Drug Information| Drug ID:   | NPD344 |
| Drug Name:   | Camphor |
| Molecular Formula:   | C10H16O |
| Canonical SMILES:   | O=C1C[C@H]2C([C@]1(C)CC2)(C)C |
| Standard InCHI:   | "InChI=1S/C10H16O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3/t7-,10+/m0/s1" |
| Standard InCHIKey:   | DSSYKIVIOFKYAU-OIBJUYFYSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD344Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC131981 |
| High Similarity | 1.0 | NPC54264 |
| High Similarity | 1.0 | NPC44751 |
| High Similarity | 1.0 | NPC173996 |
| High Similarity | 1.0 | NPC273607 |
| High Similarity | 1.0 | NPC40249 |
| High Similarity | 1.0 | NPC552965 |
| High Similarity | 1.0 | NPC603573 |
| High Similarity | 1.0 | NPC611922 |
| Remote Similarity | 0.6522 | NPC265258 |
| Remote Similarity | 0.625 | NPC142099 |
| Remote Similarity | 0.6 | NPC587383 |
| Remote Similarity | 0.5909 | NPC30991 |
| Remote Similarity | 0.5455 | NPC35472 |
| Remote Similarity | 0.5357 | NPC108820 |
| Remote Similarity | 0.5357 | NPC513252 |
| Remote Similarity | 0.5357 | NPC537530 |
| Remote Similarity | 0.5217 | NPC293343 |
| Remote Similarity | 0.5217 | NPC157298 |
| Remote Similarity | 0.5217 | NPC70231 |
| Remote Similarity | 0.5217 | NPC20017 |
| Remote Similarity | 0.5217 | NPC258672 |
| Remote Similarity | 0.5217 | NPC247786 |
| Remote Similarity | 0.5217 | NPC50629 |
| Remote Similarity | 0.5217 | NPC136232 |
| Molecular Weight   | 152.12 |
| ALogP   | 0.9693 |
| MLogP   | 2.45 |
| XLogP   | 2.127 |
| HDA   | 1 |
| HBD   | 0 |
| Rotatable Bonds   | 3 |
| TPSA   | 17.07 |
| RO5 Violation   | 0 |