H,1-2,5-10H2/t15-,18+,19+,20-/m1/s1"
Standard InCHIKey:	DQCKKXVULJGBQN-XFWGSAIBSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD4004

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	70879
0.1-0.2	137390
0.2-0.3	3411
0.3-0.4	33
0.4-0.5	16
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	8
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC611959
Intermediate Similarity	0.8358	NPC254045
Intermediate Similarity	0.8358	NPC201055
Intermediate Similarity	0.8358	NPC265000
Intermediate Similarity	0.8358	NPC64576
Intermediate Similarity	0.8358	NPC151470
Intermediate Similarity	0.8358	NPC603205
Intermediate Similarity	0.8358	NPC603486
Intermediate Similarity	0.8358	NPC611632
Remote Similarity	0.5513	NPC66909
Remote Similarity	0.5513	NPC612018

Drug Structure

NPD4004 OpenBabel08211704332D 27 32 0 0 1 0 0 0 0 0999 V2000 3.3864 1.1288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3864 0.3025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -2.4787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7156 -2.8918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7156 1.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4312 -0.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7156 -1.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8444 0.7156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6708 0.7156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4313 -2.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4312 0.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7156 -0.4132 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7156 -1.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4313 -1.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4312 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7156 -0.4132 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4312 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.1469 -2.8918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1800 1.2587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7156 0.4132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1258 -0.8263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3066 -3.7026 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4843 1.2065 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 11 1 0 0 0 0 2 11 1 0 0 0 0 3 4 2 0 0 0 0 3 12 1 0 0 0 0 4 13 1 0 0 0 0 5 6 1 0 0 0 0 5 14 1 0 0 0 0 6 20 1 0 0 0 0 7 8 1 0 0 0 0 7 19 1 0 0 0 0 8 21 1 0 0 0 0 9 12 1 0 0 0 0 9 15 1 0 0 0 0 10 11 1 0 0 0 0 10 21 1 0 0 0 0 12 16 2 0 0 0 0 13 17 2 0 0 0 0 13 22 1 0 0 0 0 14 18 1 0 0 0 0 14 23 2 0 0 0 0 15 20 1 6 0 0 0 15 21 1 0 0 0 0 16 17 1 0 0 0 0 16 19 1 0 0 0 0 17 25 1 0 0 0 0 18 19 1 1 0 0 0 18 25 1 0 0 0 0 19 20 1 1 0 0 0 20 24 1 6 0 0 0 22 26 1 0 0 0 0 24 27 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000379; DIB004033; DIB010836
DrugBank	DB00704
ChEMBL	CHEMBL19019
IUPHAR/BPS	1639
PharmaGKB	PA450588
KEGG Drug	D05113
PubChem CID	5360515
ChEBI	7465
CAS Number	16590-41-3

Drug Properties

Molecular Weight	341.16
ALogP	-1.3508
MLogP	3.11
XLogP	0.735
HDA	3
HBD	2
Rotatable Bonds	4
TPSA	70
RO5 Violation	0