NPASS drugs

Drug Information

Drug ID:	NPD3452
Drug Name:	Naloxone
Molecular Formula:	C19H21NO4
Canonical SMILES:	C=CCN1CC[C@@]23[C@@]4([C@H]1Cc1c3c(O[C@H]2C(=O)CC4)c(cc1)O)O
Standard InCHI:	"InChI=1S/C19H21NO4/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11/h2-4,14,17,21,23H,1,5-10H2/t14-,17+,18+,19-/m1/s1"
Standard InCHIKey:	UZHSEJADLWPNLE-GRGSLBFTSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD3452

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	66245
0.1-0.2	140720
0.2-0.3	4703
0.3-0.4	47
0.4-0.5	13
0.5-0.6	3
0.6-0.7	0
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	8

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC254045
High Similarity	1.0	NPC201055
High Similarity	1.0	NPC265000
High Similarity	1.0	NPC64576
High Similarity	1.0	NPC151470
High Similarity	1.0	NPC603205
High Similarity	1.0	NPC603486
High Similarity	1.0	NPC611632
Intermediate Similarity	0.8358	NPC611959
Remote Similarity	0.5733	NPC66909
Remote Similarity	0.5733	NPC612018
Remote Similarity	0.5062	NPC243483

Drug Structure

NPD3452 OpenBabel08211703112D 26 30 0 0 1 0 0 0 0 0999 V2000 -2.0521 -2.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5573 -1.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 2.5784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7444 3.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7444 -1.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.8596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.8596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9187 -0.7444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4889 0.8596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7444 1.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 1.7188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4889 2.5784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4889 -0.8596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7444 0.4298 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7444 1.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4889 1.7188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4889 -0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7444 0.4298 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4889 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.2333 3.0082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2704 -1.3108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7444 -0.4298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2114 0.8596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5830 3.7935 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7400 -1.2894 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 2 8 1 0 0 0 0 3 4 2 0 0 0 0 3 11 1 0 0 0 0 4 12 1 0 0 0 0 5 6 1 0 0 0 0 5 13 1 0 0 0 0 6 19 1 0 0 0 0 7 9 1 0 0 0 0 7 18 1 0 0 0 0 8 20 1 0 0 0 0 9 20 1 0 0 0 0 10 11 1 0 0 0 0 10 14 1 0 0 0 0 11 15 2 0 0 0 0 12 16 2 0 0 0 0 12 21 1 0 0 0 0 13 17 1 0 0 0 0 13 22 2 0 0 0 0 14 19 1 6 0 0 0 14 20 1 0 0 0 0 15 16 1 0 0 0 0 15 18 1 0 0 0 0 16 24 1 0 0 0 0 17 18 1 1 0 0 0 17 24 1 0 0 0 0 18 19 1 1 0 0 0 19 23 1 6 0 0 0 21 25 1 0 0 0 0 23 26 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000097
DrugBank	DB01183
ChEMBL	CHEMBL80
IUPHAR/BPS	1638
PharmaGKB	PA450586
KEGG Drug	D08249
PubChem CID	5284596
ChEBI	7459
CAS Number	465-65-6

Drug Properties

Molecular Weight	327.15
ALogP	-0.8484
MLogP	3
XLogP	0.612
HDA	3
HBD	2
Rotatable Bonds	4
TPSA	70
RO5 Violation	0