Drug Information| Drug ID:   | NPD3271 |
| Drug Name:   | Dicloxacillin |
| Molecular Formula:   | C19H17Cl2N3O5S |
| Canonical SMILES:   | OC(=O)[C@@H]1N2C(=O)[C@H]([C@H]2SC1(C)C)N=C(c1c(C)onc1c1c(Cl)cccc1Cl)O |
| Standard InCHI:   | "InChI=1S/C19H17Cl2N3O5S/c1-7-10(12(23-29-7)11-8(20)5-4-6-9(11)21)15(25)22-13-16(26)24-14(18(27)28)19(2,3)30-17(13)24/h4-6,13-14,17H,1-3H3,(H,22,25)(H,27,28)/t13-,14+,17-/m1/s1" |
| Standard InCHIKey:   | YFAGHNZHGGCZAX-JKIFEVAISA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD3271Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.8 | NPC478578 |
| Remote Similarity | 0.575 | NPC483358 |
| Remote Similarity | 0.5405 | NPC478433 |
| Remote Similarity | 0.5195 | NPC487966 |
| Remote Similarity | 0.5122 | NPC611211 |
| Molecular Weight   | 469.03 |
| ALogP   | 1.8205 |
| MLogP   | 2.34 |
| XLogP   | 2.642 |
| HDA   | 6 |
| HBD   | 2 |
| Rotatable Bonds   | 11 |
| TPSA   | 141.53 |
| RO5 Violation   | 0 |