Drug Information| Drug ID:   | NPD3207 |
| Drug Name:   | Tobramycin Sulfate |
| Molecular Formula:   | C18H37N5O9.H2O4S |
| Canonical SMILES:   | OS(=O)(=O)O.NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@H]([C@@H]([C@H]2O)O[C@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)N)O)N)[C@@H](C[C@@H]1O)N |
| Standard InCHI:   | "InChI=1S/C18H37N5O9.H2O4S/c19-3-9-8(25)2-7(22)17(29-9)31-15-5(20)1-6(21)16(14(15)28)32-18-13(27)11(23)12(26)10(4-24)30-18;1-5(2,3)4/h5-18,24-28H,1-4,19-23H2;(H2,1,2,3,4)/t5-,6+,7+,8-,9+,10+,11-,12+,13+,14-,15+,16-,17+,18+;/m0./s1" |
| Standard InCHIKey:   | ZEUUPKVZFKBXPW-TWDWGCDDSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD3207Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.9057 | NPC314408 |
| High Similarity | 0.9057 | NPC611979 |
| Intermediate Similarity | 0.7377 | NPC607776 |
| Remote Similarity | 0.6774 | NPC477060 |
| Remote Similarity | 0.6774 | NPC506438 |
| Remote Similarity | 0.6774 | NPC608466 |
| Remote Similarity | 0.6769 | NPC507103 |
| Remote Similarity | 0.6557 | NPC552868 |
| Remote Similarity | 0.6557 | NPC611754 |
| Remote Similarity | 0.5968 | NPC43850 |
| Remote Similarity | 0.5968 | NPC485811 |
| Remote Similarity | 0.5968 | NPC505645 |
| Remote Similarity | 0.5968 | NPC599806 |
| Remote Similarity | 0.5806 | NPC509178 |
| Remote Similarity | 0.5806 | NPC539096 |
| Remote Similarity | 0.5806 | NPC581607 |
| Remote Similarity | 0.5072 | NPC594692 |
| Remote Similarity | 0.5068 | NPC487424 |
| Remote Similarity | 0.5068 | NPC606748 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 467.26 |
| ALogP   | -7.5606 |
| MLogP   | 1.9 |
| XLogP   | -5.381 |
| HDA   | 14 |
| HBD   | 10 |
| Rotatable Bonds   | 16 |
| TPSA   | 268.17 |
| RO5 Violation   | 2 |