NPASS drugs

Drug Information

Drug ID:	NPD3450
Drug Name:	Naloxone Hydrochloride
Molecular Formula:	C19H21NO4.ClH
Canonical SMILES:	C=CCN1CC[C@@]23[C@@]4([C@H]1Cc1c3c(O[C@H]2C(=O)CC4)c(cc1)O)O.Cl
Standard InCHI:	"InChI=1S/C19H21NO4.ClH/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11;/h2-4,14,17,21,23H,1,5-10H2;1H/t14-,17+,18+,19-;/m1./s1"
Standard InCHIKey:	RGPDIGOSVORSAK-STHHAXOLSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD3450

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	66973
0.1-0.2	140135
0.2-0.3	4572
0.3-0.4	35
0.4-0.5	13
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	8

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9836	NPC254045
High Similarity	0.9836	NPC201055
High Similarity	0.9836	NPC265000
High Similarity	0.9836	NPC64576
High Similarity	0.9836	NPC151470
High Similarity	0.9836	NPC603205
High Similarity	0.9836	NPC603486
High Similarity	0.9836	NPC611632
Intermediate Similarity	0.8235	NPC611959
Remote Similarity	0.5658	NPC66909
Remote Similarity	0.5658	NPC612018

Drug Structure

NPD3450 OpenBabel08211703112D 27 30 0 0 1 0 0 0 0 0999 V2000 0.4498 -6.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9446 -5.7677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5019 -1.6648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2463 -1.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2463 -5.5327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5019 -5.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5019 -3.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5832 -4.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0130 -3.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7575 -2.9543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5019 -2.5245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9908 -1.6648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9908 -5.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7575 -3.8135 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.2463 -2.9543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9908 -2.5245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9908 -4.2433 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2463 -3.8135 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5019 -4.2433 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0130 -4.2433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.7352 -1.2351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7722 -5.5541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7575 -4.6731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7133 -3.3837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9546 -1.2867 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 5.0848 -0.4498 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7619 -5.5327 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 2 8 1 0 0 0 0 3 4 2 0 0 0 0 3 11 1 0 0 0 0 4 12 1 0 0 0 0 5 6 1 0 0 0 0 5 13 1 0 0 0 0 6 19 1 0 0 0 0 7 9 1 0 0 0 0 7 18 1 0 0 0 0 8 20 1 0 0 0 0 9 20 1 0 0 0 0 10 11 1 0 0 0 0 10 14 1 0 0 0 0 11 15 2 0 0 0 0 12 16 2 0 0 0 0 12 21 1 0 0 0 0 13 17 1 0 0 0 0 13 22 2 0 0 0 0 14 19 1 6 0 0 0 14 20 1 0 0 0 0 15 16 1 0 0 0 0 15 18 1 0 0 0 0 16 24 1 0 0 0 0 17 18 1 1 0 0 0 17 24 1 0 0 0 0 18 19 1 1 0 0 0 19 23 1 6 0 0 0 21 26 1 0 0 0 0 23 27 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	327.15
ALogP	-0.8484
MLogP	3
XLogP	0.612
HDA	3
HBD	2
Rotatable Bonds	4
TPSA	70
RO5 Violation	0