NPASS drugs

Drug Information

Drug ID:	NPD4002
Drug Name:	Naltrexone Hydrochloride
Molecular Formula:	C20H23NO4.ClH
Canonical SMILES:	O=C1CC[C@@]2([C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)CC2CC2)ccc1O)O.Cl
Standard InCHI:	"InChI=1S/C20H23NO4.ClH/c22-13-4-3-12-9-15-20(24)6-5-14(23)18-19(20,16(12)17(13)25-18)7-8-21(15)10-11-1-2-11;/h3-4,11,15,18,22,24H,1-2,5-10H2;1H/t15-,18+,19+,20-;/m1./s1"
Standard InCHIKey:	RHBRMCOKKKZVRY-ITLPAZOVSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4002

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	71408
0.1-0.2	137071
0.2-0.3	3205
0.3-0.4	35
0.4-0.5	10
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	8
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9844	NPC611959
Intermediate Similarity	0.8235	NPC254045
Intermediate Similarity	0.8235	NPC201055
Intermediate Similarity	0.8235	NPC265000
Intermediate Similarity	0.8235	NPC64576
Intermediate Similarity	0.8235	NPC151470
Intermediate Similarity	0.8235	NPC603205
Intermediate Similarity	0.8235	NPC603486
Intermediate Similarity	0.8235	NPC611632
Remote Similarity	0.5443	NPC66909
Remote Similarity	0.5443	NPC612018

Drug Structure

NPD4002 OpenBabel08211704332D 28 32 0 0 1 0 0 0 0 0999 V2000 6.1241 -0.5610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1241 -1.3873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7377 -4.1684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0221 -4.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0221 -0.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7377 -0.8634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7377 -2.5161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1690 -2.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4533 -2.9289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5821 -0.9742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4085 -0.9742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7377 -3.3421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3065 -4.1684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3065 -0.8634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4533 -2.1030 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0221 -2.9289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3065 -3.3421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3065 -1.6898 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0221 -2.1030 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7377 -1.6898 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1690 -1.6898 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.5908 -4.5816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5577 -0.4311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4533 -1.2766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6119 -2.5161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1443 -3.5040 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 0.4311 -5.3923 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2220 -0.4833 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 11 1 0 0 0 0 2 11 1 0 0 0 0 3 4 2 0 0 0 0 3 12 1 0 0 0 0 4 13 1 0 0 0 0 5 6 1 0 0 0 0 5 14 1 0 0 0 0 6 20 1 0 0 0 0 7 8 1 0 0 0 0 7 19 1 0 0 0 0 8 21 1 0 0 0 0 9 12 1 0 0 0 0 9 15 1 0 0 0 0 10 11 1 0 0 0 0 10 21 1 0 0 0 0 12 16 2 0 0 0 0 13 17 2 0 0 0 0 13 22 1 0 0 0 0 14 18 1 0 0 0 0 14 23 2 0 0 0 0 15 20 1 6 0 0 0 15 21 1 0 0 0 0 16 17 1 0 0 0 0 16 19 1 0 0 0 0 17 25 1 0 0 0 0 18 19 1 1 0 0 0 18 25 1 0 0 0 0 19 20 1 1 0 0 0 20 24 1 6 0 0 0 22 27 1 0 0 0 0 24 28 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank	DB05508
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	341.16
ALogP	-1.3508
MLogP	3.11
XLogP	0.735
HDA	3
HBD	2
Rotatable Bonds	4
TPSA	70
RO5 Violation	0