NPASS drugs

Drug Information

Drug ID:	NPD3448
Drug Name:	nalorphine
Molecular Formula:	C19H21NO3
Canonical SMILES:	C=CCN1CC[C@@]23[C@@H]4[C@H]1Cc1c3c(O[C@H]2[C@H](C=C4)O)c(cc1)O
Standard InCHI:	"InChI=1S/C19H21NO3/c1-2-8-20-9-7-19-12-4-6-15(22)18(19)23-17-14(21)5-3-11(16(17)19)10-13(12)20/h2-6,12-13,15,18,21-22H,1,7-10H2/t12-,13+,15-,18-,19-/m0/s1"
Standard InCHIKey:	UIQMVEYFGZJHCZ-SSTWWWIQSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD3448

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	64767
0.1-0.2	143061
0.2-0.3	3813
0.3-0.4	48
0.4-0.5	15
0.5-0.6	22
0.6-0.7	4
0.7-0.8	1
0.8-0.85	7
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC243483
Intermediate Similarity	0.806	NPC328423
Intermediate Similarity	0.806	NPC74436
Intermediate Similarity	0.806	NPC232533
Intermediate Similarity	0.806	NPC298343
Intermediate Similarity	0.806	NPC566104
Intermediate Similarity	0.806	NPC607466
Intermediate Similarity	0.806	NPC608460
Intermediate Similarity	0.7941	NPC485664
Remote Similarity	0.6133	NPC23347
Remote Similarity	0.6133	NPC203778
Remote Similarity	0.6133	NPC322178
Remote Similarity	0.6	NPC160593
Remote Similarity	0.5658	NPC97086
Remote Similarity	0.5632	NPC143927
Remote Similarity	0.5513	NPC43069
Remote Similarity	0.5513	NPC235802
Remote Similarity	0.5513	NPC262786
Remote Similarity	0.5513	NPC163601
Remote Similarity	0.5513	NPC2073
Remote Similarity	0.5513	NPC319632
Remote Similarity	0.5513	NPC612004
Remote Similarity	0.5375	NPC140577
Remote Similarity	0.5375	NPC146628
Remote Similarity	0.5244	NPC43726
Remote Similarity	0.5244	NPC147161
Remote Similarity	0.5181	NPC258640
Remote Similarity	0.5062	NPC254045
Remote Similarity	0.5062	NPC201055
Remote Similarity	0.5062	NPC265000
Remote Similarity	0.5062	NPC64576
Remote Similarity	0.5062	NPC151470
Remote Similarity	0.5062	NPC603205
Remote Similarity	0.5062	NPC603486
Remote Similarity	0.5062	NPC611632

Drug Structure

NPD3448 OpenBabel08211703112D 25 29 0 0 1 0 0 0 0 0999 V2000 -4.2476 -3.0754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7546 -2.3751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2031 1.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2031 -1.7128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4614 2.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4615 -2.1410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2031 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1146 -1.5980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6864 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9448 0.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2031 0.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2031 -0.8564 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9448 -0.4282 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7198 1.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7198 -1.7128 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4615 0.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7198 0.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7198 -0.8564 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4615 -0.4282 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6864 -0.8564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0219 2.1406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0218 -2.1410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3702 2.9229 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7279 -1.6564 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 2 8 1 0 0 0 0 3 5 2 0 0 0 0 3 11 1 0 0 0 0 4 6 2 0 0 0 0 4 12 1 0 0 0 0 5 14 1 0 0 0 0 6 15 1 0 0 0 0 7 9 1 0 0 0 0 8 20 1 0 0 0 0 9 20 1 0 0 0 0 10 11 1 0 0 0 0 11 16 2 0 0 0 0 12 13 1 0 0 0 0 12 19 1 1 0 0 0 13 10 1 6 0 0 0 13 20 1 0 0 0 0 14 17 2 0 0 0 0 14 21 1 0 0 0 0 15 18 1 0 0 0 0 15 22 1 1 0 0 0 16 17 1 0 0 0 0 16 19 1 0 0 0 0 17 23 1 0 0 0 0 18 19 1 1 0 0 0 18 23 1 0 0 0 0 19 7 1 6 0 0 0 21 24 1 0 0 0 0 22 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS	1629
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	311.15
ALogP	0.3623
MLogP	3.11
XLogP	0.727
HDA	4
HBD	2
Rotatable Bonds	4
TPSA	52.93
RO5 Violation	0